NPASS drugs

Drug Information

Drug ID:	NPD5368
Drug Name:	Unoprostone
Molecular Formula:	C22H38O5
Canonical SMILES:	CCCCCCCC(=O)CC[C@H]1[C@H](O)C[C@@H]([C@@H]1C/C=CCCCC(=O)O)O
Standard InCHI:	"InChI=1S/C22H38O5/c1-2-3-4-5-8-11-17(23)14-15-19-18(20(24)16-21(19)25)12-9-6-7-10-13-22(26)27/h6,9,18-21,24-25H,2-5,7-8,10-16H2,1H3,(H,26,27)/b9-6-/t18-,19-,20+,21-/m1/s1"
Standard InCHIKey:	TVHAZVBUYQMHBC-SNHXEXRGSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD; DrugBank

Structural Similarity Between NPASS Natural Products and NPD5368

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	79267
0.1-0.2	121382
0.2-0.3	9719
0.3-0.4	951
0.4-0.5	376
0.5-0.6	27
0.6-0.7	4
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9783	NPC328775
Intermediate Similarity	0.7273	NPC319445
Remote Similarity	0.6981	NPC324411
Remote Similarity	0.6909	NPC27845
Remote Similarity	0.6429	NPC328384
Remote Similarity	0.6364	NPC272105
Remote Similarity	0.5862	NPC260814
Remote Similarity	0.5862	NPC323249
Remote Similarity	0.5862	NPC27949
Remote Similarity	0.5862	NPC39547
Remote Similarity	0.5862	NPC561206
Remote Similarity	0.5862	NPC599790
Remote Similarity	0.569	NPC318389
Remote Similarity	0.569	NPC510284
Remote Similarity	0.5686	NPC69626
Remote Similarity	0.5686	NPC554292
Remote Similarity	0.5577	NPC477201
Remote Similarity	0.5577	NPC492262
Remote Similarity	0.5577	NPC543569
Remote Similarity	0.5574	NPC164308
Remote Similarity	0.5484	NPC151776
Remote Similarity	0.5424	NPC326711
Remote Similarity	0.5424	NPC496393
Remote Similarity	0.5323	NPC201225
Remote Similarity	0.5208	NPC61803
Remote Similarity	0.5208	NPC601550
Remote Similarity	0.5208	NPC74845
Remote Similarity	0.5208	NPC317381
Remote Similarity	0.5208	NPC23333
Remote Similarity	0.5208	NPC556901
Remote Similarity	0.5208	NPC587880
Remote Similarity	0.5192	NPC536270
Remote Similarity	0.5085	NPC546856

Drug Structure

NPD5368 OpenBabel08211706322D 30 30 0 0 1 0 0 0 0 0999 V2000 9.2800 2.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5369 1.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5858 2.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8427 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8916 1.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3135 3.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7202 4.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1485 0.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6810 3.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7147 4.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1974 1.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0878 2.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1215 5.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5032 0.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7601 0.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8090 0.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4543 0.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 1.5388 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8090 0.5878 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5000 1.5388 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1160 5.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6622 -0.3393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0878 2.3479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7038 4.5931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5227 6.3156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0823 2.2433 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5172 6.4202 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 8 1 0 0 0 0 6 7 1 0 0 0 0 6 9 2 0 0 0 0 7 10 1 0 0 0 0 8 11 1 0 0 0 0 9 12 1 0 0 0 0 10 13 1 0 0 0 0 11 17 1 0 0 0 0 13 22 1 0 0 0 0 14 15 1 0 0 0 0 14 17 1 0 0 0 0 16 20 1 0 0 0 0 16 21 1 0 0 0 0 17 23 2 0 0 0 0 18 12 1 6 0 0 0 18 19 1 0 0 0 0 18 20 1 0 0 0 0 19 15 1 1 0 0 0 19 21 1 0 0 0 0 20 24 1 6 0 0 0 21 25 1 6 0 0 0 22 26 2 0 0 0 0 22 27 1 0 0 0 0 24 28 1 0 0 0 0 25 29 1 0 0 0 0 27 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB012211
DrugBank	DB06826
ChEMBL	CHEMBL1201407
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI	39455
CAS Number	120373-36-6

Drug Properties

Molecular Weight	382.27
ALogP	-2.9561
MLogP	3.33
XLogP	4.186
HDA	5
HBD	3
Rotatable Bonds	19
TPSA	94.83
RO5 Violation	1