NPASS Compound

Natural Product: NPC489826

Natural Product ID	NPC489826
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DCKJZPNIZDUAHR-UDXVSVLKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10441258
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0000265] Carboxylic acids and derivatives [CHEMONTID:0000013] Amino acids, peptides, and analogues [CHEMONTID:0000348] Peptides [CHEMONTID:0004831] Oligopeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 167173 0 0 0 0 0 0 0 0999 V2000 -4.4900 -5.8284 2.8175 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4092 -5.4355 1.8323 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8032 -4.1331 1.1453 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1089 -4.4273 0.4480 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7059 -3.7083 0.1720 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1493 -2.4033 -0.4494 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3096 -2.3059 -0.8876 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.0954 -1.3312 -1.5107 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5491 -1.8281 -1.6045 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4661 -0.8827 -2.2524 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2811 -0.0206 -1.5495 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1281 0.8659 -2.1763 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1939 0.9253 -3.5517 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3743 0.0583 -4.2355 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5220 -0.8338 -3.6301 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1018 -0.0507 -0.7978 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3785 0.1012 0.2676 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.3651 1.3573 1.0003 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1909 1.0537 2.2741 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5675 0.6559 1.8041 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2499 2.2290 3.1931 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9888 1.6962 1.3957 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3503 2.7028 0.9740 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.9231 3.6582 0.0275 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6902 4.7481 0.6788 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3684 5.7173 -0.2155 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1000 6.8068 0.5805 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6240 6.3506 -1.3153 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7718 4.0858 -0.8094 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5507 3.4075 -1.8527 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8510 5.1184 -0.6720 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6488 6.1498 0.2758 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0844 7.3442 -0.5039 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3211 6.7900 -1.8294 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1898 5.3072 -1.6704 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3962 4.5492 -1.5604 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5008 3.4089 -2.1804 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6192 4.7538 -0.8749 N 0 0 0 0 0 0 0 0 0 0 0 0 3.0098 5.7974 -0.0292 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5480 5.8470 -0.1452 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8733 4.8355 -1.2182 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7536 3.8197 -0.9439 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0510 3.1197 0.2976 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 1.8884 0.4076 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7053 0.9819 -0.6681 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9752 1.2090 -1.3884 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2177 1.1196 -0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9609 -0.0309 -0.6843 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1171 -0.2194 0.0246 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5728 0.7880 0.8684 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8168 1.9530 0.9474 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6658 2.1107 0.2249 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7434 0.5926 1.5842 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3665 -0.4175 -0.3100 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1138 -1.3503 -0.5671 N 0 0 0 0 0 0 0 0 0 0 0 0 5.2165 -2.7378 -0.4412 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8021 -3.2843 0.8350 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2160 -2.8161 1.0588 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0126 -3.0199 2.0733 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0027 -3.4790 -0.8132 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8840 -3.0207 -0.6560 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9989 -4.7608 -1.3879 N 0 0 0 0 0 0 0 0 0 0 0 0 5.0669 -5.5197 -1.8736 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4754 -6.8466 -2.3875 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1741 -6.8990 -1.5607 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7669 -5.4853 -1.6389 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6773 -5.0650 -0.7449 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7668 -4.3689 -1.2080 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5055 -5.3476 0.6137 N 0 0 0 0 0 0 0 0 0 0 0 0 2.3063 -6.1813 1.4351 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9396 -5.8548 2.8967 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1235 -4.5766 2.7587 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4534 -4.8659 1.4279 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3065 -3.6909 0.9491 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4458 -3.8217 0.6041 N 0 0 0 0 0 0 0 0 0 0 0 0 0.3077 -2.4230 0.9007 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1517 -0.6069 0.3271 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9146 3.7355 1.5586 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2971 0.8569 2.3113 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8776 1.0333 -1.2402 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2753 -1.3361 -0.5340 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0880 -6.6859 2.4317 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2110 -5.0106 3.0300 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0326 -6.2196 3.7753 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4532 -5.3179 2.3941 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3766 -6.2243 1.0566 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9861 -3.3908 1.9340 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7862 -3.5671 0.6165 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5930 -5.3435 0.8802 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9342 -4.5355 -0.6318 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8606 -4.4835 -0.6915 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7562 -1.1756 -2.5945 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8831 -1.8867 -0.5186 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6102 -2.8461 -1.9921 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2627 -0.0397 -0.4449 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7749 1.5463 -1.6087 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8615 1.6233 -4.0641 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4112 0.0863 -5.3378 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8881 -1.5049 -4.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9126 2.1429 0.4984 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7501 0.1471 2.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2030 0.4641 2.6984 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0355 1.4544 1.1866 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5150 -0.2630 1.2117 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3914 1.8493 4.2475 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3060 2.7879 3.1526 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1362 2.8532 2.8999 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5549 3.0266 -0.6417 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1318 5.2070 1.5395 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5471 4.2336 1.2474 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2621 5.1868 -0.7332 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3878 7.4842 1.0710 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7725 7.3539 -0.1339 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7983 6.3348 1.3064 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9607 7.1680 -1.0447 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1892 5.6213 -2.0611 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4203 6.8675 -1.9658 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1108 5.8324 1.0369 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5136 6.5508 0.7985 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7075 7.8391 0.0761 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8628 8.1222 -0.6598 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3605 7.1828 -2.6418 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3420 7.0607 -2.0984 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3157 4.9730 -2.6458 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7629 5.6441 1.0529 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7144 6.8313 -0.3417 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0286 5.6194 0.8196 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9042 6.8669 -0.4261 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8687 4.4225 -1.1434 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6717 5.3341 -2.2049 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6561 3.1610 -1.8280 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8878 1.2372 -1.4406 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9446 2.1816 -1.8836 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0011 0.4588 -2.2426 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6757 -0.8747 -1.3403 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7256 -1.1364 -0.0319 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1959 2.7338 1.6164 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1076 3.0221 0.3140 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7599 0.9004 2.5625 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9777 -3.0643 -1.2303 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8294 -4.4110 0.7387 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7786 -2.7832 0.1041 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2742 -1.8439 1.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7785 -3.5806 1.6822 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9900 -1.9471 2.3737 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0395 -3.5134 2.0567 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5912 -3.5151 2.9124 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9122 -5.7283 -1.1866 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5247 -4.9909 -2.7501 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1155 -7.6849 -2.1216 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2732 -6.7620 -3.4515 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5318 -7.6028 -2.1269 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5036 -7.2858 -0.5971 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5176 -5.2765 -2.7198 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3941 -5.9959 1.3843 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0623 -7.2609 1.2492 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8045 -5.6517 3.5183 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2942 -6.6703 3.2896 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3515 -4.5091 3.5348 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7536 -3.6774 2.6992 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2338 -5.7263 1.6344 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3213 -1.9037 0.0091 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0796 -1.1643 1.1666 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4326 3.3030 2.3327 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2901 0.8525 2.2455 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4491 1.9215 -1.3700 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2776 -0.7490 -1.3585 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 2 3 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 2 0 8 16 1 0 16 17 2 3 17 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 18 22 1 0 22 23 2 3 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 24 29 1 0 29 30 2 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 2 3 44 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 2 0 50 51 1 0 51 52 2 0 50 53 1 0 45 54 1 0 54 55 2 3 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 56 60 1 0 60 61 2 0 60 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 2 0 67 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 2 3 74 76 1 0 54 77 1 0 43 78 1 0 22 79 1 0 16 80 1 0 6 81 1 0 75 5 1 0 15 10 1 0 35 31 1 0 42 38 1 0 52 47 1 0 66 62 1 0 73 69 1 0 1 82 1 0 1 83 1 0 1 84 1 0 2 85 1 0 2 86 1 0 3 87 1 1 4 88 1 0 4 89 1 0 4 90 1 0 5 91 1 6 8 92 1 6 9 93 1 0 9 94 1 0 11 95 1 0 12 96 1 0 13 97 1 0 14 98 1 0 15 99 1 0 18100 1 6 19101 1 0 20102 1 0 20103 1 0 20104 1 0 21105 1 0 21106 1 0 21107 1 0 24108 1 6 25109 1 0 25110 1 0 26111 1 0 27112 1 0 27113 1 0 27114 1 0 28115 1 0 28116 1 0 28117 1 0 32118 1 0 32119 1 0 33120 1 0 33121 1 0 34122 1 0 34123 1 0 35124 1 6 39125 1 0 39126 1 0 40127 1 0 40128 1 0 41129 1 0 41130 1 0 42131 1 6 45132 1 6 46133 1 0 46134 1 0 48135 1 0 49136 1 0 51137 1 0 52138 1 0 53139 1 0 56140 1 6 57141 1 0 58142 1 0 58143 1 0 58144 1 0 59145 1 0 59146 1 0 59147 1 0 63148 1 0 63149 1 0 64150 1 0 64151 1 0 65152 1 0 65153 1 0 66154 1 6 70155 1 0 70156 1 0 71157 1 0 71158 1 0 72159 1 0 72160 1 0 73161 1 1 76162 1 0 77163 1 0 78164 1 0 79165 1 0 80166 1 0 81167 1 0 M END

Standard InCHIKey	DCKJZPNIZDUAHR-UDXVSVLKSA-N
Standard InCHI	InChI=1S/C60H86N10O11/c1-9-37(8)50-56(77)62-42(32-38-17-11-10-12-18-38)51(72)64-48(35(4)5)55(76)63-43(31-34(2)3)57(78)69-29-15-21-46(69)58(79)67-27-13-19-44(67)53(74)61-41(33-39-23-25-40(71)26-24-39)52(73)65-49(36(6)7)60(81)70-30-16-22-47(70)59(80)68-28-14-20-45(68)54(75)66-50/h10-12,17-18,23-26,34-37,41-50,71H,9,13-16,19-22,27-33H2,1-8H3,(H,61,74)(H,62,77)(H,63,76)(H,64,72)(H,65,73)(H,66,75)/t37-,41-,42-,43-,44-,45-,46-,47-,48-,49-,50-/m0/s1
SMILES	CC[C@H](C)[C@H]1C(=N[C@@H](Cc2ccccc2)C(=N[C@@H](C(C)C)C(=N[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=O)N2CCC[C@H]2C(=N[C@@H](Cc2ccc(cc2)O)C(=N[C@@H](C(C)C)C(=O)N2CCC[C@H]2C(=O)N2CCC[C@H]2C(=N1)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	Maldive Islands	1995	PMID[18327911]
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[29893558]
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	9
MIC	10

Activity Type	# Activity
Cell line	6
Organism	10
Protein complex	1
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2890	Protein complex	Sodium/potassium-transporting ATPase	Homo sapiens	IC50	>	100000.0	nM	PMID[29893558]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT82	Cell line	MDA-MB-231	Homo sapiens	IC50	=	8600.0	nM	PMID[29893558]
NPT111	Cell line	K562	Homo sapiens	IC50	=	1100.0	nM	PMID[29893558]
NPT393	Cell line	HCT-116	Homo sapiens	IC50	=	1000.0	nM	PMID[29893558]
NPT81	Cell line	A549	Homo sapiens	IC50	=	1400.0	nM	PMID[29893558]
NPT1086	Cell line	SK-HEP1	Homo sapiens	IC50	=	12000.0	nM	PMID[29893558]
NPT2548	Cell line	SNU-638	Homo sapiens	IC50	=	2200.0	nM	PMID[29893558]
NPT729	Organism	Micrococcus luteus	Micrococcus luteus	MIC	>	128000.0	nM	PMID[29893558]
NPT566	Organism	Salmonella typhimurium	Salmonella enterica subsp. enterica serovar Typhimurium	MIC	>	128000.0	nM	PMID[29893558]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	>	128000.0	nM	PMID[29893558]
NPT20	Organism	Candida albicans	Candida albicans	MIC	>	128000.0	nM	PMID[29893558]
NPT329	Organism	Trichophyton rubrum	Trichophyton rubrum	MIC	>	128000.0	nM	PMID[29893558]
NPT330	Organism	Trichophyton mentagrophytes	Trichophyton mentagrophytes	MIC	>	128000.0	nM	PMID[29893558]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	128000.0	nM	PMID[29893558]
NPT766	Organism	Proteus vulgaris	Proteus vulgaris	MIC	>	128000.0	nM	PMID[29893558]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	>	128000.0	nM	PMID[29893558]
NPT87	Organism	Aspergillus fumigatus	Aspergillus fumigatus	MIC	>	128000.0	nM	PMID[29893558]
NPT2	Others	Unspecified	n.a.	IC50	>	100000.0	nM	PMID[29893558]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC489826 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16671
0.1-0.2	31004
0.2-0.3	1674
0.3-0.4	339
0.4-0.5	111
0.5-0.6	37
0.6-0.7	15
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9733	High Similarity	NPC489825
0.8765	High Similarity	NPC302597
0.85	High Similarity	NPC261934
0.7901	Intermediate Similarity	NPC5194
0.7595	Intermediate Similarity	NPC479068
0.7093	Intermediate Similarity	NPC479070
0.6875	Remote Similarity	NPC489823
0.6854	Remote Similarity	NPC479069
0.6667	Remote Similarity	NPC242482
0.6591	Remote Similarity	NPC130309
0.6556	Remote Similarity	NPC141957
0.6386	Remote Similarity	NPC224315
0.6374	Remote Similarity	NPC241794
0.6316	Remote Similarity	NPC489828
0.6264	Remote Similarity	NPC101679
0.625	Remote Similarity	NPC489556
0.6235	Remote Similarity	NPC489591
0.6154	Remote Similarity	NPC136797
0.6118	Remote Similarity	NPC485876
0.6111	Remote Similarity	NPC488256
0.6022	Remote Similarity	NPC262166
0.5977	Remote Similarity	NPC287401
0.5865	Remote Similarity	NPC487230
0.5824	Remote Similarity	NPC89489
0.5814	Remote Similarity	NPC489593
0.5802	Remote Similarity	NPC489594
0.5802	Remote Similarity	NPC153491
0.5795	Remote Similarity	NPC489557
0.5758	Remote Similarity	NPC275110
0.5714	Remote Similarity	NPC6975
0.5682	Remote Similarity	NPC489551
0.5667	Remote Similarity	NPC489824
0.566	Remote Similarity	NPC487229
0.5618	Remote Similarity	NPC202198
0.5618	Remote Similarity	NPC252878
0.5604	Remote Similarity	NPC479072
0.5591	Remote Similarity	NPC56685
0.5556	Remote Similarity	NPC233702
0.5556	Remote Similarity	NPC487310
0.5545	Remote Similarity	NPC328649
0.5464	Remote Similarity	NPC489827
0.5444	Remote Similarity	NPC16188
0.5443	Remote Similarity	NPC486124
0.5439	Remote Similarity	NPC469898
0.5435	Remote Similarity	NPC489592
0.5385	Remote Similarity	NPC489829
0.5375	Remote Similarity	NPC479753
0.5368	Remote Similarity	NPC479074
0.5354	Remote Similarity	NPC487308
0.5354	Remote Similarity	NPC487309
0.5253	Remote Similarity	NPC489165
0.5238	Remote Similarity	NPC489590
0.5213	Remote Similarity	NPC489822
0.5189	Remote Similarity	NPC54420
0.5133	Remote Similarity	NPC469902
0.5116	Remote Similarity	NPC200589
0.5047	Remote Similarity	NPC479071
0.5044	Remote Similarity	NPC61004

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC489826 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	2751
0.1-0.2	5951
0.2-0.3	398
0.3-0.4	46
0.4-0.5	4
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data