Drug Information| Drug ID:   | NPD7953 |
| Drug Name:   | Dihydroergocristine |
| Molecular Formula:   | C35H41N5O5 |
| Canonical SMILES:   | CN1C[C@@H](C[C@H]2[C@H]1Cc1c[nH]c3c1c2ccc3)C(=N[C@@]1(O[C@@]2(N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1[C@H]2CCC1)O)C(C)C)O |
| Standard InCHI:   | "InChI=1S/C35H41N5O5/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30(24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-21)32(42)39-14-8-13-29(39)35(40,44)45-34/h4-7,9-12,18,20,23,25,27-29,36,44H,8,13-17,19H2,1-3H3,(H,37,41)/t23-,25-,27-,28+,29+,34-,35+/m1/s1" |
| Standard InCHIKey:   | DEQITUUQPICUMR-HJPBWRTMSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7953Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7358 | NPC56109 |
| Intermediate Similarity | 0.7358 | NPC306412 |
| Intermediate Similarity | 0.7358 | NPC203217 |
| Remote Similarity | 0.6786 | NPC557604 |
| Remote Similarity | 0.6577 | NPC273359 |
| Remote Similarity | 0.6577 | NPC191382 |
| Remote Similarity | 0.6126 | NPC155444 |
| Remote Similarity | 0.6126 | NPC224542 |
| Remote Similarity | 0.6126 | NPC137993 |
| Remote Similarity | 0.6036 | NPC527902 |
| Remote Similarity | 0.5862 | NPC230554 |
| Remote Similarity | 0.5431 | NPC58642 |
| Remote Similarity | 0.5431 | NPC49336 |
| Remote Similarity | 0.5431 | NPC249875 |
| Remote Similarity | 0.5378 | NPC320236 |
| Remote Similarity | 0.5378 | NPC571033 |
| Remote Similarity | 0.5378 | NPC609531 |
| Remote Similarity | 0.5333 | NPC510017 |
| Remote Similarity | 0.5333 | NPC511922 |
| Remote Similarity | 0.5207 | NPC534269 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 611.31 |
| ALogP   | -1.9625 |
| MLogP   | 4.21 |
| XLogP   | 4.983 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 10 |
| TPSA   | 121.7 |
| RO5 Violation   | 0 |