NPASS Compound

Natural Product: NPC489555

Natural Product ID	NPC489555
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NUYRUQJOSVHMEN-KXYQUQMVSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44584153
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0000265] Carboxylic acids and derivatives [CHEMONTID:0000013] Amino acids, peptides, and analogues [CHEMONTID:0000348] Peptides [CHEMONTID:0004831] Oligopeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 150156 0 0 0 0 0 0 0 0999 V2000 -0.0167 -5.7026 1.4277 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1944 -4.9545 0.8681 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3442 -4.9166 1.8806 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8414 -3.5302 0.4539 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0322 -2.8468 -0.0958 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4020 -1.7317 0.3895 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.5635 -1.0004 -0.1017 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3627 -0.5279 1.0906 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8339 -1.6399 1.9466 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0953 -2.0957 3.0179 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5909 -3.1486 3.7917 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7968 -3.7419 3.5111 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5499 -3.2928 2.4364 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0635 -2.2543 1.6717 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2756 -4.7841 4.2848 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1696 0.1040 -0.9873 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9829 0.4007 -1.1222 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0327 0.9076 -1.7459 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.4271 0.7961 -1.8464 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8337 1.4266 -3.1617 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6554 2.2807 -3.5394 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5749 1.9856 -2.5649 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1777 3.1868 -1.7800 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7187 3.1352 -0.5990 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3134 4.2242 0.2272 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3960 4.5729 1.2445 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6618 4.9494 0.5603 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5534 3.9055 0.3159 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7512 4.1280 -0.3228 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0657 5.4142 -0.7253 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1809 6.4354 -0.4797 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9569 6.2310 0.1696 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2833 5.6244 -1.3724 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1552 3.7273 1.0665 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0212 4.1774 0.8758 N 0 0 0 0 0 0 0 0 0 0 0 0 1.2745 4.0350 1.3678 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3243 4.0369 2.8705 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7831 5.3072 3.4349 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3711 6.1735 2.6178 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7113 5.5795 4.7830 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0039 2.8081 0.8826 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9945 2.9825 0.1155 N 0 0 0 0 0 0 0 0 0 0 0 0 3.8940 2.1366 -0.5240 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0983 2.8662 -1.1143 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7312 3.8607 -2.1173 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6610 3.5270 -3.4494 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3017 4.4888 -4.3606 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0043 5.7902 -3.9908 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0770 6.1179 -2.6448 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4390 5.1475 -1.7324 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5060 1.0418 0.3237 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3912 -0.1158 0.0221 N 0 0 0 0 0 0 0 0 0 0 0 0 4.4377 -1.4536 -0.0464 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1001 -2.3650 1.0712 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9593 -2.1751 2.2450 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1451 -2.8972 2.4991 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6501 -2.4159 3.6429 N 0 0 0 0 0 0 0 0 0 0 0 0 5.8720 -1.4448 4.1305 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9032 -0.6404 5.2493 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9262 0.2877 5.5103 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8834 0.4160 4.6231 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8125 -0.3605 3.5007 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8096 -1.2834 3.2654 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7038 -2.0184 -1.2651 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7776 -2.8692 -1.0491 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9642 -3.5231 -2.0391 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5564 -4.8899 -2.3978 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9423 -4.7085 -2.9501 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5818 -6.0226 -3.3324 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7268 -6.7102 -4.3884 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5989 -5.8784 -5.5713 N 0 0 0 0 0 0 0 0 0 0 0 0 0.5647 -3.7919 -1.5570 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2624 -3.4836 -0.3963 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.3321 -4.3723 -2.4238 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0415 -1.6131 -2.5448 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1931 1.5162 1.4473 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6241 1.5356 1.2456 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4347 2.7760 2.0198 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3204 4.4302 -2.3808 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7283 -3.4366 -1.1374 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7372 -5.0518 1.9070 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4430 -6.4289 2.1808 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5280 -6.2784 0.6347 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5894 -5.5241 0.0101 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2270 -4.5585 1.3444 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0429 -4.1257 2.6126 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5114 -5.8923 2.3352 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5721 -3.0122 1.4484 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2279 -1.6845 -0.6666 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6384 0.0680 1.7170 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1883 0.1340 0.8512 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1491 -1.6516 3.2622 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0261 -3.5234 4.6395 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5144 -3.7337 2.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6027 -1.8668 0.8294 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9356 -5.4510 3.8568 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7887 -0.2659 -1.7852 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9529 1.3766 -1.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0162 0.5945 -3.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7418 2.0315 -3.0214 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9571 3.3435 -3.4248 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3099 2.0686 -4.5804 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6684 1.6070 -3.1188 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9634 5.1228 -0.2789 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5520 3.7025 1.8806 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0932 5.4324 1.8717 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2857 2.8952 0.6464 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4233 3.2866 -0.4994 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4221 7.4366 -0.7873 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2676 7.0474 0.3570 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9752 6.1944 -0.8647 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9154 4.9310 1.0471 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3954 4.0000 3.2419 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7436 3.2186 3.3247 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5633 6.5109 5.1644 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4019 1.6167 -1.3761 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7574 2.0849 -1.5486 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6640 3.3667 -0.2948 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8952 2.5105 -3.7297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2504 4.2186 -5.4107 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7212 6.5383 -4.7495 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8518 7.1166 -2.3156 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4876 5.4404 -0.6765 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5280 -1.7595 -0.3268 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2596 -3.4179 0.7233 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0124 -2.3327 1.3457 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5006 -3.6792 1.8352 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5336 -2.7569 4.0911 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7267 -0.7511 5.9396 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9215 0.9315 6.3803 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0790 1.1408 4.7831 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0012 -0.2774 2.7905 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9441 -2.8919 -2.9491 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9436 -5.3913 -3.1648 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5452 -5.5368 -1.4919 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9175 -4.0835 -3.8615 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5820 -4.2634 -2.1425 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6380 -6.7131 -2.4589 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5724 -5.8112 -3.7659 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2380 -7.6693 -4.6943 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7561 -7.0469 -3.9801 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4600 -6.5016 -6.3940 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7234 -5.3148 -5.4504 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9626 -5.1313 -2.2018 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2703 -1.3756 -3.1813 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9412 0.9740 1.8603 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8149 0.7132 0.6969 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8748 1.9609 2.1954 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6612 5.1950 -2.2101 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1500 -2.8926 -1.8851 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 2 3 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 12 15 1 0 7 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 2 3 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 30 33 1 0 25 34 1 0 34 35 2 3 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 36 41 1 0 41 42 2 3 42 43 1 0 43 44 1 0 44 45 1 0 45 46 2 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 2 0 43 51 1 0 51 52 2 3 52 53 1 0 53 54 1 0 54 55 1 0 55 56 2 0 56 57 1 0 57 58 1 0 58 59 2 0 59 60 1 0 60 61 2 0 61 62 1 0 62 63 2 0 53 64 1 0 64 65 2 3 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 66 72 1 0 72 73 2 3 72 74 1 0 64 75 1 0 51 76 1 0 41 77 1 0 34 78 1 0 23 79 1 0 5 80 1 0 73 4 1 0 14 9 1 0 22 18 1 0 32 27 1 0 50 45 1 0 63 55 1 0 63 58 1 0 1 81 1 0 1 82 1 0 1 83 1 0 2 84 1 0 3 85 1 0 3 86 1 0 3 87 1 0 4 88 1 1 7 89 1 6 8 90 1 0 8 91 1 0 10 92 1 0 11 93 1 0 13 94 1 0 14 95 1 0 15 96 1 0 19 97 1 0 19 98 1 0 20 99 1 0 20100 1 0 21101 1 0 21102 1 0 22103 1 6 25104 1 6 26105 1 0 26106 1 0 28107 1 0 29108 1 0 31109 1 0 32110 1 0 33111 1 0 36112 1 6 37113 1 0 37114 1 0 40115 1 0 43116 1 6 44117 1 0 44118 1 0 46119 1 0 47120 1 0 48121 1 0 49122 1 0 50123 1 0 53124 1 6 54125 1 0 54126 1 0 56127 1 0 57128 1 0 59129 1 0 60130 1 0 61131 1 0 62132 1 0 66133 1 6 67134 1 0 67135 1 0 68136 1 0 68137 1 0 69138 1 0 69139 1 0 70140 1 0 70141 1 0 71142 1 0 71143 1 0 74144 1 0 75145 1 0 76146 1 0 77147 1 0 78148 1 0 79149 1 0 80150 1 0 M END

Standard InCHIKey	NUYRUQJOSVHMEN-KXYQUQMVSA-N
Standard InCHI	InChI=1S/C58H70N10O12/c1-33(2)50-57(79)66-47(29-36-19-23-39(70)24-20-36)58(80)68-26-10-16-48(68)56(78)65-44(28-35-17-21-38(69)22-18-35)53(75)64-46(31-49(71)72)55(77)62-43(27-34-11-4-3-5-12-34)52(74)63-45(30-37-32-60-41-14-7-6-13-40(37)41)54(76)61-42(51(73)67-50)15-8-9-25-59/h3-7,11-14,17-24,32-33,42-48,50,60,69-70H,8-10,15-16,25-31,59H2,1-2H3,(H,61,76)(H,62,77)(H,63,74)(H,64,75)(H,65,78)(H,66,79)(H,67,73)(H,71,72)/t42-,43-,44-,45-,46-,47-,48-,50+/m0/s1
SMILES	CC(C)[C@@H]1C(=N[C@@H](Cc2ccc(cc2)O)C(=O)N2CCC[C@H]2C(=N[C@@H](Cc2ccc(cc2)O)C(=N[C@@H](CC(=O)O)C(=N[C@@H](Cc2ccccc2)C(=N[C@@H](Cc2c[nH]c3ccccc23)C(=N[C@@H](CCCCN)C(=N1)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1098.52	Volume:	1109.277 ? Van der Waals volume.
Dense:	0.99	LogP:	-0.968 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.056 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.468 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	58.0
TPSA:	368.01 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	13.0	Rings:	7.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.046	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.725	Fsp³:	0.397
MCE-18:	157.037 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.891	Fluc inhibitor:	0.275 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.113 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.97 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.004	Promiscuous compounds:	0.27

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.196	MDCK Permeability:	-5.247
Pgp-inhibitor:	0.978	Pgp-substrate:	1.0
PAMPA:	0.201 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.216
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.592
Plasma Protein Binding (PPB):	60.514%	Volume Distribution (VD):	-0.371
Fu:	36.806% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.992	BCRP inhibitor:	0.01
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.007	CYP2C19-substrate:	0.116
CYP2C9-inhibitor:	0.994	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.215	CYP2D6-substrate:	0.013
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.848 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.091

Half-life (T1/2):

2.717

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.0	Rat Oral Acute Toxicity:	0.925
Maximum Recommended Daily Dose:	0.987	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.969
Drug-induced Neurotoxicity:	0.218	Ototoxicity:	1.0
Hematotoxicity:	0.039	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.002
BCF:	0.316 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.474 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.089 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.162 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO41002	Phakellia sp.	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[7673945]
NPO41002	Phakellia sp.	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT137	Cell line	L1210	Mus musculus	ED50	=	2.6	ug ml-1	PMID[7673945]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC489555 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22871
0.1-0.2	25173
0.2-0.3	1315
0.3-0.4	317
0.4-0.5	126
0.5-0.6	43
0.6-0.7	9
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7863	Intermediate Similarity	NPC325976
0.7863	Intermediate Similarity	NPC326363
0.6522	Remote Similarity	NPC31385
0.6357	Remote Similarity	NPC484874
0.6299	Remote Similarity	NPC479141
0.6228	Remote Similarity	NPC293917
0.6134	Remote Similarity	NPC110602
0.6134	Remote Similarity	NPC479071
0.6098	Remote Similarity	NPC479076
0.6068	Remote Similarity	NPC328649
0.6	Remote Similarity	NPC477633
0.5964	Remote Similarity	NPC477634
0.5902	Remote Similarity	NPC479075
0.5887	Remote Similarity	NPC479073
0.5772	Remote Similarity	NPC162860
0.5748	Remote Similarity	NPC75726
0.5695	Remote Similarity	NPC153400
0.5682	Remote Similarity	NPC483985
0.5672	Remote Similarity	NPC489549
0.5672	Remote Similarity	NPC479574
0.5655	Remote Similarity	NPC485244
0.561	Remote Similarity	NPC54420
0.561	Remote Similarity	NPC477635
0.561	Remote Similarity	NPC486515
0.5556	Remote Similarity	NPC479065
0.5547	Remote Similarity	NPC479066
0.5542	Remote Similarity	NPC486506
0.5542	Remote Similarity	NPC485247
0.5542	Remote Similarity	NPC486514
0.551	Remote Similarity	NPC75634
0.5484	Remote Similarity	NPC486513
0.5366	Remote Similarity	NPC489538
0.5351	Remote Similarity	NPC479872
0.5342	Remote Similarity	NPC484347
0.5339	Remote Similarity	NPC489625
0.5333	Remote Similarity	NPC489225
0.5298	Remote Similarity	NPC484965
0.5287	Remote Similarity	NPC329843
0.5246	Remote Similarity	NPC489828
0.5217	Remote Similarity	NPC487314
0.5214	Remote Similarity	NPC486528
0.5181	Remote Similarity	NPC489535
0.514	Remote Similarity	NPC486517
0.5133	Remote Similarity	NPC485785
0.5122	Remote Similarity	NPC107077
0.5122	Remote Similarity	NPC125181
0.512	Remote Similarity	NPC223791
0.5118	Remote Similarity	NPC489539
0.5111	Remote Similarity	NPC489512
0.5091	Remote Similarity	NPC263117
0.5047	Remote Similarity	NPC17059
0.5044	Remote Similarity	NPC202198
0.5039	Remote Similarity	NPC284549
0.5027	Remote Similarity	NPC479082

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC489555 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3055
0.1-0.2	5691
0.2-0.3	340
0.3-0.4	45
0.4-0.5	12
0.5-0.6	4
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7636	Intermediate Similarity	NPD8405	Pre-clinical
0.6228	Remote Similarity	NPD7621	Clinical (unspecified phase)
0.5122	Remote Similarity	NPD7948	Phase 1
0.5076	Remote Similarity	NPD7711	Discontinued
0.507	Remote Similarity	NPD7970	Phase 4
0.507	Remote Similarity	NPD7971	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data