Drug Information| Drug ID:   | NPD7594 |
| Drug Name:   | |
| Molecular Formula:   | C31H37N5O5 |
| Canonical SMILES:   | OC(=N[C@H](C(=N[C@@H]1CCCN2[C@H]1CC(=O)N(C2=O)Cc1ccccc1)O)Cc1c[nH]c2c1cccc2)OC(C)(C)C |
| Standard InCHI:   | "InChI=1S/C31H37N5O5/c1-31(2,3)41-29(39)34-25(16-21-18-32-23-13-8-7-12-22(21)23)28(38)33-24-14-9-15-35-26(24)17-27(37)36(30(35)40)19-20-10-5-4-6-11-20/h4-8,10-13,18,24-26,32H,9,14-17,19H2,1-3H3,(H,33,38)(H,34,39)/t24-,25+,26+/m1/s1" |
| Standard InCHIKey:   | JRSRZYFBWXHHNX-ZNZIZOMTSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7594Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5059 | NPC63751 |
| Molecular Weight   | 559.28 |
| ALogP   | -0.576 |
| MLogP   | 3.77 |
| XLogP   | 5.809 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 14 |
| TPSA   | 130.82 |
| RO5 Violation   | 1 |