NPASS Compound

Natural Product: NPC328649

Natural Product ID	NPC328649
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Tyrocidine A
IUPAC Name	3-[(3R,6S,9S,12S,15S,18S,21S,24R,27S,30S)-21-(2-amino-2-oxoethyl)-9-(3-aminopropyl)-3,24,27-tribenzyl-15-[(4-hydroxyphenyl)methyl]-6-(2-methylpropyl)-2,5,8,11,14,17,20,23,26,29-decaoxo-12-propan-2-yl-1,4,7,10,13,16,19,22,25,28-decazabicyclo[28.3.0]tritriacontan-18-yl]propanamide
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL408504
PubChem CID	16129635
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0000265] Carboxylic acids and derivatives [CHEMONTID:0000013] Amino acids, peptides, and analogues [CHEMONTID:0000348] Peptides [CHEMONTID:0001995] Cyclic peptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 179184 0 0 0 0 0 0 0 0999 V2000 5.7729 -4.2200 4.5157 N 0 0 0 0 0 0 0 0 0 0 0 0 5.9361 -3.3370 3.3834 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6381 -3.1081 2.6417 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9303 -2.1771 1.4923 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6557 -1.9002 0.6822 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1127 -3.0772 0.1534 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7595 -3.5328 -0.9379 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8692 -2.7660 -2.0899 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2131 -4.9385 -0.9612 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9010 -5.0865 -1.3724 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.2575 -4.8471 -1.0271 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2674 -5.2735 -1.9402 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7771 -4.1841 0.1906 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5317 -5.1008 1.3726 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2598 -6.3750 1.1160 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5824 -6.5292 1.5546 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2658 -7.7024 1.3304 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6956 -8.7753 0.6715 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3956 -8.6367 0.2349 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7081 -7.4533 0.4621 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4300 -9.9377 0.4709 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2439 -4.0530 0.1445 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.8854 -3.2333 -0.5707 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2056 -2.3620 -1.4010 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3597 -3.1969 -0.5258 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0410 -3.3493 -1.8439 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8060 -4.6269 -2.5701 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2645 -5.8150 -1.8530 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4590 -6.7666 -1.5786 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.5872 -5.9210 -1.4625 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8926 -2.0105 0.1017 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.3786 -1.9372 1.2620 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4671 -3.0111 2.1115 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9165 -0.5948 1.7963 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3725 -0.8863 2.0051 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2165 0.1662 2.5331 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6789 0.1401 3.7598 N 0 0 0 0 0 0 0 0 0 0 0 0 -8.6058 1.2782 1.8016 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5166 0.4346 0.9725 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.4598 1.6528 0.8371 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9331 2.6091 1.7662 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8299 2.1999 -0.4250 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0064 3.3052 -0.0380 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.7713 3.2695 0.2848 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0673 4.5779 0.6683 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0392 4.7370 -0.2693 N 0 0 0 0 0 0 0 0 0 0 0 0 0.2193 4.8472 -0.2112 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0723 4.8436 0.9758 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5074 4.7986 0.5949 N 0 0 0 0 0 0 0 0 0 0 0 0 3.2085 3.6025 0.6080 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5077 2.6219 0.9232 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6298 3.3966 0.2922 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8618 2.0042 -0.1421 N 0 0 0 0 0 0 0 0 0 0 0 0 5.7629 1.7107 -1.0083 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9101 0.2689 -1.3717 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1801 -0.6035 -0.5427 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9721 -0.8304 -0.3383 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8848 -0.2137 -0.9426 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7761 -0.0061 -2.8354 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8024 0.7006 -3.6738 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5690 0.3365 -5.1468 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2068 0.2335 -3.3516 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5536 2.6998 -1.5710 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5761 3.6382 1.4493 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5842 4.9679 2.0225 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4697 5.8962 1.4727 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5807 7.1897 1.9377 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8021 7.6186 2.9858 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9154 6.6980 3.5399 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8113 5.4082 3.0687 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8276 6.1199 0.2617 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0171 7.0103 1.1357 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0166 6.1111 1.8027 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8202 4.9883 -1.5091 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1317 5.6716 0.6439 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6433 7.0030 0.9911 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6416 7.5022 2.2814 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1734 8.7607 2.5866 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6854 9.5620 1.5806 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6839 9.0657 0.2806 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1537 7.8042 -0.0275 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0750 2.0853 0.2918 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7915 2.6334 -1.4640 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6956 1.6199 -2.0006 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9714 1.3505 -1.5708 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7539 0.3497 -2.1395 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2740 -0.4225 -3.1716 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9972 -0.1688 -3.6180 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2252 0.8208 -3.0546 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2048 -5.7665 -1.7850 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5370 -5.7138 -1.1230 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6986 -7.1299 -2.1026 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8156 -4.5668 4.6310 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2494 -3.9131 5.3677 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3043 -2.3682 3.7938 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7306 -3.7292 2.7375 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2257 -4.0809 2.2982 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9419 -2.6287 3.3663 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7594 -2.5323 0.8745 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2232 -1.2013 1.9334 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9466 -1.4286 1.3930 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7671 -2.3129 -2.3400 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3204 -5.3796 0.0759 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0227 -6.0706 -2.5475 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3022 -3.1945 0.3826 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0193 -4.6567 2.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5134 -5.3536 1.5462 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0204 -5.6746 2.0709 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2867 -7.8103 1.6739 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9423 -9.4774 -0.2838 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3214 -7.3711 0.1084 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9779 -10.8251 0.3059 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1798 -2.2795 -1.3412 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7447 -4.0522 0.1132 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8104 -2.5135 -2.5408 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1364 -3.2738 -1.6471 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7696 -4.6924 -2.9220 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4292 -4.5678 -3.5146 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4791 -6.8068 -1.8103 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8130 -6.5374 -0.6762 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7491 -3.7527 2.0900 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4883 -0.4724 2.8439 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8293 -1.3305 1.0793 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4263 -1.7448 2.7475 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4108 -0.6762 4.3408 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4646 1.8021 2.0061 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2134 2.2602 2.6961 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1693 1.3893 -0.8528 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7057 4.5057 1.7090 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7976 4.0050 1.6332 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9551 4.0417 -0.5388 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0135 0.0617 -1.1475 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0542 0.4805 -1.6283 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7871 0.2708 -3.2519 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8901 -1.0927 -2.9821 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7696 1.7859 -3.6343 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6306 -0.7400 -5.3201 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6215 0.7723 -5.4860 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3818 0.8564 -5.6950 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6826 0.8457 -2.5508 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2645 -0.8490 -3.1664 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8219 0.4101 -4.2745 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1488 3.4943 -2.0065 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3001 2.8622 2.2247 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5859 3.2942 1.0972 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1091 5.6245 0.6496 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2855 7.8984 1.4855 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8729 8.6329 3.3676 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3151 7.0624 4.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1085 4.7270 3.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5261 6.3601 -0.8164 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9126 6.3859 0.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6921 7.4898 1.9025 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4991 7.8191 0.5476 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0373 6.6024 1.7342 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2763 5.9150 2.8655 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3793 4.4639 -2.2746 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9729 5.4085 1.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5689 5.6226 -0.3885 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0316 6.8481 3.0451 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1696 9.1563 3.5916 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3111 10.5403 1.7646 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2989 9.7021 -0.5154 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1178 7.4905 -1.0588 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5329 1.1718 0.4096 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1815 3.0224 -2.3283 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3505 3.5418 -1.1177 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3466 1.9593 -0.7768 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7461 0.1898 -1.7561 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9009 -1.1954 -3.5985 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6363 -0.7932 -4.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2160 0.9933 -3.4346 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2928 -5.2183 -2.7600 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7390 -6.5579 -0.4352 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6012 -4.7931 -0.5113 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3344 -5.6139 -1.8975 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5401 -7.7123 -2.5172 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3799 -7.6024 -1.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8435 -7.0555 -2.8073 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 3 7 8 1 0 7 9 1 0 9 10 1 0 10 11 2 3 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 18 21 1 0 13 22 1 0 22 23 2 3 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 3 28 30 1 0 25 31 1 0 31 32 2 3 32 33 1 0 32 34 1 0 34 35 1 0 35 36 1 0 36 37 2 3 36 38 1 0 34 39 1 0 39 40 2 3 40 41 1 0 40 42 1 0 42 43 1 0 43 44 2 3 44 45 1 0 45 46 1 0 46 47 2 3 47 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 52 53 1 0 53 54 2 3 54 55 1 0 55 56 1 0 56 57 2 3 57 58 1 0 55 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 54 63 1 0 52 64 1 0 64 65 1 0 65 66 2 0 66 67 1 0 67 68 2 0 68 69 1 0 69 70 2 0 49 71 1 0 71 72 1 0 72 73 1 0 47 74 1 0 45 75 1 0 75 76 1 0 76 77 2 0 77 78 1 0 78 79 2 0 79 80 1 0 80 81 2 0 44 82 1 0 42 83 1 0 83 84 1 0 84 85 2 0 85 86 1 0 86 87 2 0 87 88 1 0 88 89 2 0 9 90 1 0 90 91 1 0 90 92 1 0 57 5 1 0 70 65 1 0 81 76 1 0 89 84 1 0 20 15 1 0 73 48 1 0 1 93 1 0 1 94 1 0 2 95 1 0 2 96 1 0 3 97 1 0 3 98 1 0 4 99 1 0 4100 1 0 5101 1 1 8102 1 0 9103 1 1 12104 1 0 13105 1 1 14106 1 0 14107 1 0 16108 1 0 17109 1 0 19110 1 0 20111 1 0 21112 1 0 24113 1 0 25114 1 1 26115 1 0 26116 1 0 27117 1 0 27118 1 0 29119 1 0 30120 1 0 33121 1 0 34122 1 1 35123 1 0 35124 1 0 37125 1 0 38126 1 0 41127 1 0 42128 1 6 45129 1 1 48130 1 1 52131 1 6 55132 1 1 58133 1 0 59134 1 0 59135 1 0 60136 1 0 61137 1 0 61138 1 0 61139 1 0 62140 1 0 62141 1 0 62142 1 0 63143 1 0 64144 1 0 64145 1 0 66146 1 0 67147 1 0 68148 1 0 69149 1 0 70150 1 0 71151 1 0 71152 1 0 72153 1 0 72154 1 0 73155 1 0 73156 1 0 74157 1 0 75158 1 0 75159 1 0 77160 1 0 78161 1 0 79162 1 0 80163 1 0 81164 1 0 82165 1 0 83166 1 0 83167 1 0 85168 1 0 86169 1 0 87170 1 0 88171 1 0 89172 1 0 90173 1 0 91174 1 0 91175 1 0 91176 1 0 92177 1 0 92178 1 0 92179 1 0 M END

Standard InCHIKey	GSXRBRIWJGAPDU-BBVRJQLQSA-N
Standard InCHI	InChI=1S/C66H87N13O13/c1-38(2)32-47-59(85)77-52(36-42-20-12-7-13-21-42)66(92)79-31-15-23-53(79)64(90)76-49(34-41-18-10-6-11-19-41)61(87)74-48(33-40-16-8-5-9-17-40)60(86)75-51(37-55(69)82)62(88)70-46(28-29-54(68)81)58(84)73-50(35-43-24-26-44(80)27-25-43)63(89)78-56(39(3)4)65(91)71-45(22-14-30-67)57(83)72-47/h5-13,16-21,24-27,38-39,45-53,56,80H,14-15,22-23,28-37,67H2,1-4H3,(H2,68,81)(H2,69,82)(H,70,88)(H,71,91)(H,72,83)(H,73,84)(H,74,87)(H,75,86)(H,76,90)(H,77,85)(H,78,89)/t45-,46-,47-,48+,49-,50-,51-,52+,53-,56-/m0/s1
SMILES	NCCC[C@@H]1N=C(O)[C@@H](N=C(O)[C@H](Cc2ccc(cc2)O)N=C(O)[C@H](CCC(=N)O)N=C(O)[C@H](CC(=N)O)N=C(O)[C@H](N=C([C@@H](N=C([C@H]2N(C(=O)[C@H](N=C([C@@H](N=C1O)CC(C)C)O)Cc1ccccc1)CCC2)O)Cc1ccccc1)O)Cc1ccccc1)C(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1269.65	Volume:	1292.709 ? Van der Waals volume.
Dense:	0.982	LogP:	0.16 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.247 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.991 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	19.0	Rigid Bonds:	61.0
TPSA:	448.03 ? Topological Polar Surface Area.	H-Bond Acceptor:	26.0
H-Bond Donor:	16.0	Rings:	6.0
Heavy Atoms:	26.0

MedChem Properties

QED Drug-Likeness Score:	0.031	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.442	Fsp³:	0.455
MCE-18:	157.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.928	Fluc inhibitor:	0.143 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.895 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.004	Promiscuous compounds:	0.202

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.325	MDCK Permeability:	-5.131
Pgp-inhibitor:	0.908	Pgp-substrate:	1.0
PAMPA:	0.983 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.124
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.61
Plasma Protein Binding (PPB):	69.525%	Volume Distribution (VD):	-0.369
Fu:	26.5% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.927	BCRP inhibitor:	0.025
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.119 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.206

Half-life (T1/2):

3.001

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.0	Rat Oral Acute Toxicity:	0.966
Maximum Recommended Daily Dose:	0.954	Skin Sensitization:	1.0
Carcinogencity:	0.006	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.726
Drug-induced Neurotoxicity:	0.198	Ototoxicity:	1.0
Hematotoxicity:	0.307	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.001
BCF:	0.295 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.327 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.761 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.705 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23673	Brevibacillus brevis	Species	Paenibacillaceae	Bacteria	n.a.	n.a.	n.a.	PMID[4320358]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	17
MIC	28
Ratio	2
IC50	3
ICmax	3
HC50	1

Activity Type	# Activity
Lipid	2
Macromolecule	1
Organism	40
Cell line	2
Others	1
Subcellular	8

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT21750	Lipid	Lipid bilayer	n.a.	Activity	n.a.	n.a.	n.a.	PMID[33991963]
NPT23991	Macromolecule	Lipopolysaccharide (LPS)	Bacteria	Activity	n.a.	n.a.	n.a.	PMID[33991963]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT729	Organism	Micrococcus luteus	Micrococcus luteus	IC50	=	22000.0	nM	PMID[19586775]
NPT729	Organism	Micrococcus luteus	Micrococcus luteus	ICmax	=	70.0	uM	PMID[19586775]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	=	8.3	ug.mL-1	PMID[14584933]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	Ratio	=	1.0	n.a.	PMID[14584933]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	=	1.0	ug.mL-1	PMID[17547386]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	=	16.0	ug.mL-1	PMID[17728134]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	=	31.0	ug.mL-1	PMID[19281223]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	=	20.0	ug.mL-1	PMID[19281223]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	Activity	=	1.62	%	PMID[19586775]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	Activity	=	59.0	%	PMID[19586775]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	IC50	=	13000.0	nM	PMID[19586775]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	ICmax	=	25.0	uM	PMID[19586775]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	IC50	=	9900.0	nM	PMID[19586775]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	ICmax	=	16.0	uM	PMID[19586775]
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	3125.0	nM	PMID[29140694]
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	780.0	nM	PMID[29140694]
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	390.0	nM	PMID[29140694]
NPT23195	Subcellular	Cell membrane	Bacteria	Activity	n.a.	n.a.	n.a.	PMID[33991963]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	=	8.0	ug.mL-1	PMID[17547386]
NPT175	Organism	Enterococcus faecalis	Enterococcus faecalis	MIC	=	1.0	ug.mL-1	PMID[17547386]
NPT17	Organism	Staphylococcus epidermidis	Staphylococcus epidermidis	MIC	=	1.0	ug.mL-1	PMID[17547386]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	32.0	ug.mL-1	PMID[17728134]
NPT175	Organism	Enterococcus faecalis	Enterococcus faecalis	MIC	=	16.0	ug.mL-1	PMID[17728134]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	>	128.0	ug.mL-1	PMID[17728134]
NPT17	Organism	Staphylococcus epidermidis	Staphylococcus epidermidis	MIC	=	16.0	ug.mL-1	PMID[17728134]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	=	25000.0	nM	PMID[29140694]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MIC	=	100000.0	nM	PMID[29140694]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	1560.0	nM	PMID[29140694]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	2500.0	nM	PMID[33991963]
NPT19	Organism	Escherichia coli	Escherichia coli	Activity	n.a.	n.a.	n.a.	PMID[33991963]
NPT20950	Cell line	Erythrocyte	n.a.	HC50	=	14.0	uM	PMID[33991963]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	Activity	n.a.	n.a.	n.a.	PMID[33991963]
NPT175	Organism	Enterococcus faecalis	Enterococcus faecalis	MIC	=	2500.0	nM	PMID[33991963]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MIC	=	80000.0	nM	PMID[33991963]
NPT21742	Cell line	L02	Homo sapiens	Activity	n.a.	n.a.	n.a.	PMID[33991963]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	=	20000.0	nM	PMID[33991963]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	20000.0	nM	PMID[33991963]
NPT2	Others	Unspecified	n.a.	Ratio	=	2.0	ug ml-1	PMID[17547386]
NPT314	Organism	Bacillus cereus	Bacillus cereus	MIC	=	16.0	ug.mL-1	PMID[17728134]
NPT747	Organism	Acinetobacter baumannii	Acinetobacter baumannii	MIC	=	10000.0	nM	PMID[33991963]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference
Listeria monocytogenes	n.a.	T1/2	=	0.5383	hr	PMID[19586775]

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC328649 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21588
0.1-0.2	26716
0.2-0.3	1022
0.3-0.4	346
0.4-0.5	132
0.5-0.6	41
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7981	Intermediate Similarity	NPC325976
0.7981	Intermediate Similarity	NPC326363
0.6989	Remote Similarity	NPC241794
0.6818	Remote Similarity	NPC202198
0.6596	Remote Similarity	NPC136797
0.6593	Remote Similarity	NPC479072
0.6556	Remote Similarity	NPC489829
0.6087	Remote Similarity	NPC489557
0.6068	Remote Similarity	NPC489555
0.6016	Remote Similarity	NPC484875
0.5979	Remote Similarity	NPC479074
0.5946	Remote Similarity	NPC326349
0.5946	Remote Similarity	NPC323336
0.5833	Remote Similarity	NPC489822
0.5758	Remote Similarity	NPC479070
0.5714	Remote Similarity	NPC5194
0.566	Remote Similarity	NPC58725
0.5644	Remote Similarity	NPC141957
0.5591	Remote Similarity	NPC224315
0.5545	Remote Similarity	NPC261934
0.5545	Remote Similarity	NPC489825
0.5545	Remote Similarity	NPC489826
0.5537	Remote Similarity	NPC489549
0.5532	Remote Similarity	NPC485876
0.551	Remote Similarity	NPC489556
0.5484	Remote Similarity	NPC242482
0.5472	Remote Similarity	NPC489828
0.5455	Remote Similarity	NPC485116
0.5417	Remote Similarity	NPC479068
0.5405	Remote Similarity	NPC238945
0.5405	Remote Similarity	NPC296968
0.5312	Remote Similarity	NPC255447
0.5299	Remote Similarity	NPC61004
0.5275	Remote Similarity	NPC200589
0.5263	Remote Similarity	NPC489593
0.5238	Remote Similarity	NPC242159
0.5204	Remote Similarity	NPC485094
0.5145	Remote Similarity	NPC485114
0.5143	Remote Similarity	NPC479069
0.5135	Remote Similarity	NPC31385
0.5133	Remote Similarity	NPC489823
0.513	Remote Similarity	NPC487230
0.5109	Remote Similarity	NPC484874
0.5102	Remote Similarity	NPC200964
0.51	Remote Similarity	NPC489592
0.5098	Remote Similarity	NPC56685
0.5086	Remote Similarity	NPC487229
0.5057	Remote Similarity	NPC486124
0.5048	Remote Similarity	NPC262166
0.5047	Remote Similarity	NPC302597
0.5041	Remote Similarity	NPC484348

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC328649 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3061
0.1-0.2	5783
0.2-0.3	263
0.3-0.4	36
0.4-0.5	6
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5357	Remote Similarity	NPD8405	Pre-clinical

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data