Drug Information| Drug ID:   | NPD7948 |
| Drug Name:   | "Cyt-1010, Cytogel" |
| Molecular Formula:   | C35H40N6O5 |
| Canonical SMILES:   | Oc1ccc(cc1)C[C@@H](C(=N[C@@H]1CCCCN=C([C@@H](N=C([C@@H](N=C1O)Cc1c[nH]c2c1cccc2)O)Cc1ccccc1)O)O)N |
| Standard InCHI:   | "InChI=1S/C35H40N6O5/c36-27(18-23-13-15-25(42)16-14-23)32(43)39-29-12-6-7-17-37-33(44)30(19-22-8-2-1-3-9-22)40-35(46)31(41-34(29)45)20-24-21-38-28-11-5-4-10-26(24)28/h1-5,8-11,13-16,21,27,29-31,38,42H,6-7,12,17-20,36H2,(H,37,44)(H,39,43)(H,40,46)(H,41,45)/t27-,29+,30-,31-/m0/s1" |
| Standard InCHIKey:   | CFVGCGXJRNVTFP-LYXINOJLSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7948Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.642 | NPC192615 |
| Remote Similarity | 0.6383 | NPC486528 |
| Remote Similarity | 0.6075 | NPC108123 |
| Remote Similarity | 0.5802 | NPC63751 |
| Remote Similarity | 0.5729 | NPC487314 |
| Remote Similarity | 0.5546 | NPC484080 |
| Remote Similarity | 0.5122 | NPC489555 |
| Remote Similarity | 0.5093 | NPC137013 |
| Remote Similarity | 0.5085 | NPC134065 |
| Remote Similarity | 0.5074 | NPC484874 |
| Remote Similarity | 0.5057 | NPC49954 |
| Remote Similarity | 0.5041 | NPC325976 |
| Remote Similarity | 0.5041 | NPC326363 |
| Remote Similarity | 0.5038 | NPC484347 |
| Molecular Weight   | 624.31 |
| ALogP   | -3.4748 |
| MLogP   | 4.1 |
| XLogP   | 6.001 |
| HDA   | 10 |
| HBD   | 7 |
| Rotatable Bonds   | 14 |
| TPSA   | 192.4 |
| RO5 Violation   | 2 |