NPASS Compound

Natural Product: NPC489822

Natural Product ID	NPC489822
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QDSFCWAUKOHAOZ-HVYTWZIXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0000265] Carboxylic acids and derivatives [CHEMONTID:0000013] Amino acids, peptides, and analogues [CHEMONTID:0000348] Peptides [CHEMONTID:0001995] Cyclic peptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 105107 0 0 0 0 0 0 0 0999 V2000 -0.8189 6.3124 -2.6372 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4632 4.9229 -2.0897 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3681 5.1663 -0.8555 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5935 5.9556 -1.3526 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9439 3.9069 -0.2512 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0407 2.9133 0.1750 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0179 1.7145 -0.1658 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1543 3.1496 1.0278 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5377 4.3468 1.6454 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3392 3.9462 2.8956 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1048 2.7738 2.3215 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0942 2.1199 1.4064 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8492 1.6432 0.2283 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9562 0.4092 -0.0396 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4148 -0.7176 0.6777 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2541 -1.0806 1.8681 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6492 -1.4312 1.5742 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0718 -2.7300 1.4632 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4045 -3.0565 1.1593 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3106 -2.0345 0.9684 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9305 -0.7134 1.0707 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6195 -0.4368 1.3690 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0930 -1.8688 -0.2025 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2352 -3.0545 0.1875 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.9935 -4.2858 -0.4779 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9358 -4.4432 -1.6297 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8135 -5.7073 -2.3734 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3089 -6.8023 -1.9234 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2920 -5.7444 -3.7008 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5776 -4.4695 -0.8676 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3894 -4.1222 -0.1871 N 0 0 0 0 0 0 0 0 0 0 0 0 0.6631 -3.5081 1.0391 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2493 -4.4703 2.0723 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6592 -2.3945 0.7908 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7770 -2.5012 1.3639 N 0 0 0 0 0 0 0 0 0 0 0 0 3.8662 -1.5970 1.2877 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7795 -1.8433 0.1273 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9349 -0.9156 0.0801 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9918 -1.3010 -1.3391 S 0 0 0 0 0 0 0 0 0 0 0 0 8.2062 -0.3775 -1.2447 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6169 -2.9906 -1.2222 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5098 -0.1706 1.4856 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6315 0.6812 0.5615 N 0 0 0 0 0 0 0 0 0 0 0 0 3.3298 2.0854 0.6094 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6300 2.8083 0.9900 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9581 2.6165 -0.7247 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9901 3.3471 -1.0369 N 0 0 0 0 0 0 0 0 0 0 0 0 3.8241 2.2423 -1.7751 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0180 0.2841 2.7218 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3585 -1.3264 -0.0160 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3085 -5.0881 -2.1048 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6189 -1.5939 -1.4836 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4814 2.5271 -0.6469 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8174 7.0461 -1.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8491 6.3209 -3.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0497 6.6695 -3.3488 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0332 4.2957 -2.8280 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4491 4.5045 -1.7281 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1899 5.7260 -0.1124 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0258 5.3977 -2.2199 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3074 6.9437 -1.7278 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3889 5.9724 -0.5762 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4356 4.2648 0.7068 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1769 5.0164 1.0296 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7118 4.9659 2.0593 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6630 3.6652 3.7179 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0407 4.7524 3.1654 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5007 2.0944 3.0909 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9701 3.1854 1.7636 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6289 1.3209 1.9996 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4119 -0.4106 1.1045 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7777 -2.0043 2.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1649 -0.3183 2.6398 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4356 -3.5652 1.6144 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7344 -4.0838 1.0722 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3327 -2.2828 0.7350 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6483 0.1043 0.9195 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2450 0.5802 1.4667 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2342 -5.1152 0.2468 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9969 -4.3973 -1.2616 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8183 -3.5625 -2.3217 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9389 -6.8820 -0.9725 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3745 -6.6314 -4.1780 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2492 -3.0908 1.4995 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8291 -4.2853 3.0739 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0856 -5.5277 1.7865 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3366 -4.2774 2.1286 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5286 -1.8276 2.2056 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2018 -2.8785 0.2629 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2138 -1.8343 -0.8436 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7270 0.1519 0.0120 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5707 -1.1354 0.9749 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8838 -3.6662 -0.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5459 -3.0378 -0.6221 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8398 -3.4110 -2.2249 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5573 2.2436 1.3649 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4208 3.8578 1.2888 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3115 2.8692 0.1224 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1598 2.3192 1.8096 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5301 2.3495 -2.7563 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1665 1.2425 3.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9832 -1.0429 -0.7340 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5130 -5.6701 -2.2313 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8943 -2.2142 -1.8590 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8910 2.1963 -1.5261 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 3 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 15 23 1 0 23 24 2 3 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 3 27 29 1 0 25 30 1 0 30 31 2 3 31 32 1 0 32 33 1 0 32 34 1 0 34 35 2 3 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 36 42 1 0 42 43 2 3 43 44 1 0 44 45 1 0 44 46 1 0 46 47 2 3 46 48 1 0 42 49 1 0 34 50 1 0 30 51 1 0 23 52 1 0 13 53 1 0 47 5 1 0 12 8 1 0 22 17 1 0 1 54 1 0 1 55 1 0 1 56 1 0 2 57 1 0 2 58 1 0 3 59 1 1 4 60 1 0 4 61 1 0 4 62 1 0 5 63 1 1 9 64 1 0 9 65 1 0 10 66 1 0 10 67 1 0 11 68 1 0 11 69 1 0 12 70 1 1 15 71 1 1 16 72 1 0 16 73 1 0 18 74 1 0 19 75 1 0 20 76 1 0 21 77 1 0 22 78 1 0 25 79 1 1 26 80 1 0 26 81 1 0 28 82 1 0 29 83 1 0 32 84 1 1 33 85 1 0 33 86 1 0 33 87 1 0 36 88 1 1 37 89 1 0 37 90 1 0 38 91 1 0 38 92 1 0 41 93 1 0 41 94 1 0 41 95 1 0 44 96 1 1 45 97 1 0 45 98 1 0 45 99 1 0 48100 1 0 49101 1 0 50102 1 0 51103 1 0 52104 1 0 53105 1 0 M END

Standard InCHIKey	QDSFCWAUKOHAOZ-HVYTWZIXSA-N
Standard InCHI	InChI=1S/C35H52N8O9S/c1-6-19(2)28-35(51)43-15-10-13-26(43)34(50)41-24(17-22-11-8-7-9-12-22)33(49)40-25(18-27(36)44)32(48)38-20(3)29(45)39-23(14-16-53(5)52)31(47)37-21(4)30(46)42-28/h7-9,11-12,19-21,23-26,28H,6,10,13-18H2,1-5H3,(H2,36,44)(H,37,47)(H,38,48)(H,39,45)(H,40,49)(H,41,50)(H,42,46)/t19-,20-,21-,23-,24-,25-,26-,28-,53?/m0/s1
SMILES	CC[C@H](C)[C@H]1C(=O)N2CCC[C@H]2C(=N[C@@H](Cc2ccccc2)C(=N[C@@H](CC(=N)O)C(=N[C@@H](C)C(=N[C@@H](CCS(=O)C)C(=N[C@@H](C)C(=N1)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	760.36	Volume:	744.841 ? Van der Waals volume.
Dense:	1.021	LogP:	-0.749 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.349 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.345 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	33.0
TPSA:	282.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	8.0	Rings:	3.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.103	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.599	Fsp³:	0.6
MCE-18:	94.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.343	Fluc inhibitor:	0.168 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.04 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.452 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.156	Promiscuous compounds:	0.022

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.776	MDCK Permeability:	-5.304
Pgp-inhibitor:	0.584	Pgp-substrate:	1.0
PAMPA:	0.972 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.933
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.956
Plasma Protein Binding (PPB):	63.021%	Volume Distribution (VD):	-0.254
Fu:	33.409% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.959
OATP1B3 inhibitor:	0.641	BCRP inhibitor:	0.095
BSEP inhibitor:	0.755

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.051	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.231	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.008 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.759

Half-life (T1/2):

2.371

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.087	Rat Oral Acute Toxicity:	0.959
Maximum Recommended Daily Dose:	0.389	Skin Sensitization:	1.0
Carcinogencity:	0.653	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.805
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.999
Hematotoxicity:	0.756	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.0
BCF:	0.242 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.913 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.515 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.573 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	Maldive Islands	1995	PMID[18327911]
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[29893558]
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27991	Stylissa flabelliformis	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	9
MIC	10

Activity Type	# Activity
Cell line	6
Organism	10
Protein complex	1
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2890	Protein complex	Sodium/potassium-transporting ATPase	Homo sapiens	IC50	>	100000.0	nM	PMID[29893558]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT82	Cell line	MDA-MB-231	Homo sapiens	IC50	=	12000.0	nM	PMID[29893558]
NPT111	Cell line	K562	Homo sapiens	IC50	=	11000.0	nM	PMID[29893558]
NPT393	Cell line	HCT-116	Homo sapiens	IC50	=	12000.0	nM	PMID[29893558]
NPT81	Cell line	A549	Homo sapiens	IC50	=	15000.0	nM	PMID[29893558]
NPT1086	Cell line	SK-HEP1	Homo sapiens	IC50	=	13000.0	nM	PMID[29893558]
NPT2548	Cell line	SNU-638	Homo sapiens	IC50	=	12000.0	nM	PMID[29893558]
NPT729	Organism	Micrococcus luteus	Micrococcus luteus	MIC	>	128000.0	nM	PMID[29893558]
NPT566	Organism	Salmonella typhimurium	Salmonella enterica subsp. enterica serovar Typhimurium	MIC	>	128000.0	nM	PMID[29893558]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	>	128000.0	nM	PMID[29893558]
NPT20	Organism	Candida albicans	Candida albicans	MIC	>	128000.0	nM	PMID[29893558]
NPT329	Organism	Trichophyton rubrum	Trichophyton rubrum	MIC	>	128000.0	nM	PMID[29893558]
NPT330	Organism	Trichophyton mentagrophytes	Trichophyton mentagrophytes	MIC	>	128000.0	nM	PMID[29893558]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	128000.0	nM	PMID[29893558]
NPT766	Organism	Proteus vulgaris	Proteus vulgaris	MIC	>	128000.0	nM	PMID[29893558]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	>	128000.0	nM	PMID[29893558]
NPT87	Organism	Aspergillus fumigatus	Aspergillus fumigatus	MIC	>	128000.0	nM	PMID[29893558]
NPT2	Others	Unspecified	n.a.	IC50	>	100000.0	nM	PMID[29893558]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC489822 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20619
0.1-0.2	27709
0.2-0.3	1056
0.3-0.4	338
0.4-0.5	92
0.5-0.6	35
0.6-0.7	6
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8077	Intermediate Similarity	NPC322878
0.6941	Remote Similarity	NPC241794
0.6905	Remote Similarity	NPC479070
0.631	Remote Similarity	NPC479072
0.6026	Remote Similarity	NPC200589
0.6024	Remote Similarity	NPC489591
0.602	Remote Similarity	NPC489823
0.5952	Remote Similarity	NPC489557
0.5952	Remote Similarity	NPC479068
0.5934	Remote Similarity	NPC489827
0.5833	Remote Similarity	NPC328649
0.5814	Remote Similarity	NPC489824
0.5765	Remote Similarity	NPC287401
0.5682	Remote Similarity	NPC489556
0.5625	Remote Similarity	NPC489828
0.5591	Remote Similarity	NPC479069
0.5581	Remote Similarity	NPC248283
0.5581	Remote Similarity	NPC202198
0.5568	Remote Similarity	NPC489592
0.5556	Remote Similarity	NPC5194
0.5506	Remote Similarity	NPC6975
0.5476	Remote Similarity	NPC242482
0.5465	Remote Similarity	NPC255447
0.5412	Remote Similarity	NPC489593
0.5412	Remote Similarity	NPC224315
0.5385	Remote Similarity	NPC56685
0.5376	Remote Similarity	NPC489825
0.5294	Remote Similarity	NPC110602
0.5294	Remote Similarity	NPC479071
0.5227	Remote Similarity	NPC200964
0.5213	Remote Similarity	NPC261934
0.5213	Remote Similarity	NPC489826
0.5169	Remote Similarity	NPC485094
0.5169	Remote Similarity	NPC489829
0.5161	Remote Similarity	NPC479074
0.5155	Remote Similarity	NPC302597
0.5106	Remote Similarity	NPC136797
0.5098	Remote Similarity	NPC31385
0.5096	Remote Similarity	NPC296968
0.5093	Remote Similarity	NPC326349
0.5093	Remote Similarity	NPC323336
0.5053	Remote Similarity	NPC101679

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC489822 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	2861
0.1-0.2	5892
0.2-0.3	353
0.3-0.4	39
0.4-0.5	5
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data