Natural Product: NPC131887| Natural Product ID | NPC131887 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Ro-316233 |
| IUPAC Name | 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
| Synonyms | Ro-31-6233 |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL266487 |
| PubChem CID |
2399 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | DQYBRTASHMYDJG-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C20H13N3O2/c24-19-17(13-9-21-15-7-3-1-5-11(13)15)18(20(25)23-19)14-10-22-16-8-4-2-6-12(14)16/h1-10,21-22H,(H,23,24,25) |
| SMILES | c1ccc2c(c1)c(c[nH]2)C1=C(c2c[nH]c3ccccc23)C(=O)N=C1O |
  Calculated Properties| Molecular Weight:   | 327.1 | Volume:   | 333.264 Van der Waals volume.
|
| Dense:   | 0.982 | LogP:   | 2.245 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.202 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -3.814 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 2.0 | Rigid Bonds:   | 26.0 |
| TPSA:   | 81.24 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 5.0 |
| H-Bond Donor:   | 3.0 | Rings:   | 5.0 |
| Heavy Atoms:   | 5.0 |
| QED Drug-Likeness Score:   | 0.519 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.64 | Fsp3:   | 0.0 |
| MCE-18:   | 50.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.998 | Fluc inhibitor:   | 0.798 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.364 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.636 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.176 | Promiscuous compounds:   | 0.928 |
| Caco-2 Permeability:   | -4.744 | MDCK Permeability:   | -4.703 |
| Pgp-inhibitor:   | 0.443 | Pgp-substrate:   | 0.004 |
| PAMPA:   |
0.534 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.017 |
| 20% Bioavailability (F20%):   | 0.01 | 30% Bioavailability (F30%):   | 0.368 |
| 50% Bioavailability (F50%):   | 0.26 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.049 | MRP1:   | 0.06 |
| Plasma Protein Binding (PPB):   | 98.979% | Volume Distribution (VD):   | -0.572 |
| Fu: |
0.784% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.949 |
| OATP1B3 inhibitor:   | 0.907 | BCRP inhibitor:   | 0.0 |
| BSEP inhibitor:   | 0.977 |
| CYP1A2-inhibitor:   | 0.0 | CYP1A2-substrate:   | 0.549 |
| CYP2C19-inhibitor:   | 0.0 | CYP2C19-substrate:   | 0.999 |
| CYP2C9-inhibitor:   | 0.014 | CYP2C9-substrate:   | 0.001 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 1.0 |
| CYP3A4-inhibitor:   | 0.0 | CYP3A4-substrate:   | 0.649 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 1.0 |
| HLM stability:   |
1.0 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | -0.011 | Half-life (T1/2):   | 1.229 |
| hERG Blockers:   | 0.062 | hERG Blockers (10um):   | 0.174 |
| Human Hepatotoxicity (H-HT):   | 0.989 | Drug-induced Liver Injury (DILI):   | 0.999 |
| AMES Toxicity:   | 0.847 | Rat Oral Acute Toxicity:   | 0.66 |
| Maximum Recommended Daily Dose:   | 0.828 | Skin Sensitization:   | 0.937 |
| Carcinogencity:   | 0.917 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.619 | Respiratory Toxicity:   | 0.839 |
| Drug-induced Neurotoxicity:   | 0.897 | Ototoxicity:   | 0.591 |
| Hematotoxicity:   | 0.631 | Drug-induced Nephrotoxicity:   | 0.958 |
| Genotoxicity:   | 0.989 | RPMI-8226 Immunitoxicity:   | 0.02 |
| A549 Cytotoxicity:   | 0.007 | Hek293 Cytotoxicity:   | 0.089 |
| BCF:   |
1.199 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
4.206 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
5.03 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.954 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO18286 | Lycogala epidendrum | Species | Enteridiidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15911254] |
| NPO18286 | Lycogala epidendrum | Species | Enteridiidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18286 | Lycogala epidendrum | Species | Enteridiidae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO18286 | Lycogala epidendrum | Species | Enteridiidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18286 | Lycogala epidendrum | Species | Enteridiidae | Eukaryota | n.a. | n.a. | n.a. | Database[Title] |
| NPO18286 | Lycogala epidendrum | Species | Enteridiidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[8151612] |
| NPT2543 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Oryctolagus cuniculus | IC50 | = | 200000.0 | nM | PMID[8151612] |
| NPT3192 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Rattus norvegicus | IC50 | = | 3100.0 | nM | PMID[1732526] |
| NPT3192 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Rattus norvegicus | IC50 | = | 11800.0 | nM | PMID[1732526] |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | IC50 | = | 1599.0 | nM | PMID[15380221] |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | Inhibition | < | 50.0 | % | PMID[15911254] |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | Inhibition | < | 50.0 | % | PMID[15911254] |
| NPT1344 | Individual protein | Serine/threonine-protein kinase EEF2K | Homo sapiens | Inhibition | < | 50.0 | % | PMID[15911254] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Activity | = | 14.0 | % | PMID[16302800] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Activity | = | 8.0 | % | PMID[16302800] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Kd | = | 27.0 | nM | PMID[16302800] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Kb | = | 37.0 | 10^6/M | PMID[16302800] |
| NPT1046 | Individual protein | NAD-dependent deacetylase sirtuin 1 | Homo sapiens | Inhibition | = | 52.7 | % | PMID[17149860] |
| NPT1158 | Individual protein | NAD-dependent deacetylase sirtuin 2 | Homo sapiens | IC50 | = | 4700.0 | nM | PMID[17149860] |
| NPT1675 | Individual protein | CaM kinase II delta | Homo sapiens | IC50 | = | 1190.0 | nM | PMID[18334295] |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Inhibition | = | 86.0 | % | PMID[10998351] |
| NPT1426 | Individual protein | c-Jun N-terminal kinase 1 | Homo sapiens | Inhibition | = | 95.0 | % | PMID[10998351] |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Inhibition | = | 90.0 | % | PMID[10998351] |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Inhibition | = | 88.0 | % | PMID[10998351] |
| NPT1615 | Individual protein | MAP kinase p38 gamma | Homo sapiens | Inhibition | = | 83.0 | % | PMID[10998351] |
| NPT1614 | Individual protein | MAP kinase p38 delta | Homo sapiens | Inhibition | = | 90.0 | % | PMID[10998351] |
| NPT1441 | Individual protein | MAP kinase-activated protein kinase 2 | Homo sapiens | Inhibition | = | 113.0 | % | PMID[10998351] |
| NPT1613 | Individual protein | Ribosomal protein S6 kinase alpha 5 | Homo sapiens | Inhibition | = | 56.0 | % | PMID[10998351] |
| NPT1612 | Individual protein | MAP kinase-activated protein kinase 5 | Homo sapiens | Inhibition | = | 96.0 | % | PMID[10998351] |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Inhibition | = | 57.0 | % | PMID[10998351] |
| NPT1443 | Individual protein | Pyruvate dehydrogenase kinase isoform 1 | Homo sapiens | Inhibition | = | 95.0 | % | PMID[10998351] |
| NPT1448 | Individual protein | Serine/threonine-protein kinase Sgk1 | Homo sapiens | Inhibition | = | 101.0 | % | PMID[10998351] |
| NPT1611 | Individual protein | Ribosomal protein S6 kinase 1 | Homo sapiens | Inhibition | = | 87.0 | % | PMID[10998351] |
| NPT1610 | Individual protein | Rho-associated protein kinase 2 | Rattus norvegicus | Inhibition | = | 100.0 | % | PMID[10998351] |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Inhibition | = | 91.0 | % | PMID[10998351] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Inhibition | = | 91.0 | % | PMID[10998351] |
| NPT3317 | Individual protein | Serine/threonine-protein kinase MARK1 | Homo sapiens | Residual Activity | = | 37.0 | % | PMID[23398362] |
| NPT3419 | Individual protein | Serine/threonine-protein kinase SRPK3 | Homo sapiens | Residual Activity | = | 86.0 | % | PMID[23398362] |
| NPT3419 | Individual protein | Serine/threonine-protein kinase SRPK3 | Homo sapiens | Residual Activity | = | 35.0 | % | PMID[23398362] |
| NPT3284 | Individual protein | Serine/threonine-protein kinase NEK7 | Homo sapiens | Residual Activity | = | 102.0 | % | PMID[23398362] |
| NPT3214 | Individual protein | Tyrosine-protein kinase ABL2 | Homo sapiens | Residual Activity | = | 25.0 | % | PMID[23398362] |
| NPT1432 | Individual protein | Serine/threonine-protein kinase Aurora-A | Homo sapiens | Residual Activity | = | 80.0 | % | PMID[23398362] |
| NPT3266 | Individual protein | Casein kinase I delta | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT1721 | Individual protein | Death-associated protein kinase 1 | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT3219 | Individual protein | Ephrin type-A receptor 5 | Homo sapiens | Residual Activity | = | 97.0 | % | PMID[23398362] |
| NPT3372 | Individual protein | Fibroblast growth factor receptor 4 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | Residual Activity | = | 29.0 | % | PMID[23398362] |
| NPT3406 | Individual protein | Mitogen-activated protein kinase kinase kinase kinase 2 | Homo sapiens | Residual Activity | = | 80.0 | % | PMID[23398362] |
| NPT3205 | Individual protein | Tyrosine-protein kinase HCK | Homo sapiens | Residual Activity | = | 63.0 | % | PMID[23398362] |
| NPT3207 | Individual protein | c-Jun N-terminal kinase 3 | Homo sapiens | Residual Activity | = | -3.0 | % | PMID[23398362] |
| NPT1711 | Individual protein | Serine/threonine-protein kinase MST1 | Homo sapiens | Residual Activity | = | 41.0 | % | PMID[23398362] |
| NPT3285 | Individual protein | Serine/threonine protein kinase NLK | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT1432 | Individual protein | Serine/threonine-protein kinase Aurora-A | Homo sapiens | Residual Activity | = | 45.0 | % | PMID[23398362] |
| NPT3266 | Individual protein | Casein kinase I delta | Homo sapiens | Residual Activity | = | 56.0 | % | PMID[23398362] |
| NPT1721 | Individual protein | Death-associated protein kinase 1 | Homo sapiens | Residual Activity | = | 93.0 | % | PMID[23398362] |
| NPT3236 | Individual protein | Death-associated protein kinase 2 | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT3219 | Individual protein | Ephrin type-A receptor 5 | Homo sapiens | Residual Activity | = | 102.0 | % | PMID[23398362] |
| NPT3211 | Individual protein | Ephrin type-A receptor 7 | Homo sapiens | Residual Activity | = | 99.0 | % | PMID[23398362] |
| NPT3372 | Individual protein | Fibroblast growth factor receptor 4 | Homo sapiens | Residual Activity | = | 71.0 | % | PMID[23398362] |
| NPT3406 | Individual protein | Mitogen-activated protein kinase kinase kinase kinase 2 | Homo sapiens | Residual Activity | = | 19.0 | % | PMID[23398362] |
| NPT1438 | Individual protein | Insulin-like growth factor I receptor | Homo sapiens | Residual Activity | = | 128.0 | % | PMID[23398362] |
| NPT1438 | Individual protein | Insulin-like growth factor I receptor | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT1478 | Individual protein | Vascular endothelial growth factor receptor 2 | Homo sapiens | Residual Activity | = | 16.0 | % | PMID[23398362] |
| NPT1478 | Individual protein | Vascular endothelial growth factor receptor 2 | Homo sapiens | Residual Activity | = | 2.0 | % | PMID[23398362] |
| NPT3282 | Individual protein | Maternal embryonic leucine zipper kinase | Homo sapiens | Residual Activity | = | 80.0 | % | PMID[23398362] |
| NPT1711 | Individual protein | Serine/threonine-protein kinase MST1 | Homo sapiens | Residual Activity | = | 7.0 | % | PMID[23398362] |
| NPT3331 | Individual protein | Serine/threonine-protein kinase MST2 | Homo sapiens | Residual Activity | = | 64.0 | % | PMID[23398362] |
| NPT3285 | Individual protein | Serine/threonine protein kinase NLK | Homo sapiens | Residual Activity | = | 71.0 | % | PMID[23398362] |
| NPT1442 | Individual protein | Serine/threonine-protein kinase PAK 2 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT1433 | Individual protein | Serine/threonine-protein kinase Aurora-B | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT1433 | Individual protein | Serine/threonine-protein kinase Aurora-B | Homo sapiens | Residual Activity | = | 20.0 | % | PMID[23398362] |
| NPT3236 | Individual protein | Death-associated protein kinase 2 | Homo sapiens | Residual Activity | = | 58.0 | % | PMID[23398362] |
| NPT3211 | Individual protein | Ephrin type-A receptor 7 | Homo sapiens | Residual Activity | = | 67.0 | % | PMID[23398362] |
| NPT3244 | Individual protein | Tyrosine-protein kinase FER | Homo sapiens | Residual Activity | = | 111.0 | % | PMID[23398362] |
| NPT3244 | Individual protein | Tyrosine-protein kinase FER | Homo sapiens | Residual Activity | = | 52.0 | % | PMID[23398362] |
| NPT3457 | Individual protein | G protein-coupled receptor kinase 5 | Homo sapiens | Residual Activity | = | 92.0 | % | PMID[23398362] |
| NPT1438 | Individual protein | Insulin-like growth factor I receptor | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT2574 | Individual protein | Insulin receptor | Homo sapiens | Residual Activity | = | 87.0 | % | PMID[23398362] |
| NPT2574 | Individual protein | Insulin receptor | Homo sapiens | Residual Activity | = | 62.0 | % | PMID[23398362] |
| NPT3242 | Individual protein | LIM domain kinase 1 | Homo sapiens | Residual Activity | = | 108.0 | % | PMID[23398362] |
| NPT3282 | Individual protein | Maternal embryonic leucine zipper kinase | Homo sapiens | Residual Activity | = | 27.0 | % | PMID[23398362] |
| NPT3381 | Individual protein | Misshapen-like kinase 1 | Homo sapiens | Residual Activity | = | 94.0 | % | PMID[23398362] |
| NPT3331 | Individual protein | Serine/threonine-protein kinase MST2 | Homo sapiens | Residual Activity | = | 9.0 | % | PMID[23398362] |
| NPT1442 | Individual protein | Serine/threonine-protein kinase PAK 2 | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT3206 | Individual protein | Serine/threonine-protein kinase Aurora-C | Homo sapiens | Residual Activity | = | 114.0 | % | PMID[23398362] |
| NPT3273 | Individual protein | Casein kinase II alpha (prime) | Homo sapiens | Residual Activity | = | 118.0 | % | PMID[23398362] |
| NPT3273 | Individual protein | Casein kinase II alpha (prime) | Homo sapiens | Residual Activity | = | 94.0 | % | PMID[23398362] |
| NPT3336 | Individual protein | Serine/threonine-protein kinase DCLK2 | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT3216 | Individual protein | Ephrin type-A receptor 8 | Homo sapiens | Residual Activity | = | 120.0 | % | PMID[23398362] |
| NPT3216 | Individual protein | Ephrin type-A receptor 8 | Homo sapiens | Residual Activity | = | 102.0 | % | PMID[23398362] |
| NPT3457 | Individual protein | G protein-coupled receptor kinase 5 | Homo sapiens | Residual Activity | = | 44.0 | % | PMID[23398362] |
| NPT2574 | Individual protein | Insulin receptor | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT3242 | Individual protein | LIM domain kinase 1 | Homo sapiens | Residual Activity | = | 50.0 | % | PMID[23398362] |
| NPT3279 | Individual protein | Serine/threonine-protein kinase 11 | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT3381 | Individual protein | Misshapen-like kinase 1 | Homo sapiens | Residual Activity | = | 41.0 | % | PMID[23398362] |
| NPT3332 | Individual protein | Serine/threonine-protein kinase 24 | Homo sapiens | Residual Activity | = | 21.0 | % | PMID[23398362] |
| NPT3332 | Individual protein | Serine/threonine-protein kinase 24 | Homo sapiens | Residual Activity | = | 2.0 | % | PMID[23398362] |
| NPT3247 | Individual protein | Serine/threonine-protein kinase PAK 3 | Homo sapiens | Residual Activity | = | 59.0 | % | PMID[23398362] |
| NPT3247 | Individual protein | Serine/threonine-protein kinase PAK 3 | Homo sapiens | Residual Activity | = | 74.0 | % | PMID[23398362] |
| NPT3206 | Individual protein | Serine/threonine-protein kinase Aurora-C | Homo sapiens | Residual Activity | = | 94.0 | % | PMID[23398362] |
| NPT1659 | Individual protein | Tyrosine-protein kinase receptor UFO | Homo sapiens | Residual Activity | = | 86.0 | % | PMID[23398362] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | Residual Activity | = | 27.0 | % | PMID[23398362] |
| NPT3303 | Individual protein | Discoidin domain-containing receptor 2 | Homo sapiens | Residual Activity | = | 90.0 | % | PMID[23398362] |
| NPT3212 | Individual protein | Ephrin type-B receptor 1 | Homo sapiens | Residual Activity | = | 83.0 | % | PMID[23398362] |
| NPT2574 | Individual protein | Insulin receptor | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT3386 | Individual protein | Interleukin-1 receptor-associated kinase 1 | Homo sapiens | Residual Activity | = | 110.0 | % | PMID[23398362] |
| NPT3279 | Individual protein | Serine/threonine-protein kinase 11 | Homo sapiens | Residual Activity | = | 97.0 | % | PMID[23398362] |
| NPT1691 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 6 | Homo sapiens | Residual Activity | = | 79.0 | % | PMID[23398362] |
| NPT1691 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 6 | Homo sapiens | Residual Activity | = | 101.0 | % | PMID[23398362] |
| NPT3320 | Individual protein | Proto-oncogene tyrosine-protein kinase MER | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT3245 | Individual protein | Tyrosine kinase non-receptor protein 2 | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT3245 | Individual protein | Tyrosine kinase non-receptor protein 2 | Homo sapiens | Residual Activity | = | 21.0 | % | PMID[23398362] |
| NPT1659 | Individual protein | Tyrosine-protein kinase receptor UFO | Homo sapiens | Residual Activity | = | 56.0 | % | PMID[23398362] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | Residual Activity | = | 5.0 | % | PMID[23398362] |
| NPT1683 | Individual protein | Dual specificity protein kinase CLK3 | Homo sapiens | Residual Activity | = | 60.0 | % | PMID[23398362] |
| NPT3303 | Individual protein | Discoidin domain-containing receptor 2 | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT1688 | Individual protein | Myotonin-protein kinase | Homo sapiens | Residual Activity | = | 99.0 | % | PMID[23398362] |
| NPT3212 | Individual protein | Ephrin type-B receptor 1 | Homo sapiens | Residual Activity | = | 39.0 | % | PMID[23398362] |
| NPT2941 | Individual protein | Ephrin type-B receptor 2 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT3438 | Individual protein | G protein-coupled receptor kinase 7 | Homo sapiens | Residual Activity | = | 78.0 | % | PMID[23398362] |
| NPT3438 | Individual protein | G protein-coupled receptor kinase 7 | Homo sapiens | Residual Activity | = | 20.0 | % | PMID[23398362] |
| NPT3386 | Individual protein | Interleukin-1 receptor-associated kinase 1 | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT1707 | Individual protein | Serine/threonine-protein kinase 10 | Homo sapiens | Residual Activity | = | 39.0 | % | PMID[23398362] |
| NPT1707 | Individual protein | Serine/threonine-protein kinase 10 | Homo sapiens | Residual Activity | = | 15.0 | % | PMID[23398362] |
| NPT3441 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 7 | Homo sapiens | Residual Activity | = | 126.0 | % | PMID[23398362] |
| NPT3320 | Individual protein | Proto-oncogene tyrosine-protein kinase MER | Homo sapiens | Residual Activity | = | 33.0 | % | PMID[23398362] |
| NPT1337 | Individual protein | Hepatocyte growth factor receptor | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT1661 | Individual protein | ALK tyrosine kinase receptor | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT1661 | Individual protein | ALK tyrosine kinase receptor | Homo sapiens | Residual Activity | = | 44.0 | % | PMID[23398362] |
| NPT3215 | Individual protein | Tyrosine-protein kinase BRK | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT3215 | Individual protein | Tyrosine-protein kinase BRK | Homo sapiens | Residual Activity | = | 68.0 | % | PMID[23398362] |
| NPT1683 | Individual protein | Dual specificity protein kinase CLK3 | Homo sapiens | Residual Activity | = | 29.0 | % | PMID[23398362] |
| NPT1688 | Individual protein | Myotonin-protein kinase | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT2941 | Individual protein | Ephrin type-B receptor 2 | Homo sapiens | Residual Activity | = | 92.0 | % | PMID[23398362] |
| NPT3425 | Individual protein | Interleukin-1 receptor-associated kinase 4 | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT3425 | Individual protein | Interleukin-1 receptor-associated kinase 4 | Homo sapiens | Residual Activity | = | 27.0 | % | PMID[23398362] |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Residual Activity | = | 78.0 | % | PMID[23398362] |
| NPT3441 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 7 | Homo sapiens | Residual Activity | = | 117.0 | % | PMID[23398362] |
| NPT2626 | Individual protein | Myosin light chain kinase, smooth muscle | Homo sapiens | Residual Activity | = | 61.0 | % | PMID[23398362] |
| NPT1337 | Individual protein | Hepatocyte growth factor receptor | Homo sapiens | Residual Activity | = | 43.0 | % | PMID[23398362] |
| NPT3293 | Individual protein | Activin receptor type-1B | Homo sapiens | Residual Activity | = | 114.0 | % | PMID[23398362] |
| NPT3113 | Individual protein | Tyrosine-protein kinase CSK | Homo sapiens | Residual Activity | = | 111.0 | % | PMID[23398362] |
| NPT3113 | Individual protein | Tyrosine-protein kinase CSK | Homo sapiens | Residual Activity | = | 109.0 | % | PMID[23398362] |
| NPT1709 | Individual protein | Serine/threonine-protein kinase 17A | Homo sapiens | Residual Activity | = | 67.0 | % | PMID[23398362] |
| NPT1709 | Individual protein | Serine/threonine-protein kinase 17A | Homo sapiens | Residual Activity | = | 25.0 | % | PMID[23398362] |
| NPT3359 | Individual protein | Ephrin type-B receptor 3 | Homo sapiens | Residual Activity | = | 113.0 | % | PMID[23398362] |
| NPT3359 | Individual protein | Ephrin type-B receptor 3 | Homo sapiens | Residual Activity | = | 115.0 | % | PMID[23398362] |
| NPT1437 | Individual protein | Tyrosine-protein kinase FES | Homo sapiens | Residual Activity | = | 112.0 | % | PMID[23398362] |
| NPT3286 | Individual protein | Insulin receptor-related protein | Homo sapiens | Residual Activity | = | 120.0 | % | PMID[23398362] |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Residual Activity | = | 37.0 | % | PMID[23398362] |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Residual Activity | = | 93.0 | % | PMID[23398362] |
| NPT2626 | Individual protein | Myosin light chain kinase, smooth muscle | Homo sapiens | Residual Activity | = | 15.0 | % | PMID[23398362] |
| NPT3213 | Individual protein | MAP kinase signal-integrating kinase 2 | Homo sapiens | Residual Activity | = | 96.0 | % | PMID[23398362] |
| NPT3213 | Individual protein | MAP kinase signal-integrating kinase 2 | Homo sapiens | Residual Activity | = | 55.0 | % | PMID[23398362] |
| NPT3293 | Individual protein | Activin receptor type-1B | Homo sapiens | Residual Activity | = | 75.0 | % | PMID[23398362] |
| NPT3312 | Individual protein | Tyrosine-protein kinase BLK | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT3232 | Individual protein | CaM kinase I alpha | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | Residual Activity | = | 101.0 | % | PMID[23398362] |
| NPT2572 | Individual protein | Ephrin type-B receptor 4 | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT1437 | Individual protein | Tyrosine-protein kinase FES | Homo sapiens | Residual Activity | = | 48.0 | % | PMID[23398362] |
| NPT3112 | Individual protein | Tyrosine-protein kinase FGR | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT3286 | Individual protein | Insulin receptor-related protein | Homo sapiens | Residual Activity | = | 37.0 | % | PMID[23398362] |
| NPT1439 | Individual protein | Tyrosine-protein kinase ITK/TSK | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Residual Activity | = | 41.0 | % | PMID[23398362] |
| NPT3326 | Individual protein | Mitogen-activated protein kinase kinase kinase 9 | Homo sapiens | Residual Activity | = | 43.0 | % | PMID[23398362] |
| NPT3326 | Individual protein | Mitogen-activated protein kinase kinase kinase 9 | Homo sapiens | Residual Activity | = | 8.0 | % | PMID[23398362] |
| NPT3333 | Individual protein | Muscle, skeletal receptor tyrosine protein kinase | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT3312 | Individual protein | Tyrosine-protein kinase BLK | Homo sapiens | Residual Activity | = | 23.0 | % | PMID[23398362] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT3232 | Individual protein | CaM kinase I alpha | Homo sapiens | Residual Activity | = | 57.0 | % | PMID[23398362] |
| NPT1630 | Individual protein | CaM kinase II beta | Homo sapiens | Residual Activity | = | 68.0 | % | PMID[23398362] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | Residual Activity | = | 107.0 | % | PMID[23398362] |
| NPT2572 | Individual protein | Ephrin type-B receptor 4 | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT1435 | Individual protein | Receptor protein-tyrosine kinase erbB-4 | Homo sapiens | Residual Activity | = | 92.0 | % | PMID[23398362] |
| NPT3112 | Individual protein | Tyrosine-protein kinase FGR | Homo sapiens | Residual Activity | = | 60.0 | % | PMID[23398362] |
| NPT3444 | Individual protein | Homeodomain-interacting protein kinase 1 | Homo sapiens | Residual Activity | = | 101.0 | % | PMID[23398362] |
| NPT3444 | Individual protein | Homeodomain-interacting protein kinase 1 | Homo sapiens | Residual Activity | = | 63.0 | % | PMID[23398362] |
| NPT1439 | Individual protein | Tyrosine-protein kinase ITK/TSK | Homo sapiens | Residual Activity | = | 88.0 | % | PMID[23398362] |
| NPT3111 | Individual protein | Tyrosine-protein kinase Lyn | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT3111 | Individual protein | Tyrosine-protein kinase Lyn | Homo sapiens | Residual Activity | = | 32.0 | % | PMID[23398362] |
| NPT3329 | Individual protein | Serine/threonine-protein kinase MRCK-A | Homo sapiens | Residual Activity | = | 96.0 | % | PMID[23398362] |
| NPT3333 | Individual protein | Muscle, skeletal receptor tyrosine protein kinase | Homo sapiens | Residual Activity | = | 60.0 | % | PMID[23398362] |
| NPT3443 | Individual protein | Serine/threonine-protein kinase Nek11 | Homo sapiens | Residual Activity | = | 63.0 | % | PMID[23398362] |
| NPT2750 | Individual protein | Tyrosine-protein kinase BMX | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT2750 | Individual protein | Tyrosine-protein kinase BMX | Homo sapiens | Residual Activity | = | 26.0 | % | PMID[23398362] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Residual Activity | = | 53.0 | % | PMID[23398362] |
| NPT1630 | Individual protein | CaM kinase II beta | Homo sapiens | Residual Activity | = | 13.0 | % | PMID[23398362] |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | Residual Activity | = | 90.0 | % | PMID[23398362] |
| NPT1435 | Individual protein | Receptor protein-tyrosine kinase erbB-4 | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | Residual Activity | = | 4.0 | % | PMID[23398362] |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | Residual Activity | = | 1.0 | % | PMID[23398362] |
| NPT3432 | Individual protein | Homeodomain-interacting protein kinase 2 | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT3246 | Individual protein | Tyrosine-protein kinase JAK2 | Homo sapiens | Residual Activity | = | 111.0 | % | PMID[23398362] |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT3329 | Individual protein | Serine/threonine-protein kinase MRCK-A | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT3330 | Individual protein | Serine/threonine-protein kinase MRCK beta | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT3443 | Individual protein | Serine/threonine-protein kinase Nek11 | Homo sapiens | Residual Activity | = | 59.0 | % | PMID[23398362] |
| NPT1660 | Individual protein | NUAK family SNF1-like kinase 1 | Homo sapiens | Residual Activity | = | 83.0 | % | PMID[23398362] |
| NPT3315 | Individual protein | BR serine/threonine-protein kinase 1 | Homo sapiens | Residual Activity | = | 27.0 | % | PMID[23398362] |
| NPT1680 | Individual protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT1680 | Individual protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Residual Activity | = | 25.0 | % | PMID[23398362] |
| NPT1676 | Individual protein | CaM kinase II gamma | Homo sapiens | Residual Activity | = | 40.0 | % | PMID[23398362] |
| NPT1676 | Individual protein | CaM kinase II gamma | Homo sapiens | Residual Activity | = | 4.0 | % | PMID[23398362] |
| NPT3354 | Individual protein | Ephrin type-A receptor 1 | Homo sapiens | Residual Activity | = | 77.0 | % | PMID[23398362] |
| NPT3354 | Individual protein | Ephrin type-A receptor 1 | Homo sapiens | Residual Activity | = | 22.0 | % | PMID[23398362] |
| NPT1436 | Individual protein | Focal adhesion kinase 1 | Homo sapiens | Residual Activity | = | 122.0 | % | PMID[23398362] |
| NPT1436 | Individual protein | Focal adhesion kinase 1 | Homo sapiens | Residual Activity | = | 44.0 | % | PMID[23398362] |
| NPT1650 | Individual protein | Tyrosine-protein kinase receptor FLT3 | Homo sapiens | Residual Activity | = | 19.0 | % | PMID[23398362] |
| NPT3432 | Individual protein | Homeodomain-interacting protein kinase 2 | Homo sapiens | Residual Activity | = | 15.0 | % | PMID[23398362] |
| NPT3409 | Individual protein | Homeodomain-interacting protein kinase 3 | Homo sapiens | Residual Activity | = | 90.0 | % | PMID[23398362] |
| NPT3246 | Individual protein | Tyrosine-protein kinase JAK2 | Homo sapiens | Residual Activity | = | 33.0 | % | PMID[23398362] |
| NPT1440 | Individual protein | Tyrosine-protein kinase JAK3 | Homo sapiens | Residual Activity | = | 43.0 | % | PMID[23398362] |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Residual Activity | = | 61.0 | % | PMID[23398362] |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Residual Activity | = | 96.0 | % | PMID[23398362] |
| NPT3330 | Individual protein | Serine/threonine-protein kinase MRCK beta | Homo sapiens | Residual Activity | = | 84.0 | % | PMID[23398362] |
| NPT1658 | Individual protein | Serine/threonine-protein kinase NEK2 | Homo sapiens | Residual Activity | = | 90.0 | % | PMID[23398362] |
| NPT1660 | Individual protein | NUAK family SNF1-like kinase 1 | Homo sapiens | Residual Activity | = | 24.0 | % | PMID[23398362] |
| NPT1431 | Individual protein | Mitogen-activated protein kinase kinase kinase 5 | Homo sapiens | Residual Activity | = | 111.0 | % | PMID[23398362] |
| NPT3315 | Individual protein | BR serine/threonine-protein kinase 1 | Homo sapiens | Residual Activity | = | 35.0 | % | PMID[23398362] |
| NPT3344 | Individual protein | BR serine/threonine-protein kinase 2 | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT1684 | Individual protein | Casein kinase I gamma 1 | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT1675 | Individual protein | CaM kinase II delta | Homo sapiens | Residual Activity | = | 28.0 | % | PMID[23398362] |
| NPT3225 | Individual protein | Ephrin type-A receptor 2 | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT1480 | Individual protein | Fibroblast growth factor receptor 1 | Homo sapiens | Residual Activity | = | 9.0 | % | PMID[23398362] |
| NPT1650 | Individual protein | Tyrosine-protein kinase receptor FLT3 | Homo sapiens | Residual Activity | = | 1.0 | % | PMID[23398362] |
| NPT2573 | Individual protein | Vascular endothelial growth factor receptor 3 | Homo sapiens | Residual Activity | = | 2.0 | % | PMID[23398362] |
| NPT3409 | Individual protein | Homeodomain-interacting protein kinase 3 | Homo sapiens | Residual Activity | = | 37.0 | % | PMID[23398362] |
| NPT1440 | Individual protein | Tyrosine-protein kinase JAK3 | Homo sapiens | Residual Activity | = | 6.0 | % | PMID[23398362] |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Residual Activity | = | 56.0 | % | PMID[23398362] |
| NPT1613 | Individual protein | Ribosomal protein S6 kinase alpha 5 | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT1613 | Individual protein | Ribosomal protein S6 kinase alpha 5 | Homo sapiens | Residual Activity | = | 19.0 | % | PMID[23398362] |
| NPT3391 | Individual protein | Serine/threonine-protein kinase Nek3 | Homo sapiens | Residual Activity | = | 109.0 | % | PMID[23398362] |
| NPT1431 | Individual protein | Mitogen-activated protein kinase kinase kinase 5 | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT3344 | Individual protein | BR serine/threonine-protein kinase 2 | Homo sapiens | Residual Activity | = | 35.0 | % | PMID[23398362] |
| NPT1684 | Individual protein | Casein kinase I gamma 1 | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT1685 | Individual protein | Casein kinase I gamma 2 | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT1675 | Individual protein | CaM kinase II delta | Homo sapiens | Residual Activity | = | 4.0 | % | PMID[23398362] |
| NPT1677 | Individual protein | CaM kinase IV | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT3225 | Individual protein | Ephrin type-A receptor 2 | Homo sapiens | Residual Activity | = | 50.0 | % | PMID[23398362] |
| NPT3217 | Individual protein | Ephrin type-A receptor 3 | Homo sapiens | Residual Activity | = | 109.0 | % | PMID[23398362] |
| NPT1480 | Individual protein | Fibroblast growth factor receptor 1 | Homo sapiens | Residual Activity | = | 1.0 | % | PMID[23398362] |
| NPT1481 | Individual protein | Fibroblast growth factor receptor 2 | Homo sapiens | Residual Activity | = | 37.0 | % | PMID[23398362] |
| NPT2573 | Individual protein | Vascular endothelial growth factor receptor 3 | Homo sapiens | Residual Activity | = | 1.0 | % | PMID[23398362] |
| NPT1426 | Individual protein | c-Jun N-terminal kinase 1 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT1426 | Individual protein | c-Jun N-terminal kinase 1 | Homo sapiens | Residual Activity | = | 35.0 | % | PMID[23398362] |
| NPT1441 | Individual protein | MAP kinase-activated protein kinase 2 | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT1441 | Individual protein | MAP kinase-activated protein kinase 2 | Homo sapiens | Residual Activity | = | 79.0 | % | PMID[23398362] |
| NPT3374 | Individual protein | Ribosomal protein S6 kinase alpha 4 | Homo sapiens | Residual Activity | = | 49.0 | % | PMID[23398362] |
| NPT3391 | Individual protein | Serine/threonine-protein kinase Nek3 | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT1657 | Individual protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Residual Activity | = | 117.0 | % | PMID[23398362] |
| NPT2729 | Individual protein | Tyrosine-protein kinase ABL | Homo sapiens | Residual Activity | = | 93.0 | % | PMID[23398362] |
| NPT2729 | Individual protein | Tyrosine-protein kinase ABL | Homo sapiens | Residual Activity | = | 68.0 | % | PMID[23398362] |
| NPT1685 | Individual protein | Casein kinase I gamma 2 | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT1677 | Individual protein | CaM kinase IV | Homo sapiens | Residual Activity | = | 54.0 | % | PMID[23398362] |
| NPT3217 | Individual protein | Ephrin type-A receptor 3 | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT1481 | Individual protein | Fibroblast growth factor receptor 2 | Homo sapiens | Residual Activity | = | 9.0 | % | PMID[23398362] |
| NPT3267 | Individual protein | Macrophage colony stimulating factor receptor | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT3267 | Individual protein | Macrophage colony stimulating factor receptor | Homo sapiens | Residual Activity | = | 32.0 | % | PMID[23398362] |
| NPT3205 | Individual protein | Tyrosine-protein kinase HCK | Homo sapiens | Residual Activity | = | 92.0 | % | PMID[23398362] |
| NPT1438 | Individual protein | Insulin-like growth factor I receptor | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT1427 | Individual protein | c-Jun N-terminal kinase 2 | Homo sapiens | Residual Activity | = | 107.0 | % | PMID[23398362] |
| NPT3461 | Individual protein | MAP kinase-activated protein kinase 3 | Homo sapiens | Residual Activity | = | 94.0 | % | PMID[23398362] |
| NPT3374 | Individual protein | Ribosomal protein S6 kinase alpha 4 | Homo sapiens | Residual Activity | = | 6.0 | % | PMID[23398362] |
| NPT1657 | Individual protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Residual Activity | = | 127.0 | % | PMID[23398362] |
| NPT3214 | Individual protein | Tyrosine-protein kinase ABL2 | Homo sapiens | Residual Activity | = | 78.0 | % | PMID[23398362] |
| NPT1686 | Individual protein | Casein kinase I isoform gamma-3 | Homo sapiens | Residual Activity | = | 120.0 | % | PMID[23398362] |
| NPT1686 | Individual protein | Casein kinase I isoform gamma-3 | Homo sapiens | Residual Activity | = | 90.0 | % | PMID[23398362] |
| NPT1672 | Individual protein | CaM kinase I delta | Homo sapiens | Residual Activity | = | 75.0 | % | PMID[23398362] |
| NPT1672 | Individual protein | CaM kinase I delta | Homo sapiens | Residual Activity | = | 21.0 | % | PMID[23398362] |
| NPT3218 | Individual protein | Ephrin type-A receptor 4 | Homo sapiens | Residual Activity | = | 112.0 | % | PMID[23398362] |
| NPT3218 | Individual protein | Ephrin type-A receptor 4 | Homo sapiens | Residual Activity | = | 86.0 | % | PMID[23398362] |
| NPT3227 | Individual protein | Fibroblast growth factor receptor 3 | Homo sapiens | Residual Activity | = | 27.0 | % | PMID[23398362] |
| NPT3227 | Individual protein | Fibroblast growth factor receptor 3 | Homo sapiens | Residual Activity | = | 4.0 | % | PMID[23398362] |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | Residual Activity | = | 83.0 | % | PMID[23398362] |
| NPT3205 | Individual protein | Tyrosine-protein kinase HCK | Homo sapiens | Residual Activity | = | 38.0 | % | PMID[23398362] |
| NPT3205 | Individual protein | Tyrosine-protein kinase HCK | Homo sapiens | Residual Activity | = | 97.0 | % | PMID[23398362] |
| NPT1427 | Individual protein | c-Jun N-terminal kinase 2 | Homo sapiens | Residual Activity | = | 83.0 | % | PMID[23398362] |
| NPT3207 | Individual protein | c-Jun N-terminal kinase 3 | Homo sapiens | Residual Activity | = | 56.0 | % | PMID[23398362] |
| NPT3317 | Individual protein | Serine/threonine-protein kinase MARK1 | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT1703 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Residual Activity | = | 110.0 | % | PMID[23398362] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Residual Activity | = | 8.0 | % | PMID[23398362] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Residual Activity | = | 93.0 | % | PMID[23398362] |
| NPT3277 | Individual protein | Tyrosine-protein kinase receptor TYRO3 | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT3106 | Individual protein | Ribosomal protein S6 kinase alpha 1 | Homo sapiens | Residual Activity | = | 22.0 | % | PMID[23398362] |
| NPT3349 | Individual protein | Serine/threonine-protein kinase SIK1 | Homo sapiens | Residual Activity | = | 7.0 | % | PMID[23398362] |
| NPT3269 | Individual protein | Serine/threonine-protein kinase tousled-like 2 | Homo sapiens | Residual Activity | = | 9.0 | % | PMID[23398362] |
| NPT1703 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Residual Activity | = | 55.0 | % | PMID[23398362] |
| NPT3394 | Individual protein | Protein kinase C iota | Homo sapiens | Residual Activity | = | 116.0 | % | PMID[23398362] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT3106 | Individual protein | Ribosomal protein S6 kinase alpha 1 | Homo sapiens | Residual Activity | = | 3.0 | % | PMID[23398362] |
| NPT3291 | Individual protein | Serine/threonine-protein kinase SRPK1 | Homo sapiens | Residual Activity | = | 63.0 | % | PMID[23398362] |
| NPT3291 | Individual protein | Serine/threonine-protein kinase SRPK1 | Homo sapiens | Residual Activity | = | 6.0 | % | PMID[23398362] |
| NPT3299 | Individual protein | Testis-specific serine/threonine-protein kinase 1 | Homo sapiens | Residual Activity | = | 101.0 | % | PMID[23398362] |
| NPT3299 | Individual protein | Testis-specific serine/threonine-protein kinase 1 | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT1663 | Individual protein | Tyrosine-protein kinase YES | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT1663 | Individual protein | Tyrosine-protein kinase YES | Homo sapiens | Residual Activity | = | 36.0 | % | PMID[23398362] |
| NPT3394 | Individual protein | Protein kinase C iota | Homo sapiens | Residual Activity | = | 79.0 | % | PMID[23398362] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Residual Activity | = | 27.0 | % | PMID[23398362] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Residual Activity | = | 3.0 | % | PMID[23398362] |
| NPT3292 | Individual protein | Serine/threonine-protein kinase SRPK2 | Homo sapiens | Residual Activity | = | 74.0 | % | PMID[23398362] |
| NPT3462 | Individual protein | Testis-specific serine/threonine-protein kinase 2 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT3259 | Individual protein | Tyrosine-protein kinase ZAP-70 | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT1430 | Individual protein | Serine/threonine-protein kinase AKT2 | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT1430 | Individual protein | Serine/threonine-protein kinase AKT2 | Homo sapiens | Residual Activity | = | 77.0 | % | PMID[23398362] |
| NPT3364 | Individual protein | Protein kinase C mu | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT3364 | Individual protein | Protein kinase C mu | Homo sapiens | Residual Activity | = | 71.0 | % | PMID[23398362] |
| NPT3358 | Individual protein | Serine/threonine-protein kinase PLK3 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT3234 | Individual protein | Ribosomal protein S6 kinase alpha 2 | Homo sapiens | Residual Activity | = | 5.0 | % | PMID[23398362] |
| NPT3292 | Individual protein | Serine/threonine-protein kinase SRPK2 | Homo sapiens | Residual Activity | = | 22.0 | % | PMID[23398362] |
| NPT3296 | Individual protein | Serine/threonine-protein kinase 33 | Homo sapiens | Residual Activity | = | 88.0 | % | PMID[23398362] |
| NPT3462 | Individual protein | Testis-specific serine/threonine-protein kinase 2 | Homo sapiens | Residual Activity | = | 102.0 | % | PMID[23398362] |
| NPT3351 | Individual protein | Tyrosine-protein kinase TEC | Homo sapiens | Residual Activity | = | 92.0 | % | PMID[23398362] |
| NPT3259 | Individual protein | Tyrosine-protein kinase ZAP-70 | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT1687 | Individual protein | Death-associated protein kinase 3 | Homo sapiens | Residual Activity | = | 87.0 | % | PMID[23398362] |
| NPT2546 | Individual protein | Serine/threonine-protein kinase AKT3 | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT3365 | Individual protein | Serine/threonine-protein kinase D2 | Homo sapiens | Residual Activity | = | 102.0 | % | PMID[23398362] |
| NPT3358 | Individual protein | Serine/threonine-protein kinase PLK3 | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT3262 | Individual protein | Serine/threonine-protein kinase PRKX | Homo sapiens | Residual Activity | = | 91.0 | % | PMID[23398362] |
| NPT3234 | Individual protein | Ribosomal protein S6 kinase alpha 2 | Homo sapiens | Residual Activity | = | 0.0 | % | PMID[23398362] |
| NPT3254 | Individual protein | Ribosomal protein S6 kinase alpha 6 | Homo sapiens | Residual Activity | = | 9.0 | % | PMID[23398362] |
| NPT3296 | Individual protein | Serine/threonine-protein kinase 33 | Homo sapiens | Residual Activity | = | 71.0 | % | PMID[23398362] |
| NPT3351 | Individual protein | Tyrosine-protein kinase TEC | Homo sapiens | Residual Activity | = | 79.0 | % | PMID[23398362] |
| NPT1687 | Individual protein | Death-associated protein kinase 3 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT1695 | Individual protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT2546 | Individual protein | Serine/threonine-protein kinase AKT3 | Homo sapiens | Residual Activity | = | 36.0 | % | PMID[23398362] |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Residual Activity | = | 26.0 | % | PMID[23398362] |
| NPT3365 | Individual protein | Serine/threonine-protein kinase D2 | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT3367 | Individual protein | cGMP-dependent protein kinase 1 beta | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT3262 | Individual protein | Serine/threonine-protein kinase PRKX | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT3254 | Individual protein | Ribosomal protein S6 kinase alpha 6 | Homo sapiens | Residual Activity | = | 1.0 | % | PMID[23398362] |
| NPT3414 | Individual protein | Serine/threonine-protein kinase PLK2 | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT3414 | Individual protein | Serine/threonine-protein kinase PLK2 | Homo sapiens | Residual Activity | = | 94.0 | % | PMID[23398362] |
| NPT2576 | Individual protein | Tyrosine-protein kinase TIE-2 | Homo sapiens | Residual Activity | = | 77.0 | % | PMID[23398362] |
| NPT2576 | Individual protein | Tyrosine-protein kinase TIE-2 | Homo sapiens | Residual Activity | = | 91.0 | % | PMID[23398362] |
| NPT1424 | Individual protein | Serine/threonine-protein kinase RAF | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT1424 | Individual protein | Serine/threonine-protein kinase RAF | Homo sapiens | Residual Activity | = | 57.0 | % | PMID[23398362] |
| NPT1695 | Individual protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Residual Activity | = | 65.0 | % | PMID[23398362] |
| NPT1696 | Individual protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Residual Activity | = | 99.0 | % | PMID[23398362] |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Residual Activity | = | 4.0 | % | PMID[23398362] |
| NPT3367 | Individual protein | cGMP-dependent protein kinase 1 beta | Homo sapiens | Residual Activity | = | 43.0 | % | PMID[23398362] |
| NPT3263 | Individual protein | Protein tyrosine kinase 2 beta | Homo sapiens | Residual Activity | = | 97.0 | % | PMID[23398362] |
| NPT3263 | Individual protein | Protein tyrosine kinase 2 beta | Homo sapiens | Residual Activity | = | 28.0 | % | PMID[23398362] |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Residual Activity | = | 73.0 | % | PMID[23398362] |
| NPT1449 | Individual protein | Tyrosine-protein kinase SYK | Homo sapiens | Residual Activity | = | 120.0 | % | PMID[23398362] |
| NPT3239 | Individual protein | Nerve growth factor receptor Trk-A | Homo sapiens | Residual Activity | = | 58.0 | % | PMID[23398362] |
| NPT1479 | Individual protein | Stem cell growth factor receptor | Homo sapiens | Residual Activity | = | 110.0 | % | PMID[23398362] |
| NPT1696 | Individual protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT3367 | Individual protein | cGMP-dependent protein kinase 1 beta | Homo sapiens | Residual Activity | = | 83.0 | % | PMID[23398362] |
| NPT3367 | Individual protein | cGMP-dependent protein kinase 1 beta | Homo sapiens | Residual Activity | = | 28.0 | % | PMID[23398362] |
| NPT1447 | Individual protein | Serine/threonine-protein kinase RIPK2 | Homo sapiens | Residual Activity | = | 94.0 | % | PMID[23398362] |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Residual Activity | = | 102.0 | % | PMID[23398362] |
| NPT1449 | Individual protein | Tyrosine-protein kinase SYK | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT3442 | Individual protein | Mitogen-activated protein kinase kinase kinase 7 | Homo sapiens | Residual Activity | = | 93.0 | % | PMID[23398362] |
| NPT3239 | Individual protein | Nerve growth factor receptor Trk-A | Homo sapiens | Residual Activity | = | 8.0 | % | PMID[23398362] |
| NPT3270 | Individual protein | Neurotrophic tyrosine kinase receptor type 2 | Homo sapiens | Residual Activity | = | 29.0 | % | PMID[23398362] |
| NPT1479 | Individual protein | Stem cell growth factor receptor | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT1697 | Individual protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT1697 | Individual protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Residual Activity | = | 77.0 | % | PMID[23398362] |
| NPT1612 | Individual protein | MAP kinase-activated protein kinase 5 | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT1447 | Individual protein | Serine/threonine-protein kinase RIPK2 | Homo sapiens | Residual Activity | = | 74.0 | % | PMID[23398362] |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Residual Activity | = | 79.0 | % | PMID[23398362] |
| NPT1615 | Individual protein | MAP kinase p38 gamma | Homo sapiens | Residual Activity | = | 99.0 | % | PMID[23398362] |
| NPT3442 | Individual protein | Mitogen-activated protein kinase kinase kinase 7 | Homo sapiens | Residual Activity | = | 75.0 | % | PMID[23398362] |
| NPT3270 | Individual protein | Neurotrophic tyrosine kinase receptor type 2 | Homo sapiens | Residual Activity | = | 24.0 | % | PMID[23398362] |
| NPT3235 | Individual protein | MAP/microtubule affinity-regulating kinase 2 | Homo sapiens | Residual Activity | = | 74.0 | % | PMID[23398362] |
| NPT1612 | Individual protein | MAP kinase-activated protein kinase 5 | Homo sapiens | Residual Activity | = | 48.0 | % | PMID[23398362] |
| NPT3357 | Individual protein | Protein kinase N2 | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT1615 | Individual protein | MAP kinase p38 gamma | Homo sapiens | Residual Activity | = | 51.0 | % | PMID[23398362] |
| NPT3431 | Individual protein | Serine/threonine-protein kinase TAO1 | Homo sapiens | Residual Activity | = | 90.0 | % | PMID[23398362] |
| NPT3431 | Individual protein | Serine/threonine-protein kinase TAO1 | Homo sapiens | Residual Activity | = | 47.0 | % | PMID[23398362] |
| NPT3272 | Individual protein | Tyrosine-protein kinase TXK | Homo sapiens | Residual Activity | = | 112.0 | % | PMID[23398362] |
| NPT3272 | Individual protein | Tyrosine-protein kinase TXK | Homo sapiens | Residual Activity | = | 91.0 | % | PMID[23398362] |
| NPT1344 | Individual protein | Serine/threonine-protein kinase EEF2K | Homo sapiens | Residual Activity | = | 83.0 | % | PMID[23398362] |
| NPT3235 | Individual protein | MAP/microtubule affinity-regulating kinase 2 | Homo sapiens | Residual Activity | = | 33.0 | % | PMID[23398362] |
| NPT3454 | Individual protein | PAS domain-containing serine/threonine-protein kinase | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT3357 | Individual protein | Protein kinase N2 | Homo sapiens | Residual Activity | = | 37.0 | % | PMID[23398362] |
| NPT3107 | Individual protein | Rho-associated protein kinase 2 | Homo sapiens | Residual Activity | = | 105.0 | % | PMID[23398362] |
| NPT3107 | Individual protein | Rho-associated protein kinase 2 | Homo sapiens | Residual Activity | = | 85.0 | % | PMID[23398362] |
| NPT1614 | Individual protein | MAP kinase p38 delta | Homo sapiens | Residual Activity | = | 112.0 | % | PMID[23398362] |
| NPT1614 | Individual protein | MAP kinase p38 delta | Homo sapiens | Residual Activity | = | 99.0 | % | PMID[23398362] |
| NPT3426 | Individual protein | Serine/threonine-protein kinase TAO2 | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT3422 | Individual protein | Serine/threonine-protein kinase ULK2 | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT1344 | Individual protein | Serine/threonine-protein kinase EEF2K | Homo sapiens | Residual Activity | = | 91.0 | % | PMID[23398362] |
| NPT3454 | Individual protein | PAS domain-containing serine/threonine-protein kinase | Homo sapiens | Residual Activity | = | 39.0 | % | PMID[23398362] |
| NPT3204 | Individual protein | Tyrosine-protein kinase FRK | Homo sapiens | Residual Activity | = | 80.0 | % | PMID[23398362] |
| NPT3204 | Individual protein | Tyrosine-protein kinase FRK | Homo sapiens | Residual Activity | = | 41.0 | % | PMID[23398362] |
| NPT3370 | Individual protein | Tyrosine-protein kinase receptor RET | Homo sapiens | Residual Activity | = | 79.0 | % | PMID[23398362] |
| NPT1448 | Individual protein | Serine/threonine-protein kinase Sgk1 | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT3426 | Individual protein | Serine/threonine-protein kinase TAO2 | Homo sapiens | Residual Activity | = | 35.0 | % | PMID[23398362] |
| NPT3427 | Individual protein | Serine/threonine-protein kinase TAO3 | Homo sapiens | Residual Activity | = | 69.0 | % | PMID[23398362] |
| NPT3422 | Individual protein | Serine/threonine-protein kinase ULK2 | Homo sapiens | Residual Activity | = | 91.0 | % | PMID[23398362] |
| NPT3382 | Individual protein | Serine/threonine-protein kinase ULK3 | Homo sapiens | Residual Activity | = | 101.0 | % | PMID[23398362] |
| NPT3020 | Individual protein | Platelet-derived growth factor receptor alpha | Homo sapiens | Residual Activity | = | 110.0 | % | PMID[23398362] |
| NPT3020 | Individual protein | Platelet-derived growth factor receptor alpha | Homo sapiens | Residual Activity | = | 77.0 | % | PMID[23398362] |
| NPT3223 | Individual protein | Phosphorylase kinase gamma subunit 2 | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT3370 | Individual protein | Tyrosine-protein kinase receptor RET | Homo sapiens | Residual Activity | = | 28.0 | % | PMID[23398362] |
| NPT3390 | Individual protein | Macrophage-stimulating protein receptor | Homo sapiens | Residual Activity | = | 84.0 | % | PMID[23398362] |
| NPT1448 | Individual protein | Serine/threonine-protein kinase Sgk1 | Homo sapiens | Residual Activity | = | 65.0 | % | PMID[23398362] |
| NPT3456 | Individual protein | Serine/threonine-protein kinase Sgk2 | Homo sapiens | Residual Activity | = | 78.0 | % | PMID[23398362] |
| NPT3427 | Individual protein | Serine/threonine-protein kinase TAO3 | Homo sapiens | Residual Activity | = | 26.0 | % | PMID[23398362] |
| NPT3382 | Individual protein | Serine/threonine-protein kinase ULK3 | Homo sapiens | Residual Activity | = | 60.0 | % | PMID[23398362] |
| NPT2575 | Individual protein | Platelet-derived growth factor receptor beta | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT3455 | Individual protein | Protein kinase C zeta | Homo sapiens | Residual Activity | = | 78.0 | % | PMID[23398362] |
| NPT3223 | Individual protein | Phosphorylase kinase gamma subunit 2 | Homo sapiens | Residual Activity | = | 112.0 | % | PMID[23398362] |
| NPT3390 | Individual protein | Macrophage-stimulating protein receptor | Homo sapiens | Residual Activity | = | 70.0 | % | PMID[23398362] |
| NPT3456 | Individual protein | Serine/threonine-protein kinase Sgk2 | Homo sapiens | Residual Activity | = | 29.0 | % | PMID[23398362] |
| NPT3417 | Individual protein | Serine/threonine-protein kinase TBK1 | Homo sapiens | Residual Activity | = | 70.0 | % | PMID[23398362] |
| NPT3417 | Individual protein | Serine/threonine-protein kinase TBK1 | Homo sapiens | Residual Activity | = | 14.0 | % | PMID[23398362] |
| NPT1715 | Individual protein | Serine/threonine-protein kinase VRK2 | Homo sapiens | Residual Activity | = | 110.0 | % | PMID[23398362] |
| NPT1715 | Individual protein | Serine/threonine-protein kinase VRK2 | Homo sapiens | Residual Activity | = | 75.0 | % | PMID[23398362] |
| NPT1611 | Individual protein | Ribosomal protein S6 kinase 1 | Homo sapiens | Residual Activity | = | 48.0 | % | PMID[23398362] |
| NPT2575 | Individual protein | Platelet-derived growth factor receptor beta | Homo sapiens | Residual Activity | = | 83.0 | % | PMID[23398362] |
| NPT1699 | Individual protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Residual Activity | = | 71.0 | % | PMID[23398362] |
| NPT3455 | Individual protein | Protein kinase C zeta | Homo sapiens | Residual Activity | = | 25.0 | % | PMID[23398362] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Residual Activity | = | 12.0 | % | PMID[23398362] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Residual Activity | = | 0.0 | % | PMID[23398362] |
| NPT3373 | Individual protein | Proto-oncogene tyrosine-protein kinase ROS | Homo sapiens | Residual Activity | = | 101.0 | % | PMID[23398362] |
| NPT3373 | Individual protein | Proto-oncogene tyrosine-protein kinase ROS | Homo sapiens | Residual Activity | = | 86.0 | % | PMID[23398362] |
| NPT3418 | Individual protein | Serine/threonine-protein kinase Sgk3 | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT3418 | Individual protein | Serine/threonine-protein kinase Sgk3 | Homo sapiens | Residual Activity | = | 87.0 | % | PMID[23398362] |
| NPT3353 | Individual protein | TGF-beta receptor type I | Homo sapiens | Residual Activity | = | 96.0 | % | PMID[23398362] |
| NPT1611 | Individual protein | Ribosomal protein S6 kinase 1 | Homo sapiens | Residual Activity | = | 5.0 | % | PMID[23398362] |
| NPT1699 | Individual protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Residual Activity | = | 18.0 | % | PMID[23398362] |
| NPT3124 | Individual protein | Protein kinase C eta | Homo sapiens | Residual Activity | = | 68.0 | % | PMID[23398362] |
| NPT3124 | Individual protein | Protein kinase C eta | Homo sapiens | Residual Activity | = | 17.0 | % | PMID[23398362] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Residual Activity | = | 23.0 | % | PMID[23398362] |
| NPT3277 | Individual protein | Tyrosine-protein kinase receptor TYRO3 | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT3349 | Individual protein | Serine/threonine-protein kinase SIK1 | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT3353 | Individual protein | TGF-beta receptor type I | Homo sapiens | Residual Activity | = | 81.0 | % | PMID[23398362] |
| NPT3269 | Individual protein | Serine/threonine-protein kinase tousled-like 2 | Homo sapiens | Residual Activity | = | 51.0 | % | PMID[23398362] |
| NPT1671 | Individual protein | AMP-activated protein kinase, alpha-2 subunit | Homo sapiens | Thermal melting change | = | 1.2 | degrees C | PMID[18077363] |
| NPT1672 | Individual protein | CaM kinase I delta | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1673 | Individual protein | CaM kinase I gamma | Homo sapiens | Thermal melting change | = | 1.0 | degrees C | PMID[18077363] |
| NPT1674 | Individual protein | CaM kinase II alpha | Homo sapiens | Thermal melting change | = | 3.3 | degrees C | PMID[18077363] |
| NPT1630 | Individual protein | CaM kinase II beta | Homo sapiens | Thermal melting change | = | 1.2 | degrees C | PMID[18077363] |
| NPT1675 | Individual protein | CaM kinase II delta | Homo sapiens | Thermal melting change | = | 1.0 | degrees C | PMID[18077363] |
| NPT1676 | Individual protein | CaM kinase II gamma | Homo sapiens | Thermal melting change | = | 2.2 | degrees C | PMID[18077363] |
| NPT1677 | Individual protein | CaM kinase IV | Homo sapiens | Thermal melting change | = | 2.8 | degrees C | PMID[18077363] |
| NPT1678 | Individual protein | CaM-kinase kinase beta | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[18077363] |
| NPT1371 | Individual protein | Cyclin-dependent kinase 2 | Homo sapiens | Thermal melting change | = | 1.5 | degrees C | PMID[18077363] |
| NPT1571 | Individual protein | Cyclin-dependent kinase 6 | Homo sapiens | Thermal melting change | = | 1.2 | degrees C | PMID[18077363] |
| NPT1679 | Individual protein | Cyclin-dependent kinase-like 1 | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1680 | Individual protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Thermal melting change | = | 2.6 | degrees C | PMID[18077363] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | Thermal melting change | = | 2.5 | degrees C | PMID[18077363] |
| NPT1683 | Individual protein | Dual specificity protein kinase CLK3 | Homo sapiens | Thermal melting change | = | 2.5 | degrees C | PMID[18077363] |
| NPT1684 | Individual protein | Casein kinase I gamma 1 | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1685 | Individual protein | Casein kinase I gamma 2 | Homo sapiens | Thermal melting change | = | 0.7 | degrees C | PMID[18077363] |
| NPT1686 | Individual protein | Casein kinase I isoform gamma-3 | Homo sapiens | Thermal melting change | = | 0.7 | degrees C | PMID[18077363] |
| NPT1687 | Individual protein | Death-associated protein kinase 3 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1688 | Individual protein | Myotonin-protein kinase | Homo sapiens | Thermal melting change | = | 3.8 | degrees C | PMID[18077363] |
| NPT1689 | Individual protein | Tyrosine-protein kinase JAK1 | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[18077363] |
| NPT1690 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 2 | Homo sapiens | Thermal melting change | = | 2.8 | degrees C | PMID[18077363] |
| NPT1691 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 6 | Homo sapiens | Thermal melting change | = | 1.1 | degrees C | PMID[18077363] |
| NPT1431 | Individual protein | Mitogen-activated protein kinase kinase kinase 5 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Thermal melting change | = | 0.5 | degrees C | PMID[18077363] |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1692 | Individual protein | Mitogen-activated protein kinase 6 | Homo sapiens | Thermal melting change | = | 0.5 | degrees C | PMID[18077363] |
| NPT1693 | Individual protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | 0.9 | degrees C | PMID[18077363] |
| NPT1658 | Individual protein | Serine/threonine-protein kinase NEK2 | Homo sapiens | Thermal melting change | = | 1.9 | degrees C | PMID[18077363] |
| NPT1657 | Individual protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1694 | Individual protein | Serine/threonine-protein kinase OSR1 | Homo sapiens | Thermal melting change | = | 2.0 | degrees C | PMID[18077363] |
| NPT1695 | Individual protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Thermal melting change | = | 1.8 | degrees C | PMID[18077363] |
| NPT1696 | Individual protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1697 | Individual protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Thermal melting change | = | 0.8 | degrees C | PMID[18077363] |
| NPT1698 | Individual protein | Serine/threonine-protein kinase PCTAIRE-1 | Homo sapiens | Thermal melting change | = | 1.7 | degrees C | PMID[18077363] |
| NPT1699 | Individual protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Thermal melting change | = | 5.9 | degrees C | PMID[18077363] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Thermal melting change | = | 4.0 | degrees C | PMID[18077363] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Thermal melting change | = | 6.3 | degrees C | PMID[18077363] |
| NPT1702 | Individual protein | Serine/threonine-protein kinase PLK4 | Homo sapiens | Thermal melting change | = | 4.2 | degrees C | PMID[18077363] |
| NPT1703 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Thermal melting change | = | 1.4 | degrees C | PMID[18077363] |
| NPT1704 | Individual protein | Serine/threonine-protein kinase RIO2 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | 3.6 | degrees C | PMID[18077363] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | 1.0 | degrees C | PMID[18077363] |
| NPT1706 | Individual protein | Serine/threonine-protein kinase 2 | Homo sapiens | Thermal melting change | = | 4.6 | degrees C | PMID[18077363] |
| NPT1707 | Individual protein | Serine/threonine-protein kinase 10 | Homo sapiens | Thermal melting change | = | 6.2 | degrees C | PMID[18077363] |
| NPT1708 | Individual protein | Serine/threonine-protein kinase 16 | Homo sapiens | Thermal melting change | = | 3.5 | degrees C | PMID[18077363] |
| NPT1709 | Individual protein | Serine/threonine-protein kinase 17A | Homo sapiens | Thermal melting change | = | 2.9 | degrees C | PMID[18077363] |
| NPT1710 | Individual protein | Serine/threonine-protein kinase 38 | Homo sapiens | Thermal melting change | = | 0.5 | degrees C | PMID[18077363] |
| NPT1693 | Individual protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | 3.7 | degrees C | PMID[18077363] |
| NPT1711 | Individual protein | Serine/threonine-protein kinase MST1 | Homo sapiens | Thermal melting change | = | 4.1 | degrees C | PMID[18077363] |
| NPT1712 | Individual protein | TRAF2- and NCK-interacting kinase | Homo sapiens | Thermal melting change | = | 1.2 | degrees C | PMID[18077363] |
| NPT1713 | Individual protein | PDZ-binding kinase | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1715 | Individual protein | Serine/threonine-protein kinase VRK2 | Homo sapiens | Thermal melting change | = | 1.0 | degrees C | PMID[18077363] |
| NPT1717 | Individual protein | Serine/threonine-protein kinase 25 | Homo sapiens | Thermal melting change | = | 2.0 | degrees C | PMID[18077363] |
| NPT1560 | Protein complex | Cyclin-dependent kinase 4/cyclin D1 | Homo sapiens | IC50 | = | 5810.0 | nM | PMID[14552792] |
| NPT2544 | Protein complex | Cyclin-dependent kinase 2/cyclin E | Homo sapiens | IC50 | = | 11690.0 | nM | PMID[14552792] |
| NPT3605 | Individual protein | Protein kinase C gamma | Rattus norvegicus | IC50 | = | 550.0 | nM | PMID[1732526] |
| NPT2544 | Protein complex | Cyclin-dependent kinase 2/cyclin E | Homo sapiens | Residual Activity | = | 79.0 | % | PMID[23398362] |
| NPT2544 | Protein complex | Cyclin-dependent kinase 2/cyclin E | Homo sapiens | Residual Activity | = | 30.0 | % | PMID[23398362] |
| NPT1509 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | Residual Activity | = | 74.0 | % | PMID[23398362] |
| NPT1509 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | Residual Activity | = | 28.0 | % | PMID[23398362] |
| NPT1509 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT1509 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | Residual Activity | = | 42.0 | % | PMID[23398362] |
| NPT4093 | Individual protein | Serine/threonine-protein kinase haspin | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT4093 | Individual protein | Serine/threonine-protein kinase haspin | Homo sapiens | Residual Activity | = | 69.0 | % | PMID[23398362] |
| NPT592 | Individual protein | Rho-associated protein kinase 1 | Homo sapiens | Residual Activity | = | 102.0 | % | PMID[23398362] |
| NPT592 | Individual protein | Rho-associated protein kinase 1 | Homo sapiens | Residual Activity | = | 95.0 | % | PMID[23398362] |
| NPT22961 | Single protein | Inactive serine/threonine-protein kinase VRK3 | Homo sapiens | Thermal melting change | = | 1.2 | degrees C | PMID[18077363] |
| NPT321 | Protein family | cAMP-dependent protein kinase (PKA) | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[14552792] |
| NPT321 | Protein family | cAMP-dependent protein kinase (PKA) | Homo sapiens | Inhibition | > | 75.0 | % | PMID[9871700] |
| NPT1284 | Protein family | Protein kinase C (PKC) | Rattus norvegicus | IC50 | = | 100.0 | nM | PMID[1732526] |
| NPT1284 | Protein family | Protein kinase C (PKC) | Rattus norvegicus | IC50 | = | 550.0 | nM | PMID[1732526] |
| NPT36 | Individual protein | Tyrosine-protein kinase SRC | Homo sapiens | Inhibition | < | 50.0 | % | PMID[15911254] |
| NPT321 | Protein family | cAMP-dependent protein kinase (PKA) | Homo sapiens | Inhibition | = | 80.0 | % | PMID[15911254] |
| NPT321 | Protein family | cAMP-dependent protein kinase (PKA) | Homo sapiens | Inhibition | < | 50.0 | % | PMID[15911254] |
| NPT36 | Individual protein | Tyrosine-protein kinase SRC | Homo sapiens | Inhibition | = | 80.0 | % | PMID[15911254] |
| NPT1609 | Protein complex | Casein kinase II | Homo sapiens | Inhibition | = | 99.0 | % | PMID[10998351] |
| NPT3814 | Protein complex | Cyclin-dependent kinase 2/cyclin A | Homo sapiens | Residual Activity | = | 19.0 | % | PMID[23398362] |
| NPT981 | Individual protein | Inhibitor of nuclear factor kappa B kinase beta subunit | Homo sapiens | Residual Activity | = | 94.0 | % | PMID[23398362] |
| NPT491 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 1 | Homo sapiens | Residual Activity | = | 34.0 | % | PMID[23398362] |
| NPT491 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 1 | Homo sapiens | Residual Activity | = | 7.0 | % | PMID[23398362] |
| NPT1609 | Protein complex | Casein kinase II | Homo sapiens | Residual Activity | = | 80.0 | % | PMID[23398362] |
| NPT981 | Individual protein | Inhibitor of nuclear factor kappa B kinase beta subunit | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT1609 | Protein complex | Casein kinase II | Homo sapiens | Residual Activity | = | 84.0 | % | PMID[23398362] |
| NPT676 | Individual protein | Glycogen synthase kinase-3 alpha | Homo sapiens | Residual Activity | = | 19.0 | % | PMID[23398362] |
| NPT676 | Individual protein | Glycogen synthase kinase-3 alpha | Homo sapiens | Residual Activity | = | 4.0 | % | PMID[23398362] |
| NPT3814 | Protein complex | Cyclin-dependent kinase 2/cyclin A | Homo sapiens | Residual Activity | = | 97.0 | % | PMID[23398362] |
| NPT4094 | Individual protein | Serine/threonine-protein kinase WNK3 | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT831 | Individual protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Residual Activity | = | 114.0 | % | PMID[23398362] |
| NPT831 | Individual protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Residual Activity | = | 90.0 | % | PMID[23398362] |
| NPT36 | Individual protein | Tyrosine-protein kinase SRC | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT36 | Individual protein | Tyrosine-protein kinase SRC | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT880 | Individual protein | Protein kinase C gamma | Homo sapiens | Residual Activity | = | 36.0 | % | PMID[23398362] |
| NPT880 | Individual protein | Protein kinase C gamma | Homo sapiens | Residual Activity | = | 6.0 | % | PMID[23398362] |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Residual Activity | = | 96.0 | % | PMID[23398362] |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Residual Activity | = | 97.0 | % | PMID[23398362] |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Residual Activity | = | 103.0 | % | PMID[23398362] |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Residual Activity | = | 89.0 | % | PMID[23398362] |
| NPT4096 | Individual protein | Serine/threonine-protein kinase WNK2 | Homo sapiens | Residual Activity | = | 109.0 | % | PMID[23398362] |
| NPT4096 | Individual protein | Serine/threonine-protein kinase WNK2 | Homo sapiens | Residual Activity | = | 82.0 | % | PMID[23398362] |
| NPT4094 | Individual protein | Serine/threonine-protein kinase WNK3 | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT831 | Individual protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 13.27 | % | DOI[10.6019/CHEMBL4495564] |
| NPT316 | Protein family | Protein kinase C (PKC) | Homo sapiens | IC50 | = | 190.0 | nM | PMID[8151612] |
| NPT316 | Protein family | Protein kinase C (PKC) | Homo sapiens | Inhibition | > | 75.0 | % | PMID[9871700] |
| NPT761 | Individual protein | Protein kinase C epsilon | Homo sapiens | IC50 | = | 7516.0 | nM | PMID[15380221] |
| NPT316 | Protein family | Protein kinase C (PKC) | Homo sapiens | Inhibition | = | 80.0 | % | PMID[15911254] |
| NPT316 | Protein family | Protein kinase C (PKC) | Homo sapiens | Inhibition | < | 50.0 | % | PMID[15911254] |
| NPT316 | Protein family | Protein kinase C (PKC) | Homo sapiens | Inhibition | < | 80.0 | % | PMID[15911254] |
| NPT728 | Individual protein | Serine/threonine-protein kinase AKT | Homo sapiens | Inhibition | = | 101.0 | % | PMID[10998351] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Inhibition | = | 49.0 | % | PMID[10998351] |
| NPT982 | Individual protein | Inhibitor of nuclear factor kappa B kinase alpha subunit | Homo sapiens | Residual Activity | = | 93.0 | % | PMID[23398362] |
| NPT4088 | Individual protein | G protein-coupled receptor kinase 6 | Homo sapiens | Residual Activity | = | 98.0 | % | PMID[23398362] |
| NPT4088 | Individual protein | G protein-coupled receptor kinase 6 | Homo sapiens | Residual Activity | = | 68.0 | % | PMID[23398362] |
| NPT4089 | Protein complex | CDK6/cyclin D3 | Homo sapiens | Residual Activity | = | 91.0 | % | PMID[23398362] |
| NPT4089 | Protein complex | CDK6/cyclin D3 | Homo sapiens | Residual Activity | = | 45.0 | % | PMID[23398362] |
| NPT4090 | Protein complex | Cyclin-dependent kinase 7/ cyclin H | Homo sapiens | Residual Activity | = | 76.0 | % | PMID[23398362] |
| NPT4090 | Protein complex | Cyclin-dependent kinase 7/ cyclin H | Homo sapiens | Residual Activity | = | 32.0 | % | PMID[23398362] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Residual Activity | = | 31.0 | % | PMID[23398362] |
| NPT4092 | Protein complex | CDK9/cyclin T1 | Homo sapiens | Residual Activity | = | 36.0 | % | PMID[23398362] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Residual Activity | = | 6.0 | % | PMID[23398362] |
| NPT4092 | Protein complex | CDK9/cyclin T1 | Homo sapiens | Residual Activity | = | 5.0 | % | PMID[23398362] |
| NPT1767 | Protein complex | AMP-activated protein kinase, AMPK | Homo sapiens | Residual Activity | = | 66.0 | % | PMID[23398362] |
| NPT1767 | Protein complex | AMP-activated protein kinase, AMPK | Homo sapiens | Residual Activity | = | 10.0 | % | PMID[23398362] |
| NPT982 | Individual protein | Inhibitor of nuclear factor kappa B kinase alpha subunit | Homo sapiens | Residual Activity | = | 106.0 | % | PMID[23398362] |
| NPT728 | Individual protein | Serine/threonine-protein kinase AKT | Homo sapiens | Residual Activity | = | 99.0 | % | PMID[23398362] |
| NPT728 | Individual protein | Serine/threonine-protein kinase AKT | Homo sapiens | Residual Activity | = | 104.0 | % | PMID[23398362] |
| NPT881 | Individual protein | Protein kinase C delta | Homo sapiens | Residual Activity | = | 31.0 | % | PMID[23398362] |
| NPT881 | Individual protein | Protein kinase C delta | Homo sapiens | Residual Activity | = | 5.0 | % | PMID[23398362] |
| NPT761 | Individual protein | Protein kinase C epsilon | Homo sapiens | Residual Activity | = | 63.0 | % | PMID[23398362] |
| NPT761 | Individual protein | Protein kinase C epsilon | Homo sapiens | Residual Activity | = | 21.0 | % | PMID[23398362] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Thermal melting change | = | 7.8 | degrees C | PMID[18077363] |
| NPT2728 | Protein family | Tyrosine-protein kinase ABL | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[8151612] |
| NPT1570 | Protein complex | Cyclin-dependent kinase 1/cyclin B | Homo sapiens | IC50 | = | 18000.0 | nM | PMID[9871700] |
| NPT1570 | Protein complex | Cyclin-dependent kinase 1/cyclin B | Homo sapiens | Inhibition | > | 75.0 | % | PMID[9871700] |
| NPT760 | Individual protein | Protein kinase C beta | Homo sapiens | IC50 | = | 304.0 | nM | PMID[15380221] |
| NPT760 | Individual protein | Protein kinase C beta | Homo sapiens | IC50 | = | 212.0 | nM | PMID[15380221] |
| NPT4087 | Protein complex | CDK3/cyclin E | Homo sapiens | Residual Activity | = | 84.0 | % | PMID[23398362] |
| NPT4087 | Protein complex | CDK3/cyclin E | Homo sapiens | Residual Activity | = | 29.0 | % | PMID[23398362] |
| NPT833 | Individual protein | Tyrosine-protein kinase BTK | Homo sapiens | Residual Activity | = | 100.0 | % | PMID[23398362] |
| NPT4091 | Protein complex | AMP-activated protein kinase (AMPK) alpha-1/beta-1/gamma-1 | Homo sapiens | Residual Activity | = | 72.0 | % | PMID[23398362] |
| NPT833 | Individual protein | Tyrosine-protein kinase BTK | Homo sapiens | Residual Activity | = | 67.0 | % | PMID[23398362] |
| NPT4091 | Protein complex | AMP-activated protein kinase (AMPK) alpha-1/beta-1/gamma-1 | Homo sapiens | Residual Activity | = | 15.0 | % | PMID[23398362] |
| NPT1561 | Protein complex | Cyclin-dependent kinase 1/cyclin B1 | Homo sapiens | Residual Activity | = | 84.0 | % | PMID[23398362] |
| NPT1561 | Protein complex | Cyclin-dependent kinase 1/cyclin B1 | Homo sapiens | Residual Activity | = | 39.0 | % | PMID[23398362] |
| NPT887 | Individual protein | Protein kinase C theta | Homo sapiens | Residual Activity | = | 5.0 | % | PMID[23398362] |
| NPT887 | Individual protein | Protein kinase C theta | Homo sapiens | Residual Activity | = | 2.0 | % | PMID[23398362] |
| NPT760 | Individual protein | Protein kinase C beta | Homo sapiens | Residual Activity | = | 66.0 | % | PMID[23398362] |
| NPT760 | Individual protein | Protein kinase C beta | Homo sapiens | Residual Activity | = | 23.0 | % | PMID[23398362] |
| NPT760 | Individual protein | Protein kinase C beta | Homo sapiens | Residual Activity | = | 75.0 | % | PMID[23398362] |
| NPT760 | Individual protein | Protein kinase C beta | Homo sapiens | Residual Activity | = | 27.0 | % | PMID[23398362] |
| NPT22960 | Single protein | Serine/threonine-protein kinase VRK1 | Homo sapiens | Thermal melting change | = | 0.8 | degrees C | PMID[18077363] |
| NPT760 | Individual protein | Protein kinase C beta | Homo sapiens | IC50 | = | 16.0 | nM | PMID[33539089] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 6.3 | ug.mL-1 | PMID[15911254] |
| NPT1178 | Cell line | KB 3-1 | Homo sapiens | IC50 | > | 25.0 | ug.mL-1 | PMID[15911254] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[19447039] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 53780.0 | nM | PMID[19447039] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 17460.0 | nM | PMID[19447039] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 56610.0 | nM | PMID[19447039] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 13200.0 | nM | PMID[30119011] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 10300.0 | nM | PMID[30119011] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 4140.0 | nM | PMID[30119011] |
| NPT116 | Cell line | HL-60 | Homo sapiens | CC50 | > | 8000.0 | nM | PMID[33539089] |
| NPT83 | Cell line | MCF7 | Homo sapiens | CC50 | > | 8000.0 | nM | PMID[33539089] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 4.76 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 83550.0 | nM | PMID[19447039] |
| NPT4249 | Organism | Influenza B virus | Influenza B virus | log(activity) | = | 1.0 | n.a. | PMID[33539089] |
| NPT28855 | Cell line | ECa-109 cell line | Homo sapiens | IC50 | = | 15900.0 | nM | PMID[30119011] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1000000.0 | nM | DOI[10.1016/S0960-894X(00)80378-9] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 11800.0 | nM | PMID[1732526] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 350.0 | nM | PMID[19447039] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 84.0 | % | PMID[10998351] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 54.0 | % | PMID[10998351] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 93.0 | % | PMID[10998351] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 96.0 | % | PMID[10998351] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 90.0 | % | PMID[10998351] |
| NPT742 | Organism | Influenza A virus | Influenza A virus | log(activity) | = | 1.0 | n.a. | PMID[33539089] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC131887 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.8148 | Intermediate Similarity | NPC264285 |
| 0.7458 | Intermediate Similarity | NPC16352 |
| 0.6667 | Remote Similarity | NPC282247 |
| 0.6615 | Remote Similarity | NPC487019 |
| 0.6078 | Remote Similarity | NPC603879 |
| 0.5283 | Remote Similarity | NPC67288 |
| 0.5273 | Remote Similarity | NPC74413 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC131887 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| NPD |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
