Drug Information| Drug ID:   | NPD7824 |
| Drug Name:   | |
| Molecular Formula:   | C33H45N5O5 |
| Canonical SMILES:   | CCC(C1C(=O)N2CCCC2C2(N1C(=O)C(O2)(N=C(C1CN(C)C2C(C1)c1cccc3c1c(C2)c[nH]3)O)C(C)C)O)(C)C |
| Standard InCHI:   | "InChI=1S/C33H45N5O5/c1-7-31(4,5)27-29(40)37-13-9-12-25(37)33(42)38(27)30(41)32(43-33,18(2)3)35-28(39)20-14-22-21-10-8-11-23-26(21)19(16-34-23)15-24(22)36(6)17-20/h8,10-11,16,18,20,22,24-25,27,34,42H,7,9,12-15,17H2,1-6H3,(H,35,39)" |
| Standard InCHIKey:   | YLXBZBPHTNJZQE-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7824Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6239 | NPC155444 |
| Remote Similarity | 0.6239 | NPC224542 |
| Remote Similarity | 0.6239 | NPC137993 |
| Remote Similarity | 0.6147 | NPC527902 |
| Remote Similarity | 0.5965 | NPC56109 |
| Remote Similarity | 0.5965 | NPC230554 |
| Remote Similarity | 0.5965 | NPC306412 |
| Remote Similarity | 0.5965 | NPC203217 |
| Remote Similarity | 0.563 | NPC557604 |
| Remote Similarity | 0.5526 | NPC58642 |
| Remote Similarity | 0.5526 | NPC49336 |
| Remote Similarity | 0.5526 | NPC249875 |
| Remote Similarity | 0.5294 | NPC273359 |
| Remote Similarity | 0.5294 | NPC191382 |
| Molecular Weight   | 591.34 |
| ALogP   | -0.8038 |
| MLogP   | 3.99 |
| XLogP   | 3.337 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 13 |
| TPSA   | 121.7 |
| RO5 Violation   | 0 |