Drug Information| Drug ID: | NPD482 |
| Drug Name: | Tryptophan |
| Molecular Formula: | C11H12N2O2 |
| Canonical SMILES: | OC(=O)[C@H](Cc1c[nH]c2c1cccc2)N |
| Standard InCHI: | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 |
| Standard InCHIKey: | QIVBCDIJIAJPQS-VIFPVBQESA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD482Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Molecular Weight | 204.09 |
| ALogP | -1.5048 |
| MLogP | 2.23 |
| XLogP | -0.96 |
| HDA | 4 |
| HBD | 3 |
| Rotatable Bonds | 5 |
| TPSA | 79.11 |
| RO5 Violation | 0 |