Drug Information| Drug ID:   | NPD5612 |
| Drug Name:   | IS-159 |
| Molecular Formula:   | C23H27N5O5 |
| Canonical SMILES:   | NCCc1c[nH]c2c1cc(OCC(=N[C@H](C(=NCC(=N)O)O)Cc1ccc(cc1)O)O)cc2 |
| Standard InCHI:   | "InChI=1S/C23H27N5O5/c24-8-7-15-11-26-19-6-5-17(10-18(15)19)33-13-22(31)28-20(23(32)27-12-21(25)30)9-14-1-3-16(29)4-2-14/h1-6,10-11,20,26,29H,7-9,12-13,24H2,(H2,25,30)(H,27,32)(H,28,31)/t20-/m0/s1" |
| Standard InCHIKey:   | PBRWGFLPYQYNGI-FQEVSTJZSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5612Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.525 | NPC192615 |
| Molecular Weight   | 453.2 |
| ALogP   | -2.2606 |
| MLogP   | 2.89 |
| XLogP   | 1.223 |
| HDA   | 8 |
| HBD   | 7 |
| Rotatable Bonds   | 16 |
| TPSA   | 180.53 |
| RO5 Violation   | 2 |