Drug Information| Drug ID:   | NPD7617 |
| Drug Name:   | 443C81 |
| Molecular Formula:   | C31H42N10O8 |
| Canonical SMILES:   | NC(=N)NCCC[C@@H](C(=NCC(=N[C@H](C(=O)N1CCC[C@H]1C(=N)O)Cc1ccc(cc1)N(=O)=O)O)O)N=C([C@@H](Cc1ccc(cc1)O)N)O |
| Standard InCHI:   | "InChI=1S/C31H42N10O8/c32-22(15-18-7-11-21(42)12-8-18)28(45)39-23(3-1-13-36-31(34)35)29(46)37-17-26(43)38-24(16-19-5-9-20(10-6-19)41(48)49)30(47)40-14-2-4-25(40)27(33)44/h5-12,22-25,42H,1-4,13-17,32H2,(H2,33,44)(H,37,46)(H,38,43)(H,39,45)(H4,34,35,36)/t22-,23+,24+,25+/m1/s1" |
| Standard InCHIKey:   | KCFHMBXKJQJYFK-ROHNOIKCSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7617Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5047 | NPC267237 |
| Molecular Weight   | 682.32 |
| ALogP   | -3.815 |
| MLogP   | 2.89 |
| XLogP   | 1.915 |
| HDA   | 14 |
| HBD   | 10 |
| Rotatable Bonds   | 27 |
| TPSA   | 313.45 |
| RO5 Violation   | 3 |