NPASS Compound

Natural Product: NPC262077

Natural Product ID	NPC262077
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Alternaramide
IUPAC Name	n.a.
Synonyms	Alternaramide
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1077115
PubChem CID	44605719
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0001813] Peptidomimetics [CHEMONTID:0001961] Depsipeptides [CHEMONTID:0001994] Cyclic depsipeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 87 0 0 0 0 0 0 0 0999 V2000 -2.9853 -4.5601 2.2528 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5764 -4.3494 1.7417 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9915 -5.7060 1.4313 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6144 -3.5341 0.4492 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2316 -2.2075 0.6430 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7721 -1.1400 0.1854 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2655 0.2174 0.2968 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6754 0.3290 -0.2654 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2395 1.6769 -0.1890 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9521 2.1183 0.9026 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4756 3.4049 0.9374 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3068 4.2868 -0.1077 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5923 3.8528 -1.2092 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0717 2.5657 -1.2376 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4359 1.1049 -0.5542 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0423 0.6777 -1.6421 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0036 2.4143 -0.3087 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2799 3.2795 0.7651 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2947 4.4068 0.7386 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3918 4.2821 -0.5895 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1292 3.0611 -1.2567 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9736 2.1270 -1.6935 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3876 1.2602 -0.9400 N 0 0 0 0 0 0 0 0 0 0 0 0 2.2660 0.2132 -0.7548 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7223 0.5220 -1.0685 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2483 1.6155 -0.2182 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8345 1.4072 1.0112 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3071 2.4673 1.7521 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2124 3.7633 1.2961 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6311 3.9966 0.0712 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1617 2.9084 -0.6576 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8517 -1.0774 -1.3735 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1754 -1.1180 -2.4102 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1495 -2.3633 -0.8920 N 0 0 0 0 0 0 0 0 0 0 0 0 2.9184 -2.7670 0.2145 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5998 -4.0367 -0.3384 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4477 -4.7059 -1.0157 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6454 -3.5466 -1.5604 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2071 -3.8202 -1.2227 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5334 -4.4564 -1.9907 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3042 -3.3676 -0.0499 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4745 2.3036 -2.9622 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4117 -2.1424 1.3870 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7249 -4.5997 1.4259 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0096 -5.5590 2.7380 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2411 -3.8006 3.0214 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0317 -3.8069 2.5410 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0699 -5.7381 1.7768 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0920 -5.9815 0.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5116 -6.5233 2.0033 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1980 -4.0952 -0.2967 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2420 0.5005 1.3573 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3913 -0.3815 0.1776 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6702 0.0547 -1.3649 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0943 1.4338 1.7378 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0312 3.7487 1.7895 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7034 5.2995 -0.1111 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4551 4.5428 -2.0379 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5266 2.2581 -2.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3383 3.6548 0.7847 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0779 2.7329 1.7454 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4723 4.3374 1.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8258 5.3885 0.8036 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5045 4.2864 -0.4887 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1707 5.2203 -1.1744 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7362 3.3480 -2.1271 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2883 -0.0092 0.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3708 -0.3603 -0.9060 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8357 0.8614 -2.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9135 0.3948 1.3759 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7768 2.3345 2.7305 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5909 4.6104 1.8899 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5620 5.0129 -0.2751 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7069 3.1333 -1.6296 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3038 -3.1443 1.0748 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7224 -2.1161 0.5624 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3315 -3.7412 -1.1460 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0360 -4.6220 0.4622 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8594 -5.2316 -0.2369 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7460 -5.4317 -1.7989 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8129 -3.5114 -2.6531 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9812 1.5645 -3.4769 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5756 -1.4284 2.0979 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 2 3 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 7 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 3 23 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 24 32 1 0 32 33 2 0 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 22 42 1 0 5 43 1 0 41 4 1 0 14 9 1 0 21 17 1 0 31 26 1 0 38 34 1 0 1 44 1 0 1 45 1 0 1 46 1 0 2 47 1 0 3 48 1 0 3 49 1 0 3 50 1 0 4 51 1 6 7 52 1 1 8 53 1 0 8 54 1 0 10 55 1 0 11 56 1 0 12 57 1 0 13 58 1 0 14 59 1 0 18 60 1 0 18 61 1 0 19 62 1 0 19 63 1 0 20 64 1 0 20 65 1 0 21 66 1 6 24 67 1 1 25 68 1 0 25 69 1 0 27 70 1 0 28 71 1 0 29 72 1 0 30 73 1 0 31 74 1 0 35 75 1 0 35 76 1 0 36 77 1 0 36 78 1 0 37 79 1 0 37 80 1 0 38 81 1 6 42 82 1 0 43 83 1 0 M END

Standard InCHIKey	IZCWSRIIMBIBGB-MASCHLQQSA-N
Standard InCHI	InChI=1S/C33H40N4O6/c1-21(2)28-30(39)35-25(20-23-13-7-4-8-14-23)31(40)36-17-9-15-26(36)29(38)34-24(19-22-11-5-3-6-12-22)32(41)37-18-10-16-27(37)33(42)43-28/h3-8,11-14,21,24-28H,9-10,15-20H2,1-2H3,(H,34,38)(H,35,39)/t24-,25-,26+,27+,28+/m1/s1
SMILES	CC(C)[C@H]1C(=N[C@H](Cc2ccccc2)C(=O)N2CCC[C@H]2C(=N[C@H](Cc2ccccc2)C(=O)N2CCC[C@H]2C(=O)O1)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	588.29	Volume:	604.269 ? Van der Waals volume.
Dense:	0.974	LogP:	2.471 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.488 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.79 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	38.0
TPSA:	132.1 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.512	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.894	Fsp³:	0.485
MCE-18:	103.469 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.613	Fluc inhibitor:	0.006 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.014 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.728 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.001	Promiscuous compounds:	0.005

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.662	MDCK Permeability:	-4.916
Pgp-inhibitor:	1.0	Pgp-substrate:	1.0
PAMPA:	0.02 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.284
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.964
Plasma Protein Binding (PPB):	83.078%	Volume Distribution (VD):	-0.086
Fu:	17.677% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.356	BCRP inhibitor:	0.863
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.993
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	1.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.952 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.277

Half-life (T1/2):

1.7

ADMET: Toxicity

hERG Blockers:	0.013	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.258	Rat Oral Acute Toxicity:	0.348
Maximum Recommended Daily Dose:	0.978	Skin Sensitization:	1.0
Carcinogencity:	0.054	Eye Corrosion:	0.0
Eye Irritation:	0.063	Respiratory Toxicity:	0.259
Drug-induced Neurotoxicity:	0.877	Ototoxicity:	0.809
Hematotoxicity:	0.9	Drug-induced Nephrotoxicity:	0.991
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.006
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.022
BCF:	0.686 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.436 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.869 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.294 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33089	Alternaria sp. SF-5016	Species	Pleosporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19943624]
NPO33089	Alternaria sp. SF-5016	Species	Pleosporaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1
IZ	2

Activity Type	# Activity
Individual protein	1
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT178	Individual protein	Protein-tyrosine phosphatase 1B	Homo sapiens	Inhibition	=	49.0	%	PMID[15844961]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	IZ	=	8.0	mm	PMID[20524638]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	IZ	=	13.0	mm	PMID[16872131]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC262077 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15569
0.1-0.2	32155
0.2-0.3	1733
0.3-0.4	282
0.4-0.5	87
0.5-0.6	23
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7069	Intermediate Similarity	NPC285926
0.7069	Intermediate Similarity	NPC14672
0.6286	Remote Similarity	NPC200589
0.6	Remote Similarity	NPC489593
0.6	Remote Similarity	NPC224315
0.5921	Remote Similarity	NPC485876
0.5867	Remote Similarity	NPC242482
0.5769	Remote Similarity	NPC200964
0.5769	Remote Similarity	NPC489557
0.5606	Remote Similarity	NPC242159
0.557	Remote Similarity	NPC248283
0.557	Remote Similarity	NPC202198
0.5556	Remote Similarity	NPC479072
0.5476	Remote Similarity	NPC481075
0.5476	Remote Similarity	NPC479074
0.5443	Remote Similarity	NPC255447
0.5366	Remote Similarity	NPC489592
0.5287	Remote Similarity	NPC483751
0.5287	Remote Similarity	NPC240848
0.5243	Remote Similarity	NPC481337
0.5238	Remote Similarity	NPC178662
0.5238	Remote Similarity	NPC470884
0.5192	Remote Similarity	NPC481338
0.5176	Remote Similarity	NPC98424
0.5172	Remote Similarity	NPC92784
0.5169	Remote Similarity	NPC283783
0.5057	Remote Similarity	NPC209509
0.5057	Remote Similarity	NPC136797

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC262077 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	2442
0.1-0.2	6112
0.2-0.3	544
0.3-0.4	46
0.4-0.5	4
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5181	Remote Similarity	NPD7113	Clinical (unspecified phase)
0.5062	Remote Similarity	NPD4791	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data