NPASS drugs

Drug Information

Drug ID:	NPD3389
Drug Name:	Dolasetron Mesylate
Molecular Formula:	C19H20N2O3.CH4O3S.H2O
Canonical SMILES:	CS(=O)(=O)O.O=C1CN2[C@H]3C[C@H]1C[C@@H]2C[C@@H](C3)OC(=O)c1c[nH]c2c1cccc2.O
Standard InCHI:	InChI=1S/C19H20N2O3.CH4O3S.H2O/c22-18-10-21-12-5-11(18)6-13(21)8-14(7-12)24-19(23)16-9-20-17-4-2-1-3-15(16)17;1-5(2,3)4;/h1-4,9,11-14,20H,5-8,10H2;1H3,(H,2,3,4);1H2/t11-,12-,13+,14+;;
Standard InCHIKey:	QTFFGPOXNNGTGZ-LIFGOUTFSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3389

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	303
0.1-0.2	1546
0.2-0.3	7776
0.3-0.4	10654
0.4-0.5	7358
0.5-0.6	1332
0.6-0.7	1337
0.7-0.8	574
0.8-0.85	9
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.875	NPC138370
Intermediate Similarity	0.848	NPC123839
Intermediate Similarity	0.8382	NPC266249
Intermediate Similarity	0.8308	NPC278434
Intermediate Similarity	0.8205	NPC282103
Intermediate Similarity	0.8195	NPC82053
Intermediate Similarity	0.8143	NPC477979
Intermediate Similarity	0.8134	NPC118940
Intermediate Similarity	0.8109	NPC245916
Intermediate Similarity	0.801	NPC267343

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD3389 OpenBabel08211703112D 34 36 0 0 1 0 0 0 0 0999 V2000 2.6923 0.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9002 1.8350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7412 0.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1570 2.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9721 -0.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7692 -1.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9964 -0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4964 -1.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4032 2.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2035 -2.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2035 -0.9782 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4964 -1.4857 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9964 -2.3517 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9964 -0.6196 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9981 1.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0036 1.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2060 2.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8070 -1.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4964 0.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3400 2.6951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.9964 -2.3517 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 -2.8244 -5.8273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0036 -0.6196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4964 0.2464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6752 -11.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6752 -11.7267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6752 -11.7267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6752 -11.7267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6752 -11.7267 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 16.3036 -3.3505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2354 3.6896 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6752 -11.7267 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4020 -1.6752 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.2052 -1.6752 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 3 1 0 0 0 0 2 4 1 0 0 0 0 3 15 2 0 0 0 0 4 17 2 0 0 0 0 5 12 1 0 0 0 0 6 11 1 0 0 0 0 6 13 1 0 0 0 0 7 12 1 0 0 0 0 7 14 1 0 0 0 0 8 13 1 0 0 0 0 8 14 1 0 0 0 0 9 16 2 0 0 0 0 9 20 1 0 0 0 0 10 18 1 0 0 0 0 10 21 1 0 0 0 0 11 5 1 1 0 0 0 11 18 1 0 0 0 0 12 21 1 6 0 0 0 13 21 1 6 0 0 0 14 24 1 1 0 0 0 15 16 1 0 0 0 0 15 17 1 0 0 0 0 16 19 1 0 0 0 0 17 20 1 0 0 0 0 18 22 2 0 0 0 0 19 23 2 0 0 0 0 19 24 1 0 0 0 0 20 31 1 0 0 0 0 25 29 1 0 0 0 0 26 29 1 0 0 0 0 26 32 1 0 0 0 0 27 29 2 0 0 0 0 28 29 2 0 0 0 0 30 33 1 0 0 0 0 30 34 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	324.15
ALogP	-1.3246
MLogP	3
XLogP	2.55
HDA	5
HBD	1
Rotatable Bonds	3
TPSA	62.4
RO5 Violation	0