NPASS Compound

Natural Product: NPC136797

Natural Product ID	NPC136797
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Stylopeptide 2
IUPAC Name	n.a.
Synonyms	stylopeptide 2
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL256499
PubChem CID	44448210
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0000265] Carboxylic acids and derivatives [CHEMONTID:0000013] Amino acids, peptides, and analogues [CHEMONTID:0000348] Peptides [CHEMONTID:0004831] Oligopeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 169176 0 0 0 0 0 0 0 0999 V2000 11.5429 -3.2216 0.7443 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4703 -2.6105 0.1274 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6125 -3.3964 -0.6013 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5332 -2.8112 -1.2284 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2682 -1.4599 -1.1599 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1414 -0.6832 -0.4220 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2230 -1.2563 0.2091 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1271 -0.8508 -1.8257 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8641 -0.8059 -0.9980 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9177 -0.1212 0.1983 N 0 0 0 0 0 0 0 0 0 0 0 0 6.2320 0.9890 0.6513 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0669 1.1299 2.0558 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7424 2.1622 -0.0398 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7553 2.9325 0.8037 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6832 4.3542 0.2172 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5482 4.2611 -0.7893 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7503 3.2356 -0.2194 N 0 0 0 0 0 0 0 0 0 0 0 0 4.4110 3.1641 0.0867 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9939 2.1052 0.5035 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4539 4.3274 -0.0762 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9315 5.3428 0.9749 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1739 6.5913 1.0027 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4865 7.6055 0.1070 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8224 8.8137 0.1196 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8161 9.0473 1.0356 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4880 8.0530 1.9356 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1751 6.8499 1.8974 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1676 3.9858 -0.0984 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0314 3.8023 0.0778 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3754 4.3227 1.2328 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1610 3.0123 -0.8895 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4228 3.5473 -2.3096 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0991 4.9835 -2.1333 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2188 4.8139 -1.0871 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2103 3.4374 -0.7707 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2833 2.6032 -0.4309 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9580 1.4290 -0.2776 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7042 3.0964 -0.2721 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8073 4.0050 0.9034 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1511 4.5744 1.1489 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1023 5.5206 2.3796 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2786 3.6353 1.3728 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4982 1.8985 -0.1871 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.8763 1.3207 -1.2683 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4804 1.9062 -2.4845 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7083 0.0710 -1.2762 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8709 -0.3805 0.0454 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7616 -1.5279 0.4946 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4147 -2.7901 -0.2513 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4892 -3.5514 0.4691 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.4031 -4.1060 0.3194 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5214 -4.1920 -0.8756 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4661 -5.1585 -0.6659 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.1555 -4.7768 -0.3691 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0638 -3.5738 -0.3249 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9510 -5.7478 -0.1119 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1702 -5.1201 -0.0224 N 0 0 0 0 0 0 0 0 0 0 0 0 2.9139 -4.2218 -0.3705 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2808 -4.1429 0.2184 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8239 -2.8105 0.2860 N 0 0 0 0 0 0 0 0 0 0 0 0 5.2737 -2.1544 -0.8654 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1381 -2.8404 -1.8918 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8046 -2.4096 1.6186 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1678 -3.6904 2.3608 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3112 -4.6934 1.6232 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5542 -3.2563 -1.2991 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6899 -6.4541 1.2329 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6529 -5.5056 2.2582 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8931 -7.3405 1.4852 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0193 -6.4498 -0.8263 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3102 -6.2709 -1.6309 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2446 -4.8180 -2.0558 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8928 -4.7827 1.4743 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6810 -3.5397 -0.6216 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4949 -3.9393 0.5383 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2973 -5.1587 1.1400 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0454 -5.5649 2.2259 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0132 -4.7103 2.7060 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2402 -3.4857 2.1334 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4718 -3.1251 1.0563 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9840 -1.7469 1.8853 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9930 0.2276 -2.0328 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9761 1.2169 -1.6014 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5312 1.0736 -0.2152 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6563 2.6653 -1.8540 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4408 -4.1442 1.1559 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7761 -4.4742 -0.6863 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8855 -3.4984 -1.7921 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0187 0.3894 -0.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9012 -0.6444 0.7868 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3113 0.1116 -2.3230 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8569 -1.5416 -2.6869 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1348 -0.2497 -1.6737 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2610 0.7266 2.5235 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2060 2.0254 -1.0078 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7657 2.5199 0.7500 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4114 2.9243 1.8509 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6526 4.5033 -0.2974 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5016 5.0983 1.0037 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0008 3.8731 -1.7546 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0880 5.1994 -1.0575 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7651 4.8176 -1.0468 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0218 5.4997 0.9483 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7917 4.8277 1.9903 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2605 7.4338 -0.5988 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1035 9.5768 -0.5971 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3192 10.0050 1.0157 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7169 8.2061 2.6530 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9078 6.1002 2.6166 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7747 4.0740 2.1605 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3157 1.9438 -0.8037 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2077 2.9666 -2.9866 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4738 3.5166 -2.5662 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7040 5.6271 -1.7367 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5042 5.3039 -3.1102 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0358 5.4880 -0.2257 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1604 5.0940 -1.5952 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9423 3.7134 -1.1776 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5149 3.4289 1.8347 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0620 4.8310 0.8437 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4522 5.2594 0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2643 6.2120 2.2720 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0648 6.0679 2.3371 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0732 4.8651 3.2505 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2706 4.1751 1.2304 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2912 2.6943 0.8531 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2999 3.4090 2.4852 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5448 2.3305 -2.5972 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1093 -0.6532 -1.8540 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9480 -2.4404 -1.1881 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1231 -3.2233 -1.1677 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8941 -6.5057 -0.9314 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9102 -4.8291 -0.4029 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4399 -1.5695 1.9371 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7707 -2.1506 1.9786 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2413 -3.9221 2.3031 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9009 -3.6259 3.4202 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2904 -4.6629 2.0587 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6987 -5.7257 1.6579 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0617 -3.5182 -2.1668 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2260 -7.0238 1.2526 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2683 -5.7472 2.9892 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6864 -7.1970 0.7474 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6066 -8.4074 1.5717 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3731 -7.0893 2.4769 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3206 -6.9060 0.1585 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3905 -7.1478 -1.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3372 -6.9020 -2.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2022 -6.5039 -1.0157 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1959 -4.3486 -2.2524 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5739 -4.7455 -2.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4058 -4.7620 2.3487 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3067 -2.9888 -1.3232 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3224 -4.4477 -1.1964 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5212 -5.8288 0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8848 -6.5200 2.6922 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5947 -5.0374 3.5546 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9980 -2.8463 2.5314 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6354 -2.1660 0.5957 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4516 -1.0086 2.4298 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4361 -0.7790 -2.1605 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6795 0.5078 -3.0887 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8986 1.0246 -2.2681 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4187 0.3865 -0.1680 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9728 2.0755 0.0617 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7856 0.8600 0.5690 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6576 2.8985 -2.9609 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6915 3.0101 -1.4695 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5013 3.3204 -1.4658 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 2 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 2 3 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 20 28 1 0 28 29 2 3 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 38 43 1 0 43 44 2 3 44 45 1 0 44 46 1 0 46 47 1 0 47 48 2 3 48 49 1 0 49 50 1 0 50 51 2 3 51 52 1 0 52 53 1 0 53 54 1 0 54 55 2 0 54 56 1 0 56 57 1 0 57 58 2 3 58 59 1 0 59 60 1 0 60 61 1 0 61 62 2 0 60 63 1 0 63 64 1 0 64 65 1 0 58 66 1 0 56 67 1 0 67 68 1 0 67 69 1 0 53 70 1 0 70 71 1 0 71 72 1 0 51 73 1 0 49 74 1 0 74 75 1 0 75 76 2 0 76 77 1 0 77 78 2 0 78 79 1 0 79 80 2 0 48 81 1 0 46 82 1 0 82 83 1 0 83 84 1 0 83 85 1 0 7 2 1 0 61 9 1 0 80 75 1 0 17 13 1 0 27 22 1 0 35 31 1 0 72 52 1 0 65 59 1 0 1 86 1 0 3 87 1 0 4 88 1 0 6 89 1 0 7 90 1 0 8 91 1 0 8 92 1 0 9 93 1 6 12 94 1 0 13 95 1 6 14 96 1 0 14 97 1 0 15 98 1 0 15 99 1 0 16100 1 0 16101 1 0 20102 1 6 21103 1 0 21104 1 0 23105 1 0 24106 1 0 25107 1 0 26108 1 0 27109 1 0 30110 1 0 31111 1 6 32112 1 0 32113 1 0 33114 1 0 33115 1 0 34116 1 0 34117 1 0 38118 1 6 39119 1 0 39120 1 0 40121 1 0 41122 1 0 41123 1 0 41124 1 0 42125 1 0 42126 1 0 42127 1 0 45128 1 0 46129 1 6 49130 1 6 52131 1 6 56132 1 6 59133 1 6 63134 1 0 63135 1 0 64136 1 0 64137 1 0 65138 1 0 65139 1 0 66140 1 0 67141 1 6 68142 1 0 69143 1 0 69144 1 0 69145 1 0 70146 1 0 70147 1 0 71148 1 0 71149 1 0 72150 1 0 72151 1 0 73152 1 0 74153 1 0 74154 1 0 76155 1 0 77156 1 0 78157 1 0 79158 1 0 80159 1 0 81160 1 0 82161 1 0 82162 1 0 83163 1 0 84164 1 0 84165 1 0 84166 1 0 85167 1 0 85168 1 0 85169 1 0 M END

Standard InCHIKey	NFZPQFVRYHBICX-BAVUVXMLSA-N
Standard InCHI	InChI=1S/C63H84N10O12/c1-37(2)32-44-54(76)66-46(33-38(3)4)60(82)70-28-12-20-49(70)57(79)67-47(35-41-18-10-7-11-19-41)61(83)71-29-13-21-50(71)58(80)68-48(36-42-24-26-43(75)27-25-42)62(84)72-30-14-23-52(72)59(81)69-53(39(5)74)63(85)73-31-15-22-51(73)56(78)65-45(55(77)64-44)34-40-16-8-6-9-17-40/h6-11,16-19,24-27,37-39,44-53,74-75H,12-15,20-23,28-36H2,1-5H3,(H,64,77)(H,65,78)(H,66,76)(H,67,79)(H,68,80)(H,69,81)/t39-,44+,45+,46+,47+,48+,49+,50+,51+,52+,53+/m1/s1
SMILES	Oc1ccc(cc1)C[C@@H]1N=C(O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccccc2)N=C(O)[C@@H]2CCCN2C(=O)[C@H](CC(C)C)N=C(O)[C@@H](N=C([C@@H](N=C([C@H]2N(C(=O)[C@@H](N=C([C@H]3N(C1=O)CCC3)O)[C@H](O)C)CCC2)O)Cc1ccccc1)O)CC(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1172.63	Volume:	1195.109 ? Van der Waals volume.
Dense:	0.981	LogP:	1.743 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.351 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.038 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	68.0
TPSA:	317.24 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	8.0	Rings:	8.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.098	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.868	Fsp³:	0.556
MCE-18:	189.694 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.687	Fluc inhibitor:	0.02 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.883 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.001	Promiscuous compounds:	0.007

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.047	MDCK Permeability:	-5.027
Pgp-inhibitor:	1.0	Pgp-substrate:	1.0
PAMPA:	0.003 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.958
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.879
Plasma Protein Binding (PPB):	88.094%	Volume Distribution (VD):	-0.282
Fu:	13.238% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.765	BCRP inhibitor:	0.459
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.036	CYP2C19-substrate:	0.85
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.941
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.603 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.53

Half-life (T1/2):

3.35

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.0	Rat Oral Acute Toxicity:	0.737
Maximum Recommended Daily Dose:	0.991	Skin Sensitization:	1.0
Carcinogencity:	0.002	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	1.0
Drug-induced Neurotoxicity:	0.217	Ototoxicity:	1.0
Hematotoxicity:	0.01	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.0
BCF:	0.428 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.615 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.321 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.548 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32748	stylotella sp.	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[18197605]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT457	Cell line	BT-549	Homo sapiens	Inhibition	=	77.0	%	PMID[23398362]
NPT402	Cell line	Hs-578T	Homo sapiens	Inhibition	=	56.0	%	PMID[23398362]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC136797 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	11603
0.1-0.2	35661
0.2-0.3	2062
0.3-0.4	363
0.4-0.5	114
0.5-0.6	37
0.6-0.7	14
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7595	Intermediate Similarity	NPC489829
0.7209	Intermediate Similarity	NPC241794
0.7108	Intermediate Similarity	NPC489556
0.7037	Intermediate Similarity	NPC202198
0.6629	Remote Similarity	NPC141957
0.6596	Remote Similarity	NPC328649
0.6548	Remote Similarity	NPC485094
0.6517	Remote Similarity	NPC261934
0.6264	Remote Similarity	NPC262166
0.6237	Remote Similarity	NPC302597
0.6164	Remote Similarity	NPC242159
0.6154	Remote Similarity	NPC489825
0.6154	Remote Similarity	NPC489826
0.6145	Remote Similarity	NPC242482
0.6125	Remote Similarity	NPC200589
0.6071	Remote Similarity	NPC224315
0.6023	Remote Similarity	NPC479072
0.6	Remote Similarity	NPC5194
0.5909	Remote Similarity	NPC489824
0.5876	Remote Similarity	NPC489828
0.5862	Remote Similarity	NPC489557
0.5824	Remote Similarity	NPC56685
0.5784	Remote Similarity	NPC296968
0.5761	Remote Similarity	NPC479074
0.5747	Remote Similarity	NPC489591
0.5698	Remote Similarity	NPC489593
0.5667	Remote Similarity	NPC489592
0.5631	Remote Similarity	NPC489823
0.5619	Remote Similarity	NPC487230
0.5616	Remote Similarity	NPC285926
0.5616	Remote Similarity	NPC14672
0.5568	Remote Similarity	NPC46427
0.5566	Remote Similarity	NPC487229
0.5521	Remote Similarity	NPC489827
0.5506	Remote Similarity	NPC287401
0.5506	Remote Similarity	NPC479068
0.5455	Remote Similarity	NPC485876
0.5391	Remote Similarity	NPC325976
0.5391	Remote Similarity	NPC326363
0.5345	Remote Similarity	NPC489549
0.5333	Remote Similarity	NPC16188
0.527	Remote Similarity	NPC118202
0.5248	Remote Similarity	NPC107077
0.5243	Remote Similarity	NPC223791
0.5222	Remote Similarity	NPC255447
0.5208	Remote Similarity	NPC479070
0.5196	Remote Similarity	NPC275110
0.5152	Remote Similarity	NPC481074
0.5146	Remote Similarity	NPC58725
0.514	Remote Similarity	NPC162860
0.5106	Remote Similarity	NPC489822
0.5057	Remote Similarity	NPC262077
0.5051	Remote Similarity	NPC479069
0.5048	Remote Similarity	NPC31385
0.5037	Remote Similarity	NPC485113

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC136797 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	2310
0.1-0.2	6400
0.2-0.3	387
0.3-0.4	45
0.4-0.5	8
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data