NPASS Compound

Natural Product: NPC479572

Natural Product ID	NPC479572
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GDQFZMMIFCPWKT-RIUCBLHJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 286287 0 0 0 0 0 0 0 0999 V2000 33.8202 30.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 32.3202 30.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 30.8202 30.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.3202 30.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 30.8202 28.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 30.8202 27.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.5212 26.7452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 29.5212 25.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.0212 25.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 32.5212 25.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.0212 25.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 32.5212 23.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.0212 25.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.2712 23.9462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 25.7712 23.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.7712 25.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.7712 26.9462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 25.7712 22.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.4721 21.6962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 24.4721 20.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.9721 20.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.4721 20.1962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.9721 20.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.2221 18.8971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 20.7221 18.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.7221 20.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.7221 21.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.7221 23.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.2221 21.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.7221 17.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4231 16.6471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 19.4231 15.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.9231 15.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4231 15.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.9231 15.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4231 16.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.9231 15.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1731 13.8481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.6731 13.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6731 15.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6731 16.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6731 18.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6731 19.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6731 21.3481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.6731 12.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3741 11.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.3741 10.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8741 10.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3741 10.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8741 10.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.3741 10.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.8741 10.0981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.8741 10.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1241 8.7990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.6241 8.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6241 10.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6241 11.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6241 13.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1241 11.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6241 7.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3250 6.5490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.3250 5.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8250 5.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3250 5.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8250 5.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3250 5.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.8250 5.0490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.8250 5.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0750 3.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 6.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 8.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 9.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 11.2500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 2.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2760 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.2760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1470 -1.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8351 -3.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4086 -3.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7062 -2.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5260 1.2990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.0260 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0260 2.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0260 4.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5260 2.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0260 2.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0260 -0.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3250 -0.9510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.3250 -2.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8250 -2.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8250 -2.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0750 -3.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.8250 -5.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5260 -5.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2269 -6.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9279 -7.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6289 -8.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3298 -8.7990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.1241 -4.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1241 -2.7990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.4231 -5.0490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0750 -1.1519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7269 -0.9510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5260 -1.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8741 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0750 6.3481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9231 6.5490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1241 11.3971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.9721 11.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.1731 16.4462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.0212 16.6471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.2221 21.4952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 27.0702 21.6962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 27.2712 26.5442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.1192 26.7452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.3202 28.9952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 33.0702 30.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.5702 30.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.0702 30.2942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 32.3202 31.5933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 35.1446 31.1995 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 33.6374 31.9840 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 33.6374 29.0064 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 32.6832 29.0398 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 31.9572 31.9506 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 30.8202 31.9952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 27.8202 30.4952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 29.3202 31.9952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 29.1374 29.0064 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 29.3314 28.8123 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 29.5212 23.7452 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 30.8383 23.7564 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 31.3841 26.7006 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 32.8841 26.7006 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 35.5212 25.2452 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 34.2040 23.7564 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 34.0212 26.7452 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 32.5212 22.2452 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 34.0100 23.5623 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 31.0324 23.5623 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 24.2712 23.9462 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 24.2712 25.4462 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 27.2266 25.8091 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 27.0702 27.6962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 24.4721 18.6962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 25.9721 18.6962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 26.3351 21.6516 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 28.2221 18.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.2221 18.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.1776 20.7601 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.2333 20.2143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.1776 22.2601 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.7221 24.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.2221 23.3971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.2333 23.5800 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.7333 22.0800 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.0393 23.3859 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.0393 20.4083 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.4231 13.6471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.9231 13.6471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 21.1059 16.6359 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.4231 13.6471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 25.4231 15.1471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 23.9231 13.6471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 24.1059 16.6359 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.7861 18.1025 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 23.9119 16.8300 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 21.0228 17.1848 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1731 13.8481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1731 15.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1285 15.7110 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1285 17.2110 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1731 16.8481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1731 18.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1731 18.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1731 19.8481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1731 19.8481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3741 22.0981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.8710 22.2508 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3741 8.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8741 8.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2370 11.5535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.7370 11.5535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.3741 8.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.8741 8.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.8741 11.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.3741 8.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.3741 11.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.6241 11.3971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.6241 8.7990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1241 8.7990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0795 10.6620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1352 10.1162 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0795 12.1620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6241 14.7990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1241 13.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1352 13.4819 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6352 11.9819 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9412 13.2879 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9412 10.3102 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0294 3.7247 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1880 6.5045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3627 3.6487 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6880 6.5045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5079 3.5602 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8250 3.5490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8250 6.5490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3250 3.5490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3250 6.5490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5750 6.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5750 3.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0750 3.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0750 5.2500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0304 5.6130 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0304 7.1130 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0750 6.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0750 8.2500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0750 8.2500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0750 9.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0750 9.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2760 12.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7729 12.1528 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2760 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7760 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7760 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8578 2.6401 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2458 1.6317 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5736 -1.2902 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9499 -4.2246 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0967 -5.1517 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1328 -3.1443 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5148 1.1162 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5260 2.7990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3889 5.7545 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4814 3.9361 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5706 4.6620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2303 4.1234 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7088 1.3102 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5148 2.6162 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0260 1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5636 4.1994 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6880 -3.9064 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3250 -2.4510 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8250 -3.9510 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8250 -0.9510 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5750 -6.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2760 -7.0981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7760 -4.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4769 -5.2500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9769 -7.8481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6779 -8.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1779 -6.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8789 -6.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3789 -9.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3298 -10.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0308 -8.0490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5660 -2.3857 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4231 -6.5490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5750 -1.1519 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7269 -2.4510 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0260 -1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9530 2.5420 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8250 7.6471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2221 7.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8741 12.6962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.2712 12.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.9231 17.7452 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 23.3202 17.3971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.9721 22.7942 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 28.3692 22.4462 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 28.0212 27.8433 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 33.4183 27.4952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 34.7530 31.7830 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 34.7530 28.8054 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 36.8202 28.9952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 36.8202 31.5933 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 33.0702 32.8923 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 2 3 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 8 13 1 0 13 14 2 3 14 15 1 0 15 16 1 0 16 17 1 0 15 18 1 0 18 19 2 3 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 0 23 24 2 3 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 25 30 1 0 30 31 2 3 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 32 37 1 0 37 38 2 3 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 39 45 1 0 45 46 2 3 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 47 53 1 0 53 54 2 3 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 55 60 1 0 60 61 2 3 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 62 68 1 0 68 69 2 3 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 70 76 1 0 76 77 2 3 77 78 1 0 78 79 1 0 79 80 1 0 80 81 2 0 81 82 1 0 82 83 1 0 83 84 2 0 84 85 1 0 85 86 2 0 86 87 1 0 87 88 2 0 78 89 1 0 89 90 2 3 90 91 1 0 91 92 1 0 92 93 1 0 92 94 1 0 94 95 1 0 91 96 1 0 96 97 2 3 97 98 1 0 98 99 1 0 98100 1 0 100101 2 3 101102 1 0 102103 1 0 103104 1 0 104105 1 0 105106 1 0 106107 1 0 102108 1 0 108109 2 3 108110 1 0 100111 1 0 96112 1 0 89113 1 0 76114 1 0 68115 1 0 60116 1 0 53117 1 0 45118 1 0 37119 1 0 30120 1 0 23121 1 0 18122 1 0 13123 1 0 6124 1 0 5125 1 0 125126 2 3 126127 1 0 127128 1 0 126129 1 0 88 80 1 0 88 83 1 0 1130 1 0 1131 1 0 1132 1 0 2133 1 0 2134 1 0 3135 1 6 4136 1 0 4137 1 0 4138 1 0 5139 1 1 8140 1 6 9141 1 0 9142 1 0 10143 1 0 11144 1 0 11145 1 0 11146 1 0 12147 1 0 12148 1 0 12149 1 0 15150 1 1 16151 1 0 16152 1 0 17153 1 0 20154 1 6 21155 1 0 21156 1 0 22157 1 0 25158 1 1 26159 1 0 26160 1 0 27161 1 0 28162 1 0 28163 1 0 28164 1 0 29165 1 0 29166 1 0 29167 1 0 32168 1 6 33169 1 0 33170 1 0 34171 1 0 35172 1 0 35173 1 0 35174 1 0 36175 1 0 36176 1 0 36177 1 0 39178 1 1 40179 1 0 40180 1 0 41181 1 0 41182 1 0 42183 1 0 42184 1 0 43185 1 0 43186 1 0 44187 1 0 44188 1 0 47189 1 6 48190 1 0 48191 1 0 49192 1 0 49193 1 0 50194 1 0 50195 1 0 51196 1 0 51197 1 0 52198 1 0 52199 1 0 55200 1 1 56201 1 0 56202 1 0 57203 1 0 58204 1 0 58205 1 0 58206 1 0 59207 1 0 59208 1 0 59209 1 0 62210 1 6 63211 1 0 63212 1 0 64213 1 0 64214 1 0 65215 1 0 65216 1 0 66217 1 0 66218 1 0 67219 1 0 67220 1 0 70221 1 1 71222 1 0 71223 1 0 72224 1 0 72225 1 0 73226 1 0 73227 1 0 74228 1 0 74229 1 0 75230 1 0 75231 1 0 78232 1 1 79233 1 0 79234 1 0 81235 1 0 82236 1 0 84237 1 0 85238 1 0 86239 1 0 87240 1 0 91241 1 6 92242 1 6 93243 1 0 93244 1 0 93245 1 0 94246 1 0 94247 1 0 95248 1 0 95249 1 0 95250 1 0 98251 1 6 99252 1 0 99253 1 0 99254 1 0 102255 1 1 103256 1 0 103257 1 0 104258 1 0 104259 1 0 105260 1 0 105261 1 0 106262 1 0 106263 1 0 107264 1 0 107265 1 0 109266 1 0 110267 1 0 111268 1 0 112269 1 0 113270 1 0 114271 1 0 115272 1 0 116273 1 0 117274 1 0 118275 1 0 119276 1 0 120277 1 0 121278 1 0 122279 1 0 123280 1 0 124281 1 0 127282 1 0 127283 1 0 128284 1 0 128285 1 0 129286 1 0 M END

Standard InCHIKey	GDQFZMMIFCPWKT-RIUCBLHJSA-N
Standard InCHI	InChI=1S/C88H157N23O18/c1-14-53(11)72(110-71(114)45-94)88(129)107-67(43-52(9)10)83(124)108-70(48-113)86(127)109-69(47-112)85(126)105-66(42-51(7)8)82(123)104-65(41-50(5)6)81(122)102-61(32-20-25-37-91)76(117)99-62(33-21-26-38-92)78(119)103-64(40-49(3)4)80(121)101-60(31-19-24-36-90)77(118)100-63(34-22-27-39-93)79(120)106-68(44-56-46-96-58-29-17-16-28-57(56)58)84(125)111-73(54(12)15-2)87(128)97-55(13)75(116)98-59(74(95)115)30-18-23-35-89/h16-17,28-29,46,49-55,59-70,72-73,96,112-113H,14-15,18-27,30-45,47-48,89-94H2,1-13H3,(H2,95,115)(H,97,128)(H,98,116)(H,99,117)(H,100,118)(H,101,121)(H,102,122)(H,103,119)(H,104,123)(H,105,126)(H,106,120)(H,107,129)(H,108,124)(H,109,127)(H,110,114)(H,111,125)/t53-,54-,55-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,72-,73-/m0/s1
SMILES	CC[C@H](C)[C@@H](C(=N[C@@H](CC(C)C)C(=N[C@@H](CO)C(=N[C@@H](CO)C(=N[C@@H](CC(C)C)C(=N[C@@H](CC(C)C)C(=N[C@@H](CCCCN)C(=N[C@@H](CCCCN)C(=N[C@@H](CC(C)C)C(=N[C@@H](CCCCN)C(=N[C@@H](CCCCN)C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](C)C(=N[C@@H](CCCCN)C(=N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1824.21	Volume:	1871.911 ? Van der Waals volume.
Dense:	0.975	LogP:	4.752 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.818 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.184 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	67.0	Rigid Bonds:	26.0
TPSA:	745.3 ? Topological Polar Surface Area.	H-Bond Acceptor:	41.0
H-Bond Donor:	32.0	Rings:	2.0
Heavy Atoms:	41.0

MedChem Properties

QED Drug-Likeness Score:	0.017	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.871	Fsp³:	0.727
MCE-18:	92.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.336	Fluc inhibitor:	0.022 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.23 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.768 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.02	Promiscuous compounds:	0.243

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.884	MDCK Permeability:	-5.104
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.001
Plasma Protein Binding (PPB):	19.144%	Volume Distribution (VD):	-0.211
Fu:	83.546% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.97	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.946	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.084

Half-life (T1/2):

4.425

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.992	Rat Oral Acute Toxicity:	0.855
Maximum Recommended Daily Dose:	0.143	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.974
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.0	Drug-induced Nephrotoxicity:	0.979
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.01
BCF:	-0.041 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.547 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.898 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.02 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40163	Hylaeus signatus	Species	Colletidae	Eukaryota	Venom	n.a.	n.a.	PMID[26998557]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	10

Activity Type	# Activity
Organism	10

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT729	Organism	Micrococcus luteus	Micrococcus luteus	MIC	<=	3000.0	nM	PMID[26998557]
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	16000.0	nM	PMID[26998557]
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	<=	7000.0	nM	PMID[26998557]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	8000.0	nM	PMID[26998557]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	2600.0	nM	PMID[26998557]
NPT17	Organism	Staphylococcus epidermidis	Staphylococcus epidermidis	MIC	=	1600.0	nM	PMID[26998557]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	4000.0	nM	PMID[26998557]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	=	4000.0	nM	PMID[26998557]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MIC	=	8000.0	nM	PMID[26998557]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MIC	=	21000.0	nM	PMID[26998557]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC479572 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27853
0.1-0.2	20532
0.2-0.3	1116
0.3-0.4	249
0.4-0.5	59
0.5-0.6	27
0.6-0.7	10
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	7

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC479568
1.0	High Similarity	NPC479573
1.0	High Similarity	NPC479566
1.0	High Similarity	NPC479567
1.0	High Similarity	NPC479569
1.0	High Similarity	NPC479571
0.9888	High Similarity	NPC479570
0.8381	Intermediate Similarity	NPC479574
0.6705	Remote Similarity	NPC479563
0.6705	Remote Similarity	NPC479561
0.6705	Remote Similarity	NPC479560
0.6705	Remote Similarity	NPC479564
0.6187	Remote Similarity	NPC320968
0.6146	Remote Similarity	NPC479557
0.6146	Remote Similarity	NPC479554
0.6146	Remote Similarity	NPC479556
0.6146	Remote Similarity	NPC479558
0.6146	Remote Similarity	NPC479555
0.5856	Remote Similarity	NPC479553
0.5856	Remote Similarity	NPC479552
0.5856	Remote Similarity	NPC479551
0.5856	Remote Similarity	NPC479548
0.5856	Remote Similarity	NPC479549
0.5856	Remote Similarity	NPC479550
0.5833	Remote Similarity	NPC479565
0.5729	Remote Similarity	NPC479559
0.57	Remote Similarity	NPC34779
0.5682	Remote Similarity	NPC49954
0.5543	Remote Similarity	NPC479562
0.5524	Remote Similarity	NPC482066
0.549	Remote Similarity	NPC487314
0.5463	Remote Similarity	NPC482065
0.5463	Remote Similarity	NPC487117
0.5455	Remote Similarity	NPC54988
0.5274	Remote Similarity	NPC486513
0.5252	Remote Similarity	NPC484874
0.5217	Remote Similarity	NPC110602
0.5217	Remote Similarity	NPC479071
0.5196	Remote Similarity	NPC314603
0.5156	Remote Similarity	NPC486282
0.5127	Remote Similarity	NPC486515
0.5114	Remote Similarity	NPC282231
0.5092	Remote Similarity	NPC479128
0.5071	Remote Similarity	NPC75634
0.5045	Remote Similarity	NPC484329

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC479572 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3993
0.1-0.2	4948
0.2-0.3	165
0.3-0.4	32
0.4-0.5	7
0.5-0.6	5
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5888	Remote Similarity	NPD8431	Pre-clinical
0.5575	Remote Similarity	NPD8458	Clinical (unspecified phase)
0.5259	Remote Similarity	NPD8405	Pre-clinical
0.5122	Remote Similarity	NPD8488	Phase 2
0.5042	Remote Similarity	NPD8272	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data