Drug Information| Drug ID:   | NPD8458 |
| Drug Name:   | |
| Molecular Formula:   | C46H56N12O6 |
| Canonical SMILES:   | NCCCCC(C(=N)O)N=C(C(N=C(C(Cc1c[nH]c2c1cccc2)N=C(C(N=C(C(Cc1c[nH]c2c1cccc2)N=C(C(Cc1cnc[nH]1)N)O)O)C)O)O)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C46H56N12O6/c1-27(54-44(62)39(20-29-23-51-35-15-7-5-13-32(29)35)57-43(61)34(48)22-31-25-50-26-53-31)42(60)56-40(21-30-24-52-36-16-8-6-14-33(30)36)46(64)58-38(19-28-11-3-2-4-12-28)45(63)55-37(41(49)59)17-9-10-18-47/h2-8,11-16,23-27,34,37-40,51-52H,9-10,17-22,47-48H2,1H3,(H2,49,59)(H,50,53)(H,54,62)(H,55,63)(H,56,60)(H,57,61)(H,58,64)" |
| Standard InCHIKey:   | WZHKXNSOCOQYQX-UHFFFAOYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8458Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5625 | NPC234647 |
| Remote Similarity | 0.5575 | NPC479572 |
| Remote Similarity | 0.5575 | NPC479568 |
| Remote Similarity | 0.5575 | NPC479573 |
| Remote Similarity | 0.5575 | NPC479566 |
| Remote Similarity | 0.5575 | NPC479567 |
| Remote Similarity | 0.5575 | NPC479569 |
| Remote Similarity | 0.5575 | NPC479571 |
| Remote Similarity | 0.5526 | NPC479570 |
| Remote Similarity | 0.5476 | NPC89146 |
| Remote Similarity | 0.5341 | NPC63751 |
| Remote Similarity | 0.53 | NPC304804 |
| Remote Similarity | 0.528 | NPC479128 |
| Remote Similarity | 0.5114 | NPC282231 |
| Remote Similarity | 0.5113 | NPC159974 |
| Remote Similarity | 0.5109 | NPC484347 |
| Molecular Weight   | 872.44 |
| ALogP   | -4.5515 |
| MLogP   | 4.54 |
| XLogP   | 5.696 |
| HDA   | 18 |
| HBD   | 12 |
| Rotatable Bonds   | 32 |
| TPSA   | 319.33 |
| RO5 Violation   | 4 |