NPASS drugs

Drug Information

Drug ID:	NPD5487
Drug Name:	namitecan
Molecular Formula:	C23H22N4O5
Canonical SMILES:	NCCO/N=C/c1c2Cn3c(c2nc2c1cccc2)cc1c(c3=O)COC(=O)[C@]1(O)CC
Standard InCHI:	"InChI=1S/C23H22N4O5/c1-2-23(30)17-9-19-20-15(11-27(19)21(28)16(17)12-31-22(23)29)14(10-25-32-8-7-24)13-5-3-4-6-18(13)26-20/h3-6,9-10,30H,2,7-8,11-12,24H2,1H3/b25-10+/t23-/m0/s1"
Standard InCHIKey:	IBTISPLPBBHVSU-UVOOVGFISA-N
Max Developmental Stage:	Phase 1
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD5487

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	97211
0.1-0.2	113375
0.2-0.3	1124
0.3-0.4	6
0.4-0.5	5
0.5-0.6	13
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.618	NPC129909
Remote Similarity	0.618	NPC606011
Remote Similarity	0.6044	NPC192674
Remote Similarity	0.6044	NPC599867
Remote Similarity	0.6022	NPC276661
Remote Similarity	0.6022	NPC599818
Remote Similarity	0.5532	NPC90909
Remote Similarity	0.5474	NPC128115
Remote Similarity	0.5474	NPC267229
Remote Similarity	0.5474	NPC42856
Remote Similarity	0.5312	NPC316181
Remote Similarity	0.5312	NPC151781
Remote Similarity	0.5312	NPC599830
Remote Similarity	0.5263	NPC106338
Remote Similarity	0.5263	NPC303320
Remote Similarity	0.5263	NPC541875
Remote Similarity	0.5263	NPC608071
Remote Similarity	0.5213	NPC139114
Remote Similarity	0.505	NPC74562

Drug Structure

NPD5487 OpenBabel08211708292D 35 39 0 0 1 0 0 0 0 0999 V2000 -2.3779 2.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3554 2.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4440 0.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4438 0.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5995 -0.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5991 1.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2849 -4.5449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3866 -3.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5329 1.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9111 -1.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2223 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8447 -0.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7548 0.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9109 -0.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0663 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6892 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6890 0.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7546 0.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3775 0.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0661 0.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5333 -0.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0002 0.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8443 1.4630 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0735 -5.1176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.6997 -2.0335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.9105 1.4638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3777 0.0007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5333 -1.4869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8858 1.4863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3328 2.3485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5980 -3.0028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9718 -6.0869 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9638 -4.7210 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8439 3.2341 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 13 2 0 0 0 0 6 18 2 0 0 0 0 7 8 1 0 0 0 0 7 24 1 0 0 0 0 8 32 1 0 0 0 0 9 17 1 0 0 0 0 9 19 2 0 0 0 0 10 14 1 0 0 0 0 10 25 2 0 0 0 0 11 15 1 0 0 0 0 11 27 1 0 0 0 0 12 16 1 0 0 0 0 12 31 1 0 0 0 0 13 14 1 0 0 0 0 13 18 1 0 0 0 0 14 15 2 0 0 0 0 15 20 1 0 0 0 0 16 17 2 0 0 0 0 16 21 1 0 0 0 0 17 23 1 0 0 0 0 18 26 1 0 0 0 0 19 20 1 0 0 0 0 19 27 1 0 0 0 0 20 26 2 0 0 0 0 21 27 1 0 0 0 0 21 28 2 0 0 0 0 22 23 1 0 0 0 0 22 29 2 0 0 0 0 22 31 1 0 0 0 0 23 2 1 1 0 0 0 23 30 1 0 0 0 0 24 33 1 0 0 0 0 24 34 1 0 0 0 0 25 32 1 0 0 0 0 30 35 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB015955
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	434.16
ALogP	-2.502
MLogP	3
XLogP	1.846
HDA	7
HBD	2
Rotatable Bonds	8
TPSA	127.34
RO5 Violation	0