Drug Information| Drug ID:   | NPD7589 |
| Drug Name:   | |
| Molecular Formula:   | C31H36N6O8 |
| Canonical SMILES:   | NCC(=NCC(=NCC(=NCCCOc1ccc2c(c1)c(CC)c1c(n2)c2n(C1)c(=O)c1c(c2)[C@@](O)(CC)C(=O)OC1)O)O)O |
| Standard InCHI:   | "InChI=1S/C31H36N6O8/c1-3-18-19-10-17(44-9-5-8-33-26(39)13-35-27(40)14-34-25(38)12-32)6-7-23(19)36-28-20(18)15-37-24(28)11-22-21(29(37)41)16-45-30(42)31(22,43)4-2/h6-7,10-11,43H,3-5,8-9,12-16,32H2,1-2H3,(H,33,39)(H,34,38)(H,35,40)/t31-/m0/s1" |
| Standard InCHIKey:   | MWOPHYKKEDTKAZ-HKBQPEDESA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7589Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6 | NPC276661 |
| Remote Similarity | 0.6 | NPC599818 |
| Remote Similarity | 0.5789 | NPC197381 |
| Remote Similarity | 0.5294 | NPC106338 |
| Remote Similarity | 0.5294 | NPC303320 |
| Remote Similarity | 0.5294 | NPC541875 |
| Remote Similarity | 0.5294 | NPC608071 |
| Molecular Weight   | 620.26 |
| ALogP   | -3.5233 |
| MLogP   | 3.33 |
| XLogP   | 0.03 |
| HDA   | 13 |
| HBD   | 5 |
| Rotatable Bonds   | 19 |
| TPSA   | 212.75 |
| RO5 Violation   | 2 |