NPASS drugs

Drug Information

Drug ID:	NPD1392
Drug Name:	Pindolol
Molecular Formula:	C14H20N2O2
Canonical SMILES:	OC(COc1cccc2c1cc[nH]2)CNC(C)C
Standard InCHI:	"InChI=1S/C14H20N2O2/c1-10(2)16-8-11(17)9-18-14-5-3-4-13-12(14)6-7-15-13/h3-7,10-11,15-17H,8-9H2,1-2H3"
Standard InCHIKey:	JZQKKSLKJUAGIC-UHFFFAOYSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD1392

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	122944
0.1-0.2	87397
0.2-0.3	1364
0.3-0.4	17
0.4-0.5	14
0.5-0.6	4
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5439	NPC318591
Remote Similarity	0.5439	NPC612082
Remote Similarity	0.5345	NPC480696
Remote Similarity	0.5345	NPC611707

Drug Structure

NPD1392 OpenBabel08211700192D 21 22 0 0 1 0 0 0 0 0999 V2000 -1.6470 -5.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7810 -7.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 -0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 0.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 -1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 -0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0850 -4.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 -3.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7810 -6.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 -4.3090 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.9511 -1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 -0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -1.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0850 -5.8090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -4.8090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -2.8090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 0.9511 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 -6.3090 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -5.8090 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 10 1 0 0 0 0 2 10 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 13 1 0 0 0 0 5 14 2 0 0 0 0 6 7 2 0 0 0 0 6 12 1 0 0 0 0 7 15 1 0 0 0 0 8 11 1 0 0 0 0 8 16 1 0 0 0 0 9 11 1 0 0 0 0 9 18 1 0 0 0 0 10 16 1 0 0 0 0 11 17 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 15 1 0 0 0 0 14 18 1 0 0 0 0 15 19 1 0 0 0 0 16 20 1 0 0 0 0 17 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000025
DrugBank	DB00960
ChEMBL	CHEMBL500
IUPHAR/BPS	91
PharmaGKB	PA450966
KEGG Drug	D00513
PubChem CID	4828
ChEBI	8214
CAS Number	13523-86-9

Drug Properties

Molecular Weight	248.15
ALogP	-1.4302
MLogP	2.56
XLogP	1.62
HDA	3
HBD	3
Rotatable Bonds	9
TPSA	57.28
RO5 Violation	0