Drug Information| Drug ID:   | NPD8110 |
| Drug Name:   | |
| Molecular Formula:   | C38H48N8O7S |
| Canonical SMILES:   | CSCC[C@@H]1N=C(O)[C@H](CC(C)C)N=C(O)[C@H]2CN=C(C[C@@H](N=C1O)C(=N[C@H](Cc1c[nH]c3c1cccc3)C(=N[C@H](C(=N2)O)Cc1ccccc1)O)O)O |
| Standard InCHI:   | "InChI=1S/C38H48N8O7S/c1-21(2)15-27-34(49)41-26(13-14-54-3)33(48)45-30-18-32(47)40-20-31(38(53)42-27)46-35(50)28(16-22-9-5-4-6-10-22)43-36(51)29(44-37(30)52)17-23-19-39-25-12-8-7-11-24(23)25/h4-12,19,21,26-31,39H,13-18,20H2,1-3H3,(H,40,47)(H,41,49)(H,42,53)(H,43,51)(H,44,52)(H,45,48)(H,46,50)/t26-,27-,28-,29+,30+,31+/m0/s1" |
| Standard InCHIKey:   | CFDNUNSOUUFTQO-JYMVZIKVSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8110Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6444 | NPC487314 |
| Remote Similarity | 0.641 | NPC49954 |
| Remote Similarity | 0.6373 | NPC479075 |
| Remote Similarity | 0.625 | NPC479065 |
| Remote Similarity | 0.619 | NPC183377 |
| Remote Similarity | 0.619 | NPC479073 |
| Remote Similarity | 0.6075 | NPC479066 |
| Remote Similarity | 0.6026 | NPC63751 |
| Remote Similarity | 0.5833 | NPC479076 |
| Remote Similarity | 0.5727 | NPC75726 |
| Remote Similarity | 0.5532 | NPC564171 |
| Remote Similarity | 0.5426 | NPC314603 |
| Remote Similarity | 0.5361 | NPC106281 |
| Remote Similarity | 0.5312 | NPC34779 |
| Remote Similarity | 0.5306 | NPC494602 |
| Remote Similarity | 0.5306 | NPC536771 |
| Remote Similarity | 0.5234 | NPC31385 |
| Remote Similarity | 0.5138 | NPC110602 |
| Remote Similarity | 0.5138 | NPC479071 |
| Remote Similarity | 0.5128 | NPC59269 |
| Remote Similarity | 0.5122 | NPC203282 |
| Remote Similarity | 0.5116 | NPC192615 |
| Molecular Weight   | 760.34 |
| ALogP   | -0.7422 |
| MLogP   | 3.88 |
| XLogP   | 5.495 |
| HDA   | 15 |
| HBD   | 8 |
| Rotatable Bonds   | 19 |
| TPSA   | 269.22 |
| RO5 Violation   | 3 |