Drug Information| Drug ID:   | NPD8072 |
| Drug Name:   | pentagastrin |
| Molecular Formula:   | C37H49N7O9S |
| Canonical SMILES:   | CSCC[C@@H](C(=N[C@H](C(=N[C@H](C(=N)O)Cc1ccccc1)O)CC(=O)O)O)N=C([C@H](Cc1c[nH]c2c1cccc2)N=C(CCN=C(OCC(C)C)O)O)O |
| Standard InCHI:   | "InChI=1S/C37H49N7O9S/c1-22(2)21-53-37(52)39-15-13-31(45)41-29(18-24-20-40-26-12-8-7-11-25(24)26)35(50)42-27(14-16-54-3)34(49)44-30(19-32(46)47)36(51)43-28(33(38)48)17-23-9-5-4-6-10-23/h4-12,20,22,27-30,40H,13-19,21H2,1-3H3,(H2,38,48)(H,39,52)(H,41,45)(H,42,50)(H,43,51)(H,44,49)(H,46,47)/t27-,28-,29-,30-/m0/s1" |
| Standard InCHIKey:   | ALXRNCVIQSDJAO-KRCBVYEFSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD8072Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5338 | NPC153400 |
| Molecular Weight   | 767.33 |
| ALogP   | -0.2446 |
| MLogP   | 3.66 |
| XLogP   | 6.052 |
| HDA   | 16 |
| HBD   | 9 |
| Rotatable Bonds   | 33 |
| TPSA   | 294.65 |
| RO5 Violation   | 4 |