Drug Information| Drug ID:   | NPD8431 |
| Drug Name:   | pralmorelin |
| Molecular Formula:   | C45H55N9O6 |
| Canonical SMILES:   | NCCCC[C@@H](C(=N)O)N=C([C@H](N=C([C@H](Cc1c[nH]c2c1cccc2)N=C([C@@H](N=C([C@H](N=C([C@H](N)C)O)Cc1ccc2c(c1)cccc2)O)C)O)O)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C45H55N9O6/c1-27(47)41(56)52-38(24-30-19-20-31-14-6-7-15-32(31)22-30)43(58)50-28(2)42(57)53-39(25-33-26-49-35-17-9-8-16-34(33)35)45(60)54-37(23-29-12-4-3-5-13-29)44(59)51-36(40(48)55)18-10-11-21-46/h3-9,12-17,19-20,22,26-28,36-39,49H,10-11,18,21,23-25,46-47H2,1-2H3,(H2,48,55)(H,50,58)(H,51,59)(H,52,56)(H,53,57)(H,54,60)/t27-,28+,36+,37-,38-,39+/m1/s1" |
| Standard InCHIKey:   | HRNLPPBUBKMZMT-RDRUQFPZSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | TTD; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD8431Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5981 | NPC479570 |
| Remote Similarity | 0.5888 | NPC479572 |
| Remote Similarity | 0.5888 | NPC479568 |
| Remote Similarity | 0.5888 | NPC479573 |
| Remote Similarity | 0.5888 | NPC479566 |
| Remote Similarity | 0.5888 | NPC479567 |
| Remote Similarity | 0.5888 | NPC479569 |
| Remote Similarity | 0.5888 | NPC479571 |
| Remote Similarity | 0.5732 | NPC63751 |
| Remote Similarity | 0.5638 | NPC304804 |
| Remote Similarity | 0.5488 | NPC282231 |
| Remote Similarity | 0.5227 | NPC192615 |
| Remote Similarity | 0.5203 | NPC479574 |
| Remote Similarity | 0.52 | NPC487314 |
| Remote Similarity | 0.5189 | NPC177405 |
| Molecular Weight   | 817.43 |
| ALogP   | -3.915 |
| MLogP   | 4.76 |
| XLogP   | 9.283 |
| HDA   | 15 |
| HBD   | 10 |
| Rotatable Bonds   | 31 |
| TPSA   | 274.86 |
| RO5 Violation   | 4 |