Drug Information| Drug ID:   | NPD8488 |
| Drug Name:   | |
| Molecular Formula:   | C47H58N12O6 |
| Canonical SMILES:   | NCCCC[C@@H](C(=N)O)N=C([C@H](N=C([C@H](Cc1c[nH]c2c1cccc2)N=C([C@@H](N=C([C@@H](Cc1c(C)[nH]c2c1cccc2)N=C([C@H](Cc1cnc[nH]1)N)O)O)C)O)O)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C47H58N12O6/c1-27-34(33-15-7-9-17-37(33)54-27)23-41(58-44(62)35(49)22-31-25-51-26-53-31)45(63)55-28(2)43(61)57-40(21-30-24-52-36-16-8-6-14-32(30)36)47(65)59-39(20-29-12-4-3-5-13-29)46(64)56-38(42(50)60)18-10-11-19-48/h3-9,12-17,24-26,28,35,38-41,52,54H,10-11,18-23,48-49H2,1-2H3,(H2,50,60)(H,51,53)(H,55,63)(H,56,64)(H,57,61)(H,58,62)(H,59,65)/t28-,35-,38-,39+,40-,41+/m0/s1" |
| Standard InCHIKey:   | RVWNMGKSNGWLOL-GIIHNPQRSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8488Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5217 | NPC234647 |
| Remote Similarity | 0.5122 | NPC479572 |
| Remote Similarity | 0.5122 | NPC479568 |
| Remote Similarity | 0.5122 | NPC479573 |
| Remote Similarity | 0.5122 | NPC479566 |
| Remote Similarity | 0.5122 | NPC479567 |
| Remote Similarity | 0.5122 | NPC479569 |
| Remote Similarity | 0.5122 | NPC479571 |
| Remote Similarity | 0.5081 | NPC479570 |
| Remote Similarity | 0.5074 | NPC89146 |
| Molecular Weight   | 886.46 |
| ALogP   | -4.112 |
| MLogP   | 4.65 |
| XLogP   | 6.193 |
| HDA   | 18 |
| HBD   | 12 |
| Rotatable Bonds   | 33 |
| TPSA   | 319.33 |
| RO5 Violation   | 4 |