NPASS drugs

Drug Information

Drug ID:	NPD4334
Drug Name:	BN-80245
Molecular Formula:	C21H18N2O4
Canonical SMILES:	CCC1(O)CC(=O)OCc2c1cc1c3nc4ccccc4cc3Cn1c2=O
Standard InCHI:	"InChI=1S/C21H18N2O4/c1-2-21(26)9-18(24)27-11-14-15(21)8-17-19-13(10-23(17)20(14)25)7-12-5-3-4-6-16(12)22-19/h3-8,26H,2,9-11H2,1H3"
Standard InCHIKey:	PAEZRCINULFAGO-UHFFFAOYSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4334

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	66133
0.1-0.2	142919
0.2-0.3	2655
0.3-0.4	4
0.4-0.5	4
0.5-0.6	4
0.6-0.7	16
0.7-0.8	1
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.831	NPC129909
Intermediate Similarity	0.831	NPC606011
Intermediate Similarity	0.76	NPC90909
Remote Similarity	0.6842	NPC14325
Remote Similarity	0.6842	NPC28848
Remote Similarity	0.6582	NPC106338
Remote Similarity	0.6582	NPC303320
Remote Similarity	0.6582	NPC541875
Remote Similarity	0.6582	NPC608071
Remote Similarity	0.65	NPC311858
Remote Similarity	0.642	NPC316181
Remote Similarity	0.642	NPC151781
Remote Similarity	0.642	NPC267229
Remote Similarity	0.642	NPC599830
Remote Similarity	0.6296	NPC192674
Remote Similarity	0.6296	NPC599867
Remote Similarity	0.622	NPC128115
Remote Similarity	0.622	NPC42856
Remote Similarity	0.6047	NPC74562
Remote Similarity	0.5926	NPC139114
Remote Similarity	0.5921	NPC545765
Remote Similarity	0.5521	NPC201362
Remote Similarity	0.5422	NPC470003

Drug Structure

NPD4334 OpenBabel08211705262D 28 32 0 0 1 0 0 0 0 0999 V2000 0.7547 2.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7460 2.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0373 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0371 0.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1976 -0.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1973 1.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5187 -0.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8400 1.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3826 1.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8398 -0.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4369 -0.6051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3578 0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6789 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6789 -0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6791 0.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3576 0.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0002 0.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8032 0.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6787 0.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8396 -0.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4373 1.5738 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -2.5183 1.4547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.8199 0.4839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8394 -1.4847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7372 2.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3823 -0.3895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0458 3.2906 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 21 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 12 2 0 0 0 0 6 16 2 0 0 0 0 7 12 1 0 0 0 0 7 13 2 0 0 0 0 8 15 1 0 0 0 0 8 17 2 0 0 0 0 9 18 1 0 0 0 0 9 21 1 0 0 0 0 10 13 1 0 0 0 0 10 23 1 0 0 0 0 11 14 1 0 0 0 0 11 27 1 0 0 0 0 12 16 1 0 0 0 0 13 19 1 0 0 0 0 14 15 2 0 0 0 0 14 20 1 0 0 0 0 15 21 1 0 0 0 0 16 22 1 0 0 0 0 17 19 1 0 0 0 0 17 23 1 0 0 0 0 18 24 2 0 0 0 0 18 27 1 0 0 0 0 19 22 2 0 0 0 0 20 23 1 0 0 0 0 20 25 2 0 0 0 0 21 26 1 0 0 0 0 26 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB000154
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	362.13
ALogP	-1.5522
MLogP	3.11
XLogP	1.696
HDA	6
HBD	1
Rotatable Bonds	3
TPSA	79.73
RO5 Violation	0