11 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC69670
Formula: C17H18O4
Ingredient ID: NPC69670
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)/C=C/C=C/CC/C=C/c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C17H18O4/c1-19-17(18)9-7-5-3-2-4-6-8-14-10-11-15-16(12-14)21-13-20-15/h3,5-12H,2,4,13H2,1H3/b5-3+,8-6+,9-7+ |
| Standard InCHIKey | HLJZJOPIVFTQNX-NFGBADIGSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD64186] Database: NPASS [NPC69670] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
 |
| Lophocolea bidentata | Lophocolea | Lophocoleaceae |
Ingredient ID: NPC235736
Formula: C24H32O4
Ingredient ID: NPC235736
| Common Name | n.a. |
| IUPAC Name | 2-methylpropyl (2E,4E,12E)-13-(1,3-benzodioxol-5-yl)trideca-2,4,12-trienoate |
| Canonical SMILES | CC(COC(=O)/C=C/C=C/CCCCCC/C=C/c1ccc2c(c1)OCO2)C |
| Standard InCHI | InChI=1S/C24H32O4/c1-20(2)18-26-24(25)14-12-10-8-6-4-3-5-7-9-11-13-21-15-16-22-23(17-21)28-19-27-22/h8,10-17,20H,3-7,9,18-19H2,1-2H3/b10-8+,13-11+,14-12+ |
| Standard InCHIKey | GGTOOCSBWYVXHC-AUVZEZIHSA-N |
| Ingredient External Links |
PubChem CID: 101066120 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD170750] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae |
Ingredient ID: NPC227160
Formula: C21H22O6
Ingredient ID: NPC227160
| Common Name | n.a. |
| IUPAC Name | 5-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxole |
| Canonical SMILES | COc1cc(ccc1OC)[C@@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H22O6/c1-22-16-5-3-12(7-18(16)23-2)20-14-9-25-21(15(14)10-24-20)13-4-6-17-19(8-13)27-11-26-17/h3-8,14-15,20-21H,9-11H2,1-2H3/t14-,15-,20-,21+/m0/s1 |
| Standard InCHIKey | AWOGQCSIVCQXBT-LATRNWQMSA-N |
| Ingredient External Links |
PubChem CID: 10926754 ZINC ID: ZINC000012153719 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC227160] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Farfugium japonicum | Farfugium | Asteraceae |
 |
| Magnolia denudata | Magnolia | Magnoliaceae |
|
| Magnolia salicifolia | Magnolia | Magnoliaceae |
|
| Magnolia biondii | Magnolia | Magnoliaceae |
|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Magnolia kobus | Magnolia | Magnoliaceae |
 |
| Magnolia sprengeri | Magnolia | Magnoliaceae |
|
Ingredient ID: NPC21867
Formula: C21H26O5
Ingredient ID: NPC21867
| Common Name | n.a. |
| IUPAC Name | 4-[(2S,3S,4R,5R)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Canonical SMILES | COc1cc(ccc1OC)[C@@H]1O[C@@H]([C@H]([C@H]1C)C)c1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C21H26O5/c1-12-13(2)21(15-7-9-17(23-3)19(11-15)25-5)26-20(12)14-6-8-16(22)18(10-14)24-4/h6-13,20-22H,1-5H3/t12-,13+,20-,21+/m0/s1 |
| Standard InCHIKey | YPQNDHHCUQGPFN-WVGOSAFVSA-N |
| Ingredient External Links |
PubChem CID: 13939326 ZINC ID: ZINC000033832943 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC21867] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyptis tomentosa | Hyptis | Lamiaceae |
|
| Cephalonoplos segetum | Cephanonoplos | Asteraceae |
|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Lens phaseoloides | Lens | Fabaceae | |
| Ipomoea cristulata | Ipomoea | Convolvulaceae | |
| Lophozonia menziesii | Lophozonia | Nothofagaceae | |
| Myristica fragrans | Myristica | Myristicaceae |
 |
| Rhodotypos scandens | Rhodotypos | Rosaceae | |
| Pancratium trianthum | Pancratium | Amaryllidaceae |
|
| Piper pedicellosum | Piper | Piperaceae |
|
| Xanthostemon oppositifolius | Xanthostemon | Myrtaceae | |
| Esenbeckia nesiotica | Esenbeckia | Rutaceae | |
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Helipterum tenellum | Helipterum | Asteraceae |
Ingredient ID: NPC195986
Formula: C14H25NO
Ingredient ID: NPC195986
| Common Name | Pellitorin |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)deca-2,4-dienamide |
| Canonical SMILES | CCCCC/C=C/C=C/C(=NCC(C)C)O |
| Standard InCHI | InChI=1S/C14H25NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h8-11,13H,4-7,12H2,1-3H3,(H,15,16)/b9-8+,11-10+ |
| Standard InCHIKey | MAGQQZHFHJDIRE-BNFZFUHLSA-N |
| Ingredient External Links |
PubChem CID: 5318516 ZINC ID: ZINC000013838505 ChEMBL ID: CHEMBL271242 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC195986] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Brickellia longifolia | Brickellia | Asteraceae | |
| Verbesina virginica | Verbesina | Asteraceae | |
| Bellardia viscosa | Bellardia | Orobanchaceae | |
| Dichotomanthes tristaniicarpa | Dichotomanthes | Rosaceae | |
| Cochlearia officinalis | Cochlearia | Brassicaceae |
|
| Forsythia japonica | Forsythia | Oleaceae | |
| Frullania brasiliensis | Frullania | Frullaniaceae |
|
| Bupleurum rigidum | Bupleurum | Apiaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Abies webbiana | Abies | Pinaceae |
|
| Garcinia oligantha | Garcinia | Clusiaceae | |
| Iris spuria | Iris | Iridaceae |
|
| Eucalyptus hybrid | Eucalyptus | Myrtaceae | |
| Aconitum episcopale | Aconitum | Ranunculaceae | |
| Kopsia lapidilecta | Kopsia | Apocynaceae | |
| Dryopteris arguta | Dryopteris | Dryopteridaceae |
|
| Plenckia populnea | Plenckia | Celastraceae | |
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Acanthosyris paulo-alvinii | Acanthosyris | Cervantesiaceae |
|
| Phytolacca thyrsiflora | Phytolacca | Phytolaccaceae | |
| Corydalis thalictrifolia | Corydalis | Papaveraceae |
|
| Corymbia scabrida | Corymbia | Myrtaceae | |
| Calliandra eriophylla | Calliandra | Fabaceae | |
| Pinus aristata | Pinus | Pinaceae |
|
| Palisota barteri | Palisota | Commelinaceae | |
| Matsumurella chinensis | Matsumurella | Lamiaceae | |
| Piper longum | Piper | Piperaceae |
|
| Silene banksia | Silene | Caryophyllaceae | |
| Podocarpus minor | Podocarpus | Podocarpaceae | |
| Piper sarmentosum | Piper | Piperaceae |
|
| Piper nigrum | Piper | Piperaceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Ardisia japonica | Ardisia | Primulaceae |
|
| Ardisia arborescens | Ardisia | Primulaceae |
|
| Dracontium loretense | Dracontium | Araceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Piper kadsura | Piper | Piperaceae | |
| Oocystis polymorpha | Oocystis | Oocystaceae | |
| Phoebe grandis | Phoebe | Lauraceae | |
| Euphorbia wangii | Euphorbia | Euphorbiaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Carpesium longifolium | Carpesium | Asteraceae |
|
| Rubus pileatus | Rubus | Rosaceae | |
| Piper retrofractum | Piper | Piperaceae |
|
| Crocus corsicus | Crocus | Iridaceae | |
| Schefflera venulosa | Schefflera | Araliaceae |
|
| Rubus trifidus | Rubus | Rosaceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Homalium laurifolium | Homalium | Salicaceae | |
| Hippocrepis emerus | Hippocrepis | Fabaceae | |
| Betula alnoides | Betula | Betulaceae |
|
| Rhododendron latoucheae | Rhododendron | Ericaceae | |
| Coelogyne nitida | Coelogyne | Orchidaceae |
Ingredient ID: NPC171928
Formula: C20H18O6
Ingredient ID: NPC171928
| Common Name | Sesamin |
| IUPAC Name | 5-[(3S,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole |
| Canonical SMILES | C1Oc2c(O1)cc(cc2)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19+,20+/m0/s1 |
| Standard InCHIKey | PEYUIKBAABKQKQ-AFHBHXEDSA-N |
| Ingredient External Links |
PubChem CID: 72307 ZINC ID: ZINC000001668768 ChEMBL ID: CHEMBL252915 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC171928] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artabotrys uncinatus | Artabotrys | Annonaceae | |
| Scrophularia leucoclada | Scrophularia | Scrophulariaceae | |
| Brickellia longifolia | Brickellia | Asteraceae | |
| Lindera obtusiloba | Lindera | Lauraceae |
|
| Verbesina virginica | Verbesina | Asteraceae | |
| Asteriscus aquaticus | Asteriscus | Asteraceae | |
| Cinnamomum subavenium | Cinnamomum | Lauraceae |
|
| Moringa oleifera | Moringa | Moringaceae |
|
| Dichotomanthes tristaniicarpa | Dichotomanthes | Rosaceae | |
| Arnebia decumbens | Arnebia | Boraginaceae | |
| Pseudowintera colorata | Pseudowintera | Winteraceae | |
| Nigella aristata | Nigella | Ranunculaceae | |
| Cochlearia officinalis | Cochlearia | Brassicaceae |
|
| Phebalium dentatum | Phebalium | Rutaceae | |
| Crotalaria mitchellii | Crotalaria | Fabaceae | |
| Ecballium elaterium | Ecballium | Cucurbitaceae |
|
| Capparis ovata | Capparis | Capparaceae |
|
| Croton montevidensis | Croton | Euphorbiaceae | |
| Eleutherococcus senticosus | Eleutherococcus | Araliaceae |
|
| Datisca glomerata | Datisca | Datiscaceae | |
| Frullania brasiliensis | Frullania | Frullaniaceae |
|
| Acicarpha tribuloides | Acicarpha | Calyceraceae | |
| Quercus imbricaria | Quercus | Fagaceae |
|
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Bupleurum rigidum | Bupleurum | Apiaceae |
|
| Dioscorea olfersiana | Dioscorea | Dioscoreaceae |
|
| Cassine papillosa | Cassine | Celastraceae |
|
| Potamogeton malaianus | Potamogeton | Potamogetonaceae | |
| Polypodium vulgare | Polypodium | Polypodiaceae |
|
| Abies webbiana | Abies | Pinaceae |
|
| Vallaris heynei | Vallaris | Apocynaceae |
|
| Glycosmis puberula | Glycosmis | Rutaceae | |
| Otanthus maritimus | Otanthus | Asteraceae | |
| Garcinia oligantha | Garcinia | Clusiaceae | |
| Berkheya rhapontica | Berkheya | Asteraceae |
|
| Clerodendrum cyrtophyllum | Clerodendrum | Lamiaceae |
|
| Acanthothamnus aphyllus | Acanthothamnus | Celastraceae | |
| Cephalotaxus hainanensis | Cephalotaxus | Taxaceae | |
| Corymbia citriodora | Corymbia | Myrtaceae |
|
| Onobrychis bobrovii | Onobrychis | Fabaceae | |
| Iris spuria | Iris | Iridaceae |
|
| Centaurea musimomum | Centaurea | Asteraceae | |
| Eucalyptus hybrid | Eucalyptus | Myrtaceae | |
| Cuscuta chinensis | Cuscuta | Convolvulaceae |
|
| Aconitum episcopale | Aconitum | Ranunculaceae | |
| Centaurea arbutifolia | Centaurea | Asteraceae | |
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Acanthosyris paulo-alvinii | Acanthosyris | Cervantesiaceae |
|
| Senecio zoellneri | Senecio | Asteraceae | |
| Achillea magnifica | Achillea | Asteraceae | |
| Crinum stuhlmannii | Crinum | Amaryllidaceae | |
| Phyllanthus oligospermus | Phyllanthus | Phyllanthaceae | |
| Piper acutifolium | Piper | Piperaceae |
|
| Zanthoxylum integrifoliolum | Zanthoxylum | Rutaceae |
|
| Bidens tripartita | Bidens | Asteraceae |
|
| Corymbia scabrida | Corymbia | Myrtaceae | |
| Hypericum japonicum | Hypericum | Hypericaceae |
|
| Stypandra imbricata | Stypandra | Asphodelaceae | |
| Genista sessilifolia | Genista | Fabaceae | |
| Corydalis sewerzowi | Corydalis | Papaveraceae |
|
| Trapa bicornis | Trapa | Lythraceae |
|
| Palisota barteri | Palisota | Commelinaceae | |
| Cacalia robusta | Cacalia | Asteraceae | |
| Xyris indica | Xyris | Xyridaceae |
|
| Aconitum palmatum | Aconitum | Ranunculaceae |
|
| Onoseris alata | Onoseris | Asteraceae | |
| Carpesium faberi | Carpesium | Asteraceae | |
| Microcos paniculata | Microcos | Malvaceae |
|
| Vellozia streptophylla | Vellozia | Velloziaceae | |
| Aconitum tianschanicum | Aconitum | Ranunculaceae | |
| Solanum diflorum | Solanum | Solanaceae | |
| Staehelina fruticosa | Staehelina | Asteraceae | |
| Gomphostemma parviflorum | Gomphostemma | Lamiaceae | |
| Chlamydomonas allensworthii | Chlamydomonas | Chlamydomonadaceae | |
| Hippobroma longiflora | Hippobroma | Campanulaceae | |
| Psilotum nudum | Psilotum | Psilotaceae |
|
| Matsumurella chinensis | Matsumurella | Lamiaceae | |
| Codonopsis cordifolioidea | Codonopsis | Campanulaceae |
|
| Ariocarpus fissuratus | Ariocarpus | Cactaceae |
|
| Sesamum indicum | Sesamum | Pedaliaceae |
|
| Trifolium strepens | Trifolium | Fabaceae | |
| Solanum andigena | Solanum | Solanaceae | |
| Piper longum | Piper | Piperaceae |
|
| Cladrastis kentukea | Cladrastis | Fabaceae | |
| Petteria ramentacea | Petteria | Fabaceae | |
| Silene banksia | Silene | Caryophyllaceae | |
| Podocarpus minor | Podocarpus | Podocarpaceae | |
| Piper sarmentosum | Piper | Piperaceae |
|
| Cuscuta australis | Cuscuta | Convolvulaceae |
|
| Alstonia undulifolia | Alstonia | Apocynaceae | |
| Scrophularia koelzii | Scrophularia | Scrophulariaceae |
|
| Artemisia rutifolia | Artemisia | Asteraceae | |
| Ardisia japonica | Ardisia | Primulaceae |
|
| Medinilla magnifica | Medinilla | Melastomataceae |
|
| Ardisia arborescens | Ardisia | Primulaceae |
|
| Dracontium loretense | Dracontium | Araceae | |
| Ferula gummosa | Ferula | Apiaceae |
|
| Flemingia philippinensis | Flemingia | Fabaceae |
|
| Betula platyphylla | Betula | Betulaceae |
|
| Laggera alata | Laggera | Asteraceae |
|
| Polygonum flaccidum | Polygonum | Polygonaceae |
|
| Dracaena ombet | Dracaena | Asparagaceae | |
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Helipterum gnaphaloides | Helipterum | Asteraceae | |
| Daemonorops draco | Daemonorops | Arecaceae |
|
| Hubertia tomentosa | Hubertia | Asteraceae | |
| Ligustrum obtusifolium | Ligustrum | Oleaceae |
|
| Pseudoxandra sclerocarpa | Pseudoxandra | Annonaceae | |
| Papaver persicum | Papaver | Papaveraceae |
|
| Oocystis polymorpha | Oocystis | Oocystaceae | |
| Aniba rosaeodora | Aniba | Lauraceae |
|
| Helichrysum auriceps | Helichrysum | Asteraceae | |
| Garrya laurifolia | Garrya | Garryaceae | |
| Phoebe grandis | Phoebe | Lauraceae | |
| Sequoia sempervirens | Sequoia | Cupressaceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Euphorbia wangii | Euphorbia | Euphorbiaceae | |
| Carpesium longifolium | Carpesium | Asteraceae |
|
| Rubus pileatus | Rubus | Rosaceae | |
| Piper retrofractum | Piper | Piperaceae |
|
| Cinnamomum camphora | Cinnamomum | Lauraceae |
|
| Mesua ferrea | Mesua | Calophyllaceae |
|
| Crocus corsicus | Crocus | Iridaceae | |
| Myrica arborea | Myrica | Myricaceae | |
| Schefflera venulosa | Schefflera | Araliaceae |
|
| Goupia glabra | Goupia | Goupiaceae | |
| Dahlstedtia pentaphylla | Dahlstedtia | Fabaceae | |
| Rubus trifidus | Rubus | Rosaceae |
|
| Fagus fusca | Fagus | Fagaceae | |
| Spiracantha cornifolia | Spiracantha | Asteraceae | |
| Excoecaria acerifolia | Excoecaria | Euphorbiaceae |
|
| Tylophora tanakae | Tylophora | Apocynaceae | |
| Senecio cathcartensis | Senecio | Asteraceae | |
| Iryanthera polyneura | Iryanthera | Myristicaceae | |
| Myristica cagayanensis | Myristica | Myristicaceae | |
| Eleutherococcus gracilistylus | Eleutherococcus | Araliaceae | |
| Monopteryx uaucu | Monopteryx | Fabaceae |
|
| Polygala aureocauda | Polygala | Polygalaceae | |
| Charpentiera obovata | Charpentiera | Amaranthaceae | |
| Homalium laurifolium | Homalium | Salicaceae | |
| Zanthoxylum nitidum | Zanthoxylum | Rutaceae |
|
| Lotus ucrainicus | Lotus | Fabaceae | |
| Vincetoxicum hirundinaria | Vincetoxicum | Apocynaceae |
|
| Daphne genkwa | Daphne | Thymelaeaceae |
|
| Ethulia conyzoides | Ethulia | Asteraceae |
|
| Betula alnoides | Betula | Betulaceae |
|
| Coelogyne nitida | Coelogyne | Orchidaceae |
Ingredient ID: NPC129687
Formula: C20H18O6
Ingredient ID: NPC129687
| Common Name | Asarinin |
| IUPAC Name | 5-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole |
| Canonical SMILES | C1Oc2c(O1)cc(cc2)[C@@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19-,20+/m0/s1 |
| Standard InCHIKey | PEYUIKBAABKQKQ-WZBLMQSHSA-N |
| Ingredient External Links |
PubChem CID: 101612 ZINC ID: ZINC000018037965 ChEMBL ID: CHEMBL43469 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC129687] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lindera obtusiloba | Lindera | Lauraceae |
|
| Lespedeza cyrtobotrya | Lespedeza | Fabaceae |
|
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Uvaria ferruginea | Uvaria | Annonaceae | |
| Teucrium fragile | Teucrium | Lamiaceae | |
| Trichilia dregeana | Trichilia | Meliaceae |
|
| Ptelea crenulata | Ptelea | Rutaceae | |
| Hymenaea oblongifolia | Hymenaea | Fabaceae | |
| Flaveria bidentis | Flaveria | Asteraceae |
|
| Sansevieria ehrenbergii | Sansevieria | Asparagaceae |
|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Cnidoscolus texanus | Cnidoscolus | Euphorbiaceae | |
| Diospyros montana | Diospyros | Ebenaceae |
|
| Eleutherococcus gracilistylus | Eleutherococcus | Araliaceae | |
| Veronica anagallis-aquatica | Veronica | Plantaginaceae |
|
| Zanthoxylum nitidum | Zanthoxylum | Rutaceae |
|
Ingredient ID: NPC128238
Formula: C26H41NO
Ingredient ID: NPC128238
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(CN=C(/C=C/C=C/CCCCCCCCCCCc1ccccc1)O)C |
| Standard InCHI | InChI=1S/C26H41NO/c1-24(2)23-27-26(28)22-18-13-11-9-7-5-3-4-6-8-10-12-15-19-25-20-16-14-17-21-25/h11,13-14,16-18,20-22,24H,3-10,12,15,19,23H2,1-2H3,(H,27,28)/b13-11+,22-18+ |
| Standard InCHIKey | IDZIDIXCOYCXIY-MVCVICQCSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD141223] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae |
Ingredient ID: NPC128208
Formula: C20H24O5
Ingredient ID: NPC128208
| Common Name | Nectandrin B |
| IUPAC Name | 4-[(2R,3R,4S,5S)-5-(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Canonical SMILES | COc1cc(ccc1O)[C@@H]1O[C@@H]([C@H]([C@H]1C)C)c1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C20H24O5/c1-11-12(2)20(14-6-8-16(22)18(10-14)24-4)25-19(11)13-5-7-15(21)17(9-13)23-3/h5-12,19-22H,1-4H3/t11-,12+,19-,20+ |
| Standard InCHIKey | GMXMKSFJQLFOSO-JARDSOJUSA-N |
| Ingredient External Links |
PubChem CID: 156517 ZINC ID: ZINC000006067050 ChEMBL ID: CHEMBL228326 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC128208] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyptis tomentosa | Hyptis | Lamiaceae |
|
| Klasea sogdiana | Klasea | Asteraceae | |
| Cephalonoplos segetum | Cephanonoplos | Asteraceae |
|
| Endiandra anthropophagorum | Endiandra | Lauraceae | |
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Lens phaseoloides | Lens | Fabaceae | |
| Ipomoea cristulata | Ipomoea | Convolvulaceae | |
| Lophozonia menziesii | Lophozonia | Nothofagaceae | |
| Myristica fragrans | Myristica | Myristicaceae |
|
| Rhodotypos scandens | Rhodotypos | Rosaceae | |
| Pancratium trianthum | Pancratium | Amaryllidaceae |
|
| Piper pedicellosum | Piper | Piperaceae |
|
| Xanthostemon oppositifolius | Xanthostemon | Myrtaceae | |
| Esenbeckia nesiotica | Esenbeckia | Rutaceae | |
| Asclepias vestita | Asclepias | Apocynaceae | |
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Helipterum tenellum | Helipterum | Asteraceae |
Ingredient ID: NPC119949
Formula: C11H12O3
Ingredient ID: NPC119949
| Common Name | Elemicin |
| IUPAC Name | 4-methoxy-6-prop-2-enyl-1,3-benzodioxole |
| Canonical SMILES | C=CCc1cc(OC)c2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C11H12O3/c1-3-4-8-5-9(12-2)11-10(6-8)13-7-14-11/h3,5-6H,1,4,7H2,2H3 |
| Standard InCHIKey | BNWJOHGLIBDBOB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 4276 ZINC ID: ZINC000000403089 ChEMBL ID: CHEMBL481044 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC119949] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Asteriscus aquaticus | Asteriscus | Asteraceae | |
| Cinnamomum subavenium | Cinnamomum | Lauraceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Pseudowintera colorata | Pseudowintera | Winteraceae | |
| Styrax benzoin | Styrax | Styracaceae |
|
| Ligusticum jeholense | Ligusticum | Apiaceae |
|
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Phebalium dentatum | Phebalium | Rutaceae | |
| Ecballium elaterium | Ecballium | Cucurbitaceae |
|
| Capparis ovata | Capparis | Capparaceae |
|
| Croton montevidensis | Croton | Euphorbiaceae | |
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Vepris nobilis | Vepris | Rutaceae |
|
| Datisca glomerata | Datisca | Datiscaceae | |
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Quercus imbricaria | Quercus | Fagaceae |
|
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Asarum heterotropoides f. schm. var. mandshuricum (maxim.) kitag. | Asarum | Aristolochiaceae | |
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Dioscorea olfersiana | Dioscorea | Dioscoreaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Cassine papillosa | Cassine | Celastraceae |
|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Illicium verum | Illicium | Schisandraceae |
|
| Pastinaca sativa | Pastinaca | Apiaceae |
|
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Hyptis tomentosa | Hyptis | Lamiaceae |
|
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Apollonias barbujana | Apollonias | Lauraceae | |
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Hippophae rhamnoides | Hippophae | Elaeagnaceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Convallaria majalis | Convallaria | Asparagaceae |
|
| Daucus carota | Daucus | Apiaceae |
|
| Capsicum annuum | Capsicum | Solanaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Rabdosia angustifolia | Isodon | Lamiaceae | |
| Cephalonoplos segetum | Cephanonoplos | Asteraceae |
|
| Fragaria vesca | Fragaria | Rosaceae |
|
| Carthamus tinctorius | Carthamus | Asteraceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Phyllanthus oligospermus | Phyllanthus | Phyllanthaceae | |
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Vitex trifolia | Vitex | Lamiaceae |
|
| Anethum graveolens | Anethum | Apiaceae |
|
| Smilax bracteata | Smilax | Smilacaceae |
|
| Trichosanthes kirilowii | Trichosanthes | Cucurbitaceae |
|
| Tynanthus panurensis | Tynanthus | Bignoniaceae | |
| Elsholtzia splendens | Elsholtzia | Lamiaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Scutellaria sieberi | Scutellaria | Lamiaceae | |
| Christisonia bicolor | Christisonia | Orobanchaceae | |
| Atroxima liberica | Atroxima | Polygalaceae | |
| Solanum andigena | Solanum | Solanaceae | |
| Linum crispum | Linum | Linaceae | |
| Palafoxia texana | Palafoxia | Asteraceae | |
| Apium graveolens | Apium | Apiaceae |
|
| Sanguisorba officinalis | Sanguisorba | Rosaceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Lens phaseoloides | Lens | Fabaceae | |
| Piper sarmentosum | Piper | Piperaceae |
|
| Croton tiglium | Croton | Euphorbiaceae |
|
| Alstonia undulifolia | Alstonia | Apocynaceae | |
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Scrophularia koelzii | Scrophularia | Scrophulariaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Betula platyphylla | Betula | Betulaceae |
|
| Polygonum flaccidum | Polygonum | Polygonaceae |
|
| Ipomoea cristulata | Ipomoea | Convolvulaceae | |
| Persea mexicana | Persea | Lauraceae | |
| Trichosanthes rosthornii | Trichosanthes | Cucurbitaceae |
|
| Prunus armeniaca | Prunus | Rosaceae |
|
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Lophozonia menziesii | Lophozonia | Nothofagaceae | |
| Hubertia tomentosa | Hubertia | Asteraceae | |
| Lawsonia inermis | Lawsonia | Lythraceae |
|
| Myristica fragrans | Myristica | Myristicaceae |
|
| Rhodotypos scandens | Rhodotypos | Rosaceae | |
| Ligustrum obtusifolium | Ligustrum | Oleaceae |
|
| Pancratium trianthum | Pancratium | Amaryllidaceae |
|
| Helichrysum auriceps | Helichrysum | Asteraceae | |
| Etlingera elatior | Elettaria | Zingiberaceae |
|
| Petroselinum crispum | Petroselinum | Apiaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Piper pedicellosum | Piper | Piperaceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Clematis chinensis | Clematis | Ranunculaceae |
|
| Bergenia crassifolia | Bergenia | Saxifragaceae |
|
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Xanthostemon oppositifolius | Xanthostemon | Myrtaceae | |
| Esenbeckia nesiotica | Esenbeckia | Rutaceae | |
| Panax innovans | Panax | Araliaceae | |
| Fagus fusca | Fagus | Fagaceae | |
| Spiracantha cornifolia | Spiracantha | Asteraceae | |
| Tylophora tanakae | Tylophora | Apocynaceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Pseudocinchona pachyceras | Pseudocinchona | Rubiaceae | |
| Myristica cagayanensis | Myristica | Myristicaceae | |
| Helipterum tenellum | Helipterum | Asteraceae | |
| Perilla frutescens | Perilla | Lamiaceae |
|
| Licaria brasiliensis | Licaria | Lauraceae | |
| Crotalaria orixensis | Crotalaria | Fabaceae |
|
| Charpentiera obovata | Charpentiera | Amaranthaceae | |
| Lotus ucrainicus | Lotus | Fabaceae |
Ingredient ID: NPC114845
Formula: C20H24O4
Ingredient ID: NPC114845
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(COC(=O)/C=C/C=C/CC/C=C/c1ccc2c(c1)OCO2)C |
| Standard InCHI | InChI=1S/C20H24O4/c1-16(2)14-22-20(21)10-8-6-4-3-5-7-9-17-11-12-18-19(13-17)24-15-23-18/h4,6-13,16H,3,5,14-15H2,1-2H3/b6-4+,9-7+,10-8+ |
| Standard InCHIKey | UGIIJGKKURXGFX-FCGWLDPVSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD104361] Database: NPASS [NPC114845] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae |
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC114845 | C20H24O4 | 328.17 | 1.9986 | 3.22 | 5.53 | 2 | 0 | 44.76 | 11 | 2 | 24 | 1 | |
| NPC119949 | C11H12O3 | Elemicin | 192.08 | 0.6742 | 2.34 | 2.486 | 0 | 0 | 27.69 | 4 | 2 | 14 | 0 |
| NPC128208 | C20H24O5 | Nectandrin B | 344.16 | -1.0123 | 3.11 | 2.93 | 1 | 2 | 68.15 | 10 | 3 | 25 | 0 |
| NPC128238 | C26H41NO | 383.3188149 | -1.1664 | 4.1 | 11.777 | 2 | 1 | 32.59 | 16 | 1 | 28 | 2 | |
| NPC129687 | C20H18O6 | Asarinin | 354.11 | -1.6034 | 3 | 2.576 | 2 | 0 | 55.38 | 2 | 6 | 26 | 0 |
| NPC171928 | C20H18O6 | Sesamin | 354.11 | -1.6034 | 3 | 2.576 | 2 | 0 | 55.38 | 2 | 6 | 26 | 0 |
| NPC195986 | C14H25NO | Pellitorin | 223.19 | 0.5505 | 2.78 | 4.887 | 2 | 1 | 32.59 | 12 | 0 | 16 | 0 |
| NPC21867 | C21H26O5 | 358.1780239 | -0.6038 | 3.22 | 3.449 | 1 | 1 | 57.15 | 11 | 3 | 26 | 0 | |
| NPC227160 | C21H22O6 | 370.1416384 | -1.4043 | 3.11 | 2.649 | 2 | 0 | 55.38 | 6 | 5 | 27 | 0 | |
| NPC235736 | C24H32O4 | 384.2300595 | 0.8466 | 3.66 | 7.806 | 4 | 0 | 44.76 | 13 | 2 | 28 | 2 | |
| NPC69670 | C17H18O4 | 286.12 | 1.5164 | 2.89 | 4.452 | 2 | 0 | 44.76 | 8 | 2 | 21 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
