NPASS Compound

Natural Product: NPC477638

Natural Product ID	NPC477638
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Cycloviolin C
IUPAC Name	3-[(1R,4R,7S,13R,16S,22S,28S,31S,34S,37R,40S,43S,46S,49S,52R,55S,58R,64S,67S,70S,73S,76S,79R,82S,88S,91S,94S)-43,49-bis(4-aminobutyl)-28,46-bis(2-amino-2-oxoethyl)-91-benzyl-22,88-bis[(2S)-butan-2-yl]-31-(3-carbamimidamidopropyl)-70,73-bis[(1R)-1-hydroxyethyl]-4,55-bis(hydroxymethyl)-34-[(4-hydroxyphenyl)methyl]-64-methyl-76-(2-methylpropyl)-3,6,9,12,15,21,24,27,30,33,36,39,42,45,48,51,54,57,60,63,66,69,72,75,78,81,87,90,93,96-triacontaoxo-40,67,94-tri(propan-2-yl)-2a,3a,6a,7a,98,99-hexathia-2,5,8,11,14,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71,74,77,80,86,89,92,95-triacontazahexacyclo[50.44.4.413,58.437,79.016,20.082,86]octahectan-7-yl]propanoic acid
Synonyms	Cycloviolin C
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44592647
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0003297] Organic Polymers [CHEMONTID:0003298] Polypeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 424431 0 0 0 0 0 0 0 0999 V2000 5.6812 14.3619 4.3202 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9887 13.0281 3.6035 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9235 12.0156 3.9223 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8968 11.7232 5.4024 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6216 10.9176 3.0154 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4731 9.8346 2.6209 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0069 8.6336 2.6890 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8017 9.7629 2.1491 N 0 0 0 0 0 0 0 0 0 0 0 0 7.7306 10.8233 2.0405 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8647 10.2728 1.1778 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8509 8.8006 1.5307 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3614 8.5517 1.7028 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2088 7.2786 2.4761 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5214 7.1389 3.6458 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6704 6.0820 1.9036 N 0 0 0 0 0 0 0 0 0 0 0 0 6.7945 4.8136 2.5271 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6250 3.8453 2.2608 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2228 2.2842 2.9470 S 0 0 0 0 0 0 0 0 0 0 0 0 6.0129 2.1400 5.0175 S 0 0 0 0 0 0 0 0 0 0 0 0 4.4736 1.1362 5.2915 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9609 -0.3027 5.0930 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6323 -0.4104 3.7775 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8773 -0.2575 3.7062 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9126 -0.7013 2.5836 N 0 0 0 0 0 0 0 0 0 0 0 0 5.5253 -0.7494 1.2764 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4652 -1.0517 0.2746 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3038 -1.4192 0.7018 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6459 -0.9512 -1.1045 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7693 -1.2479 -2.1858 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4545 -1.8605 -1.7419 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6152 -3.5370 -1.1240 S 0 0 0 0 0 0 0 0 0 0 0 0 4.4947 -4.0965 -0.6486 S 0 0 0 0 0 0 0 0 0 0 0 0 5.5488 -4.9499 -1.6583 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1170 -4.5506 -2.9573 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1288 -4.5763 -4.1084 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9623 -3.5922 -4.8168 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3969 -5.7629 -4.3633 N 0 0 0 0 0 0 0 0 0 0 0 0 3.5137 -6.0458 -5.4440 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4089 -6.9377 -5.1076 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8111 -7.5650 -6.1045 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8672 -7.2309 -3.8434 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8027 -8.2776 -3.6716 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5296 -7.7013 -3.5920 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5952 -6.4236 -3.7353 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7603 -8.3221 -3.3838 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.0689 -7.7001 -3.4631 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8567 -7.5482 -2.2588 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0736 -7.1381 -2.4254 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5245 -7.7762 -0.9138 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2531 -8.0786 -0.2916 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6859 -9.2338 0.6113 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0267 -8.7852 1.1390 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4644 -7.6864 0.1981 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4290 -6.3618 0.8233 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3772 -5.9504 1.4187 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5129 -5.4456 0.8463 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.3864 -4.1435 1.4275 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7554 -3.1024 0.3989 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5677 -1.4480 1.1772 S 0 0 0 0 0 0 0 0 0 0 0 0 -5.9157 0.1150 -0.1687 S 0 0 0 0 0 0 0 0 0 0 0 0 -7.6119 0.6109 -0.2267 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8540 1.8314 -1.0517 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0654 2.9947 -0.4578 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3174 2.8421 0.5060 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1343 4.3318 -0.9542 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.2134 5.2758 -0.5002 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7304 6.5568 0.1664 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8778 6.9087 0.1756 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7937 7.3410 0.8210 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7061 8.6706 1.2616 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3526 9.1421 0.8513 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6277 8.3698 0.2127 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7959 10.3766 1.1139 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4349 10.6755 0.6354 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4717 10.4104 1.7597 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8928 10.0124 2.8379 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0698 10.5846 1.6855 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7524 10.2891 2.7984 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1675 10.6262 2.4870 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4305 11.0883 1.3818 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2541 10.4635 3.3447 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2575 12.0006 0.0030 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1246 12.1586 -1.1687 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9270 11.2477 -1.4935 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0741 13.3356 -1.9476 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.0803 9.0924 2.6077 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5404 8.9242 2.9392 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4205 9.7380 1.9938 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0944 11.1255 1.8963 N 0 0 0 0 0 0 0 0 0 0 0 0 -8.7977 11.9580 1.0153 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1305 11.8885 0.9988 N 0 0 0 0 0 0 0 0 0 0 0 0 -8.1287 12.8924 0.1367 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.5622 5.9309 -1.7844 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6931 6.5616 -2.5263 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0821 7.8568 -2.2411 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1839 8.4623 -2.8767 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9046 7.7811 -3.7967 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5290 6.4839 -4.0929 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4476 5.9053 -3.4664 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0111 8.3208 -4.4735 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3427 1.7453 -2.4157 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.8629 2.2459 -3.5873 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9842 2.8953 -3.4461 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4101 2.1971 -4.9785 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3382 1.3151 -5.3308 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.9546 1.6220 -5.4548 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5447 2.7071 -5.0223 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0000 0.6648 -6.0895 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6140 0.9476 -5.8386 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.8638 1.8965 -6.5583 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6429 2.5294 -7.4108 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4986 2.3073 -6.5516 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4492 1.4694 -5.7774 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7614 1.9028 -5.5593 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9523 3.1310 -5.9729 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9190 1.2931 -4.9811 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8564 0.0888 -4.2335 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6289 -0.0957 -3.0569 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3098 0.9543 -2.7335 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8726 0.9069 -6.1792 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1244 0.2691 -5.6955 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0883 -0.0815 -6.7784 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5445 -1.0430 -7.7981 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4351 -0.5343 -8.5246 N 0 0 0 0 0 0 0 0 0 0 0 0 0.1377 2.1508 -7.9834 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1057 0.7157 -8.3445 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3892 -0.1514 -7.5472 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5966 0.2187 -9.5735 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.3940 -0.7656 -5.9974 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3804 -1.6295 -6.7417 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3056 -1.2574 -8.1914 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6274 -1.4504 -8.8988 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0267 -2.8223 -8.8095 N 0 0 0 0 0 0 0 0 0 0 0 0 -8.5809 1.8857 -5.8761 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1075 1.8239 -7.3240 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2186 0.5342 -5.5733 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1592 -3.9068 2.6567 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2612 -2.7309 3.0265 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8113 -4.8169 3.5195 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.5475 -4.2831 4.6521 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7169 -4.1971 5.8995 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0367 -3.3459 6.7428 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6130 -5.0010 6.2218 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.8443 -4.7586 7.3855 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6237 -5.5646 7.5867 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3859 -6.6278 7.0063 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6069 -5.1705 8.4699 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5306 -6.0103 8.8933 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7975 -5.3311 9.9991 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0504 -4.1248 10.2119 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1514 -5.8712 10.8523 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8536 -4.9300 11.7529 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3135 -5.0739 11.3623 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9463 -6.0533 11.7038 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9699 -4.1179 10.5957 N 0 0 0 0 0 0 0 0 0 0 0 0 4.3464 -4.2949 10.1702 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9291 -3.1555 9.4689 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3156 -2.1033 9.3664 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1960 -3.1525 8.8580 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6834 -1.9901 8.1550 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7899 -1.6062 7.0119 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7816 -2.3011 6.8391 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9729 -0.5478 6.1198 N 0 0 0 0 0 0 0 0 0 0 0 0 4.2889 -5.4348 9.0670 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6668 -5.4443 13.1557 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3274 -4.5678 14.1903 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8064 -5.6149 13.4908 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4755 -6.2320 7.7704 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2604 -4.9674 7.4770 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4485 -7.1087 8.3637 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7370 -5.2014 8.6274 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0467 -6.6536 8.3698 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9406 -4.9472 9.7110 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6937 -5.2093 5.0055 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6694 -5.4107 3.8808 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3402 -4.1519 3.4551 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7193 -6.4023 4.3171 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8300 -8.5300 -4.5190 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2048 -8.0229 -4.7599 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9948 -8.5400 -5.7680 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5765 -9.3321 -6.8901 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3141 -9.2669 -2.6958 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4632 -10.4285 -2.4578 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4216 -11.3306 -3.5355 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2639 -12.4875 -3.4001 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9338 -12.8136 -2.2322 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9065 -11.9494 -1.1640 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1968 -10.7572 -1.3044 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2831 -6.4975 -6.6881 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1737 -7.6651 -6.5253 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9296 -5.4014 -7.4434 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8851 -3.3483 -3.0317 N 0 0 0 0 0 0 0 0 0 0 0 0 8.1888 -3.3262 -3.5326 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6319 -4.4634 -3.8501 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1439 -2.2146 -3.7666 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7846 -0.9131 -3.3747 N 0 0 0 0 0 0 0 0 0 0 0 0 9.4571 -0.1369 -2.3969 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4125 -0.7186 -1.8849 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0815 1.2192 -1.9980 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9006 1.5847 -0.7819 N 0 0 0 0 0 0 0 0 0 0 0 0 9.2334 2.1098 0.3114 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0038 2.2178 0.1600 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8316 2.5476 1.6217 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7236 3.0624 2.4545 N 0 0 0 0 0 0 0 0 0 0 0 0 8.0202 4.1339 1.9416 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4600 4.5843 0.8589 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2967 2.3447 -2.9565 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6393 2.7531 -3.3343 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5939 1.9025 -3.9905 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4063 0.7438 -4.3587 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8879 2.4100 -4.2601 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3967 -2.3475 -5.3007 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3973 -1.5751 -5.7743 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4450 -2.0138 1.3325 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0993 -2.2074 0.1450 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2826 14.5130 5.2212 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9573 15.1516 3.5981 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6162 14.3671 4.5862 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9557 12.7436 4.0256 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0453 13.2736 2.5390 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9575 12.6985 3.8346 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9634 12.1358 5.8145 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7180 12.2649 5.9387 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9114 10.6530 5.5437 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4178 11.4724 1.9794 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2680 11.6450 1.4238 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1532 11.1755 3.0031 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8436 10.6523 1.5232 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6949 10.3675 0.1177 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3807 8.5822 2.4678 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2481 8.1976 0.7178 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9413 8.3591 0.6558 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1899 6.2308 1.0450 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9903 4.8579 3.5775 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4289 3.7019 1.1963 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7843 4.2004 2.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0478 1.3006 6.2699 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7568 1.4454 4.5147 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1351 -1.0098 5.1223 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8563 -0.8854 2.6892 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1861 0.0798 1.0529 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6116 -0.5810 -1.4045 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2040 -2.1343 -2.7822 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8844 -1.2369 -1.0609 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7802 -1.9142 -2.6757 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5126 -5.2276 -1.0159 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1875 -6.0775 -1.7496 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8376 -5.4223 -3.3037 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4976 -6.5584 -3.6554 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1025 -5.0206 -5.7706 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1754 -6.7347 -2.9956 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8072 -8.7984 -4.6887 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7761 -9.3482 -3.1716 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8962 -6.6940 -3.9737 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9669 -7.2242 0.3495 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4812 -8.3286 -1.0048 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7899 -10.1836 0.0277 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9889 -9.3610 1.4406 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7678 -9.6084 1.0179 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9829 -8.4860 2.1972 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5097 -7.8562 -0.1547 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4004 -5.7770 0.3942 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2711 -3.9536 1.6549 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1497 -3.1948 -0.5187 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8572 -3.1656 0.2195 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1065 0.7481 0.7731 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1850 -0.2082 -0.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9002 2.1855 -1.1115 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9007 4.4830 -1.5731 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4149 4.9112 0.1677 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9154 6.7372 1.0785 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4203 9.3136 0.5648 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2776 11.0661 1.6465 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1264 9.8645 -0.1190 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2778 10.9151 0.8071 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4336 10.8685 3.7121 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7502 9.1805 3.0529 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1281 10.0223 4.2261 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1733 12.0313 -0.3964 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3239 12.8391 0.7247 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1352 13.7309 -2.2457 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8942 13.8660 -2.2784 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4330 8.7135 3.4079 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8938 10.2145 2.6537 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7923 9.2643 3.9742 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8815 7.8481 2.7938 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5368 9.2701 1.0091 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5024 9.6815 2.4092 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3444 11.5478 2.4779 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4893 12.6295 0.2324 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6882 13.3328 -0.6115 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1071 13.1042 0.2454 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8422 6.6480 -1.4244 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1813 5.0916 -2.3770 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5207 8.4528 -1.5419 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4606 9.4805 -2.6072 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1361 5.9641 -4.8410 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1459 4.9184 -3.7204 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4280 7.8544 -5.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4180 1.2116 -2.5129 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1105 3.2690 -5.2389 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6227 0.3141 -5.4927 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1807 0.9326 -7.2203 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1343 0.4203 -5.0785 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2905 3.3817 -6.3768 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1258 0.5683 -5.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5545 2.0588 -4.4553 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2390 -0.6581 -4.5497 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0241 1.8380 -6.7262 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2427 0.2415 -6.7943 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9679 -0.6145 -5.0005 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6560 1.0328 -5.0496 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0333 -0.4741 -6.3240 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4064 0.8358 -7.3531 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3562 -2.0447 -7.3627 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3790 -1.1730 -8.5399 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6440 0.3164 -9.0692 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8838 -1.2456 -9.0279 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1337 2.5610 -8.0228 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5302 2.6829 -8.6909 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7155 -0.7924 -9.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8540 0.9083 -10.2906 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3928 -1.1038 -4.9322 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4317 -0.9349 -6.4280 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4265 -1.5673 -6.2348 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7103 -2.7045 -6.7324 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9998 -0.2024 -8.3803 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4917 -1.8628 -8.6410 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3527 -0.7371 -8.4295 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5269 -1.1072 -9.9696 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5518 -3.3832 -9.5459 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0813 -2.9512 -8.8700 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4155 2.6120 -5.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9857 1.7827 -7.9772 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4464 0.9881 -7.4321 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5484 2.7901 -7.4930 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1094 0.5148 -6.2565 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5642 0.5289 -4.5089 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5405 -0.2608 -5.8716 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7574 -5.7819 3.3395 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9353 -3.2806 4.4802 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4083 -5.7305 5.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7022 -3.6675 7.5378 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6837 -4.2109 8.8020 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8034 -7.0226 9.1530 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3467 -6.8428 10.8750 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4947 -3.9162 11.6793 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4543 -3.2888 10.3433 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9496 -4.7450 10.9413 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7455 -3.9800 8.9500 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6789 -2.2026 7.6970 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7793 -1.1153 8.8029 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7731 0.0262 6.1596 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1553 -4.9460 8.1134 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4466 -6.0974 9.3362 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2486 -5.9687 9.1009 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1240 -6.4703 13.2095 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7810 -5.1741 15.0147 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1197 -3.9674 13.7063 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5530 -3.9152 14.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0914 -5.1666 14.4397 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4448 -5.2289 12.6601 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9981 -6.7163 13.5592 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9357 -6.7413 6.9279 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3218 -4.0518 7.4903 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1305 -4.8204 8.1871 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8049 -5.1350 6.4983 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3580 -8.0419 8.0493 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6290 -4.5552 8.5827 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5245 -6.7704 7.3426 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1178 -7.2373 8.4388 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8341 -6.9743 9.0883 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1458 -4.0537 10.0893 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2736 -4.7930 5.8757 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3840 -6.2285 5.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1214 -5.9156 3.0397 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0702 -3.3374 4.1722 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0223 -3.8184 2.4468 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4547 -4.3225 3.4335 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9594 -6.3149 5.4129 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6728 -6.2353 3.7686 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3846 -7.4546 4.0788 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9116 -9.5879 -4.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2148 -6.8966 -4.7293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9178 -8.4897 -4.0609 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6001 -8.2486 -5.7832 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8889 -7.4770 -6.1786 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9655 -8.9417 -5.5717 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5344 -10.4271 -6.6160 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6154 -9.1318 -7.1345 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9421 -9.2426 -7.8137 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4754 -8.7757 -1.6746 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3021 -9.6438 -3.0596 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9365 -11.0660 -4.4744 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2583 -13.1656 -4.2670 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4914 -13.7459 -2.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4038 -12.2016 -0.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1068 -10.0628 -0.4620 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4264 -6.8757 -7.3754 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3695 -8.0379 -5.5134 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2232 -7.4028 -6.9255 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8619 -8.5437 -7.1142 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9721 -5.1664 -7.1153 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3221 -4.4440 -7.4188 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9963 -5.5974 -8.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5162 -2.4625 -2.7298 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1745 -2.5189 -3.3696 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9880 -0.4261 -3.7805 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9957 1.2085 -1.7346 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8702 1.4713 -0.7918 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6163 3.2829 1.4848 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2171 1.6468 2.1175 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5251 2.6519 3.3354 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6456 2.1149 -3.8467 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7982 3.2650 -2.4381 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1366 3.3490 -2.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4900 3.6334 -4.0951 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6532 1.7590 -4.3188 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4470 -2.3475 -5.8619 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7434 -3.4223 -5.3634 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0837 -0.7390 -6.2107 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8026 -2.8574 1.5612 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1587 -1.8708 2.1774 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6072 -1.3911 -0.0578 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 2 0 43 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 47 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 2 0 54 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 65 66 1 0 66 67 1 0 67 68 2 0 67 69 1 0 69 70 1 0 70 71 1 0 71 72 2 0 71 73 1 0 73 74 1 0 74 75 1 0 75 76 2 0 75 77 1 0 77 78 1 0 78 79 1 0 79 80 2 0 79 81 1 0 74 82 1 0 82 83 1 0 83 84 2 0 83 85 1 0 70 86 1 0 86 87 1 0 87 88 1 0 88 89 1 0 89 90 1 0 90 91 2 3 90 92 1 0 66 93 1 0 93 94 1 0 94 95 2 0 95 96 1 0 96 97 2 0 97 98 1 0 98 99 2 0 97100 1 0 62101 1 0 101102 1 0 102103 2 0 102104 1 0 104105 1 0 105106 1 0 106107 2 0 106108 1 0 108109 1 0 109110 1 0 110111 2 0 110112 1 0 112113 1 0 113114 1 0 114115 2 0 114116 1 0 116117 1 0 117118 1 0 118119 2 0 116120 1 0 120121 1 0 121122 1 0 122123 1 0 123124 1 0 112125 1 0 125126 1 0 126127 2 0 126128 1 0 108129 1 0 129130 1 0 130131 1 0 131132 1 0 132133 1 0 104134 1 0 134135 1 0 134136 1 0 57137 1 0 137138 2 0 137139 1 0 139140 1 0 140141 1 0 141142 2 0 141143 1 0 143144 1 0 144145 1 0 145146 2 0 145147 1 0 147148 1 0 148149 1 0 149150 2 0 149151 1 0 151152 1 0 152153 1 0 153154 2 0 153155 1 0 155156 1 0 156157 1 0 157158 2 0 157159 1 0 159160 1 0 160161 1 0 161162 2 0 161163 1 0 156164 1 0 152165 1 0 165166 1 0 165167 1 0 148168 1 0 168169 1 0 168170 1 0 144171 1 0 171172 1 0 171173 1 0 140174 1 0 174175 1 0 175176 1 0 175177 1 0 46178 1 0 178179 1 0 178180 1 0 180181 1 0 42182 1 0 182183 1 0 183184 2 0 184185 1 0 185186 2 0 186187 1 0 187188 2 0 38189 1 0 189190 1 0 189191 1 0 34192 1 0 192193 1 0 193194 2 0 193195 1 0 195196 1 0 196197 1 0 197198 2 0 197199 1 0 199200 1 0 200201 1 0 201202 2 0 201203 1 0 203204 1 0 204205 1 0 205206 2 0 199207 1 0 207208 1 0 208209 1 0 209210 2 0 209211 1 0 195212 1 0 212213 1 0 25214 1 0 214215 1 0 81 5 1 0 12 8 1 0 205 16 1 0 163 21 1 0 118 29 1 0 53 49 1 0 99 94 1 0 188183 1 0 1216 1 0 1217 1 0 1218 1 0 2219 1 0 2220 1 0 3221 1 1 4222 1 0 4223 1 0 4224 1 0 5225 1 6 9226 1 0 9227 1 0 10228 1 0 10229 1 0 11230 1 0 11231 1 0 12232 1 6 15233 1 0 16234 1 1 17235 1 0 17236 1 0 20237 1 0 20238 1 0 21239 1 6 24240 1 0 25241 1 6 28242 1 0 29243 1 6 30244 1 0 30245 1 0 33246 1 0 33247 1 0 34248 1 6 37249 1 0 38250 1 6 41251 1 0 42252 1 6 45253 1 0 46254 1 6 50255 1 0 50256 1 0 51257 1 0 51258 1 0 52259 1 0 52260 1 0 53261 1 6 56262 1 0 57263 1 1 58264 1 0 58265 1 0 61266 1 0 61267 1 0 62268 1 6 65269 1 0 66270 1 1 69271 1 0 70272 1 6 73273 1 0 74274 1 6 77275 1 0 78276 1 0 78277 1 0 81278 1 0 82279 1 0 82280 1 0 85281 1 0 85282 1 0 86283 1 0 86284 1 0 87285 1 0 87286 1 0 88287 1 0 88288 1 0 89289 1 0 91290 1 0 92291 1 0 92292 1 0 93293 1 0 93294 1 0 95295 1 0 96296 1 0 98297 1 0 99298 1 0 100299 1 0 101300 1 0 104301 1 6 105302 1 0 108303 1 6 109304 1 0 112305 1 1 113306 1 0 116307 1 1 117308 1 0 120309 1 0 120310 1 0 121311 1 0 121312 1 0 122313 1 0 122314 1 0 123315 1 0 123316 1 0 124317 1 0 124318 1 0 125319 1 0 125320 1 0 128321 1 0 128322 1 0 129323 1 0 129324 1 0 130325 1 0 130326 1 0 131327 1 0 131328 1 0 132329 1 0 132330 1 0 133331 1 0 133332 1 0 134333 1 0 135334 1 0 135335 1 0 135336 1 0 136337 1 0 136338 1 0 136339 1 0 139340 1 0 140341 1 6 143342 1 0 144343 1 1 147344 1 0 148345 1 1 151346 1 0 152347 1 1 155348 1 0 156349 1 1 159350 1 0 160351 1 0 160352 1 0 163353 1 0 164354 1 0 164355 1 0 164356 1 0 165357 1 0 166358 1 0 166359 1 0 166360 1 0 167361 1 0 167362 1 0 167363 1 0 168364 1 6 169365 1 0 169366 1 0 169367 1 0 170368 1 0 171369 1 1 172370 1 0 172371 1 0 172372 1 0 173373 1 0 174374 1 0 174375 1 0 175376 1 0 176377 1 0 176378 1 0 176379 1 0 177380 1 0 177381 1 0 177382 1 0 178383 1 1 179384 1 0 179385 1 0 179386 1 0 180387 1 0 180388 1 0 181389 1 0 181390 1 0 181391 1 0 182392 1 0 182393 1 0 184394 1 0 185395 1 0 186396 1 0 187397 1 0 188398 1 0 189399 1 0 190400 1 0 190401 1 0 190402 1 0 191403 1 0 191404 1 0 191405 1 0 192406 1 0 195407 1 1 196408 1 0 199409 1 1 200410 1 0 203411 1 0 203412 1 0 204413 1 0 207414 1 0 207415 1 0 208416 1 0 208417 1 0 211418 1 0 212419 1 0 212420 1 0 213421 1 0 214422 1 0 214423 1 0 215424 1 0 M END

Standard InCHIKey	KERWJIKEFRTRJG-HQBYQADJSA-N
Standard InCHI	InChI=1S/C133H209N37O39S6/c1-16-66(11)102-131(208)169-44-26-33-91(169)124(201)159-85-56-210-211-57-86-119(196)156-84(55-172)118(195)157-87-58-212-215-61-90(158-117(194)83(54-171)155-111(188)77(39-40-98(181)182)145-95(178)52-143-108(85)185)123(200)164-100(64(7)8)127(204)154-80(47-71-28-19-18-20-29-71)116(193)166-103(67(12)17-2)132(209)170-45-27-34-92(170)125(202)160-88(121(198)150-78(46-62(3)4)115(192)167-104(69(14)173)130(207)168-105(70(15)174)129(206)165-99(63(5)6)126(203)144-68(13)106(183)141-51-96(179)146-86)59-213-214-60-89(161-128(205)101(65(9)10)163-112(189)75(31-22-24-42-135)147-114(191)82(50-94(137)177)153-109(186)74(149-120(87)197)30-21-23-41-134)122(199)151-79(48-72-35-37-73(175)38-36-72)113(190)148-76(32-25-43-140-133(138)139)110(187)152-81(49-93(136)176)107(184)142-53-97(180)162-102/h18-20,28-29,35-38,62-70,74-92,99-105,171-175H,16-17,21-27,30-34,39-61,134-135H2,1-15H3,(H2,136,176)(H2,137,177)(H,141,183)(H,142,184)(H,143,185)(H,144,203)(H,145,178)(H,146,179)(H,147,191)(H,148,190)(H,149,197)(H,150,198)(H,151,199)(H,152,187)(H,153,186)(H,154,204)(H,155,188)(H,156,196)(H,157,195)(H,158,194)(H,159,201)(H,160,202)(H,161,205)(H,162,180)(H,163,189)(H,164,200)(H,165,206)(H,166,193)(H,167,192)(H,168,207)(H,181,182)(H4,138,139,140)/t66-,67-,68-,69+,70+,74-,75-,76-,77-,78-,79-,80-,81-,82-,83+,84-,85-,86-,87-,88-,89-,90-,91-,92-,99-,100-,101-,102-,103-,104-,105-/m0/s1
SMILES	CC[C@H](C)[C@H]1C(=O)N2CCC[C@H]2C(=O)N[C@H]3CSSC[C@H]4C(=O)N[C@H](C(=O)N[C@H]5CSSC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N6CCC[C@H]6C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N1)CC(=O)N)CCCNC(=N)N)CC7=CC=C(C=C7)O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC5=O)CCCCN)CC(=O)N)CCCCN)C(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N4)C)C(C)C)[C@@H](C)O)[C@@H](C)O)CC(C)C)[C@@H](C)CC)CC8=CC=CC=C8)C(C)C)NC(=O)[C@H](NC(=O)[C@@H](NC(=O)CNC3=O)CCC(=O)O)CO)CO

Calculated Properties

Physi-Chem Properties

Molecular Weight:	3140.38	Volume:	2995.766 ? Van der Waals volume.
Dense:	1.048	LogP:	-1.246 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.08 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.449 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	37.0	Rigid Bonds:	159.0
TPSA:	1193.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	76.0
H-Bond Donor:	46.0	Rings:	9.0
Heavy Atoms:	82.0

MedChem Properties

QED Drug-Likeness Score:	0.01	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	9.754	Fsp³:	0.654
MCE-18:	331.418 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.668	Fluc inhibitor:	0.334 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.334 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.667 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.792	Promiscuous compounds:	0.079

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.755	MDCK Permeability:	-5.057
Pgp-inhibitor:	1.0	Pgp-substrate:	0.218
PAMPA:	0.924 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.0
Plasma Protein Binding (PPB):	-47.589%	Volume Distribution (VD):	-0.874
Fu:	235.573% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.152

Half-life (T1/2):

10.808

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.0	Drug-induced Liver Injury (DILI):	0.001
AMES Toxicity:	0.0	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.063	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	1.0	Ototoxicity:	1.0
Hematotoxicity:	0.0	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.009
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.0
BCF:	0.131 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.559 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.441 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.155 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33585	Palicourea condensata	Species	Rubiaceae	Eukaryota	Bark	Pastaza, Ecuador	1988-MAR	PMID[11430013]
NPO33585	Palicourea condensata	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	2
IC50	1

Activity Type	# Activity
Organism	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	50	nM	PMID[11430013]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	130	nM	PMID[20718473]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	IC50	=	560	nM	PMID[20718473]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477638 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25525
0.1-0.2	23400
0.2-0.3	671
0.3-0.4	179
0.4-0.5	38
0.5-0.6	11
0.6-0.7	14
0.7-0.8	0
0.8-0.85	6
0.85-0.9	3
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.95	High Similarity	NPC477631
0.869	High Similarity	NPC477639
0.8643	High Similarity	NPC600735
0.8609	High Similarity	NPC610817
0.8252	Intermediate Similarity	NPC610870
0.8141	Intermediate Similarity	NPC477630
0.8138	Intermediate Similarity	NPC603072
0.8125	Intermediate Similarity	NPC604370
0.8054	Intermediate Similarity	NPC609634
0.8	Intermediate Similarity	NPC477637
0.7961	Intermediate Similarity	NPC610535
0.7898	Intermediate Similarity	NPC600998
0.7898	Intermediate Similarity	NPC611186
0.7843	Intermediate Similarity	NPC477636
0.7834	Intermediate Similarity	NPC610649
0.7727	Intermediate Similarity	NPC609988
0.7584	Intermediate Similarity	NPC606505
0.7436	Intermediate Similarity	NPC608521
0.7278	Intermediate Similarity	NPC610704
0.707	Intermediate Similarity	NPC607485
0.6937	Remote Similarity	NPC610952
0.6829	Remote Similarity	NPC601264
0.6703	Remote Similarity	NPC607866
0.6667	Remote Similarity	NPC605666
0.6446	Remote Similarity	NPC607892
0.642	Remote Similarity	NPC600580
0.642	Remote Similarity	NPC605764
0.642	Remote Similarity	NPC605765
0.6343	Remote Similarity	NPC611556
0.6221	Remote Similarity	NPC605177
0.6185	Remote Similarity	NPC611013
0.6176	Remote Similarity	NPC600008
0.6176	Remote Similarity	NPC603103
0.6176	Remote Similarity	NPC604252
0.5988	Remote Similarity	NPC600634
0.5673	Remote Similarity	NPC601582
0.5673	Remote Similarity	NPC603992
0.5673	Remote Similarity	NPC610984
0.5652	Remote Similarity	NPC603135
0.5503	Remote Similarity	NPC610756
0.5475	Remote Similarity	NPC607277
0.5412	Remote Similarity	NPC608676
0.5168	Remote Similarity	NPC606523
0.5072	Remote Similarity	NPC603507
0.5027	Remote Similarity	NPC603201

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477638 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4577
0.1-0.2	4525
0.2-0.3	48
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data