Drug Information| Drug ID:   | NPD8303 |
| Drug Name:   | ABS-212 |
| Molecular Formula:   | C41H69N9O8 |
| Canonical SMILES:   | CC(C[C@@H](C(=O)[O-])N=C([C@H](C(C)(C)C)N=C([C@@H](N=C([C@@H]1CCCN1C(=O)[C@@H](N=C([C@H](CCC[N+](C)(C)C)C)O)CCCNC(=N)N)O)Cc1ccc(cc1)O)O)O)C |
| Standard InCHI:   | "InChI=1S/C41H69N9O8/c1-25(2)23-31(39(57)58)47-37(55)33(41(4,5)6)48-35(53)30(24-27-16-18-28(51)19-17-27)46-36(54)32-15-11-21-49(32)38(56)29(14-10-20-44-40(42)43)45-34(52)26(3)13-12-22-50(7,8)9/h16-19,25-26,29-33H,10-15,20-24H2,1-9H3,(H9-,42,43,44,45,46,47,48,51,52,53,54,55,57,58)/t26-,29-,30-,31-,32-,33+/m0/s1" |
| Standard InCHIKey:   | NWPZHWJQSGWXSJ-BJAKLJBYSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8303Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 815.53 |
| ALogP   | -3.1388 |
| MLogP   | 4.1 |
| XLogP   | 0.841 |
| HDA   | 15 |
| HBD   | 8 |
| Rotatable Bonds   | 41 |
| TPSA   | 272.93 |
| RO5 Violation   | 3 |