NPASS drugs

Drug Information

Drug ID:	NPD484
Drug Name:	Oxitriptan
Molecular Formula:	C11H12N2O3
Canonical SMILES:	OC(=O)[C@H](Cc1c[nH]c2c1cc(O)cc2)N
Standard InCHI:	InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1
Standard InCHIKey:	LDCYZAJDBXYCGN-VIFPVBQESA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD484

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	278
0.1-0.2	2106
0.2-0.3	10058
0.3-0.4	7907
0.4-0.5	6949
0.5-0.6	1737
0.6-0.7	1209
0.7-0.8	563
0.8-0.85	53
0.85-0.9	20
0.9-0.95	7
0.95-1	3

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC45459
High Similarity	1.0	NPC315491
High Similarity	0.9558	NPC213308
High Similarity	0.9392	NPC156704
High Similarity	0.9251	NPC88008
High Similarity	0.9157	NPC314002
High Similarity	0.9153	NPC220765
High Similarity	0.9101	NPC204717
High Similarity	0.9091	NPC476098
High Similarity	0.9	NPC171171

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD484 OpenBabel08201723202D 21 22 0 0 1 0 0 0 0 0999 V2000 2.6831 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 -0.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8171 1.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2872 2.7770 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9511 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5962 3.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9563 2.0339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.5491 1.8090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9271 4.4712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5743 3.9360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9344 2.2418 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6473 1.0828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 -0.9511 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4152 1.3090 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8833 4.8870 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 7 1 0 0 0 0 2 10 1 0 0 0 0 3 6 1 0 0 0 0 4 7 2 0 0 0 0 4 8 1 0 0 0 0 5 6 2 0 0 0 0 5 13 1 0 0 0 0 6 8 1 0 0 0 0 7 14 1 0 0 0 0 8 10 2 0 0 0 0 9 3 1 6 0 0 0 9 11 1 0 0 0 0 9 12 1 0 0 0 0 10 13 1 0 0 0 0 11 15 2 0 0 0 0 11 16 1 0 0 0 0 12 17 1 0 0 0 0 12 18 1 0 0 0 0 13 19 1 0 0 0 0 14 20 1 0 0 0 0 16 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB02959
ChEMBL	CHEMBL350221
IUPHAR/BPS
PharmaGKB
KEGG Drug	D07339
PubChem CID
ChEBI	58266
CAS Number

Drug Properties

Molecular Weight	220.08
ALogP	-1.9651
MLogP	2.12
XLogP	-2.134
HDA	4
HBD	4
Rotatable Bonds	6
TPSA	99.34
RO5 Violation	0