Drug Information| Drug ID:   | NPD1038 |
| Drug Name:   | Melatonin |
| Molecular Formula:   | C13H16N2O2 |
| Canonical SMILES:   | COc1ccc2c(c1)c(CCN=C(O)C)c[nH]2 |
| Standard InCHI:   | "InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16)" |
| Standard InCHIKey:   | DRLFMBDRBRZALE-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD1038Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC307963 |
| Remote Similarity | 0.6615 | NPC123705 |
| Remote Similarity | 0.6615 | NPC134962 |
| Remote Similarity | 0.6415 | NPC190296 |
| Remote Similarity | 0.625 | NPC611731 |
| Remote Similarity | 0.6038 | NPC296527 |
| Remote Similarity | 0.6038 | NPC251090 |
| Remote Similarity | 0.6038 | NPC605230 |
| Remote Similarity | 0.5714 | NPC76748 |
| Remote Similarity | 0.5714 | NPC92111 |
| Remote Similarity | 0.5714 | NPC611386 |
| Remote Similarity | 0.5614 | NPC290331 |
| Remote Similarity | 0.5246 | NPC263183 |
| Molecular Weight   | 232.12 |
| ALogP   | -0.5009 |
| MLogP   | 2.45 |
| XLogP   | 1.76 |
| HDA   | 3 |
| HBD   | 2 |
| Rotatable Bonds   | 7 |
| TPSA   | 57.61 |
| RO5 Violation   | 0 |