Drug Information| Drug ID:   | NPD4791 |
| Drug Name:   | |
| Molecular Formula:   | C21H33BN6O5 |
| Canonical SMILES:   | NC(=N)NCCC[C@@H](B(O)O)N=C([C@@H]1CCCN1C(=O)[C@H](N=C(O)C)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C21H33BN6O5/c1-14(29)26-16(13-15-7-3-2-4-8-15)20(31)28-12-6-9-17(28)19(30)27-18(22(32)33)10-5-11-25-21(23)24/h2-4,7-8,16-18,32-33H,5-6,9-13H2,1H3,(H,26,29)(H,27,30)(H4,23,24,25)/t16-,17+,18+/m1/s1" |
| Standard InCHIKey:   | FXFYPTZERULUBS-SQNIBIBYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4791Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6154 | NPC285926 |
| Remote Similarity | 0.6154 | NPC14672 |
| Remote Similarity | 0.5806 | NPC295993 |
| Remote Similarity | 0.5795 | NPC485662 |
| Remote Similarity | 0.5795 | NPC485663 |
| Remote Similarity | 0.5366 | NPC489593 |
| Remote Similarity | 0.5357 | NPC489557 |
| Remote Similarity | 0.5244 | NPC242482 |
| Remote Similarity | 0.52 | NPC296968 |
| Remote Similarity | 0.519 | NPC200589 |
| Remote Similarity | 0.5181 | NPC224315 |
| Remote Similarity | 0.5181 | NPC489621 |
| Remote Similarity | 0.5139 | NPC242159 |
| Remote Similarity | 0.5122 | NPC489622 |
| Remote Similarity | 0.5119 | NPC310783 |
| Remote Similarity | 0.5067 | NPC139738 |
| Remote Similarity | 0.5062 | NPC175359 |
| Remote Similarity | 0.5062 | NPC262077 |
| Remote Similarity | 0.506 | NPC171 |
| Remote Similarity | 0.5059 | NPC246670 |
| Molecular Weight   | 460.26 |
| ALogP   | -3.4266 |
| MLogP   | 2.45 |
| XLogP   | 2.581 |
| HDA   | 11 |
| HBD   | 7 |
| Rotatable Bonds   | 19 |
| TPSA   | 187.85 |
| RO5 Violation   | 3 |