NPASS drugs

Drug Information

Drug ID:	NPD2096
Drug Name:	Oglufanide
Molecular Formula:	C16H19N3O5
Canonical SMILES:	OC(=O)CC[C@@H](C(=N[C@H](C(=O)O)Cc1c[nH]c2c1cccc2)O)N
Standard InCHI:	"InChI=1S/C16H19N3O5/c17-11(5-6-14(20)21)15(22)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24)/t11-,13-/m0/s1"
Standard InCHIKey:	LLEUXCDZPQOJMY-AAEUAGOBSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2096

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	165385
0.1-0.2	41737
0.2-0.3	3590
0.3-0.4	855
0.4-0.5	153
0.5-0.6	16
0.6-0.7	0
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.746	NPC321708
Intermediate Similarity	0.7	NPC267885
Remote Similarity	0.5806	NPC580966
Remote Similarity	0.5806	NPC605329
Remote Similarity	0.5781	NPC480316
Remote Similarity	0.5625	NPC504295
Remote Similarity	0.5556	NPC282754
Remote Similarity	0.5484	NPC78020
Remote Similarity	0.5484	NPC609257
Remote Similarity	0.5312	NPC149155
Remote Similarity	0.5312	NPC203468
Remote Similarity	0.5312	NPC110500
Remote Similarity	0.5312	NPC605775
Remote Similarity	0.5312	NPC611955
Remote Similarity	0.5231	NPC480318
Remote Similarity	0.5156	NPC326010
Remote Similarity	0.5122	NPC572861
Remote Similarity	0.5068	NPC324083

Drug Structure

NPD2096 OpenBabel08211701392D 30 31 0 0 1 0 0 0 0 0999 V2000 2.6831 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 1.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -0.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2142 5.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5232 6.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2361 5.4223 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9511 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2872 2.7770 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5014 6.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9271 4.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9563 2.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5669 6.1654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5962 3.7281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.8104 7.7402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1705 6.0460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0511 4.2633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6473 1.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9344 2.2418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8760 7.1165 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4112 5.9575 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 -0.9511 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1487 6.2539 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7202 5.0064 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6036 1.4986 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 3 1 0 0 0 0 2 4 1 0 0 0 0 3 10 2 0 0 0 0 4 12 2 0 0 0 0 5 6 1 0 0 0 0 6 14 1 0 0 0 0 7 9 1 0 0 0 0 8 9 2 0 0 0 0 8 18 1 0 0 0 0 9 10 1 0 0 0 0 10 12 1 0 0 0 0 11 5 1 6 0 0 0 11 15 1 0 0 0 0 11 17 1 0 0 0 0 12 18 1 0 0 0 0 13 7 1 1 0 0 0 13 16 1 0 0 0 0 13 19 1 0 0 0 0 14 20 2 0 0 0 0 14 21 1 0 0 0 0 15 19 2 3 0 0 0 15 22 1 0 0 0 0 16 23 2 0 0 0 0 16 24 1 0 0 0 0 17 25 1 0 0 0 0 17 26 1 0 0 0 0 18 27 1 0 0 0 0 21 28 1 0 0 0 0 22 29 1 0 0 0 0 24 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB005391
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	333.13
ALogP	-2.2365
MLogP	2.34
XLogP	-1.607
HDA	8
HBD	5
Rotatable Bonds	12
TPSA	149
RO5 Violation	0