Drug Information| Drug ID:   | NPD6248 |
| Drug Name:   | Belotecan Hydrochloride |
| Molecular Formula:   | C25H27N3O4.ClH |
| Canonical SMILES:   | CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccccc4c(c3Cn1c2=O)CCNC(C)C.Cl |
| Standard InCHI:   | "InChI=1S/C25H27N3O4.ClH/c1-4-25(31)19-11-21-22-17(12-28(21)23(29)18(19)13-32-24(25)30)15(9-10-26-14(2)3)16-7-5-6-8-20(16)27-22;/h5-8,11,14,26,31H,4,9-10,12-13H2,1-3H3;1H/t25-;/m0./s1" |
| Standard InCHIKey:   | SJKBXKKZBKCHET-UQIIZPHYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6248Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6591 | NPC276661 |
| Remote Similarity | 0.6591 | NPC599818 |
| Remote Similarity | 0.6395 | NPC129909 |
| Remote Similarity | 0.6395 | NPC606011 |
| Remote Similarity | 0.625 | NPC192674 |
| Remote Similarity | 0.625 | NPC599867 |
| Remote Similarity | 0.5714 | NPC90909 |
| Remote Similarity | 0.5652 | NPC128115 |
| Remote Similarity | 0.5652 | NPC42856 |
| Remote Similarity | 0.5435 | NPC106338 |
| Remote Similarity | 0.5435 | NPC303320 |
| Remote Similarity | 0.5435 | NPC541875 |
| Remote Similarity | 0.5435 | NPC608071 |
| Remote Similarity | 0.5385 | NPC139114 |
| Remote Similarity | 0.537 | NPC197381 |
| Remote Similarity | 0.5319 | NPC316181 |
| Remote Similarity | 0.5319 | NPC151781 |
| Remote Similarity | 0.5319 | NPC267229 |
| Remote Similarity | 0.5319 | NPC599830 |
| Remote Similarity | 0.5051 | NPC74562 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 433.2 |
| ALogP   | -1.688 |
| MLogP   | 3.44 |
| XLogP   | 2.677 |
| HDA   | 7 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 91.76 |
| RO5 Violation   | 0 |