Drug Information| Drug ID:   | NPD7271 |
| Drug Name:   | Ergoloid mesylate |
| Molecular Formula:   | C29H37N5O5.CH4O3S |
| Canonical SMILES:   | CS(=O)(=O)O.CN1C[C@@H](C[C@H]2[C@H]1Cc1c[nH]c3c1c2ccc3)C(=N[C@@]1(O[C@@]2(N(C1=O)[C@@H](C)C(=O)N1[C@H]2CCC1)O)C(C)C)O |
| Standard InCHI:   | "InChI=1S/C29H37N5O5.CH4O3S/c1-15(2)28(27(37)34-16(3)26(36)33-10-6-9-23(33)29(34,38)39-28)31-25(35)18-11-20-19-7-5-8-21-24(19)17(13-30-21)12-22(20)32(4)14-18;1-5(2,3)4/h5,7-8,13,15-16,18,20,22-23,30,38H,6,9-12,14H2,1-4H3,(H,31,35);1H3,(H,2,3,4)/t16-,18+,20+,22+,23-,28+,29-;/m0./s1" |
| Standard InCHIKey:   | FQHMMOGHDWAXDI-WUQHHHCFSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD7271Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6636 | NPC230554 |
| Remote Similarity | 0.6261 | NPC557604 |
| Remote Similarity | 0.6182 | NPC155444 |
| Remote Similarity | 0.6182 | NPC224542 |
| Remote Similarity | 0.6182 | NPC137993 |
| Remote Similarity | 0.6091 | NPC527902 |
| Remote Similarity | 0.5913 | NPC56109 |
| Remote Similarity | 0.5913 | NPC306412 |
| Remote Similarity | 0.5913 | NPC203217 |
| Remote Similarity | 0.5478 | NPC58642 |
| Remote Similarity | 0.5478 | NPC49336 |
| Remote Similarity | 0.5478 | NPC249875 |
| Remote Similarity | 0.525 | NPC273359 |
| Remote Similarity | 0.525 | NPC191382 |
| Molecular Weight   | 535.28 |
| ALogP   | -1.9736 |
| MLogP   | 3.55 |
| XLogP   | 1.718 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 9 |
| TPSA   | 121.7 |
| RO5 Violation   | 0 |