NPASS drugs

Drug Information

Drug ID:	NPD4897
Drug Name:	LE-SN38
Molecular Formula:	C22H20N2O5
Canonical SMILES:	CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccc(cc4c(c3Cn1c2=O)CC)O
Standard InCHI:	"InChI=1S/C22H20N2O5/c1-3-12-13-7-11(25)5-6-17(13)23-19-14(12)9-24-18(19)8-16-15(20(24)26)10-29-21(27)22(16,28)4-2/h5-8,25,28H,3-4,9-10H2,1-2H3/t22-/m0/s1"
Standard InCHIKey:	FJHBVJOVLFPMQE-QFIPXVFZSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD4897

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	83552
0.1-0.2	123689
0.2-0.3	4466
0.3-0.4	10
0.4-0.5	2
0.5-0.6	8
0.6-0.7	6
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC276661
High Similarity	1.0	NPC599818
Intermediate Similarity	0.7436	NPC316181
Intermediate Similarity	0.7436	NPC151781
Intermediate Similarity	0.7436	NPC599830
Remote Similarity	0.6988	NPC74562
Remote Similarity	0.6386	NPC267229
Remote Similarity	0.6071	NPC192674
Remote Similarity	0.6071	NPC599867
Remote Similarity	0.6024	NPC129909
Remote Similarity	0.6024	NPC606011
Remote Similarity	0.596	NPC197381
Remote Similarity	0.5952	NPC106338
Remote Similarity	0.5952	NPC303320
Remote Similarity	0.5952	NPC541875
Remote Similarity	0.5952	NPC608071
Remote Similarity	0.5814	NPC128115
Remote Similarity	0.5814	NPC42856
Remote Similarity	0.5341	NPC90909

Drug Structure

NPD4897 OpenBabel08211706322D 31 35 0 0 1 0 0 0 0 0999 V2000 -6.6610 -2.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3642 2.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8770 -1.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3476 2.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3951 0.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5553 1.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5556 -0.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5183 1.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1980 -0.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8398 -0.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3953 0.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8768 -0.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7158 0.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0370 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6794 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6792 0.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7156 0.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3580 0.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0368 0.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5187 -0.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0002 0.9696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8394 1.4546 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8764 1.4553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3582 0.0007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -9.2758 -0.5065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5187 -1.4841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8807 1.4777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3309 2.3349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2760 -1.5231 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8391 3.2154 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 4 1 0 0 0 0 3 12 1 0 0 0 0 5 6 2 0 0 0 0 5 11 1 0 0 0 0 6 17 1 0 0 0 0 7 11 2 0 0 0 0 7 13 1 0 0 0 0 8 16 1 0 0 0 0 8 18 2 0 0 0 0 9 14 1 0 0 0 0 9 24 1 0 0 0 0 10 15 1 0 0 0 0 10 29 1 0 0 0 0 11 25 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 17 1 0 0 0 0 14 19 2 0 0 0 0 15 16 2 0 0 0 0 15 20 1 0 0 0 0 16 22 1 0 0 0 0 17 23 2 0 0 0 0 18 19 1 0 0 0 0 18 24 1 0 0 0 0 19 23 1 0 0 0 0 20 24 1 0 0 0 0 20 26 2 0 0 0 0 21 22 1 0 0 0 0 21 27 2 0 0 0 0 21 29 1 0 0 0 0 22 4 1 1 0 0 0 22 28 1 0 0 0 0 25 30 1 0 0 0 0 28 31 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC001345; DIB003830
DrugBank	DB05482
ChEMBL	CHEMBL837
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	104842
ChEBI	8988
CAS Number	86639-52-3

Drug Properties

Molecular Weight	392.14
ALogP	-1.7404
MLogP	3.11
XLogP	1.851
HDA	6
HBD	2
Rotatable Bonds	6
TPSA	99.96
RO5 Violation	0