NPASS Compound

Natural Product: NPC477630

Natural Product ID	NPC477630
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	cyclo[Ala-Ala-Leu-Gly-Cys(1)-Ser-Cys(2)-Lys-Asn-Lys-Val-Cys(3)-Tyr-Arg-Asn-Gly-Ile-Pro-Cys(1)-Gly-Glu-Ser-Cys(2)-Val-Trp-Ile-Pro-Cys(3)-Ile-Ser]
IUPAC Name	3-[(1R,4S,7S,13R,16S,22S,28S,31S,34S,37R,40S,43S,46S,49S,52R,55S,58R,64S,67S,70S,73S,76S,79R,82S,88S,91S,94S)-43,49-bis(4-aminobutyl)-28,46-bis(2-amino-2-oxoethyl)-22,76,88-tris[(2S)-butan-2-yl]-31-(3-carbamimidamidopropyl)-4,55,73-tris(hydroxymethyl)-34-[(4-hydroxyphenyl)methyl]-91-(1H-indol-3-ylmethyl)-67,70-dimethyl-64-(2-methylpropyl)-3,6,9,12,15,21,24,27,30,33,36,39,42,45,48,51,54,57,60,63,66,69,72,75,78,81,87,90,93,96-triacontaoxo-40,94-di(propan-2-yl)-2a,3a,6a,7a,98,99-hexathia-2,5,8,11,14,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71,74,77,80,86,89,92,95-triacontazahexacyclo[50.44.4.413,58.437,79.016,20.082,86]octahectan-7-yl]propanoic acid
Synonyms	Circulin A
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44592641
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0003297] Organic Polymers [CHEMONTID:0003298] Polypeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 424432 0 0 0 0 0 0 0 0999 V2000 1.4629 -8.7465 4.5275 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9556 -8.8343 4.5546 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6319 -8.1039 5.6725 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1522 -8.6252 6.9975 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4923 -6.6133 5.4955 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2192 -5.9064 6.6310 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4090 -5.6659 6.4868 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6115 -5.5126 7.8037 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0774 -4.9272 8.9955 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9776 -4.3516 9.8338 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2351 -4.0444 11.0026 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6733 -4.1153 9.4223 N 0 0 0 0 0 0 0 0 0 0 0 0 0.6520 -3.5537 10.2623 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6960 -4.0297 9.8572 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8133 -4.8663 8.9487 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9298 -3.6225 10.4065 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.1615 -4.1603 9.8687 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9402 -3.0155 9.2507 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8565 -3.2974 8.4971 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6964 -1.6611 9.4718 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.4193 -0.6082 8.8205 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5169 0.5618 8.5129 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4187 0.6497 9.0721 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8132 1.6075 7.6400 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.9176 2.7217 7.5128 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3388 3.7337 6.5075 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7343 4.8030 6.5070 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3373 3.5840 5.5496 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.8915 4.6297 4.7312 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7245 5.1809 3.8774 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3402 6.6410 2.9591 S 0 0 0 0 0 0 0 0 0 0 0 0 -5.6085 5.9920 1.4499 S 0 0 0 0 0 0 0 0 0 0 0 0 -4.8036 5.7711 -0.1434 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8493 7.2029 -0.8167 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3273 7.3949 -0.8247 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8613 8.2432 -0.1593 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1818 6.5753 -1.5971 N 0 0 0 0 0 0 0 0 0 0 0 0 -8.6044 6.6849 -1.5503 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2843 5.7309 -2.4356 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5324 5.7013 -2.3367 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7786 4.8490 -3.3864 N 0 0 0 0 0 0 0 0 0 0 0 0 -9.5823 3.8716 -4.0639 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.8845 2.8070 -4.7651 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7163 2.9011 -5.1173 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4975 1.5727 -5.0788 N 0 0 0 0 0 0 0 0 0 0 0 0 -8.9700 0.4684 -5.7759 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5288 -0.5757 -4.8082 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4976 -0.3312 -3.5988 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1239 -1.9025 -5.1361 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.4828 -2.6851 -4.1296 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5353 -3.7048 -3.5654 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7294 -4.3640 -2.0318 S 0 0 0 0 0 0 0 0 0 0 0 0 -8.4071 -3.3175 -0.4174 S 0 0 0 0 0 0 0 0 0 0 0 0 -7.8522 -1.8128 0.1079 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4693 -1.4612 0.6016 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4409 -1.6319 -0.4795 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4600 -2.7070 -1.1039 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4764 -0.6967 -0.8103 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.5976 -0.6747 -1.9930 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3627 -1.4708 -1.7894 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1286 -1.8539 -0.6066 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4128 -1.8613 -2.7752 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.2161 -2.5915 -2.4490 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0044 -2.2177 -3.2751 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9836 -1.6897 -4.3860 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2865 -2.4706 -2.7222 N 0 0 0 0 0 0 0 0 0 0 0 0 3.5464 -2.5046 -3.3935 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5998 -2.9837 -2.4835 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1528 -3.6052 -1.4412 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9856 -2.8748 -2.5338 N 0 0 0 0 0 0 0 0 0 0 0 0 6.8225 -3.4628 -1.4727 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9781 -2.5456 -0.3190 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5598 -2.9825 0.6883 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5267 -1.2204 -0.2926 N 0 0 0 0 0 0 0 0 0 0 0 0 6.4566 -0.2802 0.7496 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0622 -0.7508 2.0563 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3872 -2.1158 2.8980 S 0 0 0 0 0 0 0 0 0 0 0 0 4.3539 -2.1468 3.3100 S 0 0 0 0 0 0 0 0 0 0 0 0 3.4577 -3.1544 2.0129 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8828 -4.5488 2.2332 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5554 -4.9794 3.6711 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9178 -4.2729 4.4010 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0009 -6.2154 4.2011 N 0 0 0 0 0 0 0 0 0 0 0 0 3.4377 -5.6249 1.4341 N 0 0 0 0 0 0 0 0 0 0 0 0 4.2834 -6.6335 0.8742 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5049 -6.2616 1.0865 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0033 -7.8467 0.1941 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3590 -8.2915 -0.4618 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2219 -7.5606 -1.7630 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7254 -7.7331 -2.0842 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0714 -8.0670 -0.8525 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7524 -8.4714 -0.6103 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4352 -8.2017 0.5928 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6983 -9.0900 -1.4242 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6213 -8.5750 -1.2428 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.4753 -8.0836 -2.2426 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9950 -8.0849 -3.3726 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8476 -7.5670 -2.0560 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3101 -7.0694 -3.3764 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.9601 -5.8546 -3.4778 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1417 -5.2824 -2.3787 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4713 -5.1686 -4.7311 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3257 -4.0804 -4.2481 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.4767 -3.6299 -4.7922 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7728 -3.9814 -5.9405 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3715 -4.7201 -5.6369 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5838 -5.9423 -6.0575 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9598 -4.1415 -6.9096 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8269 -8.6025 -1.6381 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0505 -9.6642 -2.6295 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4522 -10.9297 -2.6274 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8839 -11.6227 -3.6814 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.7459 -10.8710 -4.3763 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4700 -11.1149 -5.5208 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3346 -10.1798 -6.0787 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4538 -8.9654 -5.4369 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7438 -8.6968 -4.2850 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8874 -9.6446 -3.7599 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1201 -9.7037 -2.7079 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2396 -10.7471 -2.3024 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0457 -10.7008 -3.1790 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5085 -11.3362 -4.5091 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0085 1.0527 0.5396 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1694 1.7721 1.5707 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3936 1.7227 -0.6373 N 0 0 0 0 0 0 0 0 0 0 0 0 8.0935 2.9791 -0.5715 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2255 4.0611 -0.0036 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0815 3.8437 0.3159 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6830 5.4040 0.1985 N 0 0 0 0 0 0 0 0 0 0 0 0 6.8526 6.3670 0.8181 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9339 7.7120 0.1085 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7436 7.8579 -0.7785 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1074 8.7771 0.4365 N 0 0 0 0 0 0 0 0 0 0 0 0 6.1909 10.1086 -0.1523 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0270 10.1724 -1.0668 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9915 9.4478 -0.8327 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8121 10.9144 -2.2357 N 0 0 0 0 0 0 0 0 0 0 0 0 3.5711 10.8220 -2.9976 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4211 11.2856 -2.1746 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6228 11.7039 -1.0450 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0957 11.2755 -2.6084 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0105 11.8122 -1.7689 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6987 10.6816 -1.1370 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5828 9.5493 -1.5790 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5224 10.7953 -0.0039 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5450 11.9422 0.8724 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9723 11.9520 1.3338 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3307 10.4921 1.4630 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3428 9.7923 0.5544 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0979 8.9133 -0.3861 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8825 8.8366 -1.5670 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1657 8.0802 0.0632 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8530 12.6680 -2.6767 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0207 13.3219 -2.0949 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0628 13.7432 -3.2586 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6656 14.5688 -2.1473 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5063 10.4068 -0.7947 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6473 11.8048 -1.2622 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8531 12.6852 -0.8426 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6530 12.1926 -2.1682 N 0 0 0 0 0 0 0 0 0 0 0 0 7.4389 6.7216 2.2000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7444 7.3708 2.2228 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9510 6.7311 1.6486 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3034 5.4549 2.2030 N 0 0 0 0 0 0 0 0 0 0 0 0 10.7904 5.3441 3.5450 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2811 6.4423 4.0659 N 0 0 0 0 0 0 0 0 0 0 0 0 10.7515 4.1436 4.2851 N 0 0 0 0 0 0 0 0 0 0 0 0 8.7919 3.4063 -1.7997 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8586 2.4913 -2.2908 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5503 1.4699 -3.1893 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4904 0.5981 -3.7074 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7937 0.7325 -3.3384 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1417 1.7335 -2.4530 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1782 2.5900 -1.9388 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8158 -0.1111 -3.8235 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0901 -3.9559 -2.0688 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0027 -4.5707 -0.9990 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8367 -2.8814 -2.8630 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8966 -1.4984 -4.4027 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0033 -0.0660 -4.0901 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2903 0.6839 -5.3930 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5129 0.1355 -6.0377 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6193 0.2613 -5.1258 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.5531 -4.0355 -3.0349 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5608 -4.9536 -2.8312 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2583 -5.0604 -1.7789 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9620 -5.8532 -3.8997 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2595 0.7736 -2.2174 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4130 1.1487 -3.3658 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0013 0.8708 -4.7360 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0294 1.3449 -5.8260 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6754 1.1073 -7.1084 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.5714 -0.0133 0.9354 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.2420 0.6684 2.0677 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5811 -0.0005 2.9596 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5693 2.0920 2.3139 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6513 2.7367 3.2101 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.8507 4.0309 3.7744 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8665 4.6904 3.4444 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7464 2.8330 1.0168 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6707 2.2805 0.1656 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7142 0.7937 -6.6235 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9938 1.6839 -7.5774 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7663 4.5123 -4.7633 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4970 5.5697 -5.7416 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7889 5.1718 -6.9465 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7359 3.9539 -7.2114 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1749 6.0878 -7.8161 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3641 0.0258 9.8899 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3379 -0.9226 10.4773 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3044 -1.5436 9.5212 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1032 -0.1947 11.5544 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0456 -4.7616 10.9927 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6340 -2.0232 10.0713 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0518 -3.7378 8.7764 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2016 -4.1799 8.2123 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0756 -9.8085 4.6988 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1037 -8.4655 3.5089 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0804 -8.0540 5.3238 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2939 -9.9037 4.5307 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3656 -8.4081 3.5885 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7228 -8.4053 5.6200 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6691 -9.6013 7.1964 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0756 -8.8414 7.0693 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4992 -7.9534 7.8220 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4496 -6.2744 5.6097 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5574 -5.7110 7.7820 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7051 -5.6152 9.5903 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4182 -4.3437 8.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8835 -3.7494 11.3012 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8813 -2.9727 11.1556 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0371 -4.9511 9.1432 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9650 -1.4496 10.1449 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0217 -0.8495 7.9622 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6681 1.5535 7.1337 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9644 2.2984 7.1121 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7315 3.2537 8.4694 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6881 2.6287 5.4468 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3169 5.4585 5.2980 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4642 4.4347 3.0687 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8414 5.3925 4.4184 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7574 5.4869 -0.0795 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3755 5.0833 -0.7425 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5038 7.1022 -1.8280 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7171 5.8979 -2.1772 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9843 6.4544 -0.4929 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9337 7.7430 -1.7382 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7909 4.9389 -3.5844 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1597 3.3664 -3.1627 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4645 1.5037 -4.7276 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7180 0.1475 -6.5243 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3227 -2.2078 -6.0589 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1214 -2.1890 -3.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4292 -3.1795 -3.2496 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7400 -4.4914 -4.2630 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6089 -1.4067 0.9171 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0147 -0.9974 -0.7196 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2426 -1.9835 1.5102 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3459 0.1193 -0.1387 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0855 -1.1034 -2.8683 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5544 -1.6554 -3.7895 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0525 -2.7451 -1.4415 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2657 -2.6141 -1.6498 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3918 -3.4552 -4.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4517 -2.3824 -3.3042 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2685 -4.3345 -1.0159 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1638 -0.8673 -1.2370 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3314 -0.2493 1.0678 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1853 -0.8683 1.8678 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0478 0.1519 2.7687 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3975 -2.9586 2.1349 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8142 -2.7429 1.0705 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0233 -4.5219 2.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6486 -6.7449 3.6759 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4650 -5.7525 1.1980 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8937 -8.6825 0.9876 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1771 -7.9237 0.1565 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3230 -9.3672 -0.6163 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5391 -6.5130 -1.7435 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8198 -8.1280 -2.5280 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4251 -6.7110 -2.4539 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6774 -8.4593 -2.8834 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5379 -10.1320 -0.7982 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0027 -8.5378 -0.2943 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8365 -6.7121 -1.3187 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1342 -7.6334 -4.1822 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1358 -5.8388 -5.3283 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9790 -3.6104 -3.4182 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7380 -3.9463 -5.2079 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7271 -6.1189 -5.4109 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1015 -5.6904 -7.0645 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2147 -6.8142 -6.3046 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7047 -4.7941 -7.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1287 -4.0385 -7.6979 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3954 -3.1297 -6.7680 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4517 -9.1506 -0.7026 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8368 -8.1599 -1.3832 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7513 -11.2797 -1.8981 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6068 -12.5861 -3.9371 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3673 -12.0779 -6.0080 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8882 -10.4291 -6.9676 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1102 -8.2309 -5.8812 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8716 -7.7710 -3.7717 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5243 -9.1214 -3.4963 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9667 -10.8322 -3.1331 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7555 -10.2845 -1.4453 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7714 -11.7053 -2.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9252 -10.3593 -3.3386 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0124 -11.5898 -2.4573 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3592 -11.9189 -4.8935 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7552 -10.5900 -5.2468 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2976 -12.1032 -4.2972 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1697 1.2701 -1.5037 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8857 2.8853 0.2661 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5824 5.5807 -0.1615 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7970 6.0707 0.9745 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4072 8.5915 1.1546 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1171 10.7850 0.7131 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5303 11.5061 -2.5687 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5787 11.4622 -3.8818 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3628 9.7876 -3.3117 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8933 10.9082 -3.5080 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4901 12.3848 -0.9510 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8774 11.6579 1.7650 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1224 12.8500 0.4770 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9960 12.4522 2.3287 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5901 12.4916 0.6077 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3595 10.3447 1.0861 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2158 10.1658 2.5198 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7294 9.0738 1.1948 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3788 8.1788 1.0383 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1228 12.0219 -3.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6388 13.7294 -2.9619 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7093 12.5793 -1.6187 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7430 14.1117 -1.4069 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5444 14.4086 -3.8780 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8695 13.3395 -3.8725 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2973 14.3912 -1.1409 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7725 14.3932 -2.1067 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5363 15.6661 -2.3562 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5292 9.8065 -1.7604 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3713 10.0847 -0.2070 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6335 12.1602 -1.8061 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4512 12.4897 -3.1236 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6687 7.3650 2.7243 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4554 5.7817 2.8190 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9796 7.5737 3.3340 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7083 8.4458 1.8341 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8464 7.4031 2.0411 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1217 6.8097 0.5734 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2183 4.6002 1.6446 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6405 6.3602 5.0530 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5272 3.2451 3.8226 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9642 4.1678 5.3006 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3248 4.3842 -1.6146 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1105 3.5540 -2.6789 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5327 1.3652 -3.4834 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2263 -0.2054 -4.4089 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1972 1.8305 -2.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5330 3.3544 -1.2482 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7342 0.2235 -4.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8446 -4.7507 -2.8120 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7056 -5.2597 -1.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6206 -3.7358 -0.5878 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4288 -5.1037 -0.2532 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9243 -2.9979 -2.7931 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5745 -1.8645 -2.5381 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5987 -2.9644 -3.9427 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2019 -1.5991 -5.2921 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9114 -1.8391 -4.8041 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0794 0.3924 -3.7080 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8778 0.1312 -3.4241 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3778 1.7827 -5.1888 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3889 0.5366 -6.0415 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7102 0.7089 -6.9905 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4005 -0.8974 -6.3584 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5056 -0.2090 -5.4351 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7703 1.2752 -4.9763 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7436 -3.9017 -4.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4477 -4.3488 -2.5159 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3711 -6.7779 -3.7129 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8031 -5.5076 -4.8981 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2650 1.2963 -2.3710 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8037 1.2259 -1.2850 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2624 2.2677 -3.3466 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4256 0.6328 -3.3471 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9111 1.4783 -4.9099 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1625 -0.2017 -4.8812 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0994 0.7189 -5.8309 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8204 2.4180 -5.7609 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2672 1.9215 -7.3898 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9956 0.9476 -7.8676 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9638 0.5026 0.1006 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6009 2.1507 2.7806 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7950 2.2311 3.4512 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8041 3.0005 0.4494 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2273 3.8474 1.2880 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6135 2.4399 0.3779 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8498 0.9993 -5.9875 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4771 -0.2036 -7.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3486 1.7568 -8.2909 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2982 3.6827 -5.3670 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5445 4.8028 -4.0379 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5364 5.9205 -6.0874 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1011 6.5170 -5.2838 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5768 5.7926 -8.5562 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7278 0.4155 10.6772 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9115 0.8549 9.3638 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6888 -1.7623 10.9185 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6025 -2.5845 9.7966 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2766 -0.9663 9.5440 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9388 -1.5547 8.5034 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3050 -0.8477 12.4052 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4860 0.6838 11.9307 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0022 0.2363 11.0633 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9033 -4.1823 11.9054 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8326 -5.8430 11.0774 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0841 -4.6449 10.6475 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0832 -1.6332 10.8148 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2149 -1.8262 9.0751 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5976 -1.5731 10.2546 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2648 -3.3343 9.8019 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5267 -2.9842 8.1657 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6118 -4.8431 8.8215 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 2 0 43 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 47 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 58 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 62 63 1 0 63 64 1 0 64 65 2 0 64 66 1 0 66 67 1 0 67 68 1 0 68 69 2 0 68 70 1 0 70 71 1 0 71 72 1 0 72 73 2 0 72 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 2 0 81 83 1 0 80 84 1 0 84 85 1 0 85 86 2 0 85 87 1 0 87 88 1 0 88 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 92 93 2 0 92 94 1 0 94 95 1 0 95 96 1 0 96 97 2 0 96 98 1 0 98 99 1 0 99100 1 0 100101 2 0 100102 1 0 102103 1 0 103104 1 0 104105 2 0 102106 1 0 106107 1 0 106108 1 0 98109 1 0 109110 1 0 110111 2 0 111112 1 0 112113 1 0 113114 2 0 114115 1 0 115116 2 0 116117 1 0 117118 2 0 94119 1 0 119120 1 0 119121 1 0 121122 1 0 75123 1 0 123124 2 0 123125 1 0 125126 1 0 126127 1 0 127128 2 0 127129 1 0 129130 1 0 130131 1 0 131132 2 0 131133 1 0 133134 1 0 134135 1 0 135136 2 0 135137 1 0 137138 1 0 138139 1 0 139140 2 0 139141 1 0 141142 1 0 142143 1 0 143144 2 0 143145 1 0 145146 1 0 146147 1 0 147148 1 0 148149 1 0 149150 1 0 150151 2 0 150152 1 0 142153 1 0 153154 1 0 153155 1 0 155156 1 0 134157 1 0 157158 1 0 158159 2 0 158160 1 0 130161 1 0 161162 1 0 162163 1 0 163164 1 0 164165 1 0 165166 2 3 165167 1 0 126168 1 0 168169 1 0 169170 2 0 170171 1 0 171172 2 0 172173 1 0 173174 2 0 172175 1 0 71176 1 0 176177 1 0 176178 1 0 67179 1 0 179180 1 0 180181 1 0 181182 1 0 182183 1 0 63184 1 0 184185 1 0 185186 2 0 185187 1 0 59188 1 0 188189 1 0 189190 1 0 190191 1 0 191192 1 0 55193 1 0 193194 1 0 194195 2 0 194196 1 0 196197 1 0 197198 1 0 198199 2 0 196200 1 0 200201 1 0 46202 1 0 202203 1 0 42204 1 0 204205 1 0 205206 1 0 206207 2 0 206208 1 0 21209 1 0 209210 1 0 210211 1 0 210212 1 0 17213 1 0 13214 1 0 9215 1 0 215216 1 0 83 5 1 0 198 29 1 0 152 34 1 0 104 50 1 0 91 87 1 0 118110 1 0 118113 1 0 149145 1 0 174169 1 0 1217 1 0 1218 1 0 1219 1 0 2220 1 0 2221 1 0 3222 1 6 4223 1 0 4224 1 0 4225 1 0 5226 1 6 8227 1 0 9228 1 1 12229 1 0 13230 1 1 16231 1 0 17232 1 6 20233 1 0 21234 1 6 24235 1 0 25236 1 0 25237 1 0 28238 1 0 29239 1 1 30240 1 0 30241 1 0 33242 1 0 33243 1 0 34244 1 6 37245 1 0 38246 1 0 38247 1 0 41248 1 0 42249 1 1 45250 1 0 46251 1 6 49252 1 0 50253 1 1 51254 1 0 51255 1 0 54256 1 0 54257 1 0 55258 1 1 58259 1 0 59260 1 6 62261 1 0 63262 1 1 66263 1 0 67264 1 6 70265 1 0 71266 1 1 74267 1 0 75268 1 1 76269 1 0 76270 1 0 79271 1 0 79272 1 0 80273 1 1 83274 1 0 84275 1 0 87276 1 1 88277 1 0 88278 1 0 89279 1 0 89280 1 0 90281 1 0 90282 1 0 94283 1 1 95284 1 0 98285 1 1 99286 1 0 102287 1 6 103288 1 0 106289 1 0 107290 1 0 107291 1 0 107292 1 0 108293 1 0 108294 1 0 108295 1 0 109296 1 0 109297 1 0 111298 1 0 112299 1 0 114300 1 0 115301 1 0 116302 1 0 117303 1 0 119304 1 6 120305 1 0 120306 1 0 120307 1 0 121308 1 0 121309 1 0 122310 1 0 122311 1 0 122312 1 0 125313 1 0 126314 1 1 129315 1 0 130316 1 1 133317 1 0 134318 1 1 137319 1 0 138320 1 0 138321 1 0 141322 1 0 142323 1 1 146324 1 0 146325 1 0 147326 1 0 147327 1 0 148328 1 0 148329 1 0 149330 1 1 152331 1 0 153332 1 6 154333 1 0 154334 1 0 154335 1 0 155336 1 0 155337 1 0 156338 1 0 156339 1 0 156340 1 0 157341 1 0 157342 1 0 160343 1 0 160344 1 0 161345 1 0 161346 1 0 162347 1 0 162348 1 0 163349 1 0 163350 1 0 164351 1 0 166352 1 0 167353 1 0 167354 1 0 168355 1 0 168356 1 0 170357 1 0 171358 1 0 173359 1 0 174360 1 0 175361 1 0 176362 1 0 177363 1 0 177364 1 0 177365 1 0 178366 1 0 178367 1 0 178368 1 0 179369 1 0 179370 1 0 180371 1 0 180372 1 0 181373 1 0 181374 1 0 182375 1 0 182376 1 0 183377 1 0 183378 1 0 184379 1 0 184380 1 0 187381 1 0 187382 1 0 188383 1 0 188384 1 0 189385 1 0 189386 1 0 190387 1 0 190388 1 0 191389 1 0 191390 1 0 192391 1 0 192392 1 0 193393 1 0 196394 1 1 197395 1 0 200396 1 0 200397 1 0 201398 1 0 202399 1 0 202400 1 0 203401 1 0 204402 1 0 204403 1 0 205404 1 0 205405 1 0 208406 1 0 209407 1 0 209408 1 0 210409 1 0 211410 1 0 211411 1 0 211412 1 0 212413 1 0 212414 1 0 212415 1 0 213416 1 0 213417 1 0 213418 1 0 214419 1 0 214420 1 0 214421 1 0 215422 1 0 215423 1 0 216424 1 0 M END

Standard InCHIKey	OEDKDVKQFDPTHK-UBIDWWFKSA-N
Standard InCHI	InChI=1S/C134H208N38O38S6/c1-15-66(10)104-131(208)160-85(54-173)119(196)147-69(13)107(184)146-70(14)108(185)153-80(45-63(4)5)109(186)143-52-99(180)149-89-58-212-211-57-88-111(188)145-51-98(179)148-79(38-39-101(182)183)114(191)158-86(55-174)120(197)162-92-61-215-213-59-90(161-121(198)87(56-175)159-122(89)199)123(200)152-76(29-20-22-40-135)112(189)156-84(49-97(138)178)117(194)150-77(30-21-23-41-136)115(192)167-103(65(8)9)130(207)165-91(60-214-216-62-93(126(203)169-104)164-128(205)95-33-26-44-172(95)133(210)106(68(12)17-3)170-118(195)82(157-129(206)102(64(6)7)168-125(92)202)47-72-50-142-75-28-19-18-27-74(72)75)124(201)154-81(46-71-34-36-73(176)37-35-71)116(193)151-78(31-24-42-141-134(139)140)113(190)155-83(48-96(137)177)110(187)144-53-100(181)166-105(67(11)16-2)132(209)171-43-25-32-94(171)127(204)163-88/h18-19,27-28,34-37,50,63-70,76-95,102-106,142,173-176H,15-17,20-26,29-33,38-49,51-62,135-136H2,1-14H3,(H2,137,177)(H2,138,178)(H,143,186)(H,144,187)(H,145,188)(H,146,184)(H,147,196)(H,148,179)(H,149,180)(H,150,194)(H,151,193)(H,152,200)(H,153,185)(H,154,201)(H,155,190)(H,156,189)(H,157,206)(H,158,191)(H,159,199)(H,160,208)(H,161,198)(H,162,197)(H,163,204)(H,164,205)(H,165,207)(H,166,181)(H,167,192)(H,168,202)(H,169,203)(H,170,195)(H,182,183)(H4,139,140,141)/t66-,67-,68-,69-,70-,76-,77-,78-,79-,80-,81-,82-,83-,84-,85-,86-,87-,88-,89-,90-,91-,92-,93-,94-,95-,102-,103-,104-,105-,106-/m0/s1
SMILES	CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H]4CSSC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@@H](C(=O)N1)NC(=O)[C@@H]5CCCN5C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC4=O)C(C)C)CC6=CNC7=CC=CC=C76)[C@@H](C)CC)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N8CCC[C@H]8C(=O)N3)[C@@H](C)CC)CC(=O)N)CCCNC(=N)N)CC9=CC=C(C=C9)O)C(C)C)CCCCN)CC(=O)N)CCCCN)NC(=O)[C@@H](NC2=O)CO)CO)CCC(=O)O)CC(C)C)C)C)CO

Calculated Properties

Physi-Chem Properties

Molecular Weight:	3149.38	Volume:	3004.075 ? Van der Waals volume.
Dense:	1.048	LogP:	-1.312 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.1 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.722 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	37.0	Rigid Bonds:	163.0
TPSA:	1189.55 ? Topological Polar Surface Area.	H-Bond Acceptor:	76.0
H-Bond Donor:	46.0	Rings:	9.0
Heavy Atoms:	82.0

MedChem Properties

QED Drug-Likeness Score:	0.011	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	9.767	Fsp³:	0.642
MCE-18:	341.564 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.675	Fluc inhibitor:	0.047 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.336 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.667 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.77	Promiscuous compounds:	0.194

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.242	MDCK Permeability:	-5.246
Pgp-inhibitor:	0.977	Pgp-substrate:	0.902
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.027
Plasma Protein Binding (PPB):	-47.802%	Volume Distribution (VD):	-0.932
Fu:	259.17% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.936

Half-life (T1/2):

10.548

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.0	Drug-induced Liver Injury (DILI):	0.0
AMES Toxicity:	0.001	Rat Oral Acute Toxicity:	0.012
Maximum Recommended Daily Dose:	0.039	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	1.0	Ototoxicity:	1.0
Hematotoxicity:	0.0	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.064
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.0
BCF:	0.121 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.618 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.754 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.403 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33585	Palicourea condensata	Species	Rubiaceae	Eukaryota	Bark	Pastaza, Ecuador	1988-MAR	PMID[11430013]
NPO33585	Palicourea condensata	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	3
MIC	4
IC50	1

Activity Type	# Activity
Organism	8

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT3153	Organism	Kluyveromyces marxianus	Kluyveromyces marxianus	MIC	=	18600	nM	PMID[20718473]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	50	nM	PMID[11430013]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	40	nM	PMID[11678673]
NPT766	Organism	Proteus vulgaris	Proteus vulgaris	MIC	=	54600	nM	PMID[20718473]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	190	nM	PMID[20718473]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	40	nM	PMID[20718473]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	IC50	=	500	nM	PMID[20718473]
NPT186	Organism	Candida tropicalis	Candida tropicalis	MIC	=	19400	nM	PMID[20718473]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477630 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	29109
0.1-0.2	19669
0.2-0.3	830
0.3-0.4	165
0.4-0.5	23
0.5-0.6	29
0.6-0.7	16
0.7-0.8	0
0.8-0.85	6
0.85-0.9	2
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
0.9728	High Similarity	NPC600998
0.9728	High Similarity	NPC611186
0.8844	High Similarity	NPC607485
0.8667	High Similarity	NPC610952
0.8431	Intermediate Similarity	NPC609988
0.8367	Intermediate Similarity	NPC600735
0.8153	Intermediate Similarity	NPC601264
0.8141	Intermediate Similarity	NPC477638
0.8077	Intermediate Similarity	NPC477631
0.8065	Intermediate Similarity	NPC477639
0.7917	Intermediate Similarity	NPC610704
0.7821	Intermediate Similarity	NPC609634
0.7736	Intermediate Similarity	NPC610535
0.7683	Intermediate Similarity	NPC610817
0.7195	Intermediate Similarity	NPC477636
0.7041	Intermediate Similarity	NPC605177
0.7	Intermediate Similarity	NPC611013
0.6894	Remote Similarity	NPC603072
0.6875	Remote Similarity	NPC604370
0.6805	Remote Similarity	NPC600008
0.6805	Remote Similarity	NPC600634
0.6805	Remote Similarity	NPC603103
0.6805	Remote Similarity	NPC604252
0.677	Remote Similarity	NPC610870
0.6609	Remote Similarity	NPC610649
0.6564	Remote Similarity	NPC477637
0.6424	Remote Similarity	NPC606505
0.6424	Remote Similarity	NPC608676
0.625	Remote Similarity	NPC607277
0.6243	Remote Similarity	NPC608521
0.6199	Remote Similarity	NPC601582
0.6199	Remote Similarity	NPC603992
0.6199	Remote Similarity	NPC610984
0.5963	Remote Similarity	NPC603629
0.5963	Remote Similarity	NPC606524
0.5941	Remote Similarity	NPC610756
0.5888	Remote Similarity	NPC607866
0.5843	Remote Similarity	NPC607892
0.57	Remote Similarity	NPC605666
0.5636	Remote Similarity	NPC611091
0.5556	Remote Similarity	NPC600192
0.5556	Remote Similarity	NPC611717
0.5519	Remote Similarity	NPC603201
0.5497	Remote Similarity	NPC601051
0.5497	Remote Similarity	NPC609990
0.5449	Remote Similarity	NPC600580
0.5449	Remote Similarity	NPC605764
0.5449	Remote Similarity	NPC605765
0.5445	Remote Similarity	NPC611556
0.5435	Remote Similarity	NPC600257
0.5404	Remote Similarity	NPC607511
0.5385	Remote Similarity	NPC604059
0.5367	Remote Similarity	NPC478028
0.5357	Remote Similarity	NPC604566
0.5341	Remote Similarity	NPC478029
0.5298	Remote Similarity	NPC323927
0.5294	Remote Similarity	NPC601205
0.5263	Remote Similarity	NPC603135
0.5249	Remote Similarity	NPC610355
0.5235	Remote Similarity	NPC604994
0.511	Remote Similarity	NPC601510
0.5033	Remote Similarity	NPC473640

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477630 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5129
0.1-0.2	3916
0.2-0.3	102
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data