Natural Product: NPC129909| Natural Product ID | NPC129909 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Camptothecin |
| IUPAC Name | n.a. |
| Synonyms | NSC-94600 |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL65 |
| PubChem CID |
24360 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | VSJKWCGYPAHWDS-FQEVSTJZSA-N |
| Standard InCHI | InChI=1S/C20H16N2O4/c1-2-20(25)14-8-16-17-12(7-11-5-3-4-6-15(11)21-17)9-22(16)18(23)13(14)10-26-19(20)24/h3-8,25H,2,9-10H2,1H3/t20-/m0/s1 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccccc4cc3Cn1c2=O |
  Calculated Properties| Molecular Weight:   | 348.11 | Volume:   | 345.12 Van der Waals volume.
|
| Dense:   | 1.009 | LogP:   | 1.442 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 1.799 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -3.392 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 1.0 | Rigid Bonds:   | 27.0 |
| TPSA:   | 81.42 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 6.0 |
| H-Bond Donor:   | 1.0 | Rings:   | 5.0 |
| Heavy Atoms:   | 6.0 |
| QED Drug-Likeness Score:   | 0.533 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 3.176 | Fsp3:   | 0.25 |
| MCE-18:   | 90.72 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.327 | Fluc inhibitor:   | 0.709 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.988 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.213 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.005 | Promiscuous compounds:   | 0.609 |
| Caco-2 Permeability:   | -5.091 | MDCK Permeability:   | -4.676 |
| Pgp-inhibitor:   | 0.007 | Pgp-substrate:   | 0.844 |
| PAMPA:   |
0.992 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.0 |
| 20% Bioavailability (F20%):   | 0.067 | 30% Bioavailability (F30%):   | 0.043 |
| 50% Bioavailability (F50%):   | 0.923 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.491 | MRP1:   | 0.603 |
| Plasma Protein Binding (PPB):   | 98.887% | Volume Distribution (VD):   | -0.366 |
| Fu: |
0.483% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.703 |
| OATP1B3 inhibitor:   | 0.124 | BCRP inhibitor:   | 0.99 |
| BSEP inhibitor:   | 0.996 |
| CYP1A2-inhibitor:   | 0.713 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.004 | CYP2C19-substrate:   | 0.001 |
| CYP2C9-inhibitor:   | 0.004 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.249 |
| CYP3A4-inhibitor:   | 0.751 | CYP3A4-substrate:   | 0.0 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.772 |
| HLM stability:   |
0.914 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 6.248 | Half-life (T1/2):   | 1.497 |
| hERG Blockers:   | 0.091 | hERG Blockers (10um):   | 0.204 |
| Human Hepatotoxicity (H-HT):   | 0.974 | Drug-induced Liver Injury (DILI):   | 0.849 |
| AMES Toxicity:   | 0.977 | Rat Oral Acute Toxicity:   | 0.729 |
| Maximum Recommended Daily Dose:   | 0.99 | Skin Sensitization:   | 0.941 |
| Carcinogencity:   | 0.988 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.008 | Respiratory Toxicity:   | 0.196 |
| Drug-induced Neurotoxicity:   | 0.971 | Ototoxicity:   | 0.698 |
| Hematotoxicity:   | 0.978 | Drug-induced Nephrotoxicity:   | 0.995 |
| Genotoxicity:   | 1.0 | RPMI-8226 Immunitoxicity:   | 0.68 |
| A549 Cytotoxicity:   | 0.41 | Hek293 Cytotoxicity:   | 0.925 |
| BCF:   |
1.14 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
4.13 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
5.114 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.849 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO29447 | Cladosporium cladosporioides | Species | Cladosporiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[ 18480899] |
| NPO64709 | Nothapodytes foetida + Neurospora sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 18669267] |
| NPO64713 | Camptotheca acuminata + Fusarium solani symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 19119919] |
| NPO64897 | Camptotheca acuminata + Aspergillus sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 19119919] |
| NPO64882 | Nothapodytes foetida + Nodulisporium sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 19521920] |
| NPO64788 | Apodytes dimidiata + Fusarium solani symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 19863979] |
| NPO64626 | Camptotheca acuminata + Xylaria sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 20112128] |
| NPO64635 | Miquelia dentata + Alternaria alternata symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 23273751] |
| NPO64939 | Miquelia dentata + Fomitopsis sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 23273751] |
| NPO64779 | Miquelia dentata + Phomopsis sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 23273751] |
| NPO64624 | Camptotheca acuminata + Botryosphaeria dothidea symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 23579767] |
| NPO64898 | Camptotheca acuminata + Trichoderma atroviride symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 23949997] |
| NPO64807 | Nothapodytes foetida + Fusarium oxysporum symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 24840354] |
| NPO64630 | Nothapodytes foetida + Entrophospora infrequens symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64965 | Camptotheca acuminata + Valsa mali symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64955 | Nothapodytes nimmoniana + Botryosphaeria parva symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64848 | Nothapodytes nimmoniana + Diaporthe conorum symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64843 | Nothapodytes nimmoniana + Fusarium oxysporum symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64726 | Nothapodytes nimmoniana + Fusarium sacchari symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64648 | Nothapodytes nimmoniana + Fusarium solani symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64974 | Nothapodytes nimmoniana + Fusarium subglutinans symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64959 | Nothapodytes nimmoniana + Fusarium verticillioides symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64763 | Nothapodytes nimmoniana + Galactomyces sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64636 | Nothapodytes nimmoniana + Irpex lacteus symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64725 | Nothapodytes nimmoniana + Phomopsis sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO64975 | Nothapodytes nimmoniana + Fusarium sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 33477910] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | leaf | n.a. | DOI[10.1016/0040-4020(73)80248-0] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | leaf | n.a. | DOI[10.1016/j.tet.2004.10.110] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | twig | n.a. | DOI[10.1016/j.tet.2004.10.110] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1111/j.1399-3054.2000.1100409.x] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10075754] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | root bark | n.a. | n.a. |
PMID[10346965] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | root | n.a. |
PMID[10617409] |
| NPO3754 | Ocotea leucoxylon | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10691712] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | West Pacific Ocean | n.a. |
PMID[11087588] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[11087588] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | root | n.a. |
PMID[11170658] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[11170658] |
| NPO20097 | Thermobifida alba | Species | Nocardiopsaceae | Bacteria | n.a. | n.a. | n.a. |
PMID[11430001] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[11575966] |
| NPO14392 | Caesalpinia minax | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[11678648] |
| NPO18349 | Casearia sylvestris | Species | Salicaceae | Eukaryota | Leaves; Twigs | n.a. | n.a. |
PMID[11858737] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12398531] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | leaves and twigs | n.a. | n.a. |
PMID[12502326] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | root | n.a. |
PMID[12560037] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[14510600] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15679325] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | twig | n.a. |
PMID[15679325] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[15679325] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[16499329] |
| NPO15805 | Didymochlaena truncatula | Species | Didymochlaenaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[16499333] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | fruit | n.a. |
PMID[18020353] |
| NPO40910 | Pithecellobium lucidum | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[18095653] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18161942] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18220355] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18774864] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | Root bark | Central Africa | n.a. |
PMID[19299148] |
| NPO11917 | Asterospicularia laurae | Species | Xeniidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19863101] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | Vietnamese | n.a. |
PMID[19899773] |
| NPO11919 | Hyrtios reticulatus | Species | Thorectidae | Eukaryota | n.a. | Papua New Guinea | n.a. |
PMID[20000782] |
| NPO7122 | Fusarium solani | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21348469] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | xylem | n.a. |
PMID[21348469] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22085418] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[22085418] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22197145] |
| NPO40692 | Stylissa cf. massa | Strain | Axinellidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22376176] |
| NPO11919 | Hyrtios reticulatus | Species | Thorectidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22695182] |
| NPO13214 | Ipomoea alba | Species | Convolvulaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[22924480] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22934600] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | whole plants | Vietnam | 2009-Aug |
PMID[23347584] |
| NPO27632 | Idesia polycarpa | Species | Salicaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23628332] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | whole plant | n.a. |
PMID[23678820] |
| NPO14392 | Caesalpinia minax | Species | Fabaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[23806110] |
| NPO14392 | Caesalpinia minax | Species | Fabaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[24303808] |
| NPO40470 | Zuelania guidonia | Species | Salicaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24484281] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[24593048] |
| NPO7122 | Fusarium solani | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25163667] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25594733] |
| NPO13214 | Ipomoea alba | Species | Convolvulaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[28006904] |
| NPO7122 | Fusarium solani | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28257197] |
| NPO40268 | Penicillium concentricum | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28409637] |
| NPO40283 | Phaeoacremonium sp. | Species | Togniniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28425292] |
| NPO1692 | Aquilaria malaccensis | Species | Thymelaeaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[28445049] |
| NPO40300 | Poupartia borbonica | Species | Anacardiaceae | Eukaryota | Leaves | n.a. | n.a. |
PMID[28557449] |
| NPO1692 | Aquilaria malaccensis | Species | Thymelaeaceae | Eukaryota | Agarwood | n.a. | n.a. |
PMID[29083898] |
| NPO24447 | Thalictrum cultratum | Species | Ranunculaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[29131616] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[30543429] |
| NPO1692 | Aquilaria malaccensis | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30672698] |
| NPO41068 | Tolypocladium sp. XL115 | Strain | Ophiocordycipitaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30702286] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[30848923] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[35108453] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[36903935] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37047195] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37179510] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[3735324] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38263385] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38380569] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[39592457] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[4954818] |
| NPO4695 | Ervatamia heyneana | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[521817] |
| NPO1692 | Aquilaria malaccensis | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7320738] |
| NPO40919 | Rutaceae sp. | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[8021652] |
| NPO28686 | Syzygium claviflorum | Species | Myrtaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[8176401] |
| NPO29177 | Crescentia cujete | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8254347] |
| NPO29196 | Cryptocarya kurzii | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8377019] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | Leaves | n.a. | n.a. |
PMID[8864235] |
| NPO40349 | Solanum umbelliferum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8882430] |
| NPO40184 | Leishmania donovani | Species | Trypanosomatidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8984149] |
| NPO582 | Trichilia emetica | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9514005] |
| NPO7122 | Fusarium solani | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[Article] |
| NPO11917 | Asterospicularia laurae | Species | Xeniidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28893 | Diphasia klaineana | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18349 | Casearia sylvestris | Species | Salicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5216 | Bacillus pumilus | Species | Bacillaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28818 | Datura quercifolia | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1692 | Aquilaria malaccensis | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29433 | Nephroma arcticum | Species | Nephromataceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO20173 | Aristolochia triangularis | Species | Aristolochiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40910 | Pithecellobium lucidum | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29121 | Trichogonia prancii | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28802 | Pratia nummularia | Species | Campanulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29196 | Cryptocarya kurzii | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7122 | Fusarium solani | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13214 | Ipomoea alba | Species | Convolvulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29507 | Erythroxylum argentinum | Species | Erythroxylaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28686 | Syzygium claviflorum | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29184 | Friesodielsia enghiana | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29177 | Crescentia cujete | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO11919 | Hyrtios reticulatus | Species | Thorectidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14392 | Caesalpinia minax | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40268 | Penicillium concentricum | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9517 | Dictyota ciliolata | Species | Dictyotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29447 | Cladosporium cladosporioides | Species | Cladosporiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO20097 | Thermobifida alba | Species | Nocardiopsaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40283 | Phaeoacremonium sp. | Species | Togniniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO41068 | Tolypocladium sp. XL115 | Strain | Ophiocordycipitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO14392 | Caesalpinia minax | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO20173 | Aristolochia triangularis | Species | Aristolochiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4695 | Ervatamia heyneana | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO28802 | Pratia nummularia | Species | Campanulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28802 | Pratia nummularia | Species | Campanulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO20173 | Aristolochia triangularis | Species | Aristolochiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO14392 | Caesalpinia minax | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29177 | Crescentia cujete | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO24447 | Thalictrum cultratum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4695 | Ervatamia heyneana | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO12582 | Camptotheca acuminata | Species | Nyssaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29274 | Euphorbia sororia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11917 | Asterospicularia laurae | Species | Xeniidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29507 | Erythroxylum argentinum | Species | Erythroxylaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO24447 | Thalictrum cultratum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14392 | Caesalpinia minax | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1692 | Aquilaria malaccensis | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28756 | Malayopython reticulatus | Species | Pythonidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9517 | Dictyota ciliolata | Species | Dictyotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28893 | Diphasia klaineana | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17428 | Mimusops manilkara | Species | Sapotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29447 | Cladosporium cladosporioides | Species | Cladosporiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20391 | Podospora decipiens | Species | Lasiosphaeriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3708 | Junceella fragilis | Species | Ellisellidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13888 | Austrocylindropuntia cylindrica | Species | Cactaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29196 | Cryptocarya kurzii | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13214 | Ipomoea alba | Species | Convolvulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15388 | Eucalyptus globulus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20173 | Aristolochia triangularis | Species | Aristolochiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28818 | Datura quercifolia | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11919 | Hyrtios reticulatus | Species | Thorectidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13851 | Garberia heterophylla | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20097 | Thermobifida alba | Species | Nocardiopsaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16944 | Schizopelte californica | Species | Opegraphaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29167 | Bombus consobrinus | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18941 | Teucrium canadense | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5216 | Bacillus pumilus | Species | Bacillaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29076 | Iris versicolor | Species | Iridaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1666 | Radopholus similis | Species | Pratylenchidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28879 | Dorstenia cayapia | Species | Moraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28802 | Pratia nummularia | Species | Campanulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20915 | Hippospongia gossypina | Species | Spongiidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28686 | Syzygium claviflorum | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27632 | Idesia polycarpa | Species | Salicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29062 | Hibiscus syriacus | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29433 | Nephroma arcticum | Species | Nephromataceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22879 | Croton tonkinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7122 | Fusarium solani | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3754 | Ocotea leucoxylon | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29177 | Crescentia cujete | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29184 | Friesodielsia enghiana | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15805 | Didymochlaena truncatula | Species | Didymochlaenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29121 | Trichogonia prancii | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11554 | Taxus sumatrana | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4386 | Strychnos icaja | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18349 | Casearia sylvestris | Species | Salicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO582 | Trichilia emetica | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 50.0 | % | PMID[15177438] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 25.0 | % | PMID[8676340] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Change | = | 6.0 | % | PMID[8676340] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Change | = | 12.0 | % | PMID[8676340] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Change | = | 9.0 | % | PMID[8676340] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Change | = | 3.0 | % | PMID[8676340] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Change | = | 7.0 | % | PMID[8676340] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 700.0 | nM | PMID[9003520] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Relaxed DNA | = | 64.0 | % | PMID[9876111] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 679.0 | nM | PMID[7853331] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Ratio | = | 0.39 | n.a. | PMID[9632364] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | CC50 | = | 820.0 | nM | PMID[1846923] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 127000.0 | nM | PMID[7699697] |
| NPT12 | Individual protein | Human immunodeficiency virus type 1 integrase | Human immunodeficiency virus 1 | IC50 | > | 100000.0 | nM | PMID[9767632] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 0.77 | n.a. | PMID[12873503] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Inhibition | = | 23.0 | % | PMID[11334569] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Stimulation | = | 8.2 | n.a. | PMID[10841808] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | REC | = | 0.5 | n.a. | PMID[12747798] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | MIC | = | 10.0 | nM | PMID[8246238] |
| NPT322 | Individual protein | DNA topoisomerase II beta | Homo sapiens | MIC | > | 100000.0 | nM | PMID[8246238] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 680.0 | nM | PMID[8410981] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 100.0 | % | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 36.0 | % | DOI[10.1016/S0960-894X(97)00398-3] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | CC50 | = | 800.0 | nM | PMID[2537428] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Effect | = | 2.0 | % | PMID[15664863] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Effect | = | 96.0 | % | PMID[15664863] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Effect | = | 84.0 | % | PMID[15664863] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | EC50 | = | 350.0 | nM | PMID[15454230] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | K app | = | 0.14 | 1/min | PMID[15454230] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | REC | = | 1.0 | n.a. | PMID[15482929] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Cleavage | = | 325.0 | % | PMID[16033260] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 300.0 | nM | PMID[15801827] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 100.0 | uM | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 47.0 | % | PMID[17035025] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Fluorescence intensity | = | 2.51 | n.a. | PMID[17411092] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Fluorescence intensity | = | 1.58 | n.a. | PMID[17411092] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Fluorescence intensity | = | 1.04 | n.a. | PMID[17411092] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Fluorescence intensity | = | 11.39 | n.a. | PMID[17411092] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Activity | = | 4.7 | % | PMID[17658776] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Activity | = | 9.5 | % | PMID[17658776] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Activity | = | 32.9 | % | PMID[17658776] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Activity | = | 43.1 | % | PMID[17658776] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 77.0 | % | PMID[17194596] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | EC50 | = | 2.1 | nM | PMID[17287122] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 0.2 | n.a. | PMID[19299037] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 90.0 | % | PMID[10691712] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 4000.0 | nM | PMID[11430001] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 17000.0 | nM | PMID[11430001] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 9000.0 | nM | PMID[11430001] |
| NPT1044 | Individual protein | DNA topoisomerase II alpha | Homo sapiens | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT144 | Individual protein | Telomerase reverse transcriptase | Homo sapiens | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC10 | = | 0.2 | nM | PMID[18676151] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[15974606] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 86.2 | % | PMID[19345580] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 100.0 | % | PMID[27070999] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 84.0 | % | PMID[19715319] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 75.5 | % | PMID[20093033] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 78.3 | % | PMID[20093033] |
| NPT1044 | Individual protein | DNA topoisomerase II alpha | Homo sapiens | Inhibition | = | 40.0 | % | PMID[20006518] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 39.5 | % | PMID[20188578] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 75.3 | % | PMID[20188578] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 41.2 | % | PMID[19939682] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 79.0 | % | PMID[19939682] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 67.1 | % | PMID[19836231] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 84.5 | % | PMID[19836231] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 68.8 | % | PMID[20392646] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 40.3 | % | PMID[20392646] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | FC | = | 1.0 | n.a. | PMID[20392545] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 2200.0 | nM | PMID[20662543] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 85.0 | % | PMID[20662543] |
| NPT163 | Individual protein | Nuclear factor NF-kappa-B p105 subunit | Homo sapiens | Potency | = | 4466.8 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 7943.3 | nM | PubChem BioAssay data set |
| NPT1197 | Individual protein | Huntingtin | Homo sapiens | Potency | = | 5623.4 | nM | PubChem BioAssay data set |
| NPT2930 | Individual protein | Hemoglobin beta chain | Homo sapiens | Potency | = | 5.0 | nM | PubChem BioAssay data set |
| NPT210 | Individual protein | Thyroid stimulating hormone receptor | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT211 | Individual protein | Hypoxia-inducible factor 1 alpha | Homo sapiens | Potency | = | 79.4 | nM | PubChem BioAssay data set |
| NPT211 | Individual protein | Hypoxia-inducible factor 1 alpha | Homo sapiens | Potency | = | 125.9 | nM | PubChem BioAssay data set |
| NPT2930 | Individual protein | Hemoglobin beta chain | Homo sapiens | Potency | = | 1000.0 | nM | PubChem BioAssay data set |
| NPT150 | Individual protein | Anthrax lethal factor | Bacillus anthracis | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 3981.1 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 6309.6 | nM | PubChem BioAssay data set |
| NPT2944 | Individual protein | Relaxin receptor 1 | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | = | 316.2 | nM | PubChem BioAssay data set |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 64.3 | % | PMID[21115246] |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 366.3 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 2059.6 | nM | PubChem BioAssay data set |
| NPT135 | Individual protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 50118.7 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 7307.8 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | AC50 | = | 6309.57 | nM | PubChem BioAssay data set |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | AC50 | = | 19952.62 | nM | PubChem BioAssay data set |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 1584.89 | nM | PubChem BioAssay data set |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 2511.89 | nM | PubChem BioAssay data set |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 69.15 | % | PMID[21419530] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 58.0 | % | PMID[26022080] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 20.9 | % | PMID[26022080] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 95.0 | % | PMID[22698783] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | IC50 | = | 970.0 | nM | DrugMatrix in vitro pharmacology data |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | Ki | = | 617.0 | nM | DrugMatrix in vitro pharmacology data |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 27.0 | % | PMID[22305342] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 26.0 | % | PMID[22305342] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 59.9 | % | PMID[22318164] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | > | 95.0 | % | PMID[22698783] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 60.0 | % | PMID[22698783] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 46.6 | % | PMID[22503656] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 23.1 | % | PMID[22503656] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 3750.0 | nM | DOI[10.1007/s00044-009-9233-5] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 4950.0 | nM | DOI[10.1007/s00044-009-9233-5] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 4750.0 | nM | DOI[10.1007/s00044-009-9233-5] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 0.77 | % | PMID[23578545] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 37.2 | % | PMID[23608763] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 70.5 | % | PMID[23608763] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 71.9 | % | PMID[24090914] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 30.6 | % | PMID[24090914] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 26.1 | % | PMID[24013413] |
| NPT105 | Individual protein | Muscleblind-like protein 1 | Homo sapiens | Potency | n.a. | 2511.9 | nM | PubChem BioAssay data set |
| NPT105 | Individual protein | Muscleblind-like protein 1 | Homo sapiens | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 461.1 | nM | PubChem BioAssay data set |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 35.5 | % | PMID[24904965] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 74.0 | % | PMID[24904965] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 65.7 | % | PMID[25062006] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 80.7 | % | PMID[25936262] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 40.8 | % | PMID[25936262] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 44.7 | % | PMID[26361737] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 52.7 | % | PMID[26361737] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 26.9 | % | PMID[26334499] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 70.9 | % | PMID[26334499] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 58.7 | % | PMID[26927425] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 27.6 | % | PMID[26927425] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 34.7 | % | PMID[26945111] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 64.7 | % | PMID[26945111] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 73.6 | % | PMID[26988802] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 24.6 | % | PMID[26988802] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 68.3 | % | PMID[27344492] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 45.2 | % | PMID[27643560] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 19.6 | % | PMID[28462840] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 69.9 | % | PMID[27654394] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 25.1 | % | PMID[27654394] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 79.5 | % | PMID[28063351] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 55.8 | % | PMID[28068603] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 22.0 | % | PMID[28068603] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 40.0 | % | PMID[29290109] |
| NPT1249 | Individual protein | Canalicular multispecific organic anion transporter 2 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | IC50 | = | 7400.0 | nM | PMID[23956101] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 63.0 | % | PMID[28384547] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 21.6 | % | PMID[28384547] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 58.2 | % | PMID[28462840] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 86.8 | % | PMID[28633898] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 45.8 | % | PMID[30262132] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 74.5 | % | PMID[30262132] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 83.9 | % | PMID[29402741] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 45.6 | % | PMID[29402741] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 0.0 | % | PMID[29501943] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 17.0 | % | PMID[29501943] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 61.0 | % | PMID[29501943] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 79.9 | % | PMID[29510948] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 34.3 | % | PMID[29510948] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | FC | = | 2.0 | n.a. | PMID[29519603] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | FC | = | 2.3 | n.a. | PMID[29519603] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | FC | = | 2.5 | n.a. | PMID[29519603] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 66.7 | % | PMID[30253887] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 44.4 | % | PMID[30253887] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 28.5 | % | PMID[29174815] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 25.0 | % | PMID[29174815] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 53.03 | % | PMID[29174815] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 23.8 | % | PMID[29174815] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 25.0 | nM | PMID[30897325] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[30897325] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 27000.0 | nM | PMID[30959322] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 80.0 | % | PMID[31229877] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 76.0 | % | PMID[31229877] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 3.0 | % | PMID[31229877] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 67.5 | % | PMID[31398033] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 38.2 | % | PMID[31398033] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 74.32 | % | PMID[31635931] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 41.0 | % | PMID[31901379] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 48.0 | % | PMID[31901379] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 26.3 | % | PMID[32201190] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 6.0 | % | PMID[32201190] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | = | 2.1 | % | PMID[32201190] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 62900.0 | nM | PMID[33492141] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 33.8 | % | PMID[27707625] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 68.2 | % | PMID[27707625] |
| NPT1044 | Individual protein | DNA topoisomerase II alpha | Homo sapiens | Inhibition | < | 30.0 | % | PMID[27707625] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 62000.0 | nM | PMID[33158579] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 80.0 | % | PMID[33962152] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[33962152] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[33794318] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[34008967] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[35635947] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[37116762] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[34844412] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35396127] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 76.0 | % | PMID[33962152] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[33744440] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 224.0 | nM | PMID[34450497] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 89.43 | % | PMID[34774339] |
| NPT211 | Individual protein | Hypoxia-inducible factor 1 alpha | Homo sapiens | Inhibition | = | 62.3 | % | PMID[34492592] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 76.2 | % | PMID[37418826] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 58.92 | % | PMID[34774339] |
| NPT1044 | Individual protein | DNA topoisomerase II alpha | Homo sapiens | Inhibition | = | 70.16 | % | PMID[35639640] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 80.0 | % | PMID[34952177] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 54.79 | % | PMID[35868003] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[34844412] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | IC50 | = | 2430.0 | nM | PMID[35868003] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 76.0 | % | PMID[34952177] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[34852457] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 91.38 | % | PMID[35396127] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 52.14 | % | PMID[35777102] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[35396127] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 94.25 | % | PMID[35639640] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 47.89 | % | PMID[34990980] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 89.65 | % | PMID[34774339] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[34678573] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 3.0 | % | PMID[33962152] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 74.7 | % | PMID[34678573] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 40.05 | % | PMID[35777102] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 80.2 | % | PMID[34774339] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 25.0 | % | PMID[35413618] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 3.0 | % | PMID[34952177] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[35612499] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | Inhibition | = | 94.38 | % | PMID[35639640] |
| NPT4480 | Individual protein | DNA ligase | Enterobacteria phage T4 | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 25.1 | nM | PubChem BioAssay data set |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 5.6 | nM | PubChem BioAssay data set |
| NPT537 | Individual protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 398.1 | nM | PubChem BioAssay data set |
| NPT537 | Individual protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 46109.1 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 398.1 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 3548.1 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 1122.0 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 316.2 | nM | PubChem BioAssay data set |
| NPT796 | Individual protein | Peripheral myelin protein 22 | Homo sapiens | Potency | = | 239.3 | nM | PubChem BioAssay data set |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 15.8 | nM | PubChem BioAssay data set |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT4487 | Individual protein | Os06g0676700 protein | Oryza sativa Japonica Group | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 4466.8 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 3548.1 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 2238.7 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 56.2 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 79.4 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 631.0 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 501.2 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | n.a. | 14125.4 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | n.a. | 17782.8 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 107.28 | % | PMID[23571415] |
| NPT50 | Individual protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | IC50 | > | 111000.0 | nM | PMID[28418653] |
| NPT4907 | Individual protein | Tyrosyl-DNA phosphodiesterase 2 | Homo sapiens | IC50 | > | 111000.0 | nM | PMID[28418653] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 135000.0 | nM | PMID[20829430] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT4907 | Individual protein | Tyrosyl-DNA phosphodiesterase 2 | Homo sapiens | IC50 | = | 0.0 | nM | PMID[28657311] |
| NPT50 | Individual protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | IC50 | = | 0.0 | nM | PMID[28657311] |
| NPT50 | Individual protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[34008967] |
| NPT317 | Nucleic acid | Nucleic Acid | n.a. | Inhibition | = | 76.0 | % | PMID[2155323] |
| NPT317 | Nucleic acid | Nucleic Acid | n.a. | Inhibition | = | 85.0 | % | PMID[2155323] |
| NPT908 | Individual protein | Ribonuclease pancreatic | Bos taurus | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT4479 | Individual protein | Deoxyribonuclease-2-alpha | Sus scrofa | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT4481 | Individual protein | Type-2 restriction enzyme BamHI | Bacillus amyloliquefaciens | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT4484 | Individual protein | Type-2 restriction enzyme PstI | Providencia stuartii | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 3548.1 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 4466.8 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 104.0 | nM | PubChem BioAssay data set |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 3981.1 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 46.5 | nM | PubChem BioAssay data set |
| NPT96 | Individual protein | Thrombopoietin | Homo sapiens | Potency | = | 125.9 | nM | PubChem BioAssay data set |
| NPT61 | Individual protein | Beta-glucocerebrosidase | Homo sapiens | Potency | n.a. | 7079.5 | nM | PubChem BioAssay data set |
| NPT61 | Individual protein | Beta-glucocerebrosidase | Homo sapiens | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT61 | Individual protein | Beta-glucocerebrosidase | Homo sapiens | Potency | n.a. | 3548.1 | nM | PubChem BioAssay data set |
| NPT61 | Individual protein | Beta-glucocerebrosidase | Homo sapiens | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT800 | Individual protein | M-phase phosphoprotein 8 | Homo sapiens | Potency | n.a. | 100000.0 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 13371.4 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 5323.3 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 2818.4 | nM | PubChem BioAssay data set |
| NPT698 | Individual protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 2667.9 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | 3.9 | % | PMID[23062825] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 74.81 | % | PMID[23571415] |
| NPT589 | Individual protein | Serum albumin | Bos taurus | KSV | = | 3.345 | 10'4L/mol | PMID[25453788] |
| NPT589 | Individual protein | Serum albumin | Bos taurus | KSV | = | 3.626 | 10'4L/mol | PMID[25453788] |
| NPT589 | Individual protein | Serum albumin | Bos taurus | Kq | = | 3.345 | 10'12L/mol/s | PMID[25453788] |
| NPT589 | Individual protein | Serum albumin | Bos taurus | Kq | = | 3.626 | 10'12L/mol/s | PMID[25453788] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT24956 | Single protein | Topoisomerase I | Bos taurus | Inhibition | = | 58.0 | % | PMID[29705710] |
| NPT24956 | Single protein | Topoisomerase I | Bos taurus | Activity | = | 47.0 | % | PMID[29705710] |
| NPT24956 | Single protein | Topoisomerase I | Bos taurus | Activity | = | 49.0 | % | PMID[29705710] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 106.22 | % | DOI[10.6019/CHEMBL4495564] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -49.62 | % | DOI[10.6019/CHEMBL4495564] |
| NPT28442 | Single protein | Nuclear receptor subfamily 4 group A member 2 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[33289551] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -24.82 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -1.11 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT5976 | Individual protein | Cytochrome c oxidase subunit 2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[35868003] |
| NPT4467 | Protein family | Somatostatin receptor | Homo sapiens | IC50 | = | 2.21 | nM | PMID[12617894] |
| NPT4472 | Individual protein | DNA topoisomerase I | Leishmania donovani donovani | Inhibition | = | 55.0 | % | PMID[17444624] |
| NPT4472 | Individual protein | DNA topoisomerase I | Leishmania donovani donovani | Inhibition | = | 39.0 | % | PMID[17444624] |
| NPT4472 | Individual protein | DNA topoisomerase I | Leishmania donovani donovani | Inhibition | = | 65.0 | % | PMID[17444624] |
| NPT4477 | Individual protein | DNA topoisomerase 1 | Chlorocebus aethiops | IC50 | = | 27000.0 | nM | PMID[11430001] |
| NPT4478 | Individual protein | Deoxyribonuclease-1 | Bos taurus | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT459 | Individual protein | Human immunodeficiency virus type 1 reverse transcriptase | Human immunodeficiency virus 1 | IC50 | > | 200.0 | ug.mL-1 | PMID[1710653] |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 35.5 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 31.6 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 28.2 | nM | PubChem BioAssay data set |
| NPT60 | Individual protein | Lysosomal alpha-glucosidase | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT792 | Individual protein | Arachidonate 15-lipoxygenase | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT4446 | Individual protein | Eukaryotic translation initiation factor 2-alpha kinase 3 | Homo sapiens | EC50 | > | 55700.0 | nM | PubChem BioAssay data set |
| NPT583 | Individual protein | Inositol monophosphatase 1 | Rattus norvegicus | Potency | = | 316.2 | nM | PubChem BioAssay data set |
| NPT8 | Individual protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 89125.1 | nM | PubChem BioAssay data set |
| NPT4489 | Individual protein | Heterogeneous nuclear ribonucleoprotein A1 | Homo sapiens | Kd | = | 82.7 | nM | PMID[22071521] |
| NPT4489 | Individual protein | Heterogeneous nuclear ribonucleoprotein A1 | Homo sapiens | Bmax | = | 67.0 | pg/mm2 | PMID[22071521] |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 1778.3 | nM | PubChem BioAssay data set |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 14.05 | % | PMID[23062825] |
| NPT27835 | Single protein | DNA topoisomerase I | Leishmania donovani (strain BPK282A1) | IC50 | = | 21920.0 | nM | PMID[36823782] |
| NPT27835 | Single protein | DNA topoisomerase I | Leishmania donovani (strain BPK282A1) | Activity | n.a. | n.a. | n.a. | PMID[36823782] |
| NPT27835 | Single protein | DNA topoisomerase I | Leishmania donovani (strain BPK282A1) | IC50 | = | 9200.0 | nM | PMID[36823782] |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | -2.253 | % | PMID[38318365] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Log K' | = | 0.08 | n.a. | PMID[11728183] |
| NPT4451 | Individual protein | DNA topoisomerase I | Mus musculus | MIC | = | 86.0 | nM | PMID[10346933] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | K | = | 30.0 | 1/Maa | PMID[8289200] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | K | = | 4700.0 | 1/Maa | PMID[8289200] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Activity | = | 1.8 | n.a. | PMID[8289200] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Activity | = | 2.3 | n.a. | PMID[8289200] |
| NPT4451 | Individual protein | DNA topoisomerase I | Mus musculus | IC50 | = | 40000.0 | nM | PMID[11334569] |
| NPT4476 | Individual protein | DNA topoisomerase | Bos taurus | IC50 | = | 17000.0 | nM | PMID[11430001] |
| NPT4451 | Individual protein | DNA topoisomerase I | Mus musculus | IC50 | = | 12000.0 | nM | PMID[11430001] |
| NPT4482 | Individual protein | Type-2 restriction enzyme EcoRI | Escherichia coli | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT4483 | Individual protein | Type-2 restriction enzyme HindIII | Haemophilus influenzae (strain ATCC 51907 / DSM 11121 / KW20 / Rd) | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT4485 | Individual protein | Type-2 restriction enzyme ScaI | Streptomyces caespitosus | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT536 | Nucleic acid | microRNA 21 | Homo sapiens | Potency | = | 104.0 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 25.1 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 199.5 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 251.2 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 4609.0 | nM | PubChem BioAssay data set |
| NPT443 | Individual protein | Histone acetyltransferase GCN5 | Homo sapiens | Potency | n.a. | 17782.8 | nM | PubChem BioAssay data set |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 44668.4 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 2908.1 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 460.9 | nM | PubChem BioAssay data set |
| NPT4491 | Individual protein | DNA topoisomerase type IB small subunit | Leishmania major | EC50 | = | 670.0 | nM | PMID[22932312] |
| NPT4213 | Individual protein | Serotransferrin | Homo sapiens | KSV | = | 2.624 | 10'4L/mol | PMID[25453788] |
| NPT4213 | Individual protein | Serotransferrin | Homo sapiens | KSV | = | 4.353 | 10'4L/mol | PMID[25453788] |
| NPT21657 | Single protein | DNA topoisomerase I | Bos taurus | Inhibition | > | 90.0 | % | PMID[30543429] |
| NPT21657 | Single protein | DNA topoisomerase I | Bos taurus | Activity | = | 47.0 | % | PMID[30543429] |
| NPT21657 | Single protein | DNA topoisomerase I | Bos taurus | Inhibition | = | 51.0 | % | PMID[30917303] |
| NPT21657 | Single protein | DNA topoisomerase I | Bos taurus | Activity | = | 16.0 | % | PMID[32345458] |
| NPT21657 | Single protein | DNA topoisomerase I | Bos taurus | Activity | = | 18.0 | % | PMID[32345458] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT2182 | Cell line | Mo | Homo sapiens | IC50 | = | 111.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT137 | Cell line | L1210 | Mus musculus | T/C | = | 164.0 | % | PMID[3735324] |
| NPT137 | Cell line | L1210 | Mus musculus | Active dose | = | 2.0 | mg kg-1 | PMID[3735324] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 30.0 | nM | PMID[23578545] |
| NPT137 | Cell line | L1210 | Mus musculus | Treated cells | = | 80.0 | % | PMID[12182872] |
| NPT137 | Cell line | L1210 | Mus musculus | Concentration | = | 0.05 | uM | PMID[12182872] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 32.0 | nM | PMID[10346933] |
| NPT313 | Cell line | P388CPT5 | Mus musculus | IC50 | = | 2800.0 | nM | PMID[10346933] |
| NPT2331 | Cell line | A-427 | Homo sapiens | IC50 | = | 24.0 | nM | PMID[9876111] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 57.0 | nM | PMID[9876111] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 57.0 | nM | PMID[9876111] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3.1 | nM | PMID[9876111] |
| NPT4452 | Cell line | CCD 19Lu | Homo sapiens | IC50 | = | 2.0 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00071-1] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 0.005 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00071-1] |
| NPT4453 | Cell line | Lu-99 cell line | n.a. | IC50 | = | 0.001 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00071-1] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 0.005 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00071-1] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 46.0 | nM | PMID[7853331] |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | IC50 | = | 48.0 | nM | PMID[7853331] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 207.0 | nM | PMID[7853331] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 37.0 | nM | PMID[7853331] |
| NPT934 | Cell line | SK-VLB | Homo sapiens | IC50 | = | 41.0 | nM | PMID[7853331] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 0.00474 | ug.mL-1 | PMID[7932525] |
| NPT4454 | Cell line | HOC-21 cell line | n.a. | IC50 | = | 0.0147 | ug.mL-1 | PMID[7932525] |
| NPT3558 | Cell line | QG-56 | n.a. | IC50 | = | 0.00463 | ug.mL-1 | PMID[7932525] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 7.0 | nM | PMID[12565975] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[12639541] |
| NPT4455 | Cell line | CAKI-2 | Homo sapiens | IC50 | = | 3960.0 | nM | PMID[12639541] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 2530.0 | nM | PMID[12639541] |
| NPT4456 | Cell line | HEC-1B cell line | n.a. | IC50 | = | 8640.0 | nM | PMID[12639541] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 66.0 | nM | PMID[12639541] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 23.0 | nM | PMID[1846923] |
| NPT137 | Cell line | L1210 | Mus musculus | T/C x100 | = | 200.0 | mg kg-1 | PMID[2155323] |
| NPT168 | Cell line | P388 | Mus musculus | T/C x100 | = | 199.0 | mg kg-1 | PMID[2155323] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 9.0 | nM | PMID[14552770] |
| NPT4457 | Cell line | KB VCR R | n.a. | IC50 | = | 9.0 | nM | PMID[14552770] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 7.0 | nM | PMID[22749423] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 8.0 | nM | PMID[22325897] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 7.0 | nM | PMID[14552770] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 7.0 | nM | PMID[14552770] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 330000.0 | nM | PMID[10576688] |
| NPT579 | Cell line | DLD-1 | Homo sapiens | IC50 | = | 14000000.0 | nM | PMID[10576688] |
| NPT4456 | Cell line | HEC-1B cell line | n.a. | IC50 | = | 60.0 | nM | PMID[10576688] |
| NPT4458 | Cell line | Caov-3 cell line | n.a. | IC50 | = | 2900000.0 | nM | PMID[10576688] |
| NPT3858 | Cell line | KATO III stomach cancer cell lines | n.a. | IC50 | = | 46000000.0 | nM | PMID[10576688] |
| NPT168 | Cell line | P388 | Mus musculus | Dose range | = | 8.0 | mg kg-1 | PMID[7381856] |
| NPT168 | Cell line | P388 | Mus musculus | DOSE | = | 4.0 | mg.kg-1 | PMID[7381856] |
| NPT168 | Cell line | P388 | Mus musculus | DOSE | = | 8.0 | mg.kg-1 | PMID[7381856] |
| NPT91 | Cell line | KB | Homo sapiens | Inhibition | = | 100.0 | % | DOI[10.1016/0960-894X(94)00462-O] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 40.0 | nM | PMID[10411476] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 70.0 | nM | PMID[10411476] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 30.0 | nM | PMID[10411476] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 35.0 | nM | PMID[10411476] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1040.0 | nM | PMID[10411476] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 330.0 | nM | PMID[12873503] |
| NPT137 | Cell line | L1210 | Mus musculus | Cells arrested | = | 81.0 | % | PMID[12873503] |
| NPT1183 | Cell line | WiDr | Homo sapiens | IC50 | = | 17.0 | nM | PMID[11334569] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 14.0 | nM | PMID[11334569] |
| NPT1097 | Cell line | MKN-45 | Homo sapiens | IC50 | = | 17.0 | nM | PMID[11334569] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[11334569] |
| NPT2058 | Cell line | NCI-H128 | Homo sapiens | IC50 | = | 18.0 | nM | PMID[11334569] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[11334569] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[11052802] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 375.0 | nM | PMID[11052802] |
| NPT3804 | Cell line | Human Tumor Cell lines | n.a. | GI50 | = | 44.0 | nM | PMID[11052802] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 5.0 | nM | DOI[10.1016/S0960-894X(97)10181-0] |
| NPT4459 | Cell line | 833K | n.a. | IC50 | = | 10.0 | nM | DOI[10.1016/S0960-894X(97)10181-0] |
| NPT2786 | Cell line | DC3F | Cricetulus griseus | IC50 | = | 6.0 | nM | DOI[10.1016/S0960-894X(97)10181-0] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[10841808] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 67.0 | nM | PMID[23578545] |
| NPT550 | Cell line | T-24 | Homo sapiens | IC50 | = | 88.0 | nM | PMID[23578545] |
| NPT4460 | Cell line | L2987 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[11755358] |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[24800942] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 30.0 | nM | PMID[24800942] |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[24502276] |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[24502276] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | = | 220.0 | nM | PMID[24502276] |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | = | 20.0 | nM | PMID[27070999] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[24800942] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | = | 40.0 | nM | PMID[20155916] |
| NPT4461 | Cell line | Panel (Carcinoma cell lines) | Homo sapiens | MGM | = | 0.0405 | n.a. | PMID[11020283] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 5.4 | nM | PMID[10479293] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 6.3 | nM | PMID[10479293] |
| NPT4462 | Cell line | NCI-H928 | n.a. | IC50 | = | 7.8 | nM | PMID[10479293] |
| NPT1986 | Cell line | RPMI 8402 | Homo sapiens | IC50 | = | 5.0 | nM | PMID[12747798] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 15.0 | nM | PMID[8246238] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 13.0 | nM | PMID[11384245] |
| NPT4264 | Cell line | Lewis lung carcinoma cell line | n.a. | IC50 | = | 33.0 | nM | PMID[12620081] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 5.6 | nM | PMID[11384245] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 ratio | = | 2.0 | n.a. | PMID[11384245] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 ratio | = | 1.4 | n.a. | PMID[11384245] |
| NPT137 | Cell line | L1210 | Mus musculus | KE | = | 4.8 | n.a. | PMID[8410981] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.01 | ug.mL-1 | PMID[8759170] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.04 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT4457 | Cell line | KB VCR R | n.a. | IC50 | = | 0.03 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 0.09 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 0.02 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 0.01 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 126.0 | nM | DOI[10.1016/S0960-894X(97)00398-3] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 600.0 | nM | PMID[23831507] |
| NPT165 | Cell line | HeLa | Homo sapiens | Concentration | = | 0.1 | uM | PMID[15026047] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 14.0 | nM | PMID[2537428] |
| NPT137 | Cell line | L1210 | Mus musculus | Radiation equivalent | = | 342.0 | n.a. | PMID[2537428] |
| NPT137 | Cell line | L1210 | Mus musculus | Radiation equivalent | = | 240.0 | n.a. | PMID[2537428] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 5300.0 | nM | PMID[14667232] |
| NPT2318 | Cell line | A172 | Homo sapiens | IC50 | = | 140.0 | nM | DOI[10.1016/0960-894X(96)00131-X] |
| NPT579 | Cell line | DLD-1 | Homo sapiens | IC50 | = | 210.0 | nM | DOI[10.1016/0960-894X(96)00131-X] |
| NPT4458 | Cell line | Caov-3 cell line | n.a. | IC50 | = | 30.0 | nM | DOI[10.1016/0960-894X(96)00131-X] |
| NPT3858 | Cell line | KATO III stomach cancer cell lines | n.a. | IC50 | = | 1170.0 | nM | DOI[10.1016/0960-894X(96)00131-X] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 180.0 | nM | DOI[10.1016/0960-894X(96)00131-X] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 51.0 | nM | PMID[9003520] |
| NPT934 | Cell line | SK-VLB | Homo sapiens | IC50 | = | 53.0 | nM | PMID[9003520] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 87.8 | nM | PMID[9003520] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 8.0 | nM | PMID[9003520] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 60.0 | nM | PMID[15081041] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 320.0 | nM | PMID[15081041] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 310.0 | nM | PMID[15081041] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 330.0 | nM | PMID[19530720] |
| NPT4466 | Cell line | Panel (56 tumour cell lines) | n.a. | IC50 | = | 40.0 | nM | PMID[10714502] |
| NPT4468 | Cell line | P338 | Mus musculus | T/C | = | 197.0 | % | PMID[3783593] |
| NPT517 | Cell line | Panel NCI-60 (60 carcinoma cell lines) | Homo sapiens | GI50 | = | 10.0 | nM | PMID[15743190] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | < | 0.005 | ug.mL-1 | PMID[15225719] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | < | 0.005 | ug.mL-1 | PMID[15225719] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 2.72 | ug.mL-1 | PMID[15225719] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 117.2 | nM | PMID[15454230] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 1414.4 | nM | PMID[15454230] |
| NPT1986 | Cell line | RPMI 8402 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[15482929] |
| NPT1986 | Cell line | RPMI 8402 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[15482929] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 10.0 | nM | PMID[15482929] |
| NPT1178 | Cell line | KB 3-1 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[15482929] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20.0 | nM | PMID[24200393] |
| NPT1178 | Cell line | KB 3-1 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[15482929] |
| NPT4461 | Cell line | Panel (Carcinoma cell lines) | Homo sapiens | Mean graph mid point | = | 0.04 | n.a. | PMID[15509164] |
| NPT323 | Cell line | SW-620 | Homo sapiens | EC50 | = | 1.2 | nM | PMID[15857116] |
| NPT323 | Cell line | SW-620 | Homo sapiens | EC50 | = | 0.15 | nM | PMID[15857116] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 0.84 | nM | PMID[15916431] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | RRI | = | 6400.0 | n.a. | PMID[15916431] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 98.2 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 98.0 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 75.8 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 75.0 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 60.6 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 39.1 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 83.2 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 94.7 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 76.9 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 93.5 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 98.1 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | -0.4 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | 49.5 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | 62.0 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | -11.7 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | 77.0 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | 93.1 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | 5.4 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | 65.8 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | 93.8 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 47.8 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 95.3 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 46.0 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 90.6 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 94.6 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 16.2 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 7.1 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 61.9 | % | PMID[16413779] |
| NPT466 | Cell line | U-937 | Homo sapiens | Inhibition | = | 78.5 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | -1.9 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 7.5 | % | PMID[16413779] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Inhibition | = | 33.4 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | -3.8 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | -7.1 | % | PMID[16413779] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Inhibition | = | -3.2 | % | PMID[16413779] |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[17402722] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 18.0 | nM | PMID[16686539] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[16686539] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 52.0 | nM | PMID[16686539] |
| NPT3723 | Cell line | CT26 | Mus musculus | IC50 | = | 34.0 | nM | PMID[16686539] |
| NPT4469 | Cell line | Renca | Mus musculus | IC50 | = | 304.0 | nM | PMID[16686539] |
| NPT4471 | Cell line | Panel (12 tumour cell lines) | Homo sapiens | IC70 | = | 8.6 | nM | PMID[16621542] |
| NPT517 | Cell line | Panel NCI-60 (60 carcinoma cell lines) | Homo sapiens | Activity | = | 0.0405 | uM | PMID[16750365] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[24360564] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 291.0 | nM | PMID[17204425] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 14.0 | nM | PMID[17204425] |
| NPT550 | Cell line | T-24 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[17204425] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 500.0 | nM | PMID[24303808] |
| NPT91 | Cell line | KB | Homo sapiens | EC50 | = | 3.6 | nM | PMID[17552563] |
| NPT25 | Cell line | MT4 | Homo sapiens | IC50 | = | 4.0 | nM | PMID[22276775] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 3.0 | nM | PMID[17254669] |
| NPT4473 | Cell line | WIL2-NS | Homo sapiens | IC50 | = | 5.0 | nM | PMID[17254669] |
| NPT4474 | Cell line | CCRF-SB | Homo sapiens | IC50 | = | 3.0 | nM | PMID[17254669] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[17254669] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[17254669] |
| NPT1506 | Cell line | SK-MES-1 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[17254669] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[17254669] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[17254669] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 69.0 | nM | PMID[21353568] |
| NPT1851 | Cell line | Col2 | Homo sapiens | IC50 | = | 45.0 | nM | PMID[21353568] |
| NPT2548 | Cell line | SNU-638 | Homo sapiens | IC50 | = | 98.0 | nM | PMID[21353568] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[21353568] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 18.0 | nM | PMID[21353568] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 32.1 | nM | PMID[17624792] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 680.0 | nM | PMID[17158054] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 32.0 | nM | PMID[17158054] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[17158054] |
| NPT309 | Cell line | 1A9 | Homo sapiens | ED50 | = | 3.2 | nM | PMID[17350834] |
| NPT81 | Cell line | A549 | Homo sapiens | ED50 | = | 6.9 | nM | PMID[17350834] |
| NPT83 | Cell line | MCF7 | Homo sapiens | ED50 | = | 3.2 | nM | PMID[17350834] |
| NPT858 | Cell line | LNCaP | Homo sapiens | ED50 | = | 2.0 | nM | PMID[17350834] |
| NPT306 | Cell line | PC-3 | Homo sapiens | ED50 | = | 16.7 | nM | PMID[17350834] |
| NPT90 | Cell line | DU-145 | Homo sapiens | ED50 | = | 10.9 | nM | PMID[17350834] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 20.9 | nM | PMID[17350834] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[27070999] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 10.0 | nM | PMID[17418582] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | = | 2.0 | nM | PMID[23750455] |
| NPT4475 | Cell line | CEM/C2 | Homo sapiens | GI50 | > | 1000.0 | nM | PMID[23750455] |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | = | 30.0 | nM | PMID[17418582] |
| NPT4475 | Cell line | CEM/C2 | Homo sapiens | RatioGI50 | > | 500.0 | n.a. | PMID[17418582] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[17827007] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | IC50 | = | 75.0 | nM | PMID[17827007] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 3200.0 | nM | PMID[20619511] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[22867707] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1080.0 | nM | PMID[21419530] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 4160.0 | nM | PMID[18178085] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 13.0 | nM | PMID[18178085] |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | = | 1.7 | nM | PMID[17962028] |
| NPT116 | Cell line | HL-60 | Homo sapiens | RatioGI50 | = | 0.9 | n.a. | PMID[17962028] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 1.4 | nM | PMID[18061452] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 180.0 | nM | PMID[18180162] |
| NPT2393 | Cell line | SAS | Homo sapiens | GI50 | = | 6000.0 | nM | PMID[20662543] |
| NPT196 | Cell line | AGS | Homo sapiens | GI50 | = | 23760.0 | nM | PMID[18180162] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | = | 90.0 | nM | PMID[20662543] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 2800.0 | nM | PMID[20662543] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 3150.0 | nM | PMID[18095653] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 12500.0 | nM | PMID[19256478] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 9670.0 | nM | PMID[18095653] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3120.0 | nM | PMID[18095653] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 280.0 | nM | PMID[19453174] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 180.0 | nM | PMID[18424133] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 3160.0 | nM | PMID[18419110] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 8810.0 | nM | PMID[18419110] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Ratio IC50 | = | 2.8 | n.a. | PMID[18424133] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 0.004 | nM | PMID[18511275] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 4.0 | nM | PMID[17673337] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 14.0 | nM | PMID[17673337] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | IC50 | = | 165.0 | nM | PMID[17673337] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 83.0 | nM | PMID[17673337] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | ED50 | = | 0.02 | ug ml-1 | PMID[18220355] |
| NPT1183 | Cell line | WiDr | Homo sapiens | ED50 | = | 0.07 | ug ml-1 | PMID[18220355] |
| NPT165 | Cell line | HeLa | Homo sapiens | ED50 | = | 0.19 | ug ml-1 | PMID[18220355] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 9.0 | nM | PMID[18676151] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | > | 10000.0 | nM | PMID[18771930] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | IC50 | = | 0.02 | ug.mL-1 | PMID[18774864] |
| NPT1183 | Cell line | WiDr | Homo sapiens | IC50 | = | 0.07 | ug.mL-1 | PMID[18774864] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 0.19 | ug.mL-1 | PMID[18774864] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 4.0 | nM | PMID[19299037] |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[19012996] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 14.0 | nM | PMID[18829334] |
| NPT91 | Cell line | KB | Homo sapiens | EC50 | = | 0.01 | ug.mL-1 | PMID[11858737] |
| NPT1851 | Cell line | Col2 | Homo sapiens | ED50 | = | 57.0 | nM | PMID[15043407] |
| NPT737 | Cell line | HUVEC | Homo sapiens | ED50 | = | 258.0 | nM | PMID[15043407] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 22.0 | nM | PMID[15043407] |
| NPT858 | Cell line | LNCaP | Homo sapiens | ED50 | = | 28.0 | nM | PMID[15043407] |
| NPT1034 | Cell line | Lu1 | Homo sapiens | ED50 | = | 29.0 | nM | PMID[15043407] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 0.054 | ug.mL-1 | PMID[8254347] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 6.2 | nM | PMID[18419110] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 1650.0 | nM | PMID[18419110] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[18419110] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 2000.0 | nM | PMID[18841903] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 300.0 | nM | PMID[18841903] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 10000.0 | nM | PMID[18841903] |
| NPT83 | Cell line | MCF7 | Homo sapiens | ED50 | > | 10.0 | uM | PMID[19026551] |
| NPT858 | Cell line | LNCaP | Homo sapiens | ED50 | > | 10.0 | uM | PMID[19026551] |
| NPT1034 | Cell line | Lu1 | Homo sapiens | ED50 | > | 10.0 | uM | PMID[19026551] |
| NPT4486 | Cell line | LX-1 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[11858737] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 9.0 | nM | PMID[11858737] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 4.0 | nM | PMID[11858737] |
| NPT1034 | Cell line | Lu1 | Homo sapiens | IC50 | = | 28.7 | nM | PMID[11858760] |
| NPT2345 | Cell line | SW626 | Homo sapiens | IC50 | = | 28.7 | nM | PMID[11858760] |
| NPT858 | Cell line | LNCaP | Homo sapiens | IC50 | = | 86.1 | nM | PMID[11858760] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 28.7 | nM | PMID[11858760] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 2.3 | ug ml-1 | PMID[7130986] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 0.02 | ug.mL-1 | PMID[8021652] |
| NPT1081 | Cell line | BXPC-3 | Homo sapiens | IC50 | = | 240.0 | nM | PMID[18554906] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[18554906] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 130.0 | nM | PMID[18554906] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[24180210] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[20961093] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 170.0 | nM | PMID[18554906] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 90.0 | nM | PMID[18554906] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 3.0 | nM | PMID[18554906] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 0.072 | ug ml-1 | PMID[19328687] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | Activity | = | 0.089 | ug ml-1 | PMID[19328687] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | Activity | = | 0.035 | ug ml-1 | PMID[19328687] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 130000.0 | nM | PMID[15974606] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 181.0 | % | PMID[521817] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 175.0 | % | PMID[521817] |
| NPT83 | Cell line | MCF7 | Homo sapiens | EC50 | = | 72.0 | nM | PMID[15730238] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | EC50 | = | 6.9 | nM | PMID[15730238] |
| NPT395 | Cell line | SF-268 | Homo sapiens | EC50 | = | 59.0 | nM | PMID[15730238] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 0.07 | ug.mL-1 | PMID[16499333] |
| NPT550 | Cell line | T-24 | Homo sapiens | Inhibition | = | 15.4 | % | PMID[18313176] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 58.0 | nM | PMID[19345580] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 89.0 | nM | PMID[19345580] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 72.0 | nM | PMID[19345580] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 40.0 | nM | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 34.6 | % | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 18.0 | % | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 15.5 | % | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 28.4 | % | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 17.5 | % | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 23.6 | % | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 10.3 | % | PMID[19203291] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 21.7 | % | PMID[19203291] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 3200.0 | nM | PMID[19256478] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 9700.0 | nM | PMID[19256478] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3100.0 | nM | PMID[19256478] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 300.0 | nM | PMID[19702283] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[19585998] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 47.0 | nM | PMID[19541483] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[19541483] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 40.0 | nM | PMID[19715319] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | = | 30.0 | nM | PMID[19715319] |
| NPT196 | Cell line | AGS | Homo sapiens | GI50 | = | 10.0 | nM | PMID[19715319] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[19715319] |
| NPT65 | Cell line | HepG2 | Homo sapiens | GI50 | = | 100.0 | nM | PMID[19715319] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | = | 700.0 | nM | PMID[19715319] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 300.0 | nM | PMID[19715319] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[19715319] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[19715319] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 200.0 | nM | PMID[19715319] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[19715319] |
| NPT196 | Cell line | AGS | Homo sapiens | IC50 | = | 20.0 | nM | PMID[19715319] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[19715319] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[19715319] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 200.0 | nM | DOI[10.1039/C4MD00344F] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[19715319] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 44.8 | % | PMID[19715319] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | = | 0.023 | nM | PMID[19743858] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | RatioGI50 | = | 1879.0 | n.a. | PMID[19743858] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 2.0 | nM | PMID[19655762] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3.0 | nM | PMID[25084144] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 3.0 | nM | PMID[19655762] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[19655762] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[24180210] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 38.0 | nM | PMID[19655762] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 455.0 | nM | PMID[19655762] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5.379 | nM | PMID[20063889] |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | = | 1900.0 | nM | PMID[19664930] |
| NPT1183 | Cell line | WiDr | Homo sapiens | GI50 | = | 1700.0 | nM | PMID[19664930] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 1300.0 | nM | PMID[21388138] |
| NPT179 | Cell line | A2780 | Homo sapiens | GI50 | = | 460.0 | nM | PMID[19664930] |
| NPT1723 | Cell line | HBL-100 | Homo sapiens | GI50 | = | 230.0 | nM | PMID[23831507] |
| NPT1577 | Cell line | SW1573 | Homo sapiens | GI50 | = | 210.0 | nM | PMID[19664930] |
| NPT90 | Cell line | DU-145 | Homo sapiens | Inhibition | = | 69.4 | % | PMID[19800803] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 1460.0 | nM | PMID[19954977] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 7420.0 | nM | PMID[19954977] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 2770.0 | nM | PMID[19954977] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[19954977] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1850.0 | nM | PMID[19954977] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 860.0 | nM | PMID[20093033] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 850.0 | nM | PMID[20093033] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 920.0 | nM | PMID[20093033] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 65.0 | nM | PMID[21419530] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 3570.0 | nM | PMID[20093033] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 940.0 | nM | PMID[20188578] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 630.0 | nM | PMID[19939682] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Inhibition | = | 0.05 | % | PMID[20188578] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 640.0 | nM | PMID[20188578] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[19939682] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 660.0 | nM | PMID[19939682] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[19939682] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 760.0 | nM | PMID[19939682] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[19916529] |
| NPT139 | Cell line | HT-29 | Homo sapiens | ED50 | = | 0.06 | uM | PMID[20939540] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[19863101] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1220.0 | nM | PMID[19653666] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1220.0 | nM | PMID[19653666] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 1220.0 | nM | PMID[19653666] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1220.0 | nM | PMID[19653666] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 130.0 | nM | PMID[19691293] |
| NPT2382 | Cell line | SW948 | Homo sapiens | IC50 | = | 160.0 | nM | PMID[19691293] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 580.0 | nM | PMID[19836231] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1070.0 | nM | PMID[19836231] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[19836231] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 680.0 | nM | PMID[19836231] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 67.0 | nM | PMID[19836231] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 2.0 | nM | PMID[20590148] |
| NPT80 | Cell line | Raji | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[20329739] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | EC50 | = | 160.0 | nM | PMID[20192247] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 940.0 | nM | PMID[20356735] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 590.0 | nM | PMID[20356735] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | = | 1300.0 | nM | PMID[20438092] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 280.0 | nM | PMID[20438092] |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | = | 2000.0 | nM | PMID[23831507] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | GI50 | = | 150.0 | nM | PMID[20438092] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 300.0 | nM | PMID[20392646] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 400.0 | nM | PMID[25481396] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[26022080] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[21601964] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[21601964] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | < | 13.0 | nM | PMID[20392545] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[20392545] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | < | 13.0 | nM | PMID[20392545] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 33.0 | % | PMID[20591678] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | Activity | = | 1.0 | % | PMID[20591678] |
| NPT395 | Cell line | SF-268 | Homo sapiens | Activity | = | 25.0 | % | PMID[20591678] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 570.0 | nM | PMID[20591678] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | = | 30.0 | nM | PMID[20591678] |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | = | 190.0 | nM | PMID[20591678] |
| NPT1329 | Cell line | Detroit 551 | Homo sapiens | GI50 | = | 990.0 | nM | PMID[20662543] |
| NPT83 | Cell line | MCF7 | Homo sapiens | RatioGI50 | = | 1.74 | n.a. | PMID[20591678] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | RatioGI50 | = | 33.0 | n.a. | PMID[20591678] |
| NPT395 | Cell line | SF-268 | Homo sapiens | RatioGI50 | = | 5.21 | n.a. | PMID[20591678] |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | = | 60.0 | nM | PMID[21115210] |
| NPT111 | Cell line | K562 | Homo sapiens | RatioGI50 | = | 16.5 | n.a. | PMID[20591678] |
| NPT139 | Cell line | HT-29 | Homo sapiens | EC50 | = | 60.0 | nM | PMID[20825206] |
| NPT306 | Cell line | PC-3 | Homo sapiens | FC | = | 0.258 | n.a. | PMID[16680159] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 4200.0 | nM | PMID[20619511] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 14200.0 | nM | PMID[20619511] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 2300.0 | nM | PMID[20619511] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[20619511] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | > | 25000.0 | nM | PMID[20638158] |
| NPT1329 | Cell line | Detroit 551 | Homo sapiens | RatioGI50 | = | 0.96 | n.a. | PMID[20662543] |
| NPT1329 | Cell line | Detroit 551 | Homo sapiens | RatioGI50 | = | 4.5 | n.a. | PMID[20662543] |
| NPT1329 | Cell line | Detroit 551 | Homo sapiens | RatioGI50 | = | 11.0 | n.a. | PMID[20662543] |
| NPT1329 | Cell line | Detroit 551 | Homo sapiens | RatioGI50 | = | 0.35 | n.a. | PMID[20662543] |
| NPT2393 | Cell line | SAS | Homo sapiens | RatioGI50 | = | 0.17 | n.a. | PMID[20662543] |
| NPT165 | Cell line | HeLa | Homo sapiens | RatioGI50 | = | 5.5 | n.a. | PMID[20662543] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 80.0 | nM | PMID[20662543] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 57.0 | nM | PMID[20942490] |
| NPT114 | Cell line | LoVo | Homo sapiens | IC50 | = | 3100.0 | nM | PMID[20942490] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 710.0 | nM | PMID[20942490] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[21044847] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 330.0 | nM | PMID[21044847] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 16240.0 | nM | PMID[21044847] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 67.0 | nM | PMID[21074444] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | IC50 | = | 700.0 | nM | PMID[21074444] |
| NPT744 | Cell line | IMR-32 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[21074444] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[21074444] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[25936262] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[21074444] |
| NPT762 | Cell line | A-431 | Homo sapiens | IC50 | = | 11.0 | nM | PMID[21071230] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 8.9 | nM | PMID[21071230] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 17.0 | nM | PMID[21071230] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 2430.0 | nM | PMID[21115246] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 590.0 | nM | PMID[21115246] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 610.0 | nM | PMID[21115246] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[21115246] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3600.0 | nM | PMID[20961093] |
| NPT306 | Cell line | PC-3 | Homo sapiens | TGI | > | 100000.0 | nM | PMID[21115210] |
| NPT111 | Cell line | K562 | Homo sapiens | TGI | = | 50120.0 | nM | PMID[21115210] |
| NPT139 | Cell line | HT-29 | Homo sapiens | TGI | = | 31620.0 | nM | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | TGI | = | 160.0 | nM | PMID[23831811] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 15.15 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 16.91 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 41.61 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 25.73 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 11.51 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 10.4 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 65.62 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 10.92 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 71.45 | % | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 21.25 | % | PMID[21115210] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | = | 60.0 | nM | PMID[21115210] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | = | 50.0 | nM | PMID[23831811] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 650.0 | nM | PMID[21186067] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[21186067] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[21341674] |
| NPT1396 | Cell line | NCI-H69 | Homo sapiens | IC50 | = | 1.0 | nM | PMID[21341674] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | Ratio | > | 77.0 | n.a. | PMID[21341674] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[21341674] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[21341674] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 13.0 | nM | PMID[21341674] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 96.0 | % | PMID[21334793] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 4.0 | % | PMID[21334793] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 35.0 | % | PMID[21334793] |
| NPT114 | Cell line | LoVo | Homo sapiens | GI50 | = | 8.0 | nM | PMID[21388138] |
| NPT916 | Cell line | SK-MEL | Homo sapiens | GI50 | = | 47.0 | nM | PMID[21388138] |
| NPT15 | Cell line | Jurkat | Homo sapiens | GI50 | = | 90.0 | nM | PMID[21388138] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 200.0 | nM | PMID[21388138] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | = | 480.0 | nM | PMID[21388138] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 6000.0 | nM | PMID[21388138] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 3970.0 | nM | PMID[21419530] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 310.0 | nM | PMID[21419530] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 970.0 | nM | PMID[21419530] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[21513293] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | < | 40.0 | nM | PMID[21513293] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[21513293] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[21599000] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 190.0 | nM | PMID[21599000] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 11120.0 | nM | PMID[21599000] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 890.0 | nM | PMID[21599000] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | Ratio IC50 | = | 29.67 | n.a. | PMID[21599000] |
| NPT171 | Cell line | MRC5 | Homo sapiens | Ratio IC50 | = | 0.08 | n.a. | PMID[21599000] |
| NPT395 | Cell line | SF-268 | Homo sapiens | Ratio IC50 | = | 4.68 | n.a. | PMID[21599000] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 1.6 | nM | PMID[22376176] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 60.0 | % | PMID[21620534] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 0.072 | ug.mL-1 | PMID[21684168] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 0.096 | ug.mL-1 | PMID[21684168] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 1.54 | ug.mL-1 | PMID[21684168] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | IC50 | = | 6.88 | ug.mL-1 | PMID[21684168] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | INH | = | 0.3 | uM | PMID[21601964] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[21775156] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 91.0 | nM | PMID[21873069] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 166.0 | nM | PMID[21873069] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 2544.0 | nM | PMID[21873069] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | IC50 | = | 7860.0 | nM | PMID[21873069] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 3.0 | nM | PMID[21973054] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 13.0 | nM | PMID[24502276] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 17.78 | % | PMID[21843907] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 27.06 | % | PMID[21843907] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 50.18 | % | PMID[21843907] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 19.64 | % | PMID[21843907] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 27.27 | % | PMID[21843907] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 47.95 | % | PMID[21843907] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | IC50 | = | 9550.0 | nM | PMID[21843907] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 10000.0 | nM | PMID[21843907] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 13.94 | % | PMID[21843907] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 12.79 | % | PMID[21843907] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 44.0 | % | PMID[21843907] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 40.88 | % | PMID[21843907] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Potency | n.a. | 251.2 | nM | PubChem BioAssay data set |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 82.0 | nM | PubChem BioAssay data set |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 44.7 | nM | PubChem BioAssay data set |
| NPT1160 | Cell line | BJ | Homo sapiens | EC50 | = | 7.67 | nM | PubChem BioAssay data set |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | Potency | n.a. | 1778.3 | nM | PubChem BioAssay data set |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 8930.0 | nM | PMID[21983445] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 56.0 | nM | PMID[21978950] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[22044245] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[22044245] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[22044245] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[22044245] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 17.0 | % | PMID[22047801] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 52.0 | % | PMID[22047801] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 11.0 | % | PMID[22047801] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 17.42 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 13.42 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 18.67 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 21.21 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 17.59 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 6.71 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 11.36 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 46.12 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 5.39 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 3.06 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 3.05 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 47.24 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 59.5 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 58.52 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 18.36 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 16.24 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 15.27 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 23.38 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 20.21 | % | PMID[22104973] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 20.25 | % | PMID[22104973] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 0.6 | ug.mL-1 | PMID[21985060] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 7.0 | % | PMID[22123322] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 18.0 | % | PMID[22123322] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 2600.0 | nM | PMID[22197145] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 1800.0 | nM | PMID[22197145] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 2700.0 | nM | PMID[22197145] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 55.5 | % | PMID[22245048] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 5.0 | nM | PMID[22305342] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[22318164] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 1180.0 | nM | PMID[22318164] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 2370.0 | nM | PMID[22318164] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3910.0 | nM | PMID[22318164] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1010.0 | nM | PMID[22318164] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 71.0 | nM | PMID[22325897] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[22325897] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 26.0 | nM | PMID[22325897] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 1980.0 | nM | PMID[22325897] |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 14.03 | nM | PubChem BioAssay data set |
| NPT367 | Cell line | MDA-N | Homo sapiens | GI50 | n.a. | 145.21 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 19.41 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 30.27 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 11.64 | nM | PubChem BioAssay data set |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 33.73 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 14.96 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 14.49 | nM | PubChem BioAssay data set |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | n.a. | 10.0 | nM | PMID[24800942] |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 27.16 | nM | PubChem BioAssay data set |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 173.78 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 76.38 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 176.6 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 32.21 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 11.56 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 11.97 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 11.07 | nM | PubChem BioAssay data set |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 38.82 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 80.91 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 18.16 | nM | PubChem BioAssay data set |
| NPT572 | Cell line | DMS-273 | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 937.56 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 1324.34 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 36.64 | nM | PubChem BioAssay data set |
| NPT573 | Cell line | M19-MEL | Homo sapiens | GI50 | n.a. | 47.97 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 22.34 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 20.65 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 159.22 | nM | PubChem BioAssay data set |
| NPT574 | Cell line | XF498 | Homo sapiens | GI50 | n.a. | 48.31 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 106.66 | nM | PubChem BioAssay data set |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 33.65 | nM | PubChem BioAssay data set |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 209.41 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 26.06 | nM | PubChem BioAssay data set |
| NPT168 | Cell line | P388 | Mus musculus | GI50 | n.a. | 26.67 | nM | PubChem BioAssay data set |
| NPT457 | Cell line | BT-549 | Homo sapiens | GI50 | n.a. | 114.82 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 297.85 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 18.11 | nM | PubChem BioAssay data set |
| NPT575 | Cell line | KM-20L2 | Homo sapiens | GI50 | n.a. | 77.62 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 27.16 | nM | PubChem BioAssay data set |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | GI50 | n.a. | 158.85 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 151.71 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 23.01 | nM | PubChem BioAssay data set |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 11.51 | nM | PubChem BioAssay data set |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | n.a. | 11.35 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 95.06 | nM | PubChem BioAssay data set |
| NPT731 | Cell line | LXFL 529 | Homo sapiens | GI50 | n.a. | 372.39 | nM | PubChem BioAssay data set |
| NPT576 | Cell line | DMS-114 | Homo sapiens | GI50 | n.a. | 20.56 | nM | PubChem BioAssay data set |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | n.a. | 64.42 | nM | PubChem BioAssay data set |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | n.a. | 22.54 | nM | PubChem BioAssay data set |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 20.18 | nM | PubChem BioAssay data set |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | n.a. | 15.78 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 10.64 | nM | PubChem BioAssay data set |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 65.77 | nM | PubChem BioAssay data set |
| NPT552 | Cell line | P388/ADR | Mus musculus | GI50 | n.a. | 25.35 | nM | PubChem BioAssay data set |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 11.8 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 184.08 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 11.53 | nM | PubChem BioAssay data set |
| NPT402 | Cell line | Hs-578T | Homo sapiens | GI50 | n.a. | 816.58 | nM | PubChem BioAssay data set |
| NPT578 | Cell line | SNB-78 | Homo sapiens | GI50 | n.a. | 332.66 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 21.38 | nM | PubChem BioAssay data set |
| NPT579 | Cell line | DLD-1 | Homo sapiens | GI50 | n.a. | 242.66 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 54.33 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 17.95 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 44.87 | nM | PubChem BioAssay data set |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 227.51 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 285.76 | nM | PubChem BioAssay data set |
| NPT406 | Cell line | RXF 393 | Homo sapiens | GI50 | n.a. | 25.64 | nM | PubChem BioAssay data set |
| NPT738 | Cell line | SN12K1 | Homo sapiens | GI50 | n.a. | 24.49 | nM | PubChem BioAssay data set |
| NPT732 | Cell line | HOP-18 | Homo sapiens | GI50 | n.a. | 122.18 | nM | PubChem BioAssay data set |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 6400.0 | nM | PMID[22326393] |
| NPT65 | Cell line | HepG2 | Homo sapiens | FC | = | 4.0 | n.a. | PMID[22326393] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[22276775] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[22276775] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1570.0 | nM | PMID[23153813] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 22.9 | nM | PMID[22647222] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 33.8 | nM | PMID[22647222] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | < | 100.0 | nM | PMID[22409771] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | < | 100.0 | nM | PMID[22409771] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | < | 100.0 | nM | PMID[22409771] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | < | 100.0 | nM | PMID[26810835] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 5.0 | nM | PMID[22749423] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 9170.0 | nM | PMID[22819942] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 9920.0 | nM | PMID[22819942] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 9290.0 | nM | PMID[22819942] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 7940.0 | nM | PMID[22819942] |
| NPT4490 | Cell line | IMR-90 | Homo sapiens | IC50 | = | 430.0 | nM | PMID[22863526] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[22863526] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 2.0 | nM | PMID[22863526] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[25481396] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 3.0 | nM | PMID[22758788] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[22867707] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | = | 150.0 | nM | PMID[22867707] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | < | 1000.0 | nM | PMID[22867707] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | < | 1000.0 | nM | PMID[22867707] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | < | 1000.0 | nM | PMID[22867707] |
| NPT2326 | Cell line | BT-20 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[22867707] |
| NPT2308 | Cell line | CAMA-1 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[23142674] |
| NPT3882 | Cell line | MFE-296 | Homo sapiens | IC50 | < | 1000.0 | nM | PMID[22867707] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 2610.0 | nM | PMID[23084702] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 110.0 | nM | PMID[23084702] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 43.6 | nM | PMID[23084702] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[23142674] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[24180210] |
| NPT845 | Cell line | BT-474 | Homo sapiens | IC50 | = | 12750.0 | nM | PMID[23142674] |
| NPT2488 | Cell line | MDA-MB-453 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT2326 | Cell line | BT-20 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT2473 | Cell line | MDA-MB-361 | Homo sapiens | IC50 | = | 170.0 | nM | PMID[23142674] |
| NPT2463 | Cell line | MDA-MB-157 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[23142674] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT133 | Cell line | ZR-75-1 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT2743 | Cell line | MCF-12A | Homo sapiens | IC50 | < | 10.0 | nM | PMID[23142674] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 8.8 | nM | PMID[22698783] |
| NPT114 | Cell line | LoVo | Homo sapiens | Ratio | = | 3.4 | n.a. | PMID[23137376] |
| NPT114 | Cell line | LoVo | Homo sapiens | Activity | = | 23.81 | % | PMID[23137376] |
| NPT114 | Cell line | LoVo | Homo sapiens | Activity | = | 17.61 | % | PMID[23137376] |
| NPT2405 | Cell line | SAOS-2 | Homo sapiens | GI50 | > | 287000.0 | nM | PMID[22867019] |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | < | 3.0 | nM | PMID[22867019] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | > | 287000.0 | nM | PMID[22867019] |
| NPT65 | Cell line | HepG2 | Homo sapiens | GI50 | = | 220.0 | nM | PMID[22867019] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | GI50 | = | 6290.0 | nM | PMID[22867019] |
| NPT1045 | Cell line | U2OS | Homo sapiens | GI50 | > | 287000.0 | nM | PMID[22867019] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 83.0 | nM | PMID[22867019] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | = | 33.0 | nM | PMID[22867019] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 170.0 | nM | PMID[22867019] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 1010.0 | nM | PMID[22503656] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 1530.0 | nM | PMID[22503656] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 1060.0 | nM | PMID[22503656] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 1380.0 | nM | PMID[22503656] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 121.0 | nM | PMID[23102893] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 28.7 | nM | PMID[23102893] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 15.8 | nM | PMID[23102893] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 58.0 | ug.mL-1 | DOI[10.1007/s00044-010-9381-7] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 0.28 | ug.mL-1 | DOI[10.1007/s00044-010-9381-7] |
| NPT165 | Cell line | HeLa | Homo sapiens | Activity | = | 68.6 | % | PMID[23354071] |
| NPT165 | Cell line | HeLa | Homo sapiens | Activity | = | 17.7 | % | PMID[23354071] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 51.0 | % | PMID[23419739] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 6.0 | % | PMID[23419739] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 88.0 | % | PMID[23419739] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 69.0 | % | PMID[23419739] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 50.0 | nM | PMID[23357037] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 7.0 | nM | PMID[23357037] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 2.0 | nM | PMID[23357037] |
| NPT2268 | Cell line | DOK | Homo sapiens | IC50 | = | 18.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1899 | Cell line | DSH1 | Homo sapiens | IC50 | = | 15.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1184 | Cell line | Daoy | Homo sapiens | IC50 | = | 0.4809 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 2281.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1900 | Cell line | DU-4475 | Homo sapiens | IC50 | = | 3.067 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT394 | Cell line | EKVX | Homo sapiens | IC50 | = | 436.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1901 | Cell line | EM-2 | Homo sapiens | IC50 | = | 4.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2269 | Cell line | EPLC-272H | Homo sapiens | IC50 | = | 72.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1905 | Cell line | ES4 | Homo sapiens | IC50 | = | 1.474 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1903 | Cell line | ES5 | Homo sapiens | IC50 | = | 0.7735 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1902 | Cell line | ES1 | Homo sapiens | IC50 | = | 0.09574 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1904 | Cell line | ES3 | Homo sapiens | IC50 | = | 0.9311 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2270 | Cell line | Detroit562 | Homo sapiens | IC50 | = | 13.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2271 | Cell line | DoTc2-4510 | Homo sapiens | IC50 | = | 4.032 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1908 | Cell line | EC-GI-10 | Homo sapiens | IC50 | = | 7.904 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT3465 | Cell line | ECC10 | Homo sapiens | IC50 | = | 3.853 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2272 | Cell line | EFM-19 | Homo sapiens | IC50 | = | 126.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2273 | Cell line | EFO-21 | Homo sapiens | IC50 | = | 20.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2274 | Cell line | EFO-27 | Homo sapiens | IC50 | = | 80.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2275 | Cell line | EGI-1 | Homo sapiens | IC50 | = | 25.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT376 | Cell line | A498 | Homo sapiens | IC50 | = | 7.077 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 14.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2276 | Cell line | A673 | Homo sapiens | IC50 | = | 0.8149 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1081 | Cell line | BXPC-3 | Homo sapiens | IC50 | = | 116.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2277 | Cell line | C-33-A | Homo sapiens | IC50 | = | 6.477 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2278 | Cell line | COLO-741 | Homo sapiens | IC50 | = | 109.27 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2279 | Cell line | COLO-792 | Homo sapiens | IC50 | = | 169.17 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1913 | Cell line | DJM-1 | Homo sapiens | IC50 | = | 436.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2280 | Cell line | A704 | Homo sapiens | IC50 | = | 15.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2281 | Cell line | ABC-1 | Homo sapiens | IC50 | = | 3.468 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1911 | Cell line | C2BBe1 | Homo sapiens | IC50 | = | 2.438 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2282 | Cell line | C32 | Homo sapiens | IC50 | = | 13.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1912 | Cell line | COLO-800 | Homo sapiens | IC50 | = | 0.4281 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1914 | Cell line | COLO-824 | Homo sapiens | IC50 | = | 269.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2283 | Cell line | DK-MG | Homo sapiens | IC50 | = | 84.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT576 | Cell line | DMS-114 | Homo sapiens | IC50 | = | 81.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT369 | Cell line | ACHN | Homo sapiens | IC50 | = | 6.663 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1916 | Cell line | ACN | Homo sapiens | IC50 | = | 85.66 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2284 | Cell line | C3A | Homo sapiens | IC50 | = | 56.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1452 | Cell line | C8166 | Homo sapiens | IC50 | = | 41.48 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1915 | Cell line | COLO-829 | Homo sapiens | IC50 | = | 11.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2285 | Cell line | COR-L105 | Homo sapiens | IC50 | = | 184.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1918 | Cell line | DMS-79 | Homo sapiens | IC50 | = | 31.85 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1919 | Cell line | DOHH-2 | Homo sapiens | IC50 | = | 0.6022 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT196 | Cell line | AGS | Homo sapiens | IC50 | = | 16.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1920 | Cell line | ALL-PO | Homo sapiens | IC50 | = | 1.534 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | = | 5.354 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2286 | Cell line | CAL-120 | Homo sapiens | IC50 | = | 594.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2287 | Cell line | COR-L23 | Homo sapiens | IC50 | = | 6.849 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1922 | Cell line | COR-L88 | Homo sapiens | IC50 | = | 40.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT572 | Cell line | DMS-273 | Homo sapiens | IC50 | = | 6.072 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1924 | Cell line | AM-38 | Homo sapiens | IC50 | = | 4.408 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2288 | Cell line | AN3-CA | Homo sapiens | IC50 | = | 33.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2289 | Cell line | CAL-12T | Homo sapiens | IC50 | = | 262.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | IC50 | = | 2.018 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2291 | Cell line | CP50-MEL-B | Homo sapiens | IC50 | = | 72.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1926 | Cell line | CP66-MEL | Homo sapiens | IC50 | = | 208.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1629 | Cell line | CWR22R | Homo sapiens | IC50 | = | 9.314 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1928 | Cell line | ATN-1 | Homo sapiens | IC50 | = | 2.043 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2292 | Cell line | CAL-33 | Homo sapiens | IC50 | = | 5.997 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2293 | Cell line | CAL-39 | Homo sapiens | IC50 | = | 19.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1930 | Cell line | CTB-1 | Homo sapiens | IC50 | = | 0.4292 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2294 | Cell line | 23132-87 | Homo sapiens | IC50 | = | 19.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2295 | Cell line | 5637 | Homo sapiens | IC50 | = | 4.183 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2296 | Cell line | AU565 | Homo sapiens | IC50 | = | 3.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2297 | Cell line | ASPC1 | Homo sapiens | IC50 | = | 168.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2298 | Cell line | BALL-1 | Homo sapiens | IC50 | = | 108.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2299 | Cell line | CAL-51 | Homo sapiens | IC50 | = | 29.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2300 | Cell line | CAL-54 | Homo sapiens | IC50 | = | 4.758 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2301 | Cell line | CAL-62 | Homo sapiens | IC50 | = | 0.9836 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1932 | Cell line | CTV-1 | Homo sapiens | IC50 | = | 0.9054 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1933 | Cell line | CW-2 | Homo sapiens | IC50 | = | 35.45 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2302 | Cell line | 639-V | Homo sapiens | IC50 | = | 0.1714 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2303 | Cell line | 647-V | Homo sapiens | IC50 | = | 0.8964 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1931 | Cell line | BB30-HNC | Homo sapiens | IC50 | = | 21.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1934 | Cell line | BB49-HNC | Homo sapiens | IC50 | = | 120.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2304 | Cell line | CAL-72 | Homo sapiens | IC50 | = | 150.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2305 | Cell line | CAL-85-1 | Homo sapiens | IC50 | = | 7923.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2306 | Cell line | Ca-Ski | Homo sapiens | IC50 | = | 4.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1031 | Cell line | Ca9-22 | Homo sapiens | IC50 | = | 2.211 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1094 | Cell line | 697 | Homo sapiens | IC50 | = | 2.029 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2307 | Cell line | 769-P | Homo sapiens | IC50 | = | 25.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT401 | Cell line | 786-0 | Homo sapiens | IC50 | = | 5.021 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1935 | Cell line | BB65-RCC | Homo sapiens | IC50 | = | 1.853 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2308 | Cell line | CAMA-1 | Homo sapiens | IC50 | = | 87.43 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2309 | Cell line | CAPAN-1 | Homo sapiens | IC50 | = | 14.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2310 | Cell line | CaR-1 | Homo sapiens | IC50 | = | 6.427 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2311 | Cell line | Calu-3 | Homo sapiens | IC50 | = | 32.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1939 | Cell line | 8-MG-BA | Homo sapiens | IC50 | = | 1.502 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2312 | Cell line | 8305C | Homo sapiens | IC50 | = | 93.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2313 | Cell line | BCPAP | Homo sapiens | IC50 | = | 3.041 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1937 | Cell line | CAS-1 | Homo sapiens | IC50 | = | 121.91 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 5.547 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1938 | Cell line | Calu-6 | Homo sapiens | IC50 | = | 178.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1313 | Cell line | Capan-2 | Homo sapiens | IC50 | = | 452.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1215 | Cell line | 8505C | Homo sapiens | IC50 | = | 3.301 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1941 | Cell line | A101D | Homo sapiens | IC50 | = | 257.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1940 | Cell line | BE-13 | Homo sapiens | IC50 | = | 4.564 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2314 | Cell line | BEN | Homo sapiens | IC50 | = | 107.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2315 | Cell line | BFTC-905 | Homo sapiens | IC50 | = | 0.1398 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2316 | Cell line | CFPAC-1 | Homo sapiens | IC50 | = | 14.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1943 | Cell line | CGTH-W-1 | Homo sapiens | IC50 | = | 3.275 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2317 | Cell line | ChaGo-K-1 | Homo sapiens | IC50 | = | 304.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1944 | Cell line | D-247MG | Homo sapiens | IC50 | = | 39.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2318 | Cell line | A172 | Homo sapiens | IC50 | = | 12.76 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2319 | Cell line | A204 | Homo sapiens | IC50 | = | 4.525 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1383 | Cell line | A2058 | Homo sapiens | IC50 | = | 3.599 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2320 | Cell line | BFTC-909 | Homo sapiens | IC50 | = | 6.925 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2321 | Cell line | BHT-101 | Homo sapiens | IC50 | = | 1.822 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2322 | Cell line | CHL-1 | Homo sapiens | IC50 | = | 6.091 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1946 | Cell line | D-263MG | Homo sapiens | IC50 | = | 9.114 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1947 | Cell line | D283 Med | n.a. | IC50 | = | 3.198 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 2.902 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2323 | Cell line | BHY | Homo sapiens | IC50 | = | 5.31 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2324 | Cell line | CHP-212 | Homo sapiens | IC50 | = | 1.026 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1953 | Cell line | D-336MG | Homo sapiens | IC50 | = | 5.205 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1954 | Cell line | D-392MG | Homo sapiens | IC50 | = | 17.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1955 | Cell line | A3-KAW | Homo sapiens | IC50 | = | 1.669 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1083 | Cell line | A-375 | Homo sapiens | IC50 | = | 3.688 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2325 | Cell line | BPH-1 | Homo sapiens | IC50 | = | 2.082 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2326 | Cell line | BT-20 | Homo sapiens | IC50 | = | 25.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1952 | Cell line | COLO-320-HSR | Homo sapiens | IC50 | = | 62.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1956 | Cell line | COLO-668 | Homo sapiens | IC50 | = | 22.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2327 | Cell line | D-423MG | Homo sapiens | IC50 | = | 2.551 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1957 | Cell line | D-502MG | Homo sapiens | IC50 | = | 22.59 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1958 | Cell line | A388 | Homo sapiens | IC50 | = | 10.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1959 | Cell line | A4-Fuk | Homo sapiens | IC50 | = | 1.749 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT845 | Cell line | BT-474 | Homo sapiens | IC50 | = | 1985.76 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT457 | Cell line | BT-549 | Homo sapiens | IC50 | = | 17.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2328 | Cell line | COLO-678 | Homo sapiens | IC50 | = | 3682.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2329 | Cell line | COLO-679 | Homo sapiens | IC50 | = | 4791.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1961 | Cell line | D-542MG | Homo sapiens | IC50 | = | 291.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2330 | Cell line | D-566MG | Homo sapiens | IC50 | = | 0.1315 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2331 | Cell line | A-427 | Homo sapiens | IC50 | = | 4.251 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT762 | Cell line | A-431 | Homo sapiens | IC50 | = | 1552.36 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1960 | Cell line | BV-173 | Homo sapiens | IC50 | = | 2.381 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1963 | Cell line | Becker | Homo sapiens | IC50 | = | 23.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2332 | Cell line | COLO-680N | Homo sapiens | IC50 | = | 72.45 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1964 | Cell line | COLO-684 | Homo sapiens | IC50 | = | 13.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1962 | Cell line | DB | Homo sapiens | IC50 | = | 1.161 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2333 | Cell line | DBTRG-05MG | Homo sapiens | IC50 | = | 40.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1965 | Cell line | DEL | Homo sapiens | IC50 | = | 0.8157 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2334 | Cell line | NCI-H1793 | Homo sapiens | IC50 | = | 27.23 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1966 | Cell line | NCI-H1838 | Homo sapiens | IC50 | = | 253.14 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1967 | Cell line | NCI-H526 | Homo sapiens | IC50 | = | 1.028 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2335 | Cell line | NCI-H596 | n.a. | IC50 | = | 2968.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2336 | Cell line | OE19 | Homo sapiens | IC50 | = | 3273.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2337 | Cell line | OE33 | Homo sapiens | IC50 | = | 25.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1091 | Cell line | RPMI-7951 | Homo sapiens | IC50 | = | 4.753 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | IC50 | = | 29.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT311 | Cell line | SK-LU-1 | Homo sapiens | IC50 | = | 4.713 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT926 | Cell line | SK-MEL-1 | Homo sapiens | IC50 | = | 51.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1312 | Cell line | SW1990 | Homo sapiens | IC50 | = | 37.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2338 | Cell line | SW48 | Homo sapiens | IC50 | = | 3.017 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2339 | Cell line | TGBC24TKB | Homo sapiens | IC50 | = | 53.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1971 | Cell line | GI-1 | Homo sapiens | IC50 | = | 3.365 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2204 | Cell line | HH | Homo sapiens | IC50 | = | 13.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 3.734 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1973 | Cell line | IST-SL1 | Homo sapiens | IC50 | = | 34.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1975 | Cell line | KS-1 | Homo sapiens | IC50 | = | 57.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2340 | Cell line | KU-19-19 | Homo sapiens | IC50 | = | 22.03 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1976 | Cell line | LNCaP-Clone-FGC | Homo sapiens | IC50 | = | 31.03 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2209 | Cell line | MFH-ino | Homo sapiens | IC50 | = | 27.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1978 | Cell line | MFM-223 | Homo sapiens | IC50 | = | 5270.72 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1979 | Cell line | NB13 | Homo sapiens | IC50 | = | 28.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1980 | Cell line | NB14 | Homo sapiens | IC50 | = | 0.9071 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | IC50 | = | 334.48 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2342 | Cell line | NCI-H630 | Homo sapiens | IC50 | = | 282.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2343 | Cell line | NCI-H650 | Homo sapiens | IC50 | = | 54.96 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1968 | Cell line | OMC-1 | Homo sapiens | IC50 | = | 78.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1984 | Cell line | ONS-76 | Homo sapiens | IC50 | = | 2.406 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1987 | Cell line | RPMI-8866 | Homo sapiens | IC50 | = | 1.725 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | IC50 | = | 54.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2344 | Cell line | SK-MEL-24 | Homo sapiens | IC50 | = | 38.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 4.082 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2345 | Cell line | SW626 | Homo sapiens | IC50 | = | 76.9 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2346 | Cell line | TI-73 | Homo sapiens | IC50 | = | 14.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT384 | Cell line | TK-10 | Homo sapiens | IC50 | = | 55.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1972 | Cell line | GI-ME-N | Homo sapiens | IC50 | = | 33.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2347 | Cell line | GMS-10 | Homo sapiens | IC50 | = | 7.311 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2348 | Cell line | HLE | Homo sapiens | IC50 | = | 5.753 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2349 | Cell line | HMV-2 cell line | n.a. | IC50 | = | 8.887 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2350 | Cell line | HN | Homo sapiens | IC50 | = | 1.399 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1990 | Cell line | J-RT3-T3-5 | Homo sapiens | IC50 | = | 2.579 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1505 | Cell line | J82 | Homo sapiens | IC50 | = | 4.722 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1991 | Cell line | KU812 cell line | n.a. | IC50 | = | 8.365 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | IC50 | = | 3.72 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2351 | Cell line | MG-63 | Homo sapiens | IC50 | = | 7.654 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2352 | Cell line | MHH-ES-1 | Homo sapiens | IC50 | = | 0.1293 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1995 | Cell line | NB17 | Homo sapiens | IC50 | = | 2.175 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2353 | Cell line | NCI-H1993 | Homo sapiens | IC50 | = | 9621.56 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2354 | Cell line | NCI-H2009 | Homo sapiens | IC50 | = | 68.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2355 | Cell line | NCI-H2029 | Homo sapiens | IC50 | = | 491.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2356 | Cell line | NCI-H661 | Homo sapiens | IC50 | = | 13.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1396 | Cell line | NCI-H69 | Homo sapiens | IC50 | = | 311.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1997 | Cell line | OS-RC-2 | Homo sapiens | IC50 | = | 9.968 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 956.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1998 | Cell line | RS4-11 | Homo sapiens | IC50 | = | 0.9022 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2357 | Cell line | RT-112 | Homo sapiens | IC50 | = | 14.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | = | 17.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2358 | Cell line | SK-MEL3 | Homo sapiens | IC50 | = | 329.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2359 | Cell line | SK-MEL-30 | Homo sapiens | IC50 | = | 2281.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1988 | Cell line | SW684 | Homo sapiens | IC50 | = | 711.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2360 | Cell line | SW756 | Homo sapiens | IC50 | = | 4.211 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2361 | Cell line | SW780 | Homo sapiens | IC50 | = | 25.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2362 | Cell line | TYK-nu | Homo sapiens | IC50 | = | 4.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2363 | Cell line | U-118-MG | Homo sapiens | IC50 | = | 19.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1989 | Cell line | GOTO | Homo sapiens | IC50 | = | 0.7058 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2364 | Cell line | GP5d | Homo sapiens | IC50 | = | 12.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2365 | Cell line | HO-1-N-1 | Homo sapiens | IC50 | = | 0.8385 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT379 | Cell line | HOP-62 | Homo sapiens | IC50 | = | 3293.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2001 | Cell line | JAR | Homo sapiens | IC50 | = | 14.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2366 | Cell line | JEG-3 | Homo sapiens | IC50 | = | 13.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1992 | Cell line | KURAMOCHI | Homo sapiens | IC50 | = | 3634.01 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2002 | Cell line | KY821 | Homo sapiens | IC50 | = | 8.123 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2367 | Cell line | KYSE-140 | Homo sapiens | IC50 | = | 69.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2003 | Cell line | LS-1034 | Homo sapiens | IC50 | = | 9492.4 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2004 | Cell line | LS-123 | Homo sapiens | IC50 | = | 7325.59 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2005 | Cell line | MHH-NB-11 | Homo sapiens | IC50 | = | 0.8418 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1996 | Cell line | NB5 | Homo sapiens | IC50 | = | 1.925 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2007 | Cell line | NB6 | Homo sapiens | IC50 | = | 182.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2368 | Cell line | NCI-H2030 | Homo sapiens | IC50 | = | 48.53 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2369 | Cell line | NCI-H2052 | Homo sapiens | IC50 | = | 28.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | IC50 | = | 188.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | IC50 | = | 43.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2370 | Cell line | RVH-421 | Homo sapiens | IC50 | = | 71.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT406 | Cell line | RXF 393 | Homo sapiens | IC50 | = | 4.662 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1506 | Cell line | SK-MES-1 | Homo sapiens | IC50 | = | 10.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2371 | Cell line | SW837 | Homo sapiens | IC50 | = | 48.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2014 | Cell line | SW872 | Homo sapiens | IC50 | = | 24.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1045 | Cell line | U2OS | Homo sapiens | IC50 | = | 13.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2015 | Cell line | U-266 | Homo sapiens | IC50 | = | 69.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2016 | Cell line | ES6 | Homo sapiens | IC50 | = | 88.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2017 | Cell line | ES7 | Homo sapiens | IC50 | = | 0.02543 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2000 | Cell line | GR-ST | Homo sapiens | IC50 | = | 0.701 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2018 | Cell line | GT3TKB | Homo sapiens | IC50 | = | 1.759 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2372 | Cell line | H-EMC-SS | Homo sapiens | IC50 | = | 95.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT372 | Cell line | HOP-92 | Homo sapiens | IC50 | = | 8.787 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT307 | Cell line | HOS | Homo sapiens | IC50 | = | 1.398 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2019 | Cell line | JVM-2 | Homo sapiens | IC50 | = | 3029.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2020 | Cell line | JVM-3 | Homo sapiens | IC50 | = | 2.504 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2373 | Cell line | KYSE-150 cell line | n.a. | IC50 | = | 245.96 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2374 | Cell line | KYSE-180 | Homo sapiens | IC50 | = | 13.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2021 | Cell line | LS-411N | Homo sapiens | IC50 | = | 58.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2006 | Cell line | MHH-PREB-1 | Homo sapiens | IC50 | = | 2.733 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | IC50 | = | 2.759 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2375 | Cell line | MKN-1 | Homo sapiens | IC50 | = | 37.91 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2008 | Cell line | NB69 | Homo sapiens | IC50 | = | 0.5694 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2023 | Cell line | NB7 | Homo sapiens | IC50 | = | 16.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2376 | Cell line | NBsusSR | Homo sapiens | IC50 | = | 0.1936 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2377 | Cell line | NCI-H2087 | Homo sapiens | IC50 | = | 5.074 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2024 | Cell line | NCI-H209 | Homo sapiens | IC50 | = | 0.04843 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2012 | Cell line | NCI-H720 | Homo sapiens | IC50 | = | 44.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2378 | Cell line | NCI-H727 | Homo sapiens | IC50 | = | 1009.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2025 | Cell line | NCI-H747 | Homo sapiens | IC50 | = | 296.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | IC50 | = | 7.272 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2379 | Cell line | P12-Ichikawa | Homo sapiens | IC50 | = | 0.1016 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2026 | Cell line | Ramos-2G6-4C10 | Homo sapiens | IC50 | = | 10.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2380 | Cell line | SK-N-AS | Homo sapiens | IC50 | = | 5.377 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2027 | Cell line | SK-N-DZ | Homo sapiens | IC50 | = | 21.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2381 | Cell line | SW900 | Homo sapiens | IC50 | = | 31.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2382 | Cell line | SW948 | Homo sapiens | IC50 | = | 260.2 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1535 | Cell line | U-87 MG | Homo sapiens | IC50 | = | 6.632 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2031 | Cell line | ES8 | Homo sapiens | IC50 | = | 0.7956 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2383 | Cell line | ESS-1 | Homo sapiens | IC50 | = | 7.079 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2891 | Cell line | H4 | Homo sapiens | IC50 | = | 0.6154 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT759 | Cell line | H9 | Homo sapiens | IC50 | = | 0.3582 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2032 | Cell line | HAL-01 | Homo sapiens | IC50 | = | 2.551 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2384 | Cell line | HPAF-II | Homo sapiens | IC50 | = | 55.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT924 | Cell line | HSC-2 | Homo sapiens | IC50 | = | 11.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2385 | Cell line | HSC-3 | Homo sapiens | IC50 | = | 3.015 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 1077.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2386 | Cell line | KYSE-270 | Homo sapiens | IC50 | = | 5.223 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2387 | Cell line | KYSE-410 | Homo sapiens | IC50 | = | 78.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2022 | Cell line | LS-513 | Homo sapiens | IC50 | = | 19.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2034 | Cell line | LU-134-A | Homo sapiens | IC50 | = | 0.5865 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2388 | Cell line | LU-135 | Homo sapiens | IC50 | = | 28.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1179 | Cell line | MKN-28 | Homo sapiens | IC50 | = | 51.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1097 | Cell line | MKN-45 | Homo sapiens | IC50 | = | 27.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2389 | Cell line | NCI-H1048 | Homo sapiens | IC50 | = | 0.5292 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2036 | Cell line | NCI-H1092 | Homo sapiens | IC50 | = | 43.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2390 | Cell line | NCI-H2122 | Homo sapiens | IC50 | = | 12.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1082 | Cell line | NCI-H2126 | Homo sapiens | IC50 | = | 178.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2391 | Cell line | NCI-H810 | Homo sapiens | IC50 | = | 50.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2040 | Cell line | P30-OHK | Homo sapiens | IC50 | = | 2.792 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2392 | Cell line | S-117 | Homo sapiens | IC50 | = | 78.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2393 | Cell line | SAS | Homo sapiens | IC50 | = | 1.241 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2028 | Cell line | SK-N-FI | Homo sapiens | IC50 | = | 106.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2043 | Cell line | SK-NEP-1 | Homo sapiens | IC50 | = | 1.227 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2029 | Cell line | SW 954 | Homo sapiens | IC50 | = | 20.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2044 | Cell line | SW 962 | Homo sapiens | IC50 | = | 20.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT371 | Cell line | UO-31 | Homo sapiens | IC50 | = | 34.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT380 | Cell line | U-251 | Homo sapiens | IC50 | = | 1.869 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2045 | Cell line | ETK-1 | Homo sapiens | IC50 | = | 34.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2047 | Cell line | HC-1 | Homo sapiens | IC50 | = | 3.344 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2394 | Cell line | HSC-4 | Homo sapiens | IC50 | = | 0.1816 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2049 | Cell line | HT | Homo sapiens | IC50 | = | 29.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2051 | Cell line | K5 | Homo sapiens | IC50 | = | 3.201 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2395 | Cell line | KYSE-450 | Homo sapiens | IC50 | = | 23.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2396 | Cell line | KYSE-510 | Homo sapiens | IC50 | = | 6.754 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2397 | Cell line | KYSE-520 cell line | n.a. | IC50 | = | 82.56 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2053 | Cell line | LU-139 | Homo sapiens | IC50 | = | 16.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2398 | Cell line | MKN-7 | Homo sapiens | IC50 | = | 144.23 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2055 | Cell line | ML-2 | Homo sapiens | IC50 | = | 2.165 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2057 | Cell line | NCI-H1155 | Homo sapiens | IC50 | = | 1.188 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2399 | Cell line | NCI-H2170 | Homo sapiens | IC50 | = | 13.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2039 | Cell line | NCI-H82 | Homo sapiens | IC50 | = | 588.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2400 | Cell line | PA-1 | Homo sapiens | IC50 | = | 0.981 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2401 | Cell line | PANC-03-27 | Homo sapiens | IC50 | = | 7.103 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2402 | Cell line | PANC-08-13 | Homo sapiens | IC50 | = | 44.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2042 | Cell line | SBC-1 | Homo sapiens | IC50 | = | 27.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2403 | Cell line | SBC-5 | Homo sapiens | IC50 | = | 32.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 7210.91 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2063 | Cell line | SK-PN-DW | Homo sapiens | IC50 | = | 1.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2404 | Cell line | SW982 | Homo sapiens | IC50 | = | 4.062 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2405 | Cell line | SAOS-2 | Homo sapiens | IC50 | = | 17.77 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT403 | Cell line | UACC-257 | Homo sapiens | IC50 | = | 115.96 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT398 | Cell line | UACC-62 | Homo sapiens | IC50 | = | 31.03 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2065 | Cell line | EW-1 | Homo sapiens | IC50 | = | 1.777 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2048 | Cell line | HCC1187 | Homo sapiens | IC50 | = | 314.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2406 | Cell line | HCC1395 | Homo sapiens | IC50 | = | 1367.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2407 | Cell line | HCC1419 | Homo sapiens | IC50 | = | 4155.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | IC50 | = | 0.3944 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT658 | Cell line | HT1197 | Homo sapiens | IC50 | = | 1093.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2052 | Cell line | KALS-1 | Homo sapiens | IC50 | = | 69.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2067 | Cell line | KARPAS-299 | Homo sapiens | IC50 | = | 2892.53 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2408 | Cell line | KYSE-70 cell line | n.a. | IC50 | = | 92.14 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2068 | Cell line | L-363 | Homo sapiens | IC50 | = | 1.869 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2069 | Cell line | Lu-65 | Homo sapiens | IC50 | = | 276.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2409 | Cell line | LU-99A | Homo sapiens | IC50 | = | 3.854 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2056 | Cell line | MLMA | Homo sapiens | IC50 | = | 8.145 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2071 | Cell line | MMAC-SF | Homo sapiens | IC50 | = | 38.4 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | IC50 | = | 9.425 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2073 | Cell line | NCI-H1304 | Homo sapiens | IC50 | = | 59.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2411 | Cell line | NCI-H2228 | Homo sapiens | IC50 | = | 49.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT465 | Cell line | NCI-N87 | Homo sapiens | IC50 | = | 8.743 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT788 | Cell line | SNU1 | Homo sapiens | IC50 | = | 1.088 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2412 | Cell line | Panc1005 | Homo sapiens | IC50 | = | 19.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2413 | Cell line | PC-14 | Homo sapiens | IC50 | = | 13.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2062 | Cell line | SCC-15 | Homo sapiens | IC50 | = | 18.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2414 | Cell line | SCC-25 | Homo sapiens | IC50 | = | 56.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2078 | Cell line | SK-UT-1 | Homo sapiens | IC50 | = | 3.067 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2415 | Cell line | SKG-IIIa | Homo sapiens | IC50 | = | 4.582 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2245 | Cell line | SiHa | Homo sapiens | IC50 | = | 86.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT550 | Cell line | T-24 | Homo sapiens | IC50 | = | 1.614 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 13.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2416 | Cell line | UACC-893 | Homo sapiens | IC50 | = | 383.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2417 | Cell line | UMUC3 | Homo sapiens | IC50 | = | 3.093 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2066 | Cell line | EW-11 | Homo sapiens | IC50 | = | 2.659 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2080 | Cell line | EW-13 | Homo sapiens | IC50 | = | 3.267 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2418 | Cell line | HCC1569 | Homo sapiens | IC50 | = | 267.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2419 | Cell line | HT-1376 | Homo sapiens | IC50 | = | 1780.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2082 | Cell line | HT-144 | Homo sapiens | IC50 | = | 17.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2084 | Cell line | KARPAS-45 | Homo sapiens | IC50 | = | 134.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2086 | Cell line | L-428 | Homo sapiens | IC50 | = | 148.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2070 | Cell line | LXF-289 cell line | n.a. | IC50 | = | 7.054 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT114 | Cell line | LoVo | Homo sapiens | IC50 | = | 14.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2072 | Cell line | MN-60 | Homo sapiens | IC50 | = | 5.083 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT3466 | Cell line | MOLT-13 | Homo sapiens | IC50 | = | 1.787 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2074 | Cell line | NCI-H1355 | Homo sapiens | IC50 | = | 66.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2089 | Cell line | NCI-H1395 | Homo sapiens | IC50 | = | 110.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | IC50 | = | 22.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2420 | Cell line | NCI-H2291 | Homo sapiens | IC50 | = | 975.25 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2091 | Cell line | SNU-5 | Homo sapiens | IC50 | = | 42.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 9.753 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2421 | Cell line | PFSK-1 | Homo sapiens | IC50 | = | 26.03 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2422 | Cell line | SCC-4 | Homo sapiens | IC50 | = | 19.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2423 | Cell line | SCC-9 | Homo sapiens | IC50 | = | 33.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT368 | Cell line | SN12C | Homo sapiens | IC50 | = | 4.503 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT392 | Cell line | SNB-75 | Homo sapiens | IC50 | = | 17.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2424 | Cell line | T84 | Homo sapiens | IC50 | = | 4602.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1125 | Cell line | T98G | Homo sapiens | IC50 | = | 27.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2425 | Cell line | UMC-11 | Homo sapiens | IC50 | = | 2511.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2096 | Cell line | VA-ES-BJ | Homo sapiens | IC50 | = | 3.469 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2097 | Cell line | EW-16 | Homo sapiens | IC50 | = | 0.1214 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2426 | Cell line | HCC1806 | Homo sapiens | IC50 | = | 3.143 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1884 | Cell line | HCC1937 | Homo sapiens | IC50 | = | 349.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2427 | Cell line | HCC1954 | Homo sapiens | IC50 | = | 266.61 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 85.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2428 | Cell line | HT-3 | Homo sapiens | IC50 | = | 0.2119 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2429 | Cell line | HT55 | Homo sapiens | IC50 | = | 192.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2085 | Cell line | Kasumi 1 | n.a. | IC50 | = | 4.066 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2099 | Cell line | KE-37 | Homo sapiens | IC50 | = | 1.535 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1358 | Cell line | LAMA-84 | Homo sapiens | IC50 | = | 7.02 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2101 | Cell line | LAN-6 | Homo sapiens | IC50 | = | 124.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2430 | Cell line | M059J | Homo sapiens | IC50 | = | 4.095 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT387 | Cell line | M14 | Homo sapiens | IC50 | = | 9.948 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2088 | Cell line | MOLT-16 | Homo sapiens | IC50 | = | 0.7318 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 1.616 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2431 | Cell line | NCI-H1437 | Homo sapiens | IC50 | = | 34.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | IC50 | = | 40.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2432 | Cell line | NCI-H2342 | Homo sapiens | IC50 | = | 618.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2092 | Cell line | NEC8 | Homo sapiens | IC50 | = | 3.108 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2106 | Cell line | NH-12 | Homo sapiens | IC50 | = | 3.793 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2107 | Cell line | PSN1 | Homo sapiens | IC50 | = | 3.069 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2109 | Cell line | SCH | Homo sapiens | IC50 | = | 628.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT890 | Cell line | SNU-387 | Homo sapiens | IC50 | = | 256.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2433 | Cell line | SNU-423 | Homo sapiens | IC50 | = | 128.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2434 | Cell line | TCC-SUP | Homo sapiens | IC50 | = | 39.04 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2435 | Cell line | VM-CUB-1 | Homo sapiens | IC50 | = | 2.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2436 | Cell line | VMRC-RCZ | Homo sapiens | IC50 | = | 47.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1653 | Cell line | WM-115 | Homo sapiens | IC50 | = | 102.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2098 | Cell line | EW-18 | Homo sapiens | IC50 | = | 150.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2437 | Cell line | EW-22 | Homo sapiens | IC50 | = | 0.5566 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2113 | Cell line | EW-24 | Homo sapiens | IC50 | = | 4.033 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2116 | Cell line | HCC2218 | Homo sapiens | IC50 | = | 55.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2438 | Cell line | HTC-C3 | Homo sapiens | IC50 | = | 31.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2117 | Cell line | HuTu80 | Homo sapiens | IC50 | = | 3.382 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2100 | Cell line | KG-1 | n.a. | IC50 | = | 1.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2118 | Cell line | KGN | Homo sapiens | IC50 | = | 10.59 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2120 | Cell line | LB1047-RCC | Homo sapiens | IC50 | = | 7.897 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2121 | Cell line | LB2241-RCC | Homo sapiens | IC50 | = | 2.076 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2439 | Cell line | MC-IXC | Homo sapiens | IC50 | = | 0.513 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2122 | Cell line | MC116 | Homo sapiens | IC50 | = | 15.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2123 | Cell line | MPP-89 | Homo sapiens | IC50 | = | 27.24 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2440 | Cell line | NCI-H1563 | Homo sapiens | IC50 | = | 150.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2441 | Cell line | NCI-H2347 | Homo sapiens | IC50 | = | 185.61 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2442 | Cell line | NCI-H2405 | Homo sapiens | IC50 | = | 58.48 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2126 | Cell line | NKM-1 | Homo sapiens | IC50 | = | 0.441 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2127 | Cell line | NMC-G1 | Homo sapiens | IC50 | = | 19.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2108 | Cell line | QIMR-WIL | Homo sapiens | IC50 | = | 0.7753 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2128 | Cell line | RCC10RGB | Homo sapiens | IC50 | = | 113.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2111 | Cell line | SF-126 | Homo sapiens | IC50 | = | 2.835 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 3.379 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2443 | Cell line | SNU-449 | Homo sapiens | IC50 | = | 194.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2112 | Cell line | TE-1 | Homo sapiens | IC50 | = | 35.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2130 | Cell line | TE-10 | Homo sapiens | IC50 | = | 147.61 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2444 | Cell line | YAPC | Homo sapiens | IC50 | = | 29.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2445 | Cell line | YH-13 | Homo sapiens | IC50 | = | 11.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2114 | Cell line | EW-3 | Homo sapiens | IC50 | = | 0.3192 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2132 | Cell line | EOL1 | Homo sapiens | IC50 | = | 0.2708 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | IC50 | = | 150.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2446 | Cell line | HCC38 | Homo sapiens | IC50 | = | 12.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT402 | Cell line | Hs-578T | Homo sapiens | IC50 | = | 144.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2447 | Cell line | HuCCT-1 | Homo sapiens | IC50 | = | 73.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2119 | Cell line | KINGS-1 | Homo sapiens | IC50 | = | 332.9 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2448 | Cell line | KLE | Homo sapiens | IC50 | = | 411.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2134 | Cell line | LB2518-MEL | Homo sapiens | IC50 | = | 87.25 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 6.427 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2137 | Cell line | MS-1 | Homo sapiens | IC50 | = | 2.774 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2138 | Cell line | MSTO-211H | Homo sapiens | IC50 | = | 8.238 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2449 | Cell line | NCI-H1573 | Homo sapiens | IC50 | = | 173.4 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2139 | Cell line | NCI-H1581 | Homo sapiens | IC50 | = | 33.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2450 | Cell line | NCI-H2452 | Homo sapiens | IC50 | = | 90.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2451 | Cell line | NCI-H28 | Homo sapiens | IC50 | = | 38.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2452 | Cell line | NCI-H292 | n.a. | IC50 | = | 2.24 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2140 | Cell line | NOMO-1 | Homo sapiens | IC50 | = | 1.557 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2453 | Cell line | RCM-1 | Homo sapiens | IC50 | = | 28.66 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2454 | Cell line | RD | Homo sapiens | IC50 | = | 15.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT399 | Cell line | SF-295 | Homo sapiens | IC50 | = | 7.909 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT374 | Cell line | SF-539 | Homo sapiens | IC50 | = | 9.009 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2455 | Cell line | SNU-C2B | Homo sapiens | IC50 | = | 35.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2456 | Cell line | TE-11 | Homo sapiens | IC50 | = | 16.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2144 | Cell line | TE-12 | Homo sapiens | IC50 | = | 265.25 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2457 | Cell line | YKG-1 | Homo sapiens | IC50 | = | 5.453 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT994 | Cell line | ZR-75-30 | Homo sapiens | IC50 | = | 261.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1216 | Cell line | FaDu | Homo sapiens | IC50 | = | 0.5392 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2458 | Cell line | FTC-133 | Homo sapiens | IC50 | = | 4.567 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2459 | Cell line | HCC70 | Homo sapiens | IC50 | = | 45.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2460 | Cell line | HCE-4 | Homo sapiens | IC50 | = | 1.814 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | = | 115.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2461 | Cell line | HuO-3N1 | Homo sapiens | IC50 | = | 12.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2462 | Cell line | HuO9 | Homo sapiens | IC50 | = | 2.881 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2133 | Cell line | KM-H2 | Homo sapiens | IC50 | = | 55.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT386 | Cell line | KM12 | Homo sapiens | IC50 | = | 74.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2135 | Cell line | LB373-MEL-D | Homo sapiens | IC50 | = | 91.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2148 | Cell line | LB771-HNC | Homo sapiens | IC50 | = | 196.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2463 | Cell line | MDA-MB-157 | Homo sapiens | IC50 | = | 7.569 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2464 | Cell line | MDA-MB-175-VII | Homo sapiens | IC50 | = | 83.02 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 229.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1649 | Cell line | MV4-11 | Homo sapiens | IC50 | = | 0.7058 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2465 | Cell line | NCI-H1623 | Homo sapiens | IC50 | = | 0.7479 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2150 | Cell line | NCI-H1648 | Homo sapiens | IC50 | = | 38.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2466 | Cell line | NCI-H358 | Homo sapiens | IC50 | = | 105.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2141 | Cell line | NOS-1 | Homo sapiens | IC50 | = | 91.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2152 | Cell line | NTERA-2-cl-D1 | Homo sapiens | IC50 | = | 0.2738 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2467 | Cell line | RERF-LC-MS | Homo sapiens | IC50 | = | 22.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2153 | Cell line | RH-1 | Homo sapiens | IC50 | = | 3.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2154 | Cell line | SH-4 | Homo sapiens | IC50 | = | 59.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2155 | Cell line | SHP77 | Homo sapiens | IC50 | = | 1543.63 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2159 | Cell line | TE-5 | Homo sapiens | IC50 | = | 7.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2160 | Cell line | no-10 | Homo sapiens | IC50 | = | 174.04 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2468 | Cell line | G-361 | Homo sapiens | IC50 | = | 2544.45 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2469 | Cell line | G-401 | Homo sapiens | IC50 | = | 19.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2470 | Cell line | G-402 | Homo sapiens | IC50 | = | 24.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2162 | Cell line | HCE-T | Homo sapiens | IC50 | = | 5.469 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 5.051 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2471 | Cell line | HuP-T3 | Homo sapiens | IC50 | = | 36.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2472 | Cell line | HuP-T4 | Homo sapiens | IC50 | = | 0.8814 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2163 | Cell line | KMOE-2 | Homo sapiens | IC50 | = | 11.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2166 | Cell line | LB831-BLC | Homo sapiens | IC50 | = | 18.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2473 | Cell line | MDA-MB-361 | Homo sapiens | IC50 | = | 34.43 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2474 | Cell line | MDA-MB-415 | Homo sapiens | IC50 | = | 134.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2149 | Cell line | MZ1-PC | Homo sapiens | IC50 | = | 20.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2168 | Cell line | MZ2-MEL | Homo sapiens | IC50 | = | 14.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1820 | Cell line | NCI-H1650 | Homo sapiens | IC50 | = | 149.39 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2475 | Cell line | NCI-H1651 | Homo sapiens | IC50 | = | 14.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2476 | Cell line | NCI-H441 | Homo sapiens | IC50 | = | 28.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT937 | Cell line | NCI-H446 | Homo sapiens | IC50 | = | 56.63 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2477 | Cell line | NUGC-3 | Homo sapiens | IC50 | = | 3.136 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2478 | Cell line | NY | Homo sapiens | IC50 | = | 4356.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2479 | Cell line | OAW-28 | Homo sapiens | IC50 | = | 7.263 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2480 | Cell line | RH-18 | Homo sapiens | IC50 | = | 389.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2170 | Cell line | RKO | Homo sapiens | IC50 | = | 4.23 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2481 | Cell line | SW1088 | Homo sapiens | IC50 | = | 27.77 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2482 | Cell line | SW 1116 | Homo sapiens | IC50 | = | 190.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2483 | Cell line | SW13 | Homo sapiens | IC50 | = | 2.993 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2173 | Cell line | TE-6 | Homo sapiens | IC50 | = | 178.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2161 | Cell line | no-11 | Homo sapiens | IC50 | = | 113.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2175 | Cell line | GAK | Homo sapiens | IC50 | = | 218.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2484 | Cell line | GAMG | Homo sapiens | IC50 | = | 1.527 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 776.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2176 | Cell line | HD-MY-Z | Homo sapiens | IC50 | = | 1.634 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2485 | Cell line | IA-LM | Homo sapiens | IC50 | = | 12.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2486 | Cell line | IGR-1 | Homo sapiens | IC50 | = | 151.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 36.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2165 | Cell line | KNS-42 | Homo sapiens | IC50 | = | 33.14 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2487 | Cell line | KNS-62 | Homo sapiens | IC50 | = | 7.701 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2180 | Cell line | LC-2-ad | Homo sapiens | IC50 | = | 2.806 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2488 | Cell line | MDA-MB-453 | Homo sapiens | IC50 | = | 6.965 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1773 | Cell line | ME-180 | Homo sapiens | IC50 | = | 2.692 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2169 | Cell line | MZ7-mel | Homo sapiens | IC50 | = | 8.612 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2489 | Cell line | MeWo | Homo sapiens | IC50 | = | 46.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2490 | Cell line | NCI-H1666 | Homo sapiens | IC50 | = | 18.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2491 | Cell line | NCI-H1693 | Homo sapiens | IC50 | = | 26.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 24.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2184 | Cell line | NCI-H510A | Homo sapiens | IC50 | = | 1.699 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2492 | Cell line | OAW-42 | Homo sapiens | IC50 | = | 8.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2493 | Cell line | OC-314 | Homo sapiens | IC50 | = | 2.506 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2494 | Cell line | RMG-I | Homo sapiens | IC50 | = | 244.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT3467 | Cell line | SJRH30 | Homo sapiens | IC50 | = | 298.06 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2188 | Cell line | SJSA-1 | Homo sapiens | IC50 | = | 18.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2495 | Cell line | SW1417 | Homo sapiens | IC50 | = | 52.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2496 | Cell line | SW1463 | Homo sapiens | IC50 | = | 51.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1577 | Cell line | SW1573 | Homo sapiens | IC50 | = | 2.348 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2174 | Cell line | TE-8 | Homo sapiens | IC50 | = | 4.17 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2189 | Cell line | TE-9 | Homo sapiens | IC50 | = | 23.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1354 | Cell line | TGBC11TKB | Homo sapiens | IC50 | = | 12.24 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2190 | Cell line | GB-1 | Homo sapiens | IC50 | = | 4.677 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2177 | Cell line | HDLM-2 | Homo sapiens | IC50 | = | 486.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2497 | Cell line | HEC-1 | Homo sapiens | IC50 | = | 18.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2178 | Cell line | KNS-81-FD | Homo sapiens | IC50 | = | 19.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2498 | Cell line | KOSC-2 | Homo sapiens | IC50 | = | 4.393 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2499 | Cell line | KP-4 | Homo sapiens | IC50 | = | 3.162 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2500 | Cell line | LCLC-103H cell line | n.a. | IC50 | = | 20.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2181 | Cell line | MEG-01 | Homo sapiens | IC50 | = | 39.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2501 | Cell line | MEL-HO | Homo sapiens | IC50 | = | 7.628 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2502 | Cell line | MEL-JUSO | Homo sapiens | IC50 | = | 35.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2503 | Cell line | NCI-H1703 | Homo sapiens | IC50 | = | 6.515 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2504 | Cell line | NCI-H1755 | Homo sapiens | IC50 | = | 208.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2505 | Cell line | NCI-H520 | n.a. | IC50 | = | 162.01 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2185 | Cell line | OCI-AML2 | Homo sapiens | IC50 | = | 0.8868 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2199 | Cell line | OCUB-M | Homo sapiens | IC50 | = | 38.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2506 | Cell line | RO82-W-1 | Homo sapiens | IC50 | = | 14.91 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2507 | Cell line | RPMI-2650 | Homo sapiens | IC50 | = | 2.217 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1086 | Cell line | SK-HEP1 | Homo sapiens | IC50 | = | 7.253 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2201 | Cell line | SK-LMS-1 | Homo sapiens | IC50 | = | 180.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2508 | Cell line | SW1710 | Homo sapiens | IC50 | = | 33.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2509 | Cell line | SW1783 | Homo sapiens | IC50 | = | 24.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2202 | Cell line | TGBC1TKB | Homo sapiens | IC50 | = | 109.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2191 | Cell line | GCIY | Homo sapiens | IC50 | = | 66.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2510 | Cell line | GCT | Homo sapiens | IC50 | = | 5.023 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 6.311 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2511 | Cell line | HGC-27 | Homo sapiens | IC50 | = | 4.073 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2205 | Cell line | IST-MEL1 | Homo sapiens | IC50 | = | 3.81 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2206 | Cell line | IST-MES1 | Homo sapiens | IC50 | = | 10.56 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2207 | Cell line | KP-N-YN | Homo sapiens | IC50 | = | 102.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2208 | Cell line | KP-N-YS | Homo sapiens | IC50 | = | 736.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2512 | Cell line | LCLC-97TM1 | Homo sapiens | IC50 | = | 8.136 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2513 | Cell line | LK-2 | Homo sapiens | IC50 | = | 35.53 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2514 | Cell line | LN-405 | Homo sapiens | IC50 | = | 517.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2515 | Cell line | MFE-280 | Homo sapiens | IC50 | = | 21.56 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2210 | Cell line | NB10 | Homo sapiens | IC50 | = | 0.6143 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2211 | Cell line | NB12 | Homo sapiens | IC50 | = | 44.02 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2197 | Cell line | NCI-H1770 | Homo sapiens | IC50 | = | 157.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1669 | Cell line | NCI-H1792 | Homo sapiens | IC50 | = | 40.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT306 | Cell line | PC-3 | Homo sapiens | Activity | = | 4.76 | % | PMID[24910974] |
| NPT306 | Cell line | PC-3 | Homo sapiens | Activity | = | 4.94 | % | PMID[24910974] |
| NPT306 | Cell line | PC-3 | Homo sapiens | Activity | = | 30.17 | % | PMID[24910974] |
| NPT306 | Cell line | PC-3 | Homo sapiens | Activity | = | 60.44 | % | PMID[24910974] |
| NPT2548 | Cell line | SNU-638 | Homo sapiens | IC50 | = | 280.0 | nM | PMID[23608763] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 70.0 | nM | PMID[23608763] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 32300.0 | nM | PMID[23562244] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Ratio | = | 0.64 | n.a. | PMID[23665106] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI | = | 52.0 | % | PMID[23602620] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 48.33 | % | PMID[23602620] |
| NPT4475 | Cell line | CEM/C2 | Homo sapiens | GI50 | = | 1000.0 | nM | PMID[23750455] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | RatioGI50 | = | 500.0 | n.a. | PMID[23750455] |
| NPT139 | Cell line | HT-29 | Homo sapiens | TGI | = | 790.0 | nM | PMID[23831811] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 13.0 | nM | PMID[24900725] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 162.0 | nM | PMID[24900725] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 99.0 | nM | PMID[24900725] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 78.0 | nM | PMID[24900725] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 31.0 | nM | PMID[24900725] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[24900725] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 24.0 | nM | PMID[24900725] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 0.04 | nM | PMID[24900725] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | IC50 | = | 0.4 | ug.mL-1 | PMID[23816880] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 16.0 | nM | PMID[24033077] |
| NPT1183 | Cell line | WiDr | Homo sapiens | GI50 | = | 1800.0 | nM | PMID[23831507] |
| NPT1577 | Cell line | SW1573 | Homo sapiens | GI50 | = | 250.0 | nM | PMID[23831507] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[24041234] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 1200.0 | nM | DOI[10.1039/C4MD00344F] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | IC50 | = | 190.0 | nM | PMID[24041234] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[24041234] |
| NPT2454 | Cell line | RD | Homo sapiens | Activity | = | 0.67 | % | PMID[23974020] |
| NPT2454 | Cell line | RD | Homo sapiens | Activity | = | 3.1 | % | PMID[23974020] |
| NPT2454 | Cell line | RD | Homo sapiens | Activity | = | 4.08 | % | PMID[23974020] |
| NPT2454 | Cell line | RD | Homo sapiens | Activity | = | 92.16 | % | PMID[23974020] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 37050.0 | nM | PMID[23974020] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 780.0 | nM | PMID[24013413] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 390.0 | nM | PMID[24013413] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 420.0 | nM | PMID[24013413] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 300.0 | nM | PMID[24013413] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 21.6 | % | DOI[10.1039/C5MD00289C] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 2.4 | % | DOI[10.1039/C5MD00289C] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 74.8 | % | DOI[10.1039/C5MD00289C] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 1.2 | % | DOI[10.1039/C5MD00289C] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 50.5 | % | PMID[24056146] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[24069881] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | < | 1.0 | nM | PMID[24069881] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 650.0 | nM | PMID[24069881] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[24180210] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[24180210] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[24180210] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 0.7 | nM | PMID[24200393] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3.3 | nM | PMID[24200393] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 130.0 | nM | PMID[24200393] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[24303808] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[24303808] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[24303808] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[24360564] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[24360564] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[24484281] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 80.0 | nM | PMID[24484281] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | RatioGI50 | = | 2.04 | n.a. | PMID[24502276] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 35.48 | nM | PMID[24502276] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 17.38 | nM | PMID[24502276] |
| NPT90 | Cell line | DU-145 | Homo sapiens | RatioGI50 | > | 54.85 | n.a. | PMID[24502276] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 18.2 | nM | PMID[24502276] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 40.9 | % | PMID[24502276] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 46.1 | % | DOI[10.1039/C3MD00055A] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 53.3 | % | DOI[10.1039/C3MD00055A] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 61.8 | % | DOI[10.1039/C3MD00055A] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 0.0 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 17.0 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 42.0 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 40.0 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 80.5 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 19.5 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 23.5 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 62.0 | % | DOI[10.1039/C3MD00399J] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 53.0 | % | DOI[10.1039/C3MD00399J] |
| NPT168 | Cell line | P388 | Mus musculus | ED50 | = | 8.6 | 10'-6umol/ml | PMID[423214] |
| NPT137 | Cell line | L1210 | Mus musculus | ED50 | = | 2.8 | 10'-6umol/ml | PMID[423214] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 81.0 | % | PMID[423214] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 204.0 | % | PMID[423214] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 147.0 | % | PMID[423214] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 137.0 | % | PMID[423214] |
| NPT137 | Cell line | L1210 | Mus musculus | T/C | = | 85.0 | % | PMID[423214] |
| NPT137 | Cell line | L1210 | Mus musculus | T/C | = | 168.0 | % | PMID[423214] |
| NPT137 | Cell line | L1210 | Mus musculus | T/C | = | 131.0 | % | PMID[423214] |
| NPT137 | Cell line | L1210 | Mus musculus | T/C | = | 114.0 | % | PMID[423214] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | IC50 | = | 0.03 | ug.mL-1 | PMID[24593048] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 280.0 | nM | PMID[24904965] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 4010.0 | nM | PMID[24904965] |
| NPT165 | Cell line | HeLa | Homo sapiens | Activity | = | 33.1 | % | DOI[10.1039/C2MD20098H] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 110.0 | nM | PMID[26361737] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | < | 0.024 | ug.mL-1 | PMID[24940955] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 79.6 | % | PMID[25062005] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 11.0 | % | PMID[25062005] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 4.9 | % | PMID[25062005] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 2.2 | % | PMID[25062005] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 30.8 | % | PMID[25062005] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 280.0 | nM | PMID[25062006] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 950.0 | nM | PMID[25062006] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 750.0 | nM | PMID[25062006] |
| NPT3881 | Cell line | MX1 | Homo sapiens | IC50 | = | 1700.0 | nM | PMID[24901491] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 65.1 | nM | PMID[24901491] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 510.0 | nM | PMID[24901491] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 1.64 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 15.22 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 36.98 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 51.12 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 81.62 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 83.26 | % | PMID[24980118] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 420.0 | nM | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 56.16 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 41.38 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 13.7 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 1.4 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 4.1 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 3.18 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 2.76 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 4.32 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 3.04 | % | PMID[24980118] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Activity | = | 0.12 | % | PMID[24980118] |
| NPT1083 | Cell line | A-375 | Homo sapiens | IC50 | = | 187.0 | nM | PMID[24980118] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 110.0 | nM | PMID[24980118] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 342.0 | nM | PMID[24980118] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 29.0 | nM | PMID[25003995] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 37.0 | nM | PMID[26994847] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 16.0 | nM | PMID[26994847] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 0.5 | nM | PMID[25084144] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1300.0 | nM | PMID[25084144] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1.0 | nM | PMID[27017547] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[25237727] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 0.6 | nM | PMID[25247770] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 49.0 | % | PMID[25259515] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 96.1 | % | PMID[25259515] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 126.0 | % | PMID[25259515] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 29.0 | % | PMID[25881826] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 48.5 | % | PMID[25881826] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 30.0 | % | PMID[25881826] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 130.0 | nM | PMID[25590864] |
| NPT737 | Cell line | HUVEC | Homo sapiens | IC50 | = | 200.0 | nM | PMID[25590864] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 5370.0 | nM | PMID[25599951] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 11620.0 | nM | PMID[25599951] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 26450.0 | nM | PMID[25599951] |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | IC50 | = | 2.05 | ug.mL-1 | PMID[25867737] |
| NPT1893 | Cell line | MEF | Mus musculus | IC50 | = | 5.87 | ug.mL-1 | PMID[25867737] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Inhibition | = | 45.31 | % | PMID[25453788] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 2820.0 | nM | PMID[25936262] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 1840.0 | nM | PMID[26945111] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 180.0 | nM | PMID[26945111] |
| NPT1329 | Cell line | Detroit 551 | Homo sapiens | IC50 | = | 990.0 | nM | DOI[10.1039/C4MD00133H] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | IC50 | = | 3140.0 | nM | DOI[10.1039/C4MD00133H] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 2110.0 | nM | DOI[10.1039/C4MD00133H] |
| NPT196 | Cell line | AGS | Homo sapiens | IC50 | = | 23760.0 | nM | DOI[10.1039/C4MD00133H] |
| NPT2393 | Cell line | SAS | Homo sapiens | IC50 | = | 6000.0 | nM | DOI[10.1039/C4MD00133H] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 520.0 | nM | PMID[26022080] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 310.0 | nM | PMID[26022080] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 410.0 | nM | PMID[26022080] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[26226379] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 90.0 | nM | PMID[26226379] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[26226379] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[26226379] |
| NPT937 | Cell line | NCI-H446 | Homo sapiens | IC50 | > | 200000.0 | nM | PMID[26226379] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | < | 3.0 | nM | PMID[26226379] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[26188908] |
| NPT1917 | Cell line | CA46 | Homo sapiens | IC50 | = | 520.0 | nM | PMID[26188908] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 14000.0 | nM | PMID[26188908] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1600.0 | nM | PMID[26188908] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 300.0 | nM | PMID[26361737] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 80.0 | nM | PMID[26361737] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 52.4 | % | PMID[26222449] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[25799376] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[25799376] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 6080.0 | nM | PMID[26334499] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 1620.0 | nM | PMID[26334499] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1590.0 | nM | PMID[26334499] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | IC50 | = | 14760.0 | nM | PMID[26602827] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 5770.0 | nM | PMID[26602827] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 6130.0 | nM | PMID[26602827] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | <= | 100.0 | nM | PMID[26810835] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | < | 1000.0 | nM | PMID[26810835] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[26649907] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Ratio IC50 | = | 0.5 | n.a. | PMID[26649907] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 19800.0 | nM | PMID[26649907] |
| NPT165 | Cell line | HeLa | Homo sapiens | Ratio IC50 | = | 0.1 | n.a. | PMID[26649907] |
| NPT2430 | Cell line | M059J | Homo sapiens | IC50 | = | 5500.0 | nM | PMID[26649907] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity_index | = | 1.55 | n.a. | PMID[26703795] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity_index | = | 1.11 | n.a. | PMID[26703795] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity_index | = | 0.33 | n.a. | PMID[26703795] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 85.0 | nM | PMID[26890120] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 11170.0 | nM | PMID[26927425] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 590.0 | nM | PMID[26927425] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 4100.0 | nM | PMID[26988802] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 350.0 | nM | PMID[27156772] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 190.0 | nM | PMID[27156772] |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[27156772] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 8.9 | % | PMID[27157005] |
| NPT111 | Cell line | K562 | Homo sapiens | Activity | = | 39.6 | % | PMID[27157005] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 11.4 | % | PMID[27157005] |
| NPT762 | Cell line | A-431 | Homo sapiens | Activity | = | 65.0 | % | PMID[27135370] |
| NPT1083 | Cell line | A-375 | Homo sapiens | IC50 | = | 13.0 | nM | PMID[27096049] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 9.0 | nM | PMID[27096049] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 80.88 | % | PMID[28923388] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 12.44 | % | PMID[27721148] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 1.6 | % | PMID[28923388] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 5.07 | % | PMID[28923388] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | < | 1.8 | nM | PMID[28006904] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 60010.0 | nM | PMID[28063351] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 71300.0 | nM | PMID[28063351] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 240.0 | nM | PMID[28063351] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[28068603] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 2100.0 | nM | PMID[28384547] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 90.0 | nM | PMID[28068603] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 24.0 | nM | PMID[27871039] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 57.0 | nM | PMID[27871039] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 14.0 | nM | PMID[27871039] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[27871039] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 29.0 | nM | PMID[27871039] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[28027871] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[31546197] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 8.63 | nM | PMID[28285912] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 307.0 | nM | PMID[28285912] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 50.0 | nM | PMID[28285912] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 87.5 | nM | PMID[28285912] |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | < | 10.0 | nM | PMID[24502276] |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | < | 10.0 | nM | PMID[24502276] |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | < | 10.0 | nM | PMID[24800942] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[28351590] |
| NPT994 | Cell line | ZR-75-30 | Homo sapiens | IC50 | = | 240.0 | nM | PMID[28351590] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[28506750] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[28506750] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 700.0 | nM | PMID[28506750] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 20.33 | % | PMID[28506750] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 14.14 | % | PMID[28506750] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 7.9 | % | PMID[28506750] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 31.47 | % | PMID[28506750] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | Activity | = | 13.16 | % | PMID[28506750] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | Activity | = | 9.44 | % | PMID[28506750] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 14.17 | % | PMID[28506750] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 10.25 | % | PMID[28506750] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 5.54 | % | PMID[28506750] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 6.73 | % | PMID[28506750] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | Activity | = | 13.04 | % | PMID[28506750] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | Activity | = | 5.22 | % | PMID[28506750] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 11.5 | nM | PMID[28454671] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 60.0 | nM | PMID[28384547] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 10100.0 | nM | PMID[28462840] |
| NPT3140 | Cell line | MGC-803 | Homo sapiens | IC50 | = | 9450.0 | nM | PMID[28462840] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 28660.0 | nM | PMID[28462840] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 13640.0 | nM | PMID[28462840] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 3800.0 | nM | PMID[28511910] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | < | 1000.0 | nM | PMID[28511910] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 4920.0 | nM | PMID[28511910] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | Activity | = | 42.0 | % | PMID[29370702] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | Activity | = | 26.0 | % | PMID[29370702] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | Activity | = | 31.0 | % | PMID[29370702] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | Activity | = | 3.3 | % | PMID[29370702] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 2310.0 | nM | PMID[28633898] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 2620.0 | nM | PMID[28633898] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | IC50 | = | 180.0 | nM | PMID[28689976] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 73.0 | nM | PMID[28409637] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 120.0 | nM | PMID[28425292] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 6960.0 | nM | PMID[29131616] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 920.0 | nM | PMID[29131616] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 19.0 | nM | PMID[27318980] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 159.0 | nM | PMID[28477443] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 9.0 | nM | PMID[31176097] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 3.0 | nM | PMID[29705710] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | GI50 | = | 6.0 | nM | PMID[29705710] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 19.0 | nM | PMID[29705710] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 75.0 | nM | PMID[31176097] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 13200.0 | nM | PMID[30025344] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5500.0 | nM | PMID[30025344] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[29402741] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1370.0 | nM | PMID[29402741] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | = | 7.0 | nM | PMID[30336023] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 21.0 | nM | PMID[30336023] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 210.0 | nM | PMID[30336023] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | GI50 | = | 99.0 | nM | PMID[30336023] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 6.7 | nM | PMID[29429833] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 80.0 | nM | PMID[28557449] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[28557449] |
| NPT2454 | Cell line | RD | Homo sapiens | IC50 | = | 4490.0 | nM | PMID[28923382] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 8870.0 | nM | PMID[28923382] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 13620.0 | nM | PMID[28923382] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 54690.0 | nM | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 37.37 | % | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 36.41 | % | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 26.08 | % | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 0.132 | % | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 0.12 | % | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 3.53 | % | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 63.71 | % | PMID[28923382] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 32.64 | % | PMID[28923382] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | IC50 | = | 3040.0 | nM | PMID[28923388] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 1880.0 | nM | PMID[30340899] |
| NPT2454 | Cell line | RD | Homo sapiens | IC50 | = | 1240.0 | nM | PMID[28923388] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5930.0 | nM | PMID[28923388] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | -30.0 | % | PMID[28923388] |
| NPT2309 | Cell line | CAPAN-1 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[30017114] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | IC50 | = | 180.0 | nM | PMID[30017114] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | IC50 | = | 90.0 | nM | PMID[30017114] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 5.5 | nM | PMID[29501943] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 0.56 | nM | PMID[29501943] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[29510948] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 490.0 | nM | PMID[29510948] |
| NPT2306 | Cell line | Ca-Ski | Homo sapiens | IC50 | = | 1800.0 | nM | PMID[29407986] |
| NPT165 | Cell line | HeLa | Homo sapiens | Activity | = | 3.0 | % | PMID[29407986] |
| NPT2306 | Cell line | Ca-Ski | Homo sapiens | Activity | = | 2.0 | % | PMID[29407986] |
| NPT165 | Cell line | HeLa | Homo sapiens | Activity | = | 29.0 | % | PMID[29407986] |
| NPT2306 | Cell line | Ca-Ski | Homo sapiens | Activity | = | 62.0 | % | PMID[29407986] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[30007563] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1300.0 | nM | PMID[30007563] |
| NPT2224 | Cell line | TERT-RPE1 | Homo sapiens | IC50 | > | 40000.0 | nM | PMID[29223099] |
| NPT1160 | Cell line | BJ | Homo sapiens | IC50 | > | 40000.0 | nM | PMID[29223099] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 90.0 | nM | PMID[29223099] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[29223099] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[29223099] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 340.0 | nM | PMID[29223099] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 430.0 | nM | PMID[29223099] |
| NPT2224 | Cell line | TERT-RPE1 | Homo sapiens | IC50 | = | 27200.0 | nM | PMID[29223099] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 711.0 | nM | PMID[29223099] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[29223099] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 40000.0 | nM | PMID[29223099] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 4370.0 | nM | PMID[29223099] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 110.0 | nM | PMID[29541373] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 540.0 | nM | PMID[29541373] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 160.0 | nM | PMID[29541373] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 19.0 | % | PMID[30108955] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 59.4 | % | PMID[30108955] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 19.2 | % | PMID[30108955] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 2.43 | % | PMID[30108955] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 2.16 | % | PMID[30108955] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 23.6 | % | PMID[30108955] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 9.12 | % | PMID[30108955] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 65.1 | % | PMID[30108955] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[30109008] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 420.0 | nM | PMID[30109008] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 16440.0 | nM | PMID[30109008] |
| NPT80 | Cell line | Raji | Homo sapiens | IC50 | = | 3270.0 | nM | PMID[30109008] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 18240.0 | nM | PMID[30109008] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 2210.0 | nM | PMID[30109008] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | IC50 | = | 3010.0 | nM | PMID[30340899] |
| NPT2454 | Cell line | RD | Homo sapiens | IC50 | = | 1720.0 | nM | PMID[30340899] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1310.0 | nM | PMID[30340899] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 1610.0 | nM | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 5.73 | % | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 7.33 | % | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 5.08 | % | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 81.86 | % | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 27.71 | % | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 10.06 | % | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 36.77 | % | PMID[30340899] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 24.52 | % | PMID[30340899] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 370.0 | nM | PMID[30055465] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[30055465] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 6080.0 | nM | PMID[30125725] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 1360.0 | nM | PMID[30125725] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 1080.0 | nM | PMID[30125725] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 660.0 | nM | PMID[30125725] |
| NPT3887 | Cell line | CNE | Homo sapiens | IC50 | = | 340.0 | nM | PMID[30125725] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 420.0 | nM | PMID[30125725] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | IC50 | = | 8370.0 | nM | PMID[30685528] |
| NPT3140 | Cell line | MGC-803 | Homo sapiens | IC50 | = | 2960.0 | nM | PMID[30685528] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 4790.0 | nM | PMID[30685528] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 4430.0 | nM | PMID[30685528] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 6510.0 | nM | PMID[30685528] |
| NPT550 | Cell line | T-24 | Homo sapiens | IC50 | = | 6800.0 | nM | PMID[30685528] |
| NPT3140 | Cell line | MGC-803 | Homo sapiens | TGI | = | 51.5 | % | PMID[30685528] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 660.0 | nM | PMID[30600208] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 680.0 | nM | PMID[30509782] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 0.32 | nM | PMID[30702286] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | = | 0.32 | nM | PMID[30702286] |
| NPT114 | Cell line | LoVo | Homo sapiens | IC50 | = | 0.32 | nM | PMID[30702286] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 0.32 | nM | PMID[30702286] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[31546197] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 37.3 | % | PMID[31767266] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | Activity | = | 59.3 | % | PMID[31767266] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 5690.0 | nM | PMID[30875505] |
| NPT550 | Cell line | T-24 | Homo sapiens | IC50 | = | 3090.0 | nM | PMID[30875505] |
| NPT3140 | Cell line | MGC-803 | Homo sapiens | IC50 | = | 4270.0 | nM | PMID[30875505] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 5370.0 | nM | PMID[30875505] |
| NPT3140 | Cell line | MGC-803 | Homo sapiens | TGI | = | 62.3 | % | PMID[30875505] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 12.0 | nM | PMID[31176097] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 210.0 | nM | PMID[31176097] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 99.0 | nM | PMID[31176097] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Ratio | = | 8.3 | n.a. | PMID[31176097] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | < | 64.0 | nM | PMID[30509782] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 450.0 | nM | PMID[30509782] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 90.0 | nM | PMID[30509782] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 290.0 | nM | PMID[30509782] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 28.4 | nM | PMID[32952994] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 8.5 | nM | PMID[32952994] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 73.6 | % | PMID[32952994] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 49.0 | nM | PMID[31398033] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 250.0 | nM | PMID[31398033] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[31398033] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 23980.0 | nM | PMID[31398033] |
| NPT2459 | Cell line | HCC70 | Homo sapiens | IC50 | = | 44.0 | nM | PMID[31398033] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[31880942] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 2700.0 | nM | PMID[31880942] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 2800.0 | nM | PMID[31880942] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 2400.0 | nM | PMID[31880942] |
| NPT1086 | Cell line | SK-HEP1 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[31880942] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 16.0 | nM | PMID[30543429] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 2.0 | nM | PMID[30543429] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 13.0 | nM | PMID[30543429] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | = | 2.3 | nM | PMID[30543429] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3320.0 | nM | PMID[30902399] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 84.0 | nM | PMID[32292547] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 39.0 | nM | PMID[32292547] |
| NPT1091 | Cell line | RPMI-7951 | Homo sapiens | IC50 | = | 220.0 | nM | PMID[32435422] |
| NPT2344 | Cell line | SK-MEL-24 | Homo sapiens | IC50 | = | 460.0 | nM | PMID[32435422] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[32201190] |
| NPT660 | Cell line | SW480 | Homo sapiens | FC | = | 0.3 | n.a. | PMID[32201190] |
| NPT116 | Cell line | HL-60 | Homo sapiens | FC | = | 0.0 | n.a. | PMID[32201190] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 61.13 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 39.71 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 4.14 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 11.17 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 30.71 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 53.97 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 37.51 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 58.66 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 6.31 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 28.49 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 10.49 | % | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 54.71 | % | PMID[30853330] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 22000.0 | nM | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 32110.0 | nM | PMID[30853330] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 51500.0 | nM | PMID[30853330] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 50880.0 | nM | PMID[30853330] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 68.24 | % | PMID[32672460] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 1.92 | % | PMID[32672460] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 29.83 | % | PMID[32672460] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 0.0 | % | PMID[32672460] |
| NPT2100 | Cell line | KG-1 | n.a. | IC50 | = | 1600.0 | nM | PMID[33161122] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1700.0 | nM | PMID[33161122] |
| NPT15 | Cell line | Jurkat | Homo sapiens | GI50 | = | 60.0 | nM | PMID[29313676] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 190.0 | nM | PMID[29313676] |
| NPT2245 | Cell line | SiHa | Homo sapiens | GI50 | = | 550.0 | nM | PMID[29313676] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 60.0 | nM | PMID[29313676] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 50.0 | nM | PMID[29313676] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 195.0 | nM | PMID[29313676] |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[29313676] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | = | 5.7 | nM | PMID[29313676] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | = | 400.0 | nM | PMID[29313676] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[32668379] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[32668379] |
| NPT1312 | Cell line | SW1990 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[32668379] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[32668379] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 320.0 | nM | PMID[32711231] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[32711231] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[32711231] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[32711231] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1560.0 | nM | PMID[32711231] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[32711231] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 1670.0 | nM | PMID[32711231] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | IC50 | = | 5650.0 | nM | PMID[32711231] |
| NPT737 | Cell line | HUVEC | Homo sapiens | IC50 | = | 10.0 | nM | PMID[32711231] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 8830.0 | nM | PMID[27707625] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | IC50 | = | 1710.0 | nM | PMID[27707625] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 3670.0 | nM | PMID[27707625] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 250.0 | nM | PMID[33158579] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Ratio | = | 0.32 | n.a. | PMID[33158579] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[32279049] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 5500.0 | nM | PMID[32279049] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 1700.0 | nM | PMID[32279049] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[32682183] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 8750.0 | nM | PMID[32682183] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1660.0 | nM | PMID[32932211] |
| NPT3190 | Cell line | NHDF | Homo sapiens | IC50 | = | 5380.0 | nM | PMID[32932211] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[33443423] |
| NPT3722 | Cell line | 4T1 | Mus musculus | IC50 | = | 170.0 | nM | PMID[34844412] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[34852457] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 100.0 | nM | PMID[34175539] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 110.0 | nM | PMID[34844412] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 170.0 | nM | PMID[34052678] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.88 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 relative | = | 200.0 | nM | ECBD screening data for assay EOS300108 |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1.0 | nM | PMID[33962152] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 8900.0 | nM | PMID[34852457] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.48 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2678 | Cell line | NB-4 | Homo sapiens | IC50 | = | 2010.0 | nM | PMID[36906964] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[35550978] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[35462164] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[36924947] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | IC50 | = | 30.0 | nM | PMID[36924947] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 5.5 | nM | PMID[33962152] |
| NPT76 | Cell line | C6 | Rattus norvegicus | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 910.0 | nM | PMID[36906964] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 18600.0 | nM | PMID[36996717] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[34852457] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 560.0 | nM | PMID[34844412] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.33 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT114 | Cell line | LoVo | Homo sapiens | IC50 | = | 1540.0 | nM | PMID[34844412] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 3210.0 | nM | PMID[34008967] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.7 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 18240.0 | nM | PMID[36996717] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 12.3 | % | PMID[36351049] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[36331508] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 38.6 | % | PMID[36351049] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 1990.0 | nM | PMID[32526552] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 470.0 | nM | PMID[35635947] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.64 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT1577 | Cell line | SW1573 | Homo sapiens | GI50 | = | 300.0 | nM | PMID[37531922] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 33.16 | nM | PMID[37806498] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 8280.0 | nM | PMID[34852457] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[34678573] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[36758308] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[33744688] |
| NPT1357 | Cell line | H22 | Mus musculus | IC50 | = | 540.0 | nM | PMID[34844412] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[36924947] |
| NPT737 | Cell line | HUVEC | Homo sapiens | IC50 | = | 60.0 | nM | PMID[36924947] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | -0.34 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT2170 | Cell line | RKO | Homo sapiens | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[35462164] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | -0.11 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 2690.0 | nM | PMID[32526552] |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | IC50 | = | 610.0 | nM | PMID[35612499] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 32100.0 | nM | PMID[33421712] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[36924947] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[36924947] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 350.0 | nM | PMID[34008967] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 310.0 | nM | PMID[34008967] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 1890.0 | nM | PMID[36906964] |
| NPT1535 | Cell line | U-87 MG | Homo sapiens | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 0.35 | % | PMID[36351049] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 264.0 | nM | PMID[34844412] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | > | 6400.0 | nM | PMID[34844412] |
| NPT2257 | Cell line | MCF-10A | Homo sapiens | IC50 | = | 2190.0 | nM | PMID[34844412] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[34952177] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[36758308] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[33143937] |
| NPT3140 | Cell line | MGC-803 | Homo sapiens | IC50 | > | 150000.0 | nM | PMID[35462164] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[33289551] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 420.0 | nM | PMID[34844412] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.41 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 3820.0 | nM | PMID[36351049] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 1060.0 | nM | PMID[36351049] |
| NPT2257 | Cell line | MCF-10A | Homo sapiens | IC50 | = | 2580.0 | nM | PMID[36351049] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 48.8 | % | PMID[36351049] |
| NPT515 | Cell line | SGC-7901 | Homo sapiens | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT2170 | Cell line | RKO | Homo sapiens | IC50 | = | 61.7 | nM | PMID[35868003] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 1810.0 | nM | PMID[36906964] |
| NPT465 | Cell line | NCI-N87 | Homo sapiens | IC50 | = | 2320.0 | nM | PMID[36351049] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.83 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 610.0 | nM | PMID[37418826] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 50.8 | % | PMID[36351049] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 74.0 | nM | PMID[35550978] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[35612499] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 490.0 | nM | PMID[35612499] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 22000.0 | nM | PMID[33421712] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 13200.0 | nM | PMID[38107170] |
| NPT2473 | Cell line | MDA-MB-361 | Homo sapiens | IC50 | = | 170.0 | nM | PMID[38107170] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 17.0 | nM | PMID[34052678] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 241.0 | nM | PMID[34052678] |
| NPT681 | Cell line | PC-12 | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[33289551] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[34844412] |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | Activity | = | -27.0 | % | PMID[38665841] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 1590.0 | nM | PMID[32526552] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 210.0 | nM | PMID[34008967] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.82 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 2.01 | nM | PMID[35567964] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 1.7 | 10^-5 uM | PMID[33962152] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 2800.0 | nM | PMID[32526552] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 90.0 | nM | PMID[34844412] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[34844412] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[34852457] |
| NPT2488 | Cell line | MDA-MB-453 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[38107170] |
| NPT3140 | Cell line | MGC-803 | Homo sapiens | IC50 | = | 17760.0 | nM | PMID[36996717] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.65 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 790.0 | nM | PMID[36758308] |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | = | 2000.0 | nM | PMID[37531922] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 2560.0 | nM | PMID[36906964] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 310.0 | nM | PMID[34844412] |
| NPT2308 | Cell line | CAMA-1 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[38107170] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[38107170] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 1360.0 | nM | PMID[38107170] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[38107170] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[36758308] |
| NPT886 | Cell line | NIH3T3 | Mus musculus | Activity | = | 37.51 | % | PMID[36996717] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 580.0 | nM | PMID[36906964] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 33.45 | nM | PMID[37806498] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | -0.29 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[34678573] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[32526552] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 4860.0 | nM | PMID[36906964] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 9020.0 | nM | PMID[36758308] |
| NPT1723 | Cell line | HBL-100 | Homo sapiens | GI50 | = | 200.0 | nM | PMID[37531922] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.2 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | -0.84 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 3950.0 | nM | PMID[38107170] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | < | 10.0 | nM | PMID[38107170] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 600.0 | nM | PMID[37531922] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 370.0 | nM | PMID[35612499] |
| NPT515 | Cell line | SGC-7901 | Homo sapiens | IC50 | = | 5800.0 | nM | PMID[35868003] |
| NPT2170 | Cell line | RKO | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35868003] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[36924947] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[36823782] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.59 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | IC50 | = | 690.0 | nM | PMID[35612499] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35635947] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35635947] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1.0 | nM | PMID[34952177] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 5.5 | nM | PMID[34952177] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | > | 150000.0 | nM | PMID[35462164] |
| NPT2511 | Cell line | HGC-27 | Homo sapiens | IC50 | > | 150000.0 | nM | PMID[35462164] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 21.0 | nM | PMID[35550978] |
| NPT737 | Cell line | HUVEC | Homo sapiens | IC50 | = | 12.0 | nM | PMID[35550978] |
| NPT1081 | Cell line | BXPC-3 | Homo sapiens | IC50 | = | 62.5 | nM | PMID[37806498] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.75 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 50.0 | nM | PMID[34008967] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | = | 2260.0 | nM | PMID[35635947] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[36351049] |
| NPT5420 | Cell line | MCF10 | Homo sapiens | IC50 | = | 24770.0 | nM | PMID[33962153] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 170.0 | nM | PMID[34171512] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 90.0 | nM | PMID[34678573] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 350.0 | nM | PMID[35612499] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 230.0 | nM | PMID[34678573] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1370.0 | nM | PMID[35868003] |
| NPT1083 | Cell line | A-375 | Homo sapiens | IC50 | = | 660.0 | nM | PMID[35612499] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 5.6 | nM | PMID[34952177] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | < | 1850.0 | nM | PMID[35462164] |
| NPT2511 | Cell line | HGC-27 | Homo sapiens | IC50 | = | 166.0 | nM | PMID[35868003] |
| NPT137 | Cell line | L1210 | Mus musculus | Toxic dose | = | 16.0 | mg kg-1 | PMID[3735324] |
| NPT83 | Cell line | MCF7 | Homo sapiens | ID50 | < | 3.2 | ng ml-1 | PMID[12161136] |
| NPT2046 | Cell line | EVSA-T | Homo sapiens | ID50 | < | 3.2 | ng ml-1 | PMID[12161136] |
| NPT1183 | Cell line | WiDr | Homo sapiens | ID50 | < | 3.2 | ng ml-1 | PMID[12161136] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | ID50 | < | 3.2 | ng ml-1 | PMID[12161136] |
| NPT573 | Cell line | M19-MEL | Homo sapiens | ID50 | < | 13.0 | ng ml-1 | PMID[12161136] |
| NPT376 | Cell line | A498 | Homo sapiens | ID50 | < | 3.2 | ng ml-1 | PMID[12161136] |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | ID50 | < | 5.0 | ng ml-1 | PMID[12161136] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | = | 10.0 | nM | PMID[9767632] |
| NPT91 | Cell line | KB | Homo sapiens | CC50 | = | 6.0 | nM | PMID[9767632] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | ID50 | = | 2.8 | nM | PMID[11965362] |
| NPT4465 | Cell line | HCT-116/VM46 | Homo sapiens | ID50 | = | 2.4 | nM | PMID[11965362] |
| NPT306 | Cell line | PC-3 | Homo sapiens | ID50 | = | 3.8 | nM | PMID[11965362] |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | ID50 | = | 3.9 | nM | PMID[11965362] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | CC50 | = | 3.0 | nM | PMID[22884523] |
| NPT4473 | Cell line | WIL2-NS | Homo sapiens | CC50 | = | 5.0 | nM | PMID[22884523] |
| NPT4474 | Cell line | CCRF-SB | Homo sapiens | CC50 | = | 4.0 | nM | PMID[22884523] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | CC50 | = | 70.0 | nM | PMID[22884523] |
| NPT83 | Cell line | MCF7 | Homo sapiens | CC50 | = | 20.0 | nM | PMID[22047799] |
| NPT1506 | Cell line | SK-MES-1 | Homo sapiens | CC50 | = | 30.0 | nM | PMID[22047799] |
| NPT65 | Cell line | HepG2 | Homo sapiens | CC50 | = | 20.0 | nM | PMID[22047799] |
| NPT90 | Cell line | DU-145 | Homo sapiens | CC50 | = | 15.0 | nM | PMID[22047799] |
| NPT171 | Cell line | MRC5 | Homo sapiens | CC50 | = | 200.0 | nM | PMID[22884523] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | = | 4.0 | nM | PMID[22884523] |
| NPT83 | Cell line | MCF7 | Homo sapiens | CC50 | = | 80.0 | nM | PMID[22884523] |
| NPT1506 | Cell line | SK-MES-1 | Homo sapiens | CC50 | = | 50.0 | nM | PMID[22884523] |
| NPT65 | Cell line | HepG2 | Homo sapiens | CC50 | = | 40.0 | nM | PMID[22884523] |
| NPT90 | Cell line | DU-145 | Homo sapiens | CC50 | = | 80.0 | nM | PMID[22884523] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.83 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.41 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.12 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.32 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.89 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.56 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 794.33 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1258.93 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1000.0 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 501.19 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 1471.6 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 2332.3 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 1168.9 | nM | PubChem BioAssay data set |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition index | = | -0.1388 | n.a. | DOI[10.1101/2020.04.03.023846] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 81.85 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT21748 | Cell line | LN-229 | Homo sapiens | IC50 | = | 0.32 | nM | PMID[30702286] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 1.0 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.11 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 75.0 | nM | PMID[33744440] |
| NPT28833 | No target | No relevant target | n.a. | solubility | n.a. | n.a. | n.a. | PMID[34052678] |
| NPT30075 | Cell line | KG-1 | Homo sapiens | IC50 | = | 2310.0 | nM | PMID[36906964] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[36823782] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 24.0 | n.a. | PMID[34844412] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 45.0 | nM | PMID[33744440] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 250.0 | nM | PMID[32858470] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[33289551] |
| NPT25189 | Cell line | CT26.WT | Mus musculus | IC50 | = | 430.0 | nM | PMID[35868003] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 53.0 | % | PMID[34852457] |
| NPT28438 | Unchecked | Unchecked | n.a. | EC50 | = | 700.0 | nM | PMID[34311084] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | n.a. | n.a. | n.a. | PMID[33744688] |
| NPT28438 | Unchecked | Unchecked | n.a. | RatioGI50 | = | 9.2 | n.a. | PMID[34008967] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | n.a. | n.a. | % | PMID[37859718] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 83.67 | nM | PMID[37806498] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 10.0 | nM | PMID[33744440] |
| NPT28689 | Cell line | HCCLM9 | Homo sapiens | IC50 | > | 150000.0 | nM | PMID[35462164] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Inhibition | = | 18.0 | % | PMID[15080977] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Inhibition | = | 19.0 | % | PMID[15080977] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Inhibition | = | 10.0 | % | PMID[15080977] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Inhibition | = | 78.0 | % | PMID[15080977] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Inhibition | = | 68.0 | % | PMID[15080977] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Inhibition | = | 40.0 | % | PMID[15080977] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 2.0 | ug ml-1 | PMID[7381856] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | T/C | = | 144.0 | % | PMID[7932525] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | T/C | = | 176.0 | % | PMID[7932525] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | T/C | = | 142.0 | % | PMID[7932525] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | T/C | = | 130.0 | % | PMID[7932525] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 330.0 | nM | PMID[11563925] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 8.5 | nM | PMID[10479293] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 61000.0 | nM | PMID[18676151] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 33.0 | nM | PMID[9207945] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5.6 | nM | PMID[9207945] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 10000.0 | nM | PMID[24484281] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 10.0 | nM | PMID[16033260] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 30.0 | nM | PMID[27070999] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 220.0 | nM | PMID[16033260] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 20.0 | nM | PMID[17418582] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 40.0 | nM | PMID[16033260] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5385.0 | nM | PMID[15916431] |
| NPT24850 | Cell line | LNCaP C4-2 | Homo sapiens | Inhibition | = | 69.0 | % | PMID[16971123] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 500.0 | nM | PMID[21186067] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 15.0 | nM | PMID[17350834] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 24.0 | nM | PMID[22698783] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 1.5 | nM | PMID[17962028] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC50 | > | 200000.0 | nM | PMID[18040043] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.004 | nM | PMID[18511275] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 10.0 | nM | PMID[18511275] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC50 | = | 0.16 | ug.mL-1 | PMID[11000035] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC50 | = | 0.014 | ug.mL-1 | PMID[11000035] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC50 | > | 100.0 | ug.mL-1 | PMID[11000035] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC50 | = | 0.18 | ug.mL-1 | PMID[11000035] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC50 | = | 0.06 | ug.mL-1 | PMID[11000035] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Activity | = | 110.0 | ug ml-1 | PMID[11678653] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Activity | = | 0.6 | ug ml-1 | PMID[8158166] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Activity | > | 20.0 | ug ml-1 | PMID[8158166] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5.0 | nM | PMID[18676151] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 15.0 | nM | DOI[10.1039/C4MD00133H] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 25.0 | nM | PMID[18771930] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 26.0 | nM | PMID[18771930] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.08 | ug.mL-1 | PMID[18774864] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 4.0 | nM | PMID[19299037] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 8.7 | ug ml-1 | PMID[1479381] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 0.6 | ug ml-1 | PMID[1479381] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 0.9 | ug ml-1 | PMID[8882430] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 100.0 | ug ml-1 | PMID[8882430] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 200.0 | ug ml-1 | PMID[15165164] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 5.0 | ug ml-1 | PMID[15165164] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 230.0 | nM | PMID[15043407] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 110.0 | ug ml-1 | PMID[8021652] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 12.0 | ug ml-1 | PMID[14510601] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC12 | = | 75.0 | ug ml-1 | PMID[14510601] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Activity | = | 8.7 | ug ml-1 | PMID[8158166] |
| NPT141 | Organism | Agrobacterium tumefaciens | Agrobacterium tumefaciens | Activity | = | -100.0 | % | DOI[10.1021/np50107a012] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 28.7 | nM | PMID[11858760] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 3280.0 | nM | PMID[18554906] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 6.0 | nM | PMID[18829334] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 80.0 | nM | PMID[19715319] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1700.0 | nM | PMID[19715319] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 60.0 | nM | PMID[19715319] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 43.21 | nM | PMID[19743858] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 30.0 | nM | PMID[27639365] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 210.0 | nM | PMID[20438092] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 25000.0 | nM | PMID[20638158] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 1030.0 | nM | PMID[20662543] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 34400.0 | nM | PMID[18644961] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Potency | = | 12995.3 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 52.0 | nM | PMID[21341674] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 57.0 | nM | PMID[21341674] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 33.0 | nM | PMID[21388138] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 260.0 | nM | PMID[22044245] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 15200.0 | nM | PMID[22326393] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | < | 100.0 | nM | PMID[22409771] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 10.0 | nM | PMID[22749423] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | < | 1000.0 | nM | DOI[10.1039/C4MD00306C] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 6.8 | nM | PMID[22698783] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 423.0 | nM | PMID[22698783] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 37.1 | nM | PMID[23102893] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | < | 10.0 | nM | PMID[24180210] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 300.0 | nM | PMID[24484281] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | > | 1000.0 | nM | PMID[24502276] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | < | 2.8 | 10'-6umol/ml | PMID[423214] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2780.0 | nM | PMID[24685545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 10070.0 | nM | PMID[24904965] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1980.0 | nM | PMID[25062006] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 474.0 | nM | PMID[24901491] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 786.0 | nM | PMID[24901491] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 131.0 | nM | PMID[24980118] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 120.0 | nM | PMID[25003995] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 3600.0 | nM | PMID[25237727] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 6300.0 | nM | PMID[25237727] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 40.0 | nM | PMID[25237727] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.15 | nM | PMID[25247770] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 70.0 | nM | PMID[27017547] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 220.0 | nM | DOI[10.1039/C4MD00133H] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 710.0 | nM | PMID[26226379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 960.0 | nM | PMID[26226379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | < | 3.0 | nM | PMID[26226379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 140.0 | nM | PMID[26226379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 100.0 | nM | DOI[10.1039/C4MD00306C] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 190.0 | nM | DOI[10.1039/C4MD00344F] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | <= | 100.0 | nM | PMID[26810835] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 60.9 | % | DOI[10.1039/C5MD00289C] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1290.0 | nM | PMID[26927425] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 20.0 | nM | PMID[26945111] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2820.0 | nM | PMID[26945111] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 7000.0 | nM | PMID[26988802] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 7100.0 | nM | PMID[26988802] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5.5 | nM | PMID[27017547] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 23.4 | % | PMID[27157005] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 12.8 | % | PMID[27157005] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 3.0 | nM | PMID[27096049] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 35.0 | nM | PMID[27096049] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 9520.0 | nM | PMID[27667553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 11360.0 | nM | PMID[27667553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 17650.0 | nM | PMID[27667553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 59130.0 | nM | PMID[27344492] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 29810.0 | nM | PMID[27344492] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 100000.0 | nM | PMID[27344492] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 39.8 | nM | PMID[27448924] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1410.0 | nM | PMID[27416553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1270.0 | nM | PMID[27416553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 460.0 | nM | PMID[27416553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1520.0 | nM | PMID[27416553] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 33.16 | % | PMID[27416553] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 48.15 | % | PMID[27416553] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 11.32 | % | PMID[27416553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 80.0 | nM | PMID[27484510] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1.4 | nM | PMID[27484510] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 130.0 | nM | PMID[27484510] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 600.0 | nM | PMID[27484510] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 4.4 | % | PMID[27487570] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 54.6 | % | PMID[27487570] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 16.3 | % | PMID[27487570] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 25.8 | % | PMID[27487570] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 2.0 | nM | PMID[27597409] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 2.1 | nM | PMID[27597409] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 5.4 | nM | PMID[27597409] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1120.0 | nM | PMID[27639365] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 310.0 | nM | PMID[27643560] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 13700.0 | nM | PMID[27643560] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 110.0 | nM | PMID[27643560] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 400.0 | nM | PMID[27643560] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 830.0 | nM | PMID[27643560] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1060.0 | nM | PMID[27643560] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 590.0 | nM | PMID[27654394] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 380.0 | nM | PMID[27654394] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 350.0 | nM | PMID[27654394] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 4540.0 | nM | PMID[27654394] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 890.0 | nM | PMID[27721148] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1240.0 | nM | PMID[27721148] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 6700.0 | nM | PMID[27721148] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 3040.0 | nM | PMID[27721148] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1840.0 | nM | PMID[27721148] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5930.0 | nM | PMID[27721148] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Inhibition | = | 5.61 | % | DOI[10.6019/CHEMBL4296183] |
| NPT20 | Organism | Candida albicans | Candida albicans | Inhibition | = | 4.14 | % | DOI[10.6019/CHEMBL4296183] |
| NPT25041 | Cell line | MDA-MB-436 | Homo sapiens | IC50 | = | 31860.0 | nM | PMID[31398033] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | EC50 | = | 7840.0 | nM | PMID[36823782] |
| NPT30138 | Protein family | Histone deacetylase | Homo sapiens | IC50 | = | 50.0 | nM | PMID[33143937] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | Activity | n.a. | n.a. | n.a. | PMID[36823782] |
| NPT29328 | Cell line | NCI-H520 | Homo sapiens | IC50 | = | 25.01 | nM | PMID[37806498] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | EC50 | = | 3794.0 | nM | PMID[36823782] |
| NPT20904 | Cell line | Hep 3B2 | Homo sapiens | IC50 | = | 434.29 | nM | PMID[37806498] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 1120.0 | nM | PMID[34879200] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | EC50 | = | 12820.0 | nM | PMID[36823782] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | EC50 | = | 6582.0 | nM | PMID[36823782] |
| NPT621 | Tissue | Plasma | Homo sapiens | Activity | = | 61.4 | % | PMID[18313176] |
| NPT621 | Tissue | Plasma | Homo sapiens | Activity | = | 28.4 | % | PMID[18313176] |
| NPT621 | Tissue | Plasma | Homo sapiens | Activity | = | 19.4 | % | PMID[18313176] |
| NPT621 | Tissue | Plasma | Homo sapiens | Activity | = | 14.6 | % | PMID[18313176] |
| NPT621 | Tissue | Plasma | Homo sapiens | Activity | = | 3.8 | % | PMID[18313176] |
| NPT20950 | Cell line | Erythrocyte | n.a. | EC50 | = | 429.9 | ug.mL-1 | DOI[10.1007/s00044-010-9381-7] |
| NPT26418 | Protein family | Topoisomerase I/II | Homo sapiens | Inhibition | = | 74.6 | % | PMID[28068603] |
| NPT26418 | Protein family | Topoisomerase I/II | Homo sapiens | Inhibition | = | 80.5 | % | PMID[28068603] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Inhibition | = | 5.98 | % | DOI[10.6019/CHEMBL4296183] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | = | 11.38 | % | DOI[10.6019/CHEMBL4296183] |
| NPT26526 | Cell line | MHCC97H | Homo sapiens | IC50 | = | 0.32 | nM | PMID[30702286] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 2150.0 | nM | PMID[30875505] |
| NPT30033 | Cell line | Macrophage | Mus musculus | EC50 | = | 18320.0 | nM | PMID[36823782] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | > | 150000.0 | nM | PMID[35462164] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | -0.02 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT29426 | Cell line | SU-DHL-2 | Homo sapiens | IC50 | = | 940.0 | nM | PMID[36906964] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | 0.11 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 140.0 | nM | PMID[35612499] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | 1.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2254 | Organism | Schistosoma mansoni | Schistosoma mansoni | In vitro activity | n.a. | n.a. | n.a. | Using ChEMBL to complement schistosome drug discovery |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 800 | nM | PMID[22197145] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 87.5 | n.a. | PMID[10346933] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 2.0 | n.a. | PMID[12620081] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 1.4 | n.a. | PMID[12620081] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 100.0 | % | DOI[10.1016/S0960-894X(01)80158-X] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 63.3 | % | PMID[18178085] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 84.1 | % | PMID[18178085] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 3000.0 | nM | PMID[11430001] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 300000.0 | nM | PMID[11430001] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 81.3 | % | PMID[18296054] |
| NPT3749 | Tissue | Hippocampus | Rattus norvegicus | Activity | = | 51.6 | % | PMID[18676148] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 0.2 | n.a. | PMID[19012996] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 1000000.0 | nM | PMID[15974606] |
| NPT624 | Tissue | Plasma | Mus musculus | Activity | = | 40.5 | % | PMID[18313176] |
| NPT624 | Tissue | Plasma | Mus musculus | Activity | = | 24.5 | % | PMID[18313176] |
| NPT624 | Tissue | Plasma | Mus musculus | Activity | = | 10.9 | % | PMID[18313176] |
| NPT624 | Tissue | Plasma | Mus musculus | Activity | = | 5.3 | % | PMID[18313176] |
| NPT624 | Tissue | Plasma | Mus musculus | Activity | = | 55.1 | % | PMID[18313176] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 41.0 | % | PMID[19954977] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 54.0 | % | PMID[19954977] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 73.0 | % | PMID[20638158] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 0.0 | % | PMID[20662543] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[20662543] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 134.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 316.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 44.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | EC50 | < | 100.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT471 | Organism | Trypanosoma brucei brucei | Trypanosoma brucei brucei | Inhibition | = | 27.0 | % | PMID[18824603] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 61.0 | % | PMID[18824603] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 80.0 | % | PMID[21186067] |
| NPT2 | Others | Unspecified | n.a. | Ratio | > | 250.0 | n.a. | PMID[21341674] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 1.0 | n.a. | PMID[21341674] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1412.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 25.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 20.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 63.1 | % | PMID[22819942] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 26.3 | % | PMID[22819942] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 2000.0 | nM | PMID[22932312] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 48.0 | n.a. | PMID[22698783] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 3.83 | n.a. | PMID[23137376] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 17.96 | % | PMID[23137376] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 17.56 | % | PMID[23137376] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1584.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 15848.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 4466.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3548.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 5011.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 580.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2238.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3981.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1778.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 500000.0 | nM | PMID[25221657] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 25000.0 | nM | PMID[26188908] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 81.0 | % | PMID[26188908] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.5 | n.a. | PMID[26649907] |
| NPT2 | Others | Unspecified | n.a. | IC50 | < | 1000.0 | nM | PMID[26810835] |
| NPT25746 | Cell line | CNE-2 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[30025344] |
| NPT25746 | Cell line | CNE-2 | Homo sapiens | IC50 | = | 980.0 | nM | PMID[30125725] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | Inhibition | = | -0.94 | % | DOI[10.6019/CHEMBL4296183] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 3.0 | nM | PMID[27096049] |
| NPT23103 | Cell line | PC-3M | Homo sapiens | IC50 | = | 480.0 | nM | PMID[35696646] |
| NPT23103 | Cell line | PC-3M | Homo sapiens | IC50 | = | 190.0 | nM | PMID[35696646] |
| NPT30059 | Cell line | SK-N-BE(2) | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[33289551] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT139 | Cell line | HT-29 | Homo sapiens | Tumor growth delay | = | 4.0 | day | PMID[9876111] |
| NPT32 | Organism | Mus musculus | Mus musculus | Log kill | = | 1.2 | n.a. | PMID[11356111] |
| NPT32 | Organism | Mus musculus | Mus musculus | Log kill | = | 2.8 | n.a. | PMID[11356111] |
| NPT32 | Organism | Mus musculus | Mus musculus | Log kill | < | 0.7 | n.a. | PMID[11356111] |
| NPT32 | Organism | Mus musculus | Mus musculus | Log kill | > | 2.8 | n.a. | PMID[11356111] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 4.9 | % | PMID[12565975] |
| NPT32 | Organism | Mus musculus | Mus musculus | MTD | = | 22.0 | uM kg-1 | PMID[1846923] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 118.0 | % | PMID[1846923] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.02 | ug ml-1 | PMID[2155323] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.08 | ug ml-1 | PMID[2155323] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 197.0 | % | PMID[7381856] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 250.0 | n.a. | PMID[3681902] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 185.0 | n.a. | PMID[3681902] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 147.0 | n.a. | PMID[3681902] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 129.0 | n.a. | PMID[3681902] |
| NPT32 | Organism | Mus musculus | Mus musculus | Lactone | = | 100.0 | % | PMID[9438019] |
| NPT32 | Organism | Mus musculus | Mus musculus | Lactone | = | 42.0 | % | PMID[9438019] |
| NPT32 | Organism | Mus musculus | Mus musculus | Lactone | = | 35.0 | % | PMID[9438019] |
| NPT32 | Organism | Mus musculus | Mus musculus | Lactone | = | 18.0 | % | PMID[9438019] |
| NPT32 | Organism | Mus musculus | Mus musculus | Mean time to death | = | 38.7 | day | PMID[8642549] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | < | 2.93 | n.a. | PMID[8642549] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | < | 193.0 | % | PMID[8642549] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 250.0 | % | PMID[3681902] |
| NPT32 | Organism | Mus musculus | Mus musculus | Highest active dose | = | 12.0 | mg kg-1 | PMID[8410981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Cures | = | 1.0 | n.a. | PMID[8410981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Toxic dose | = | 10.0 | mg kg-1 | PMID[8410981] |
| NPT32 | Organism | Mus musculus | Mus musculus | MTD | = | 12.0 | mg kg-1 | PMID[11965362] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 183.0 | % | PMID[11965362] |
| NPT32 | Organism | Mus musculus | Mus musculus | TGD | = | 17.0 | day | PMID[12502373] |
| NPT32 | Organism | Mus musculus | Mus musculus | MTD | ~ | 20.0 | (mg of CPT) kg-1 | PMID[12502373] |
| NPT32 | Organism | Mus musculus | Mus musculus | Lactone | = | 20.0 | % | PMID[10447944] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 11.3 | g | PMID[25453788] |
| NPT32 | Organism | Mus musculus | Mus musculus | CC50 | = | 620.0 | nM | PMID[27639365] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | T bound | = | 2.7 | ns | PMID[8289200] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | T bound | = | 1.3 | ns | PMID[8289200] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Lactone | = | 5.3 | % | PMID[11052802] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 13.0 | % | PMID[8355258] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | < | 0.5 | % | PMID[8355258] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | < | 0.2 | % | PMID[8355258] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | K | = | 30.0 | 1/Maa | PMID[8355258] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | K | = | 4700.0 | 1/Maa | PMID[8355258] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 1.8 | n.a. | PMID[8355258] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 2.3 | n.a. | PMID[8355258] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Lactone | = | 7.0 | % | PMID[10447944] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 55.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 406.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 101.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 135.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 30330000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 102.17 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 636.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 732.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1570.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 442.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 126.8 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.67 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 144.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 15.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 21.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 10193.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 165.83 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 702.17 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5390000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 34.62 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 138000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 11080.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 91.83 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 25.68 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 399000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.37 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.5 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 6.5 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.0 | /100WBC | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1202830.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 51.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 41200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 392.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 81.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 161.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 30670000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 100.5 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 648.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 242.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1868.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 188.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 116.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.51 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 142.55 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.2 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60800.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 18.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 17.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 11849.17 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 69.83 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 730.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5930000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 37.42 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 144000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 12670.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 93.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.32 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 385000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.08 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.5 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 6.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1170500.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 60.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 43000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 408.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 104.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 126.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 33330000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 101.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 750.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 727.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1383.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 388.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 11.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 119.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.3 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 145.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 59300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 13.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 41.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 12074.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 83.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 834.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5450000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 34.8 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 136300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 13030.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 92.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 25.13 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 392300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.97 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 6.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 732670.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 43.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 40300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 352.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 70.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 146.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 29330000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 102.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 643.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 241.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.8 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 2016.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 147.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 110.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.31 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 141.3 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 45.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 11856.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 131.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1233.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5710000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 35.9 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 140300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 13270.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 89.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.57 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 390700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.87 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 9.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1215000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 37.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 430.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 79.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 130.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 33000000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 736.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 318.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.6 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1533.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 136.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 108.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.76 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 142.73 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 61000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 16.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 9985.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 46.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 602.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5090000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 32.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 132000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 10630.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 94.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 25.93 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 408700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.53 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 5.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1247670.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 42.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 247.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 101.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 170.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 22330000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 103.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 560.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 674.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1840.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 581.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 124.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.08 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 142.1 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 18.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 7405.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 102.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 225.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5350000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 31.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 121300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 7730.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 95.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 22.77 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 383300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 59.3 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 3.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1318330.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Homo sapiens | n.a. | Peff | = | 1.0 | ucm/s | PMID[24900725] |
| Homo sapiens | n.a. | Peff | = | 7.88 | ucm/s | PMID[24900725] |
| Mus musculus | Liver | T1/2 | = | 1.75 | hr | PMID[26719208] |
| Rattus norvegicus | Small intestine | Ka | = | 3.02 | /hr | PMID[24980118] |
| Rattus norvegicus | Small intestine | Peff | = | 7.48 | 10'-5cm/s | PMID[24980118] |
| Homo sapiens | n.a. | Drug uptake | n.a. | n.a. | n.a. | PMID[34852457] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Mus musculus | LD50 | = | 56.2 | mg.kg-1 | PMID[25003995] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC129909 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.7917 | Intermediate Similarity | NPC608071 |
| 0.7703 | Intermediate Similarity | NPC316181 |
| 0.7703 | Intermediate Similarity | NPC151781 |
| 0.7568 | Intermediate Similarity | NPC192674 |
| 0.7467 | Intermediate Similarity | NPC128115 |
| 0.7215 | Intermediate Similarity | NPC74562 |
| 0.7027 | Intermediate Similarity | NPC14325 |
| 0.7027 | Intermediate Similarity | NPC28848 |
| 0.6667 | Remote Similarity | NPC311858 |
| 0.6024 | Remote Similarity | NPC276661 |
| 0.5556 | Remote Similarity | NPC470003 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC129909 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD3785 | Pre-clinical |
| 0.831 | Intermediate Similarity | NPD4334 | Discontinued |
| 0.7568 | Intermediate Similarity | NPD3800 | Phase 2 |
| 0.7179 | Intermediate Similarity | NPD3777 | Phase 3 |
| 0.679 | Remote Similarity | NPD6261 | Phase 2 |
| 0.65 | Remote Similarity | NPD5444 | Phase 2 |
| 0.6471 | Remote Similarity | NPD6206 | Phase 2 |
| 0.6471 | Remote Similarity | NPD6249 | Phase 3 |
| 0.6463 | Remote Similarity | NPD4901 | Clinical (unspecified phase) |
| 0.6429 | Remote Similarity | NPD5507 | Phase 4 |
| 0.6395 | Remote Similarity | NPD6248 | Phase 2 |
| 0.6353 | Remote Similarity | NPD5506 | Approved |
| 0.618 | Remote Similarity | NPD5487 | Phase 1 |
| 0.6024 | Remote Similarity | NPD4315 | Phase 2 |
| 0.6024 | Remote Similarity | NPD4897 | Phase 2 |
| 0.5269 | Remote Similarity | NPD5835 | Phase 3 |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
