Drug Information| Drug ID:   | NPD7791 |
| Drug Name:   | "Dihydroergotamine (Migraine, Tempo-Inhaled/Oral), Map; Dihydroergotamine" |
| Molecular Formula:   | C33H37N5O5 |
| Canonical SMILES:   | CN1C[C@@H](C[C@H]2[C@H]1Cc1c[nH]c3c1c2ccc3)C(=N[C@]1(C)O[C@@]2(N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1[C@H]2CCC1)O)O |
| Standard InCHI:   | "InChI=1S/C33H37N5O5/c1-32(35-29(39)21-15-23-22-10-6-11-24-28(22)20(17-34-24)16-25(23)36(2)18-21)31(41)38-26(14-19-8-4-3-5-9-19)30(40)37-13-7-12-27(37)33(38,42)43-32/h3-6,8-11,17,21,23,25-27,34,42H,7,12-16,18H2,1-2H3,(H,35,39)/t21-,23-,25-,26+,27+,32-,33+/m1/s1" |
| Standard InCHIKey:   | LUZRJRNZXALNLM-JGRZULCMSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7791Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7358 | NPC273359 |
| Intermediate Similarity | 0.7358 | NPC191382 |
| Remote Similarity | 0.6786 | NPC557604 |
| Remote Similarity | 0.6577 | NPC56109 |
| Remote Similarity | 0.6577 | NPC306412 |
| Remote Similarity | 0.6577 | NPC203217 |
| Remote Similarity | 0.6126 | NPC58642 |
| Remote Similarity | 0.6126 | NPC49336 |
| Remote Similarity | 0.6126 | NPC249875 |
| Remote Similarity | 0.6036 | NPC527902 |
| Remote Similarity | 0.5431 | NPC155444 |
| Remote Similarity | 0.5431 | NPC224542 |
| Remote Similarity | 0.5431 | NPC137993 |
| Remote Similarity | 0.5378 | NPC320236 |
| Remote Similarity | 0.5378 | NPC571033 |
| Remote Similarity | 0.5378 | NPC609531 |
| Remote Similarity | 0.5333 | NPC510017 |
| Remote Similarity | 0.5333 | NPC511922 |
| Remote Similarity | 0.5207 | NPC230554 |
| Remote Similarity | 0.5207 | NPC534269 |
| Remote Similarity | 0.5082 | NPC116551 |
| TTD   | DIB009258; DAP000078 |
| DrugBank   | DB00320 |
| ChEMBL   | CHEMBL1732 |
| IUPHAR/BPS   | 121 |
| PharmaGKB   | PA164743028 |
| KEGG Drug   | |
| PubChem CID   | 10531 |
| ChEBI   | 4562 |
| CAS Number   | 511-12-6 |
| Molecular Weight   | 583.28 |
| ALogP   | -2.4841 |
| MLogP   | 3.99 |
| XLogP   | 4.328 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 8 |
| TPSA   | 121.7 |
| RO5 Violation   | 0 |