NPASS drugs

Drug Information

Drug ID:	NPD2095
Drug Name:	Golotimod
Molecular Formula:	C16H19N3O5
Canonical SMILES:	OC(=N[C@H](C(=O)O)Cc1c[nH]c2c1cccc2)CC[C@H](C(=O)O)N
Standard InCHI:	"InChI=1S/C16H19N3O5/c17-11(15(21)22)5-6-14(20)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12/h1-4,8,11,13,18H,5-7,17H2,(H,19,20)(H,21,22)(H,23,24)/t11-,13+/m1/s1"
Standard InCHIKey:	CATMPQFFVNKDEY-YPMHNXCESA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2095

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	164764
0.1-0.2	41869
0.2-0.3	3866
0.3-0.4	1002
0.4-0.5	207
0.5-0.6	22
0.6-0.7	6
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7241	NPC267885
Remote Similarity	0.6875	NPC321708
Remote Similarity	0.6	NPC149155
Remote Similarity	0.6	NPC203468
Remote Similarity	0.6	NPC110500
Remote Similarity	0.6	NPC605775
Remote Similarity	0.6	NPC611955
Remote Similarity	0.5806	NPC504295
Remote Similarity	0.5694	NPC585650
Remote Similarity	0.5672	NPC561461
Remote Similarity	0.5641	NPC572861
Remote Similarity	0.5556	NPC248041
Remote Similarity	0.5556	NPC126709
Remote Similarity	0.5493	NPC282754
Remote Similarity	0.5397	NPC480318
Remote Similarity	0.5323	NPC275846
Remote Similarity	0.5238	NPC580966
Remote Similarity	0.5238	NPC605329
Remote Similarity	0.5231	NPC480316
Remote Similarity	0.5224	NPC283219
Remote Similarity	0.5161	NPC78020
Remote Similarity	0.5161	NPC609257
Remote Similarity	0.5082	NPC216077
Remote Similarity	0.5079	NPC164540
Remote Similarity	0.5079	NPC315555
Remote Similarity	0.5079	NPC326010
Remote Similarity	0.5079	NPC55772
Remote Similarity	0.5079	NPC96195
Remote Similarity	0.5079	NPC607622

Drug Structure

NPD2095 OpenBabel08211701392D 30 31 0 0 1 0 0 0 0 0999 V2000 2.6831 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 1.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -0.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5669 6.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2361 5.4223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8760 7.1165 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9511 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2872 2.7770 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9271 4.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8541 7.3244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9563 2.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2068 7.8596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5962 3.7281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0511 4.2633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5232 6.5812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1631 8.2754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6473 1.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9344 2.2418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5158 8.8107 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7713 7.6517 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 -0.9511 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7202 5.0064 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4940 9.0186 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6036 1.4986 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 3 1 0 0 0 0 2 4 1 0 0 0 0 3 10 2 0 0 0 0 4 12 2 0 0 0 0 5 6 1 0 0 0 0 6 14 1 0 0 0 0 7 9 1 0 0 0 0 8 9 2 0 0 0 0 8 18 1 0 0 0 0 9 10 1 0 0 0 0 10 12 1 0 0 0 0 11 5 1 6 0 0 0 11 15 1 0 0 0 0 11 17 1 0 0 0 0 12 18 1 0 0 0 0 13 7 1 1 0 0 0 13 16 1 0 0 0 0 13 19 1 0 0 0 0 14 19 2 3 0 0 0 14 20 1 0 0 0 0 15 21 2 0 0 0 0 15 22 1 0 0 0 0 16 23 2 0 0 0 0 16 24 1 0 0 0 0 17 25 1 0 0 0 0 17 26 1 0 0 0 0 18 27 1 0 0 0 0 20 28 1 0 0 0 0 22 29 1 0 0 0 0 24 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB003684
DrugBank	DB05475
ChEMBL	CHEMBL2103812
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number	229305-39-9

Drug Properties

Molecular Weight	333.13
ALogP	-2.2365
MLogP	2.34
XLogP	-1.607
HDA	8
HBD	5
Rotatable Bonds	12
TPSA	149
RO5 Violation	0