Drug Information| Drug ID:   | NPD8097 |
| Drug Name:   | Talaporfin |
| Molecular Formula:   | C38H41N5O9 |
| Canonical SMILES:   | CCC1=C(C)C2=N/C/1=Cc1[nH]c(c(c1C)C(=O)O)/C(=C/1N=C(/C=c/3[nH]/c(=C2)/c(C=C)c3C)[C@H]([C@@H]1CCC(=O)O)C)/CC(=N[C@H](C(=O)O)CC(=O)O)O |
| Standard InCHI:   | "InChI=1S/C38H41N5O9/c1-7-20-16(3)24-12-26-18(5)22(9-10-32(45)46)35(42-26)23(11-31(44)41-30(37(49)50)15-33(47)48)36-34(38(51)52)19(6)27(43-36)14-29-21(8-2)17(4)25(40-29)13-28(20)39-24/h7,12-14,18,22,30,39,43H,1,8-11,15H2,2-6H3,(H,41,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)/b24-12-,25-13-,26-12-,27-14-,28-13-,29-14-,35-23-,36-23-/t18-,22-,30-/m0/s1" |
| Standard InCHIKey:   | VSEIDZLLWQQJGK-WSUYNKMOSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8097Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6327 | NPC195457 |
| Remote Similarity | 0.6327 | NPC560165 |
| Remote Similarity | 0.6327 | NPC602089 |
| Remote Similarity | 0.6263 | NPC547227 |
| Remote Similarity | 0.6122 | NPC516208 |
| Remote Similarity | 0.5825 | NPC509452 |
| Remote Similarity | 0.5769 | NPC572209 |
| Remote Similarity | 0.5607 | NPC268676 |
| Remote Similarity | 0.5607 | NPC574307 |
| Remote Similarity | 0.5514 | NPC187255 |
| Remote Similarity | 0.5514 | NPC587357 |
| Remote Similarity | 0.5413 | NPC85702 |
| Remote Similarity | 0.5413 | NPC597178 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 711.29 |
| ALogP   | 1.1656 |
| MLogP   | 4.1 |
| XLogP   | 3.948 |
| HDA   | 14 |
| HBD   | 7 |
| Rotatable Bonds   | 22 |
| TPSA   | 239.15 |
| RO5 Violation   | 3 |