NPASS drugs

Drug Information

Drug ID:	NPD2189
Drug Name:	Tegaserod
Molecular Formula:	C16H23N5O
Canonical SMILES:	CCCCCNC(=N)N/N=C/c1c[nH]c2c1cc(OC)cc2
Standard InCHI:	InChI=1S/C16H23N5O/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21)/b20-11+
Standard InCHIKey:	IKBKZGMPCYNSLU-RGVLZGJSSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2189

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	538
0.1-0.2	4011
0.2-0.3	8812
0.3-0.4	10075
0.4-0.5	4374
0.5-0.6	1768
0.6-0.7	1030
0.7-0.8	261
0.8-0.85	14
0.85-0.9	3
0.9-0.95	3
0.95-1	1

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC476465
High Similarity	0.913	NPC76748
High Similarity	0.9081	NPC92111
High Similarity	0.9076	NPC296527
High Similarity	0.8984	NPC307963
High Similarity	0.8691	NPC251090
High Similarity	0.8513	NPC176538
Intermediate Similarity	0.8404	NPC176127
Intermediate Similarity	0.8368	NPC171171
Intermediate Similarity	0.836	NPC204717

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD2189 OpenBabel08211701392D 26 27 0 0 0 0 0 0 0 0999 V2000 0.1533 9.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4152 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5158 8.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2068 7.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8760 7.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -0.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5669 6.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 1.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9271 4.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0511 4.2633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2361 5.4223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2872 2.7770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5962 3.7281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.5491 1.8090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7202 5.0064 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2142 5.6302 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 -0.9511 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5743 3.9360 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 22 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 8 1 0 0 0 0 6 7 2 0 0 0 0 6 13 1 0 0 0 0 7 15 1 0 0 0 0 8 18 1 0 0 0 0 9 13 2 0 0 0 0 9 14 1 0 0 0 0 10 12 2 0 0 0 0 10 19 1 0 0 0 0 11 12 1 0 0 0 0 11 20 2 0 0 0 0 12 14 1 0 0 0 0 13 22 1 0 0 0 0 14 15 2 0 0 0 0 15 19 1 0 0 0 0 16 17 2 0 0 0 0 16 18 1 0 0 0 0 16 21 1 0 0 0 0 17 23 1 0 0 0 0 18 24 1 0 0 0 0 19 25 1 0 0 0 0 20 21 1 0 0 0 0 21 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001526
DrugBank	DB01079
ChEMBL	CHEMBL76370
IUPHAR/BPS
PharmaGKB	PA130413154
KEGG Drug	D06056
PubChem CID
ChEBI	51043
CAS Number	145158-71-0

Drug Properties

Molecular Weight	301.19
ALogP	-1.777
MLogP	2.56
XLogP	4.6
HDA	5
HBD	4
Rotatable Bonds	11
TPSA	85.29
RO5 Violation	0