Drug Information| Drug ID:   | NPD7470 |
| Drug Name:   | POL-443 |
| Molecular Formula:   | C30H36N4O6 |
| Canonical SMILES:   | CC(C[C@@H](C(=N[C@H](C(=O)O)Cc1c[nH]c2c1cccc2)O)N=C([C@@H]1CCCN1C(=O)OCc1ccccc1)O)C |
| Standard InCHI:   | "InChI=1S/C30H36N4O6/c1-19(2)15-24(27(35)33-25(29(37)38)16-21-17-31-23-12-7-6-11-22(21)23)32-28(36)26-13-8-14-34(26)30(39)40-18-20-9-4-3-5-10-20/h3-7,9-12,17,19,24-26,31H,8,13-16,18H2,1-2H3,(H,32,36)(H,33,35)(H,37,38)/t24-,25-,26-/m0/s1" |
| Standard InCHIKey:   | LCCDOHWSIHXCRI-GSDHBNRESA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7470Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5714 | NPC134065 |
| Remote Similarity | 0.5429 | NPC54657 |
| Remote Similarity | 0.5309 | NPC267885 |
| Remote Similarity | 0.5149 | NPC286484 |
| Remote Similarity | 0.5143 | NPC293917 |
| Molecular Weight   | 548.26 |
| ALogP   | -1.0406 |
| MLogP   | 3.66 |
| XLogP   | 5.977 |
| HDA   | 10 |
| HBD   | 4 |
| Rotatable Bonds   | 18 |
| TPSA   | 147.81 |
| RO5 Violation   | 2 |