NPASS drugs

Drug Information

Drug ID:	NPD3777
Drug Name:	Rubitecan
Molecular Formula:	C20H15N3O6
Canonical SMILES:	CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4cccc(c4cc3Cn1c2=O)N(=O)=O
Standard InCHI:	"InChI=1S/C20H15N3O6/c1-2-20(26)13-7-16-17-10(8-22(16)18(24)12(13)9-29-19(20)25)6-11-14(21-17)4-3-5-15(11)23(27)28/h3-7,26H,2,8-9H2,1H3/t20-/m0/s1"
Standard InCHIKey:	VHXNKPBCCMUMSW-FQEVSTJZSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3777

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	103830
0.1-0.2	107152
0.2-0.3	728
0.3-0.4	3
0.4-0.5	5
0.5-0.6	4
0.6-0.7	12
0.7-0.8	4
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7179	NPC129909
Intermediate Similarity	0.7179	NPC606011
Intermediate Similarity	0.7	NPC192674
Intermediate Similarity	0.7	NPC599867
Remote Similarity	0.6914	NPC128115
Remote Similarity	0.6914	NPC42856
Remote Similarity	0.6667	NPC106338
Remote Similarity	0.6667	NPC303320
Remote Similarity	0.6667	NPC541875
Remote Similarity	0.6667	NPC608071
Remote Similarity	0.6506	NPC316181
Remote Similarity	0.6506	NPC151781
Remote Similarity	0.6506	NPC599830
Remote Similarity	0.6386	NPC90909
Remote Similarity	0.631	NPC267229
Remote Similarity	0.6136	NPC74562
Remote Similarity	0.5618	NPC276661
Remote Similarity	0.5618	NPC599818
Remote Similarity	0.5465	NPC139114
Remote Similarity	0.54	NPC556976

Drug Structure

NPD3777 OpenBabel08211704332D 30 34 0 0 1 0 0 0 0 0999 V2000 -2.3586 2.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3444 2.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3751 0.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5373 1.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3753 0.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8628 -0.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5123 1.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1880 -0.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8378 -0.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0251 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6999 0.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6754 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6752 0.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6997 0.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5377 -0.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3500 0.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0249 0.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5127 -0.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0002 0.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8374 1.4511 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8624 1.4519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3502 0.0007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.5379 -1.4964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5129 -1.4829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8786 1.4742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3301 2.3294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6597 -2.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4163 -2.0033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8371 3.2078 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 14 1 0 0 0 0 5 15 2 0 0 0 0 6 10 2 0 0 0 0 6 11 1 0 0 0 0 7 13 1 0 0 0 0 7 16 2 0 0 0 0 8 10 1 0 0 0 0 8 22 1 0 0 0 0 9 12 1 0 0 0 0 9 29 1 0 0 0 0 10 17 1 0 0 0 0 11 14 2 0 0 0 0 11 15 1 0 0 0 0 12 13 2 0 0 0 0 12 18 1 0 0 0 0 13 20 1 0 0 0 0 14 21 1 0 0 0 0 15 23 1 0 0 0 0 16 17 1 0 0 0 0 16 22 1 0 0 0 0 17 21 2 0 0 0 0 18 22 1 0 0 0 0 18 24 2 0 0 0 0 19 20 1 0 0 0 0 19 25 2 0 0 0 0 19 29 1 0 0 0 0 20 2 1 1 0 0 0 20 26 1 0 0 0 0 23 27 2 0 0 0 0 23 28 2 0 0 0 0 26 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC000115; DIB008120
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	472335
ChEBI
CAS Number

Drug Properties

Molecular Weight	393.1
ALogP	-0.9269
MLogP	2.67
XLogP	1.809
HDA	6
HBD	1
Rotatable Bonds	5
TPSA	122.87
RO5 Violation	0