Drug Information| Drug ID:   | NPD7970 |
| Drug Name:   | Eptifibatide |
| Molecular Formula:   | C35H49N11O9S2 |
| Canonical SMILES:   | OC(=O)C[C@@H]1N=C(O)CN=C(O)[C@H](CCCCNC(=N)N)N=C(O)CCSSC[C@H](N=C([C@H]2N(C(=O)[C@@H](N=C1O)Cc1c[nH]c3c1cccc3)CCC2)O)C(=N)O |
| Standard InCHI:   | "InChI=1S/C35H49N11O9S2/c36-30(51)25-18-57-56-13-10-27(47)42-22(8-3-4-11-39-35(37)38)31(52)41-17-28(48)43-23(15-29(49)50)32(53)44-24(14-19-16-40-21-7-2-1-6-20(19)21)34(55)46-12-5-9-26(46)33(54)45-25/h1-2,6-7,16,22-26,40H,3-5,8-15,17-18H2,(H2,36,51)(H,41,52)(H,42,47)(H,43,48)(H,44,53)(H,45,54)(H,49,50)(H4,37,38,39)/t22-,23-,24-,25-,26-/m0/s1" |
| Standard InCHIKey:   | CZKPOZZJODAYPZ-LROMGURASA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7970Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.559 | NPC486508 |
| Remote Similarity | 0.5515 | NPC486503 |
| Remote Similarity | 0.5494 | NPC518501 |
| Remote Similarity | 0.5455 | NPC485125 |
| Remote Similarity | 0.5422 | NPC563597 |
| Remote Similarity | 0.5401 | NPC483985 |
| Remote Similarity | 0.5361 | NPC497646 |
| Remote Similarity | 0.5308 | NPC54744 |
| Remote Similarity | 0.5115 | NPC329847 |
| Remote Similarity | 0.507 | NPC489555 |
| Remote Similarity | 0.5057 | NPC486506 |
| Remote Similarity | 0.5057 | NPC485247 |
| Remote Similarity | 0.5057 | NPC486514 |
| Remote Similarity | 0.5029 | NPC477635 |
| Remote Similarity | 0.5029 | NPC489225 |
| Remote Similarity | 0.5028 | NPC329855 |
| Molecular Weight   | 831.32 |
| ALogP   | -3.3218 |
| MLogP   | 2.89 |
| XLogP   | 0.667 |
| HDA   | 20 |
| HBD   | 12 |
| Rotatable Bonds   | 19 |
| TPSA   | 392.93 |
| RO5 Violation   | 3 |