NPASS drugs

Drug Information

Drug ID:	NPD4184
Drug Name:
Molecular Formula:	C20H28N4O4
Canonical SMILES:	CN=C([C@H](Cc1c[nH]c2c1cccc2)N=C([C@@H](CC(=NO)O)CC(C)C)O)O
Standard InCHI:	"InChI=1S/C20H28N4O4/c1-12(2)8-13(10-18(25)24-28)19(26)23-17(20(27)21-3)9-14-11-22-16-7-5-4-6-15(14)16/h4-7,11-13,17,22,28H,8-10H2,1-3H3,(H,21,27)(H,23,26)(H,24,25)/t13-,17+/m1/s1"
Standard InCHIKey:	NITYDPDXAAFEIT-DYVFJYSZSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4184

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	119629
0.1-0.2	86935
0.2-0.3	3930
0.3-0.4	1033
0.4-0.5	192
0.5-0.6	15
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6176	NPC49954
Remote Similarity	0.6129	NPC59269
Remote Similarity	0.6061	NPC203282
Remote Similarity	0.5909	NPC282231
Remote Similarity	0.5735	NPC279918
Remote Similarity	0.5652	NPC54988
Remote Similarity	0.5541	NPC228835
Remote Similarity	0.5507	NPC63751
Remote Similarity	0.5342	NPC192615
Remote Similarity	0.5325	NPC160105
Remote Similarity	0.5301	NPC314603
Remote Similarity	0.5286	NPC263183
Remote Similarity	0.5278	NPC11126
Remote Similarity	0.5244	NPC304804
Remote Similarity	0.5231	NPC515922
Remote Similarity	0.5176	NPC34779
Remote Similarity	0.5143	NPC553095
Remote Similarity	0.5059	NPC564171

Drug Structure

NPD4184 OpenBabel08211704332D 33 34 0 0 1 0 0 0 0 0999 V2000 -1.6473 -1.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0074 0.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2361 -5.4223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 -1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 -0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -1.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 0.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2946 -0.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 -2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5817 -1.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 -0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3164 -0.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6036 -1.4986 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 -1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 -0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2872 -2.7770 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2509 -0.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9344 -2.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5962 -3.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9271 -4.4712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.9563 -2.0339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.9418 -0.0123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.2290 -1.1713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2435 -3.1928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5743 -3.9360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6110 0.7308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 0.9511 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8981 -0.4282 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2216 -3.4007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8833 -4.8870 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3019 1.6819 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 1 0 0 0 0 2 12 1 0 0 0 0 3 21 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 7 1 0 0 0 0 6 15 2 0 0 0 0 7 16 2 0 0 0 0 8 12 1 0 0 0 0 9 14 1 0 0 0 0 10 13 1 0 0 0 0 10 18 1 0 0 0 0 11 14 2 0 0 0 0 11 22 1 0 0 0 0 13 8 1 1 0 0 0 13 19 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 22 1 0 0 0 0 17 9 1 1 0 0 0 17 20 1 0 0 0 0 17 23 1 0 0 0 0 18 24 2 3 0 0 0 18 25 1 0 0 0 0 19 23 2 3 0 0 0 19 26 1 0 0 0 0 20 21 2 3 0 0 0 20 27 1 0 0 0 0 22 29 1 0 0 0 0 24 28 1 0 0 0 0 25 30 1 0 0 0 0 26 31 1 0 0 0 0 27 32 1 0 0 0 0 28 33 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DPR000165; DNC003010; DNC003714
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	132519
ChEBI
CAS Number

Drug Properties

Molecular Weight	388.21
ALogP	-0.5848
MLogP	2.78
XLogP	3.588
HDA	6
HBD	5
Rotatable Bonds	16
TPSA	133.79
RO5 Violation	0