Drug Information| Drug ID:   | NPD7730 |
| Drug Name:   | Dihydroergocryptine Mesylate |
| Molecular Formula:   | C32H43N5O5.CH4O3S |
| Canonical SMILES:   | CS(=O)(=O)O.CC(C[C@H]1C(=O)N2CCC[C@H]2[C@]2(N1C(=O)[C@@](O2)(N=C([C@H]1CN(C)[C@H]2[C@H](C1)c1cccc3c1c(C2)c[nH]3)O)C(C)C)O)C |
| Standard InCHI:   | "InChI=1S/C32H43N5O5.CH4O3S/c1-17(2)12-25-29(39)36-11-7-10-26(36)32(41)37(25)30(40)31(42-32,18(3)4)34-28(38)20-13-22-21-8-6-9-23-27(21)19(15-33-23)14-24(22)35(5)16-20;1-5(2,3)4/h6,8-9,15,17-18,20,22,24-26,33,41H,7,10-14,16H2,1-5H3,(H,34,38);1H3,(H,2,3,4)/t20-,22-,24-,25+,26+,31-,32+;/m1./s1" |
| Standard InCHIKey:   | TZGKQIBPZOZAKF-PJLVGBPESA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7730Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7358 | NPC230554 |
| Remote Similarity | 0.6887 | NPC155444 |
| Remote Similarity | 0.6887 | NPC224542 |
| Remote Similarity | 0.6887 | NPC137993 |
| Remote Similarity | 0.6636 | NPC527902 |
| Remote Similarity | 0.6207 | NPC557604 |
| Remote Similarity | 0.6126 | NPC58642 |
| Remote Similarity | 0.6126 | NPC49336 |
| Remote Similarity | 0.6126 | NPC249875 |
| Remote Similarity | 0.5862 | NPC56109 |
| Remote Similarity | 0.5862 | NPC306412 |
| Remote Similarity | 0.5862 | NPC203217 |
| Remote Similarity | 0.5207 | NPC273359 |
| Remote Similarity | 0.5207 | NPC191382 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 577.33 |
| ALogP   | -1.1964 |
| MLogP   | 3.88 |
| XLogP   | 3.153 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 121.7 |
| RO5 Violation   | 0 |