Drug Information| Drug ID:   | NPD4901 |
| Drug Name:   | |
| Molecular Formula:   | C22H20N2O6 |
| Canonical SMILES:   | OCCOC1c2cc3ccccc3nc2c2n1c(=O)c1c(c2)[C@@](O)(CC)C(=O)OC1 |
| Standard InCHI:   | "InChI=1S/C22H20N2O6/c1-2-22(28)15-10-17-18-13(9-12-5-3-4-6-16(12)23-18)20(29-8-7-25)24(17)19(26)14(15)11-30-21(22)27/h3-6,9-10,20,25,28H,2,7-8,11H2,1H3/t20?,22-/m0/s1" |
| Standard InCHIKey:   | XAKLYHGHEFMDAP-IAXKEJLGSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4901Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6543 | NPC139114 |
| Remote Similarity | 0.6463 | NPC129909 |
| Remote Similarity | 0.6463 | NPC606011 |
| Remote Similarity | 0.593 | NPC90909 |
| Remote Similarity | 0.5111 | NPC106338 |
| Remote Similarity | 0.5111 | NPC303320 |
| Remote Similarity | 0.5111 | NPC541875 |
| Remote Similarity | 0.5111 | NPC608071 |
| Remote Similarity | 0.5055 | NPC192674 |
| Remote Similarity | 0.5055 | NPC599867 |
| Molecular Weight   | 408.13 |
| ALogP   | -2.0576 |
| MLogP   | 3 |
| XLogP   | 1.408 |
| HDA   | 8 |
| HBD   | 2 |
| Rotatable Bonds   | 7 |
| TPSA   | 109.19 |
| RO5 Violation   | 0 |