18 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC86906
Formula: C30H48N2O2
Ingredient ID: NPC86906
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=C(O[C@@H]1C[C@H]2[C@H]([C@H]3[C@@]41CN([C@H]([C@H]4CC3)C)C)CC=C1[C@]2(C)CC[C@@H](C1)N(C)C)CC=C(C)C |
| Standard InCHI | InChI=1S/C30H48N2O2/c1-19(2)8-13-28(33)34-27-17-26-23(25-12-11-24-20(3)32(7)18-30(24,25)27)10-9-21-16-22(31(5)6)14-15-29(21,26)4/h8-9,20,22-27H,10-18H2,1-7H3/t20-,22-,23-,24+,25-,26-,27+,29-,30+/m0/s1 |
| Standard InCHIKey | WGJLLAVOYXFCTC-BMSXNQCFSA-N |
| Ingredient External Links |
PubChem CID: 11225162 ChEMBL ID: CHEMBL364090 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD9357] Database: NPASS [NPC86906] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Mentha suaveolens | Mentha | Lamiaceae |
  |
| Protea compacta | Protea | Proteaceae | |
| Alpinia formosana | Alpinia | Zingiberaceae | |
| Rubus moluccanus | Rubus | Rosaceae |
 |
| Bidens parviflora | Bidens | Asteraceae |
|
| Heliotropium angiospermum | Heliotropium | Heliotropiaceae |
|
| Asparagus setaceus | Asparagus | Asparagaceae |
|
| Typhonium flagelliforme | Typhonium | Araceae |
|
| Papaver hybrid | Papaver | Papaveraceae | |
| Piper hostmannianum | Piper | Piperaceae | |
| Elsholtzia stauntonii | Elsholtzia | Lamiaceae |
|
| Flindersia australis | Flindersia | Rutaceae | |
| Anisocycla grandidieri | Anisocycla | Menispermaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Bambusa tulda | Bambusa | Poaceae |
|
| Diplospora dubia | Diplospora | Rubiaceae | |
| Pinus bungeana | Pinus | Pinaceae |
|
| Holarrhena pubescens | Holarrhena | Apocynaceae |
|
| Haemanthus tigrinus | Haemanthus | Amaryllidaceae | |
| Croton balsamifer | Croton | Euphorbiaceae |
Ingredient ID: NPC79238
Formula: C29H46N2O2
Ingredient ID: NPC79238
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CN[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2C[C@@H](OC(=O)CC=C(C)C)[C@]24[C@H]3CC[C@@H]4[C@@H](N(C2)C)C)C1)C |
| Standard InCHI | InChI=1S/C29H46N2O2/c1-18(2)7-12-27(32)33-26-16-25-22(9-8-20-15-21(30-5)13-14-28(20,25)4)24-11-10-23-19(3)31(6)17-29(23,24)26/h7-8,19,21-26,30H,9-17H2,1-6H3/t19-,21-,22-,23+,24-,25-,26+,28-,29+/m0/s1 |
| Standard InCHIKey | BJEAHAPLWWPUQZ-XGHHNQJOSA-N |
| Ingredient External Links |
PubChem CID: 11178537 ChEMBL ID: CHEMBL195752 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD123156] Database: NPASS [NPC79238] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC7214
Formula: C24H40N2
Ingredient ID: NPC7214
| Common Name | Conessine |
| IUPAC Name | n.a. |
| Canonical SMILES | CN([C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]24[C@H]3CC[C@@H]4[C@@H](N(C2)C)C)C1)C)C |
| Standard InCHI | InChI=1S/C24H40N2/c1-16-20-8-9-22-19-7-6-17-14-18(25(3)4)10-12-23(17,2)21(19)11-13-24(20,22)15-26(16)5/h6,16,18-22H,7-15H2,1-5H3/t16-,18-,19+,20+,21-,22-,23-,24-/m0/s1 |
| Standard InCHIKey | GPLGAQQQNWMVMM-MYAJQUOBSA-N |
| Ingredient External Links |
PubChem CID: 441082 ZINC ID: ZINC000004097188 ChEMBL ID: CHEMBL191703 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC7214] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Mentha suaveolens | Mentha | Lamiaceae |
|
| Protea compacta | Protea | Proteaceae | |
| Alpinia formosana | Alpinia | Zingiberaceae | |
| Rubus moluccanus | Rubus | Rosaceae |
|
| Bidens parviflora | Bidens | Asteraceae |
|
| Heliotropium angiospermum | Heliotropium | Heliotropiaceae |
|
| Asparagus setaceus | Asparagus | Asparagaceae |
|
| Typhonium flagelliforme | Typhonium | Araceae |
|
| Papaver hybrid | Papaver | Papaveraceae | |
| Piper hostmannianum | Piper | Piperaceae | |
| Elsholtzia stauntonii | Elsholtzia | Lamiaceae |
|
| Flindersia australis | Flindersia | Rutaceae | |
| Anisocycla grandidieri | Anisocycla | Menispermaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Bambusa tulda | Bambusa | Poaceae |
|
| Diplospora dubia | Diplospora | Rubiaceae | |
| Pinus bungeana | Pinus | Pinaceae |
|
| Holarrhena pubescens | Holarrhena | Apocynaceae |
|
| Haemanthus tigrinus | Haemanthus | Amaryllidaceae | |
| Croton balsamifer | Croton | Euphorbiaceae |
Ingredient ID: NPC71621
Formula: C21H36N2
Ingredient ID: NPC71621
| Common Name | n.a. |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-aminoethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
| Canonical SMILES | N[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC[C@@H]2[C@@H](N)C)C)C1)C |
| Standard InCHI | InChI=1S/C21H36N2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,13,15-19H,5-12,22-23H2,1-3H3/t13-,15-,16-,17+,18-,19-,20-,21+/m0/s1 |
| Standard InCHIKey | XDELLWIDOQOKHV-YZXCLFAISA-N |
| Ingredient External Links |
PubChem CID: 92198 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD27776] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC56044
Formula: C21H35NO
Ingredient ID: NPC56044
| Common Name | n.a. |
| IUPAC Name | 1-(3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| Canonical SMILES | NC1CCC2(C(C1)CCC1C2CCC2(C1CCC2C(=O)C)C)C |
| Standard InCHI | InChI=1S/C21H35NO/c1-13(23)17-6-7-18-16-5-4-14-12-15(22)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19H,4-12,22H2,1-3H3 |
| Standard InCHIKey | POWBIOMTXFDIOP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 410825 |
| Plant-Ingredient Association Reference |
Database: TCMID [8009] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Holarrhena febrifuga | Holarrhena | Apocynaceae |
|
| Funtumia elastica | Funtumia | Apocynaceae |
|
Ingredient ID: NPC39927
Formula: C6H7O6P
Ingredient ID: NPC39927
| Common Name | n.a. |
| IUPAC Name | (5-formylfuran-3-yl)methyl phosphate |
| Canonical SMILES | O=Cc1occ(c1)COP(=O)([O-])[O-] |
| Standard InCHI | InChI=1S/C6H7O6P/c7-2-6-1-5(3-11-6)4-12-13(8,9)10/h1-3H,4H2,(H2,8,9,10)/p-2 |
| Standard InCHIKey | XUMMAWMKFFMZAH-UHFFFAOYSA-L |
| Ingredient External Links |
PubChem CID: 25201088 |
| Plant-Ingredient Association Reference |
Database: TCMID [8010] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Holarrhena febrifuga | Holarrhena | Apocynaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Atractylodes lancea | Atractylodes | Asteraceae |
|
| Artemisia scoparia | Artemisia | Asteraceae |
|
| Ocimum basilicum | Ocimum | Lamiaceae |
|
| Codium fragile | Codium | Codiaceae |
|
| Trifolium pratense | Trifolium | Fabaceae |
 |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Cynomorium songaricum | Cynomorium | Cynomoriaceae |
|
| Ulva pertusa | Ulva | Ulvaceae |
|
Ingredient ID: NPC38216
Formula: C29H46O2
Ingredient ID: NPC38216
| Common Name | n.a. |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| Canonical SMILES | CC(=CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC=C2[C@]1(C)CC[C@@H](C2)OC(=O)C)C)C |
| Standard InCHI | InChI=1S/C29H46O2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(31-21(4)30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8,10,20,23-27H,7,9,11-18H2,1-6H3/t20-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| Standard InCHIKey | OBQGEVWZIBSVFW-VEVYEIKRSA-N |
| Ingredient External Links |
PubChem CID: 10916916 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD13663] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC36783
Formula: C23H39NO
Ingredient ID: NPC36783
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O[C@H]1CC[C@]2(C(=CC[C@H]3[C@H]2CC[C@]2([C@@H]3CC[C@@H]2[C@@H](N(C)C)C)C)C1)C |
| Standard InCHI | InChI=1S/C23H39NO/c1-15(24(4)5)19-8-9-20-18-7-6-16-14-17(25)10-12-22(16,2)21(18)11-13-23(19,20)3/h6,15,17-21,25H,7-14H2,1-5H3/t15-,17-,18+,19+,20+,21+,22-,23+/m0/s1 |
| Standard InCHIKey | UJGXCOFZMJCRLN-SBVJFDTMSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD102704] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC301585
Formula: C14H28O2
Ingredient ID: NPC301585
| Common Name | Myristic Acid |
| IUPAC Name | tetradecanoic acid |
| Canonical SMILES | CCCCCCCCCCCCCC(=O)O |
| Standard InCHI | InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16) |
| Standard InCHIKey | TUNFSRHWOTWDNC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 11005 ChEMBL ID: CHEMBL111077 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD144583] Database: NPASS [NPC301585] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Citrus unshiu | Citrus | Rutaceae |
|
| Glechoma longituba | Glechoma | Lamiaceae |
|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Odontites rubra | Odontites | Orobanchaceae | |
| Paederia scandens | Paederia | Rubiaceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Ranunculus ternatus | Ranunculus | Ranunculaceae | |
| Schistostephium rotundifolium | Schistostephium | Asteraceae | |
| Podocarpus amarus | Podocarpus | Podocarpaceae | |
| Lespedeza cyrtobotrya | Lespedeza | Fabaceae |
|
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Prosopis ruscifolia | Prosopis | Fabaceae |
|
| Teucrium orientale | Teucrium | Lamiaceae |
|
| Eucalyptus froggattii | Eucalyptus | Myrtaceae | |
| Garcinia macrophylla | Garcinia | Clusiaceae |
|
| Amsinckia menziesii | Amsinckia | Boraginaceae | |
| Aquilaria agallochum | Aquilaria | Thymelaeaceae |
|
| Siphocampylus verticillatus | Siphocampylus | Campanulaceae | |
| Viburnum chingii | Viburnum | Adoxaceae | |
| Camptotheca acuminata | Camptotheca | Nyssaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Pistacia mexicana | Pistacia | Anacardiaceae |
|
| Maytenus loeseneri | Maytenus | Celastraceae | |
| Pyrola japonica | Pyrola | Ericaceae |
|
| Magnolia liliiflora | Magnolia | Magnoliaceae | |
| Aconitum kamtschaticum | Aconitum | Ranunculaceae | |
| Paranephelius uniflorus | Paranephelius | Asteraceae | |
| Narcissus concolor | Narcissus | Amaryllidaceae | |
| Hyptis tomentosa | Hyptis | Lamiaceae |
|
| Petalostemon purpureum | Petalostemon | Fabaceae |
|
| Maytenus serrata | Maytenus | Celastraceae |
|
| Melaleuca uncinata | Melaleuca | Myrtaceae | |
| Uvaria ferruginea | Uvaria | Annonaceae | |
| Houttuynia cordata | Houttuynia | Saururaceae |
|
| Hakea saligna | Hakea | Proteaceae | |
| Iris tectorum | Iris | Iridaceae |
|
| Aquilaria sinensis | Aquilaria | Thymelaeaceae |
|
| Vitex negundo | Vitex | Lamiaceae |
|
| Dipteronia dyeriana | Dipteronia | Aceraceae | |
| Teucrium fragile | Teucrium | Lamiaceae | |
| Lobelia chinensis | Lobelia | Campanulaceae |
|
| Monodora angolensis | Monodora | Annonaceae | |
| Trollius chinensis | Trollius | Ranunculaceae |
|
| Aloe ferox | Aloe | Asphodelaceae |
|
| Artemisia taurica | Artemisia | Asteraceae |
|
| Hippophae rhamnoides | Hippophae | Elaeagnaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Podocarpus salignus | Podocarpus | Podocarpaceae |
|
| Psychotria bahiensis | Psychotria | Rubiaceae | |
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Oldenlandia diffusa | Oldenlandia | Rubiaceae |
|
| Cnidium monnieri | Cnidium | Apiaceae |
|
| Veltheimia viridifolia | Veltheimia | Hyacinthaceae | |
| Plectranthus mollis | Plectranthus | Lamiaceae |
|
| Hypoxis nyasica | Hypoxis | Hypoxidaceae | |
| Dodonaea polyandra | Dodonaea | Sapindaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Isodon japonica var. glaucocalyx | Isodon | Lamiaceae | |
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Trichilia dregeana | Trichilia | Meliaceae |
|
| Actinidia kolomikta | Actinidia | Actinidiaceae |
|
| Murraya kwangsiensis | Murraya | Rutaceae |
|
| Xylopia aethiopica | Xylopia | Annonaceae |
|
| Mirabilis jalapa | Mirabilis | Nyctaginaceae |
|
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Capsicum annuum | Capsicum | Solanaceae |
|
| Veratrum stenophyllum | Veratrum | Melanthiaceae | |
| Cinnamosma madagascariensis | Cinnamosma | Canellaceae | |
| Phalaenopsis aphrodite | Phalaenopsis | Orchidaceae | |
| Fumaria kraliki | Fumaria | Papaveraceae | |
| Ajuga bracteosa | Ajuga | Lamiaceae |
|
| Ptelea crenulata | Ptelea | Rutaceae | |
| Aegiceras corniculatum | Aegiceras | Primulaceae |
|
| Hymenaea oblongifolia | Hymenaea | Fabaceae | |
| Helichrysum nudifolium | Helichrysum | Asteraceae |
|
| Sideritis syriaca | Sideritis | Lamiaceae |
|
| Ephedra herba | Ephedra | Ephedraceae | |
| Benincasa hispida | Benincasa | Cucurbitaceae |
|
| Macaranga sinensis | Macaranga | Euphorbiaceae | |
| Arbutus menziesii | Arbutus | Ericaceae |
|
| Flaveria bidentis | Flaveria | Asteraceae |
|
| Sansevieria ehrenbergii | Sansevieria | Asparagaceae |
|
| Santalum album | Santalum | Santalaceae |
|
| Avrainvillea nigricans | Avrainvillea | Udoteaceae | |
| Cephalonoplos segetum | Cephanonoplos | Asteraceae |
|
| Lycium chinense | Lycium | Solanaceae |
|
| Allium monspessulanum | Allium | Amaryllidaceae | |
| Sonneratia alba | Sonneratia | Lythraceae |
|
| Agrimonia pilosa | Agrimonia | Rosaceae |
|
| Curcuma phaeocaulis | Curcuma | Zingiberaceae | |
| Justicia trinervia | Justicia | Acanthaceae | |
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Rhododendron ferrugineum | Rhododendron | Ericaceae |
|
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Carthamus tinctorius | Carthamus | Asteraceae |
|
| Drypetes roxburghii | Drypetes | Putranjivaceae |
|
| Juglans regia | Juglans | Juglandaceae |
|
| Acacia pulchella | Acacia | Fabaceae | |
| Buddleja variabilis | Buddleja | Scrophulariaceae | |
| Senecio scandens | Senecio | Asteraceae |
|
| Vallaris solanacea | Vallaris | Apocynaceae |
|
| Gmelina arborea | Gmelina | Lamiaceae |
|
| Mentha pulegiformis | Mentha | Lamiaceae | |
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Salvia nubicola | Salvia | Lamiaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Astragalus complanatus | Astragalus | Fabaceae |
|
| Grindelia nana | Grindelia | Asteraceae | |
| Panax quinquefolius | Panax | Araliaceae |
|
| Patrinia scabiosifolia | Patrinia | Caprifoliaceae |
|
| Haloxylon salicornicum | Haloxylon | Chenopodiaceae |
|
| Combretum indicum | Combretum | Combretaceae |
|
| Leucanthemum maximum | Leucanthemum | Asteraceae | |
| Punica granatum | Punica | Lythraceae |
|
| Vitex trifolia | Vitex | Lamiaceae |
|
| Rhododendron aureum | Rhododendron | Ericaceae |
|
| Calea megacephala | Calea | Asteraceae | |
| Tephroseris integrifolia | Tephroseris | Asteraceae |
|
| Trichosanthes kirilowii | Trichosanthes | Cucurbitaceae |
|
| Abies nobilis | Abies | Pinaceae | |
| Persea indica | Persea | Lauraceae |
|
| Panax notoginseng | Panax | Araliaceae |
|
| Corydalis cornuta | Corydalis | Papaveraceae | |
| Vepris pilosa | Vepris | Rutaceae | |
| Disepalum plagioneurum | Disepalum | Annonaceae | |
| Piper aequale | Piper | Piperaceae |
|
| Alkanna hirsutissima | Alkanna | Boraginaceae | |
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Vouacapoua macropetala | Vouacapoua | Fabaceae |
|
| Pinus picea | Pinus | Pinaceae | |
| Picris radicata | Picris | Asteraceae | |
| Acrocomia sclerocarpa | Acrocomia | Arecaceae | |
| Curcuma kwangsiensis | Curcuma | Zingiberaceae |
|
| Eremophila serrulata | Eremophila | Scrophulariaceae | |
| Rodgersia podophylla | Rodgersia | Saxifragaceae |
|
| Delphinium campylocentrum | Delphinium | Ranunculaceae | |
| Cordyline indivisa | Cordyline | Asparagaceae |
|
| Primula hirsuta | Primula | Primulaceae | |
| Jasminum grandiflorum | Jasminum | Oleaceae |
|
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Viscum coloratum | Viscum | Viscaceae |
|
| Lycium barbarum | Lycium | Solanaceae |
|
| Polygonatum odoratum | Polygonatum | Asparagaceae |
|
| Imperata cylindrica | Imperata | Poaceae |
|
| Jatropha curcas | Jatropha | Euphorbiaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Curcuma longa | Curcuma | Zingiberaceae |
|
| Hansenia forbesii | Hansenia | Apiaceae | |
| Vincetoxicum pycnostelma | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Citrus reticulata | Citrus | Rutaceae |
|
| Buchenavia tetraphylla | Buchenavia | Combretaceae | |
| Glechoma grandis | Glechoma | Lamiaceae |
|
| Ophiorrhiza blumeana | Ophiorrhiza | Rubiaceae | |
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Cordylanthus kingii | Cordylanthus | Orobanchaceae | |
| Zanthoxylum chiriquinum | Zanthoxylum | Rutaceae | |
| Euphorbia hirta | Euphorbia | Euphorbiaceae |
|
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Terminalia chebula | Terminalia | Combretaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Sophora viciifolia | Sophora | Fabaceae |
|
| Cynomorium songaricum | Cynomorium | Cynomoriaceae |
|
| Annona impressivenia | Annona | Annonaceae | |
| Actaea simplex | Actaea | Ranunculaceae | |
| Garcinia lateriflora | Garcinia | Clusiaceae |
|
| Senna alexandrina | Senna | Fabaceae |
|
| Artemisia argyi | Artemisia | Asteraceae |
|
| Ulva prolifera | Ulva | Ulvaceae | |
| Aloe spicata | Aloe | Asphodelaceae |
|
| Lens phaseoloides | Lens | Fabaceae | |
| Alseodaphne corneri | Alseodaphne | Lauraceae | |
| Thymus piperella | Thymus | Lamiaceae |
|
| Forsteronia refracta | Forsteronia | Apocynaceae | |
| Eragrostis viscosa | Eragrostis | Poaceae |
|
| Nauclea officinalis | Nauclea | Rubiaceae |
|
| Grewia mollis | Grewia | Malvaceae |
|
| Heterotheca grandiflora | Heterotheca | Asteraceae | |
| Croton cumingii | Croton | Euphorbiaceae |
|
| Bersama yangambiensis | Bersama | Melianthaceae | |
| Ruta pinnata | Ruta | Rutaceae |
|
| Disynaphia halimifolia | Disynaphia | Asteraceae | |
| Panax ginseng | Panax | Araliaceae |
|
| Kaunia saltensis | Kaunia | Asteraceae | |
| Heliotropium floridum | Heliotropium | Heliotropiaceae | |
| Castanopsis sclerophylla | Castanopsis | Fagaceae |
|
| Gymnocarpium robertianum | Gymnocarpium | Cystopteridaceae | |
| Oncoba echinata | Oncoba | Salicaceae | |
| Salvia dorrii | Salvia | Lamiaceae | |
| Juglans nigra | Juglans | Juglandaceae |
|
| Teucrium depressum | Teucrium | Lamiaceae | |
| Mangifera indica | Mangifera | Anacardiaceae |
|
| Aconitum nevadense | Aconitum | Ranunculaceae | |
| Trichilia rubescens | Trichilia | Meliaceae | |
| Conocephalum japonicum | Conocephalum | Conocephalaceae | |
| Hovenia acerba | Hovenia | Rhamnaceae |
|
| Stevia polycephala | Stevia | Asteraceae | |
| Sophora angustifolia | Sophora | Fabaceae | |
| Ostericum grosseserratum | Ostericum | Apiaceae |
|
| Kaempferia marginata | Kaempferia | Zingiberaceae |
|
| Hippophae fructus | Hippophae | Elaeagnaceae | |
| Litchi chinensis | Litchi | Sapindaceae |
|
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Fridericia chica | Fridericia | Bignoniaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Ongokea klaineana | Ongokea | Aptandraceae | |
| Amomum neoaurantiacum | Amomum | Zingiberaceae | |
| Elaeagnus angustifolia | Elaeagnus | Elaeagnaceae |
|
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Doodia picta | Doodia | Blechnaceae | |
| Echiochilon pauciflorum | Echiochilon | Boraginaceae | |
| Bruguiera gymnorhiza | Bruguiera | Rhizophoraceae |
|
| Ipomoea cristulata | Ipomoea | Convolvulaceae | |
| Portulaca oleracea | Portulaca | Portulacaceae |
|
| Trichosanthes rosthornii | Trichosanthes | Cucurbitaceae |
|
| Prunus armeniaca | Prunus | Rosaceae |
|
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Lophozonia menziesii | Lophozonia | Nothofagaceae | |
| Diplospora dubia | Diplospora | Rubiaceae | |
| Myristica fragrans | Myristica | Myristicaceae |
|
| Rhodotypos scandens | Rhodotypos | Rosaceae | |
| Gymnanthemum amygdalinum | Gymnanthemum | Asteraceae |
|
| Silybum marianum | Silybum | Asteraceae |
|
| Pancratium trianthum | Pancratium | Amaryllidaceae |
|
| Phegopteris bukoensis | Phegopteris | Thelypteridaceae | |
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Piper pedicellosum | Piper | Piperaceae |
|
| Aconitum vilmorinianum | Aconitum | Ranunculaceae | |
| Cnidoscolus texanus | Cnidoscolus | Euphorbiaceae | |
| Boronella koniambiensis | Boronella | Rutaceae | |
| Canarium strictum | Canarium | Burseraceae |
|
| Xanthostemon oppositifolius | Xanthostemon | Myrtaceae | |
| Esenbeckia nesiotica | Esenbeckia | Rutaceae | |
| Cannabis sativa | Cannabis | Cannabaceae |
|
| Raphanus sativus | Raphanus | Brassicaceae |
|
| Allium azureum ledeb | Allium | Amaryllidaceae | |
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Peucedanum palustre | Peucedanum | Apiaceae |
|
| Coreopsis grandiflora | Coreopsis | Asteraceae |
|
| Scapania nemorea | Scapania | Scapaniaceae | |
| Eria tomentosa | Eria | Orchidaceae | |
| Otostegia fruticosa | Otostegia | Lamiaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Lepidonia jonesii | Lepidonia | Asteraceae | |
| Diospyros montana | Diospyros | Ebenaceae |
|
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Isoberlinia angolensis | Isoberlinia | Fabaceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Helipterum tenellum | Helipterum | Asteraceae | |
| Physalis solanaceus | Physalis | Solanaceae | |
| Glehnia littoralis | Glehnia | Apiaceae |
|
| Patrinia villosa | Patrinia | Caprifoliaceae |
|
| Veronica anagallis-aquatica | Veronica | Plantaginaceae |
|
| Crocus sativus | Crocus | Iridaceae |
|
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
Ingredient ID: NPC283277
Formula: C21H32N2
Ingredient ID: NPC283277
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | N[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]24[C@H]3CC[C@@H]4[C@@H](N=C2)C)C1)C |
| Standard InCHI | InChI=1S/C21H32N2/c1-13-17-5-6-19-16-4-3-14-11-15(22)7-9-20(14,2)18(16)8-10-21(17,19)12-23-13/h3,12-13,15-19H,4-11,22H2,1-2H3/t13-,15-,16+,17+,18-,19-,20-,21-/m0/s1 |
| Standard InCHIKey | ALQAUMHHCJMVID-LQOGWUMHSA-N |
| Ingredient External Links |
PubChem CID: 76330309 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD176955] Database: NPASS [NPC283277] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Mentha suaveolens | Mentha | Lamiaceae |
|
| Protea compacta | Protea | Proteaceae | |
| Alpinia formosana | Alpinia | Zingiberaceae | |
| Rubus moluccanus | Rubus | Rosaceae |
|
| Bidens parviflora | Bidens | Asteraceae |
|
| Heliotropium angiospermum | Heliotropium | Heliotropiaceae |
|
| Asparagus setaceus | Asparagus | Asparagaceae |
|
| Typhonium flagelliforme | Typhonium | Araceae |
|
| Papaver hybrid | Papaver | Papaveraceae | |
| Piper hostmannianum | Piper | Piperaceae | |
| Elsholtzia stauntonii | Elsholtzia | Lamiaceae |
|
| Flindersia australis | Flindersia | Rutaceae | |
| Anisocycla grandidieri | Anisocycla | Menispermaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Bambusa tulda | Bambusa | Poaceae |
|
| Diplospora dubia | Diplospora | Rubiaceae | |
| Pinus bungeana | Pinus | Pinaceae |
|
| Holarrhena pubescens | Holarrhena | Apocynaceae |
|
| Haemanthus tigrinus | Haemanthus | Amaryllidaceae | |
| Croton balsamifer | Croton | Euphorbiaceae |
Ingredient ID: NPC272592
Formula: C25H44N2
Ingredient ID: NPC272592
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CN([C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC[C@@H]2[C@H](N(C)C)C)C)C1)C)C |
| Standard InCHI | InChI=1S/C25H44N2/c1-17(26(4)5)21-10-11-22-20-9-8-18-16-19(27(6)7)12-14-24(18,2)23(20)13-15-25(21,22)3/h8,17,19-23H,9-16H2,1-7H3/t17-,19+,20+,21-,22+,23+,24+,25-/m1/s1 |
| Standard InCHIKey | YTNIUPZRMQLHNV-NMQWMWRVSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD151183] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Citrus unshiu | Citrus | Rutaceae |
|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC244582
Formula: C22H38N2
Ingredient ID: NPC244582
| Common Name | n.a. |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-aminoethyl]-N,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
| Canonical SMILES | CN[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC[C@@H]2[C@@H](N)C)C)C1)C |
| Standard InCHI | InChI=1S/C22H38N2/c1-14(23)18-7-8-19-17-6-5-15-13-16(24-4)9-11-21(15,2)20(17)10-12-22(18,19)3/h5,14,16-20,24H,6-13,23H2,1-4H3/t14-,16-,17-,18+,19-,20-,21-,22+/m0/s1 |
| Standard InCHIKey | MTTRNPRLWQGKCB-KUJPYBTHSA-N |
| Ingredient External Links |
PubChem CID: 15560372 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD63933] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Mentha suaveolens | Mentha | Lamiaceae |
|
| Protea compacta | Protea | Proteaceae | |
| Alpinia formosana | Alpinia | Zingiberaceae | |
| Rubus moluccanus | Rubus | Rosaceae |
|
| Bidens parviflora | Bidens | Asteraceae |
|
| Heliotropium angiospermum | Heliotropium | Heliotropiaceae |
|
| Asparagus setaceus | Asparagus | Asparagaceae |
|
| Typhonium flagelliforme | Typhonium | Araceae |
|
| Papaver hybrid | Papaver | Papaveraceae | |
| Piper hostmannianum | Piper | Piperaceae | |
| Elsholtzia stauntonii | Elsholtzia | Lamiaceae |
|
| Flindersia australis | Flindersia | Rutaceae | |
| Anisocycla grandidieri | Anisocycla | Menispermaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Bambusa tulda | Bambusa | Poaceae |
|
| Diplospora dubia | Diplospora | Rubiaceae | |
| Pinus bungeana | Pinus | Pinaceae |
|
| Holarrhena pubescens | Holarrhena | Apocynaceae |
|
| Haemanthus tigrinus | Haemanthus | Amaryllidaceae | |
| Croton balsamifer | Croton | Euphorbiaceae |
Ingredient ID: NPC21664
Formula: C25H44N2O
Ingredient ID: NPC21664
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@@]12CC[C@@H]3[C@@H]([C@H]2CC[C@@H]1[C@@H](N(C)C)C)CC=C1[C@]3(C)CC[C@@H](C1)N(C)C |
| Standard InCHI | InChI=1S/C25H44N2O/c1-17(26(3)4)21-9-10-23-20-8-7-18-15-19(27(5)6)11-13-24(18,2)22(20)12-14-25(21,23)16-28/h7,17,19-23,28H,8-16H2,1-6H3/t17-,19-,20-,21+,22+,23+,24-,25-/m0/s1 |
| Standard InCHIKey | UCNIUVSOJLHWRM-AVYAGCKQSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD187773] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC171175
Formula: C31H52O
Ingredient ID: NPC171175
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C/C=C(C(C)C)/CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H]([C@H]2C)O)C)C |
| Standard InCHI | InChI=1S/C31H52O/c1-8-23(20(2)3)10-9-21(4)24-13-15-29(7)27-12-11-25-22(5)26(32)14-16-30(25)19-31(27,30)18-17-28(24,29)6/h8,20-22,24-27,32H,9-19H2,1-7H3/b23-8-/t21-,22+,24-,25+,26+,27+,28-,29+,30-,31+/m1/s1 |
| Standard InCHIKey | BHLIFYSVSGTVMZ-MDSWOMCASA-N |
| Ingredient External Links |
PubChem CID: 101614311 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD10111] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC161162
Formula: C23H39NO
Ingredient ID: NPC161162
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC[C@@H]2[C@H](N(C)C)C)C)C1)C |
| Standard InCHI | InChI=1S/C23H39NO/c1-15(24(4)5)19-8-9-20-18-7-6-16-14-17(25)10-12-22(16,2)21(18)11-13-23(19,20)3/h6,15,17-21,25H,7-14H2,1-5H3/t15-,17+,18+,19-,20+,21+,22+,23-/m1/s1 |
| Standard InCHIKey | UJGXCOFZMJCRLN-YDDBCJSBSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD120468] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Ampelopsis japonica | Ampelopsis | Vitaceae |
|
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Alpinia galanga | Alpinia | Zingiberaceae |
|
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC151843
Formula: C22H37NO
Ingredient ID: NPC151843
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CN[C@H]([C@H]1CC[C@H]2[C@]1(C)CC[C@@H]1[C@@H]2CC=C2[C@]1(C)CC[C@@H](C2)O)C |
| Standard InCHI | InChI=1S/C22H37NO/c1-14(23-4)18-7-8-19-17-6-5-15-13-16(24)9-11-21(15,2)20(17)10-12-22(18,19)3/h5,14,16-20,23-24H,6-13H2,1-4H3/t14-,16-,17+,18+,19+,20+,21-,22+/m0/s1 |
| Standard InCHIKey | DUTRRAKUNDUIQG-XFBJGIQASA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD140180] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Ingredient ID: NPC118329
Formula: C23H38N2
Ingredient ID: NPC118329
| Common Name | Isoconessimine |
| IUPAC Name | n.a. |
| Canonical SMILES | CN[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]24[C@H]3CC[C@@H]4[C@@H](N(C2)C)C)C1)C |
| Standard InCHI | InChI=1S/C23H38N2/c1-15-19-7-8-21-18-6-5-16-13-17(24-3)9-11-22(16,2)20(18)10-12-23(19,21)14-25(15)4/h5,15,17-21,24H,6-14H2,1-4H3/t15-,17-,18+,19+,20-,21-,22-,23-/m0/s1 |
| Standard InCHIKey | UBWOPONWVXRTKE-ALCLCTQTSA-N |
| Ingredient External Links |
PubChem CID: 11772257 ChEMBL ID: CHEMBL371125 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD130719] Database: NPASS [NPC118329] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Mentha suaveolens | Mentha | Lamiaceae |
|
| Protea compacta | Protea | Proteaceae | |
| Alpinia formosana | Alpinia | Zingiberaceae | |
| Rubus moluccanus | Rubus | Rosaceae |
|
| Bidens parviflora | Bidens | Asteraceae |
|
| Heliotropium angiospermum | Heliotropium | Heliotropiaceae |
|
| Holarrhena febrifuga | Holarrhena | Apocynaceae |
|
| Asparagus setaceus | Asparagus | Asparagaceae |
|
| Typhonium flagelliforme | Typhonium | Araceae |
|
| Papaver hybrid | Papaver | Papaveraceae | |
| Piper hostmannianum | Piper | Piperaceae | |
| Elsholtzia stauntonii | Elsholtzia | Lamiaceae |
|
| Flindersia australis | Flindersia | Rutaceae | |
| Anisocycla grandidieri | Anisocycla | Menispermaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Bambusa tulda | Bambusa | Poaceae |
|
| Diplospora dubia | Diplospora | Rubiaceae | |
| Pinus bungeana | Pinus | Pinaceae |
|
| Holarrhena pubescens | Holarrhena | Apocynaceae |
|
| Haemanthus tigrinus | Haemanthus | Amaryllidaceae | |
| Croton balsamifer | Croton | Euphorbiaceae |
Ingredient ID: NPC110615
Formula: C21H35NO
Ingredient ID: NPC110615
| Common Name | n.a. |
| IUPAC Name | 1-[(3R,5S,8R,9S,10S,13S,14S,17S)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| Canonical SMILES | N[C@@H]1CC[C@]2([C@H](C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2C(=O)C)C)C |
| Standard InCHI | InChI=1S/C21H35NO/c1-13(23)17-6-7-18-16-5-4-14-12-15(22)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19H,4-12,22H2,1-3H3/t14-,15+,16-,17+,18-,19-,20-,21+/m0/s1 |
| Standard InCHIKey | POWBIOMTXFDIOP-SYBPFIFISA-N |
| Ingredient External Links |
PubChem CID: 101702 ZINC ID: ZINC000004098874 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC110615] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vincetoxicum stauntonii | Vincetoxicum | Apocynaceae | |
| Prostanthera prunelloides | Prostanthera | Lamiaceae | |
| Funtumia elastica | Funtumia | Apocynaceae |
|
| Leucas volkensii | Leucas | Lamiaceae | |
| Diplospora dubia | Diplospora | Rubiaceae |
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC110615 | C21H35NO | 317.2718647 | 0.0351 | 3.55 | 6.031 | 2 | 1 | 43.09 | 5 | 4 | 23 | 1 | |
| NPC118329 | C23H38N2 | Isoconessimine | 342.3 | -0.0183 | 3.77 | 4.76 | 2 | 1 | 15.27 | 5 | 5 | 25 | 0 |
| NPC151843 | C22H37NO | 331.2875148 | 0.0363 | 3.66 | 5.464 | 2 | 2 | 32.26 | 2 | 4 | 24 | 1 | |
| NPC161162 | C23H39NO | 345.3031649 | 0.5722 | 3.77 | 5.703 | 2 | 1 | 23.47 | 2 | 4 | 25 | 1 | |
| NPC171175 | C31H52O | 440.4018163 | 2.1486 | 4.76 | 12.494 | 1 | 1 | 20.23 | 5 | 5 | 32 | 1 | |
| NPC21664 | C25H44N2O | 388.345364 | 0.1596 | 3.88 | 4.5 | 3 | 1 | 26.71 | 4 | 4 | 28 | 0 | |
| NPC244582 | C22H38N2 | (3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-aminoethyl]-N,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine | 330.3034992 | -0.2533 | 3.66 | 5.397 | 2 | 2 | 38.05 | 2 | 4 | 24 | 1 |
| NPC272592 | C25H44N2 | 372.3504494 | 1.2503 | 3.99 | 6.265 | 2 | 0 | 6.48 | 3 | 4 | 27 | 1 | |
| NPC283277 | C21H32N2 | 312.256549 | -0.7235 | 3.55 | 4.189 | 2 | 1 | 38.38 | 3 | 5 | 23 | 0 | |
| NPC301585 | C14H28O2 | Myristic Acid | 228.21 | -3.3217 | 2.78 | 6.432 | 2 | 1 | 37.3 | 14 | 0 | 16 | 2 |
| NPC36783 | C23H39NO | 345.3031649 | 0.5722 | 3.77 | 5.703 | 2 | 1 | 23.47 | 2 | 4 | 25 | 1 | |
| NPC38216 | C29H46O2 | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 426.3497807 | 3.2052 | 4.43 | 10.401 | 2 | 0 | 26.3 | 6 | 4 | 31 | 1 |
| NPC39927 | C6H7O6P | (5-formylfuran-3-yl)methyl phosphate | 203.9823745 | -2.0866 | 1.35 | -1.192 | 5 | 0 | 112.44 | 4 | 1 | 13 | 0 |
| NPC56044 | C21H35NO | 1-(3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone | 317.2718647 | 0.0351 | 3.55 | 6.031 | 2 | 1 | 43.09 | 1 | 4 | 23 | 1 |
| NPC71621 | C21H36N2 | (3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-aminoethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine | 316.2878492 | -0.6851 | 3.55 | 5.007 | 2 | 2 | 52.04 | 1 | 4 | 23 | 1 |
| NPC7214 | C24H40N2 | Conessine | 356.32 | 0.5176 | 3.88 | 4.999 | 2 | 0 | 6.48 | 6 | 5 | 26 | 0 |
| NPC79238 | C29H46N2O2 | 454.36 | 1.3688 | 4.21 | 5.279 | 4 | 1 | 41.57 | 11 | 5 | 33 | 1 | |
| NPC86906 | C30H48N2O2 | 468.37 | 1.9047 | 4.32 | 5.518 | 4 | 0 | 32.78 | 12 | 5 | 34 | 1 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
