NPASS drugs

Drug Information

Drug ID:	NPD6206
Drug Name:	Gimatecan
Molecular Formula:	C25H25N3O5
Canonical SMILES:	CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccccc4c(c3Cn1c2=O)/C=N/OC(C)(C)C
Standard InCHI:	"InChI=1S/C25H25N3O5/c1-5-25(31)18-10-20-21-16(12-28(20)22(29)17(18)13-32-23(25)30)15(11-26-33-24(2,3)4)14-8-6-7-9-19(14)27-21/h6-11,31H,5,12-13H2,1-4H3/b26-11+/t25-/m0/s1"
Standard InCHIKey:	UIVFUQKYVFCEKJ-OPTOVBNMSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD6206

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	104368
0.1-0.2	106202
0.2-0.3	1140
0.3-0.4	6
0.4-0.5	4
0.5-0.6	15
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6471	NPC129909
Remote Similarity	0.6471	NPC606011
Remote Similarity	0.6111	NPC276661
Remote Similarity	0.6111	NPC599818
Remote Similarity	0.5955	NPC192674
Remote Similarity	0.5955	NPC599867
Remote Similarity	0.5778	NPC90909
Remote Similarity	0.5714	NPC128115
Remote Similarity	0.5714	NPC42856
Remote Similarity	0.5543	NPC267229
Remote Similarity	0.5495	NPC106338
Remote Similarity	0.5495	NPC303320
Remote Similarity	0.5495	NPC541875
Remote Similarity	0.5495	NPC608071
Remote Similarity	0.5444	NPC139114
Remote Similarity	0.5376	NPC316181
Remote Similarity	0.5376	NPC151781
Remote Similarity	0.5376	NPC599830
Remote Similarity	0.5102	NPC74562

Drug Structure

NPD6206 OpenBabel08211709092D 34 38 0 0 1 0 0 0 0 0999 V2000 -2.3763 2.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3502 -3.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9539 -2.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2799 -4.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3544 2.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4382 0.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4380 0.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5943 -0.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5939 1.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5312 1.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9070 -1.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2194 -0.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8441 -0.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7502 0.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9068 -0.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0628 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6880 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6878 0.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7500 0.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3752 0.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0626 0.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5315 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0002 0.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3815 -3.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8437 1.4620 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6951 -2.0321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.9064 1.4628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3754 0.0007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5316 -1.4865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8852 1.4853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3326 2.3468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5935 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8434 3.2319 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 5 1 0 0 0 0 2 24 1 0 0 0 0 3 24 1 0 0 0 0 4 24 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 7 9 1 0 0 0 0 8 14 2 0 0 0 0 9 19 2 0 0 0 0 10 18 1 0 0 0 0 10 20 2 0 0 0 0 11 15 1 0 0 0 0 11 26 2 0 0 0 0 12 16 1 0 0 0 0 12 28 1 0 0 0 0 13 17 1 0 0 0 0 13 32 1 0 0 0 0 14 15 1 0 0 0 0 14 19 1 0 0 0 0 15 16 2 0 0 0 0 16 21 1 0 0 0 0 17 18 2 0 0 0 0 17 22 1 0 0 0 0 18 25 1 0 0 0 0 19 27 1 0 0 0 0 20 21 1 0 0 0 0 20 28 1 0 0 0 0 21 27 2 0 0 0 0 22 28 1 0 0 0 0 22 29 2 0 0 0 0 23 25 1 0 0 0 0 23 30 2 0 0 0 0 23 32 1 0 0 0 0 24 33 1 0 0 0 0 25 5 1 1 0 0 0 25 31 1 0 0 0 0 26 33 1 0 0 0 0 31 34 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB010607
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	447.18
ALogP	-0.7417
MLogP	3.33
XLogP	3.922
HDA	6
HBD	1
Rotatable Bonds	9
TPSA	101.32
RO5 Violation	0